Update config.go

* add more architectures for linux build process

equivalent to 7d665fa1f4/helpers/build-release-binaries/main.go

* add solaris and s390x

Co-authored-by: Nicco <hi@nicco.io>

.dockerignore

@@ -0,0 +1,6 @@
+*
+!**/*.go
+!build
+!cmd
+!internal
+!go.*

.github/workflows/build.yml

@@ -3,16 +3,44 @@ name: Main
 on:
   push:
     tags:
-      - 'v*.*.*'
+      - "v*.*.*"
 
 jobs:
-  build:
+  docker:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Set up QEMU
+        uses: docker/setup-qemu-action@v1
+      - name: Set up Docker Buildx
+        uses: docker/setup-buildx-action@v1
+      - name: Docker Labels
+        id: meta
+        uses: crazy-max/ghaction-docker-meta@v2
+        with:
+          images: cupcakearmy/autorestic
+          tags: |
+            type=semver,pattern={{version}}
+            type=semver,pattern={{major}}.{{minor}}
+            type=semver,pattern={{major}}
+      - name: Login to DockerHub
+        uses: docker/login-action@v1
+        with:
+          username: ${{ secrets.DOCKERHUB_USERNAME }}
+          password: ${{ secrets.DOCKERHUB_TOKEN }}
+      - name: Build and push
+        uses: docker/build-push-action@v2
+        with:
+          platforms: linux/amd64,linux/arm64
+          push: true
+          tags: ${{ steps.meta.outputs.tags }}
+
+  release:
     runs-on: ubuntu-latest
     steps:
       - uses: actions/checkout@v2
       - uses: actions/setup-go@v2
         with:
-          go-version: '^1.16.3'
+          go-version: "^1.16.3"
       - name: Build
         run: go run build/build.go
 

CHANGELOG.md

@@ -5,13 +5,162 @@ All notable changes to this project will be documented in this file.
 The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
 and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
 
+## [1.7.1] - 2022-04-27
+
+### Fixed
+
+- #178 Lean flag not working properly.
+
+## [1.7.0] - 2022-04-27
+
+### Changed
+
+- #147 Stream output instead of buffering.
+
+### Fixed
+
+- #184 duplicate global options.
+- #154 add docs for migration.
+- #182 fix bug with upgrading custom restic with custom path.
+
+## [1.6.2] - 2022-04-14
+
+### Fixed
+
+- Version bump in code.
+
+## [1.6.1] - 2022-04-14
+
+### Fixed
+
+- Bump go version in docker file to 18.
+
+## [1.6.0] - 2022-04-14
+
+### Added
+
+- support for copy command #145
+- partial restore with `--include`, `--exclude`, `--iinclude`, `--iexclude` flags #161
+- run forget automatically after backup #158
+- exit codes to hooks as env variable #142
+
+### Fixed
+
+- Lean flag not removing all output #178
+
+## [1.5.8] - 2022-03-18
+
+### Fixed
+
+- Better error handling for bad config files.
+
+## [1.5.7] - 2022-03-11
+
+### Added
+
+- SSH in docker image. @fariszr
+
+### Security
+
+- Updated dependencies
+
+## [1.5.6] - 2022-03-10
+
+### Fixed
+
+- Add bash in docker image for hooks. @fariszr
+
+## [1.5.5] - 2022-02-16
+
+### Changed
+
+- Go version was updated from `1.16` to `1.17`
+
+### Fixed
+
+- Home directory was not being taken into account for loading configs.
+
+## [1.5.4] - 2022-02-16
+
+### Fixed
+
+- Lean flag not omitting all output.
+
+## [1.5.3] - 2022-02-16
+
+### Fixed
+
+- Error throwing not finding config even it's not being used.
+
+## [1.5.2] - 2022-02-13
+
+### Fixed
+
+- Config loading @jjromannet
+- Making a backup of the file @jjromannet
+
+## [1.5.1] - 2021-12-06
+
+### Changed
+
+- use official docker image instead of installing rclone every time docker is used.
+- docker docs
+
+### Fixed
+
+- lock file not always next to the config file.
+- update / install bugs.
+- lock docker image tag to the current autorestic version
+- better error logging
+
+## [1.5.0] - 2021-11-20
+
+### Added
+
+- Support for multiple paths.
+- Improved error handling.
+- Allow for specific snapshot to be restored.
+- Docker image.
+
+### Fixed
+
+- rclone in docker volumes.
+
+### Changed
+
+- [Breaking Change] Declaration of docker volumes. See: https://autorestic.vercel.app/migration/1.4_1.5.
+- [Breaking Change] Hooks default executing directory now defaults to the config file directory. See: https://autorestic.vercel.app/migration/1.4_1.5.
+
+## [1.4.1] - 2021-10-31
+
+### Fixed
+
+- Numeric values from config files not being passed to env.
+
+## [1.4.0] - 2021-10-30
+
+### Added
+
+- Allow specify to specify a backend for location backup.
+- Global restic flags.
+- Generic ENV support for backends.
+
+### Changed
+
+- Install now only requires `wget`.
+- Env variable for the `KEY` has been renamed from `AUTORESTIC_[BACKEND NAME]_KEY` -> `AUTORESTIC_[BACKEND NAME]_RESTIC_PASSWORD`.
+
+### Fixed
+
+- Error handling during upgrade & uninstall.
+
 ## [1.3.0] - 2021-10-26
 
 ### Added
 
-- Pass restic backup metadata as ENV to hooks
+- Pass restic backup metadata as ENV to hooks.
 - Support for `XDG_CONFIG_HOME` and `${HOME}/.config` as default locations for `.autorestic.yaml` file.
-- Binary restic flags are now supported
+- Binary restic flags are now supported.
 - Pass encryption keys from env variables or files.
 
 ## [1.2.0] - 2021-08-05
@@ -19,12 +168,12 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 ### Added
 
 - Community page
-- Support for yaml references and aliases
+- Support for yaml references and aliases.
 
 ### Fixed
 
-- Better verbose output for hooks
-- Better error message for bad formatted configs
+- Better verbose output for hooks.
+- Better error message for bad formatted configs.
 
 ## [1.1.2] - 2021-07-11
 
@@ -36,24 +185,24 @@ Don't check all backend when running `forget` or `exec` commands.
 
 ### Added
 
-- Options for backends
+- Options for backends.
 
 ## [1.1.0] - 2021-05-06
 
 ### Added
 
-- use custom restic binary
-- success & failure hooks
+- use custom restic binary.
+- success & failure hooks.
 
 ### Fixed
 
-- don't skip other locations on failure
+- don't skip other locations on failure.
 
 ## [1.0.9] - 2021-05-01
 
 ### Fixed
 
-- Validation for docker volumes
+- Validation for docker volumes.
 
 ## [1.0.8] - 2021-04-28
 
@@ -76,7 +225,7 @@ Don't check all backend when running `forget` or `exec` commands.
 
 ### Added
 
-- Support for rclone
+- Support for rclone.
 
 ## [1.0.5] - 2021-04-24
 
@@ -89,17 +238,17 @@ Don't check all backend when running `forget` or `exec` commands.
 
 ### Added
 
-- Options to add rest username and password in config
+- Options to add rest username and password in config.
 
 ### Fixed
 
-- Don't add empty strings when saving config
+- Don't add empty strings when saving config.
 
 ## [1.0.3] - 2021-04-20
 
 ### Fixed
 
-- Auto upgrade script was not working on linux as linux does not support writing to the binary that is being executed
+- Auto upgrade script was not working on linux as linux does not support writing to the binary that is being executed.
 
 ## [1.0.2] - 2021-04-20
 
@@ -115,7 +264,7 @@ Don't check all backend when running `forget` or `exec` commands.
 
 ### Added
 
-- Completion command for various shells
+- Completion command for various shells.
 
 ## [1.0.0] - 2021-04-17
 

Dockerfile

@@ -0,0 +1,12 @@
+FROM golang:1.18-alpine as builder
+
+WORKDIR /app
+COPY go.* .
+RUN go mod download
+COPY . .
+RUN go build
+
+FROM alpine
+RUN apk add --no-cache restic rclone bash openssh
+COPY --from=builder /app/autorestic /usr/bin/autorestic
+CMD [ "autorestic" ]

build/build.go

@@ -17,11 +17,14 @@ import (
 var DIR, _ = filepath.Abs("./dist")
 
 var targets = map[string][]string{
+	// "aix":     {"ppc64"}, // Not supported by fsnotify
 	"darwin":  {"amd64", "arm64"},
 	"freebsd": {"386", "amd64", "arm"},
-	"linux":   {"386", "amd64", "arm", "arm64"},
+	"linux":   {"386", "amd64", "arm", "arm64", "ppc64le", "mips", "mipsle", "mips64", "mips64le", "s390x"},
 	"netbsd":  {"386", "amd64"},
 	"openbsd": {"386", "amd64"},
+	// "windows": {"386", "amd64"}, // Not supported by autorestic
+	"solaris": {"amd64"},
 }
 
 type buildOptions struct {

cmd/backup.go

@@ -2,6 +2,7 @@ package cmd
 
 import (
 	"fmt"
+	"strings"
 
 	"github.com/cupcakearmy/autorestic/internal"
 	"github.com/cupcakearmy/autorestic/internal/colors"
@@ -22,10 +23,15 @@ var backupCmd = &cobra.Command{
 		CheckErr(err)
 		errors := 0
 		for _, name := range selected {
-			location, _ := internal.GetLocation(name)
-			errs := location.Backup(false)
-			for err := range errs {
-				colors.Error.Println(err)
+			var splitted = strings.Split(name, "@")
+			var specificBackend = ""
+			if len(splitted) > 1 {
+				specificBackend = splitted[1]
+			}
+			location, _ := internal.GetLocation(splitted[0])
+			errs := location.Backup(false, specificBackend)
+			for _, err := range errs {
+				colors.Error.Printf("%s\n\n", err)
 				errors++
 			}
 		}

cmd/check.go

@@ -11,6 +11,7 @@ var checkCmd = &cobra.Command{
 	Use:   "check",
 	Short: "Check if everything is setup",
 	Run: func(cmd *cobra.Command, args []string) {
+		internal.GetConfig()
 		err := lock.Lock()
 		CheckErr(err)
 		defer lock.Unlock()

cmd/cron.go

@@ -2,6 +2,7 @@ package cmd
 
 import (
 	"github.com/cupcakearmy/autorestic/internal"
+	"github.com/cupcakearmy/autorestic/internal/flags"
 	"github.com/cupcakearmy/autorestic/internal/lock"
 	"github.com/spf13/cobra"
 )
@@ -11,7 +12,7 @@ var cronCmd = &cobra.Command{
 	Short: "Run cron job for automated backups",
 	Long:  `Intended to be mainly triggered by an automated system like systemd or crontab. For each location checks if a cron backup is due and runs it.`,
 	Run: func(cmd *cobra.Command, args []string) {
-		internal.CRON_LEAN, _ = cmd.Flags().GetBool("lean")
+		internal.GetConfig()
 		err := lock.Lock()
 		CheckErr(err)
 		defer lock.Unlock()
@@ -23,5 +24,5 @@ var cronCmd = &cobra.Command{
 
 func init() {
 	rootCmd.AddCommand(cronCmd)
-	cronCmd.Flags().Bool("lean", false, "only output information about actual backups")
+	cronCmd.Flags().BoolVar(&flags.CRON_LEAN, "lean", false, "only output information about actual backups")
 }

cmd/exec.go

@@ -1,6 +1,8 @@
 package cmd
 
 import (
+	"fmt"
+
 	"github.com/cupcakearmy/autorestic/internal"
 	"github.com/cupcakearmy/autorestic/internal/colors"
 	"github.com/cupcakearmy/autorestic/internal/lock"
@@ -18,10 +20,23 @@ var execCmd = &cobra.Command{
 
 		selected, err := internal.GetAllOrSelected(cmd, true)
 		CheckErr(err)
+
+		var errors []error
 		for _, name := range selected {
 			colors.PrimaryPrint("  Executing on \"%s\"  ", name)
 			backend, _ := internal.GetBackend(name)
-			backend.Exec(args)
+			err := backend.Exec(args)
+			if err != nil {
+				errors = append(errors, err)
+			}
+		}
+
+		if len(errors) > 0 {
+			for _, err := range errors {
+				colors.Error.Printf("%s\n\n", err)
+			}
+
+			CheckErr(fmt.Errorf("%d errors were found", len(errors)))
 		}
 	},
 }

cmd/restore.go

@@ -9,9 +9,11 @@ import (
 )
 
 var restoreCmd = &cobra.Command{
-	Use:   "restore",
+	Use:   "restore [snapshot id]",
 	Short: "Restore backup for location",
+	Args:  cobra.MaximumNArgs(1),
 	Run: func(cmd *cobra.Command, args []string) {
+		internal.GetConfig()
 		err := lock.Lock()
 		CheckErr(err)
 		defer lock.Unlock()
@@ -24,7 +26,23 @@ var restoreCmd = &cobra.Command{
 		target, _ := cmd.Flags().GetString("to")
 		from, _ := cmd.Flags().GetString("from")
 		force, _ := cmd.Flags().GetBool("force")
-		err = l.Restore(target, from, force)
+		snapshot := ""
+		if len(args) > 0 {
+			snapshot = args[0]
+		}
+
+		// Get optional flags
+		optional := []string{}
+		for _, flag := range []string{"include", "exclude", "iinclude", "iexclude"} {
+			values, err := cmd.Flags().GetStringSlice(flag)
+			if err == nil {
+				for _, value := range values {
+					optional = append(optional, "--"+flag, value)
+				}
+			}
+		}
+
+		err = l.Restore(target, from, force, snapshot, optional)
 		CheckErr(err)
 	},
 }
@@ -36,4 +54,10 @@ func init() {
 	restoreCmd.Flags().String("to", "", "Where to restore the data")
 	restoreCmd.Flags().StringP("location", "l", "", "Location to be restored")
 	restoreCmd.MarkFlagRequired("location")
+
+	// Passed on flags
+	restoreCmd.Flags().StringSliceP("include", "i", []string{}, "Include a pattern")
+	restoreCmd.Flags().StringSliceP("exclude", "e", []string{}, "Exclude a pattern")
+	restoreCmd.Flags().StringSlice("iinclude", []string{}, "Include a pattern, case insensitive")
+	restoreCmd.Flags().StringSlice("iexclude", []string{}, "Exclude a pattern, case insensitive")
 }

cmd/root.go

@@ -3,9 +3,11 @@ package cmd
 import (
 	"os"
 	"path/filepath"
+	"strings"
 
 	"github.com/cupcakearmy/autorestic/internal"
 	"github.com/cupcakearmy/autorestic/internal/colors"
+	"github.com/cupcakearmy/autorestic/internal/flags"
 	"github.com/cupcakearmy/autorestic/internal/lock"
 	"github.com/spf13/cobra"
 
@@ -27,7 +29,7 @@ var rootCmd = &cobra.Command{
 	Version: internal.VERSION,
 	Use:     "autorestic",
 	Short:   "CLI Wrapper for restic",
-	Long:    "Documentation: https://autorestic.vercel.app",
+	Long:    "Documentation:\thttps://autorestic.vercel.app\nSupport:\thttps://discord.gg/wS7RpYTYd2",
 }
 
 func Execute() {
@@ -36,26 +38,32 @@ func Execute() {
 
 func init() {
 	rootCmd.PersistentFlags().StringVarP(&cfgFile, "config", "c", "", "config file (default is $HOME/.autorestic.yml or ./.autorestic.yml)")
-	rootCmd.PersistentFlags().BoolVar(&internal.CI, "ci", false, "CI mode disabled interactive mode and colors and enables verbosity")
-	rootCmd.PersistentFlags().BoolVarP(&internal.VERBOSE, "verbose", "v", false, "verbose mode")
-	rootCmd.PersistentFlags().StringVar(&internal.RESTIC_BIN, "restic-bin", "restic", "specify custom restic binary")
+	rootCmd.PersistentFlags().BoolVar(&flags.CI, "ci", false, "CI mode disabled interactive mode and colors and enables verbosity")
+	rootCmd.PersistentFlags().BoolVarP(&flags.VERBOSE, "verbose", "v", false, "verbose mode")
+	rootCmd.PersistentFlags().StringVar(&flags.RESTIC_BIN, "restic-bin", "restic", "specify custom restic binary")
+	rootCmd.PersistentFlags().StringVar(&flags.DOCKER_IMAGE, "docker-image", "cupcakearmy/autorestic:"+internal.VERSION, "specify a custom docker image")
 	cobra.OnInitialize(initConfig)
 }
 
 func initConfig() {
 	if ci, _ := rootCmd.Flags().GetBool("ci"); ci {
 		colors.DisableColors(true)
-		internal.VERBOSE = true
+		flags.VERBOSE = true
 	}
 
 	if cfgFile != "" {
 		viper.SetConfigFile(cfgFile)
+		viper.AutomaticEnv()
+		if viper.ConfigFileUsed() == "" {
+			colors.Error.Println("cannot read config file %s\n", cfgFile)
+			os.Exit(1)
+		}
 	} else {
-		viper.AddConfigPath(".")
+		configPaths := []string{"."}
 
 		// Home
-		if home, err := homedir.Dir(); err != nil {
-			viper.AddConfigPath(home)
+		if home, err := homedir.Dir(); err == nil {
+			configPaths = append(configPaths, home)
 		}
 
 		// XDG_CONFIG_HOME
@@ -66,10 +74,17 @@ func initConfig() {
 					prefix = filepath.Join(home, ".config")
 				}
 			}
-			viper.AddConfigPath(filepath.Join(prefix, "autorestic"))
+			xdgConfig := filepath.Join(prefix, "autorestic")
+			configPaths = append(configPaths, xdgConfig)
 		}
-
-		viper.SetConfigName(".autorestic")
+		for _, cfgPath := range configPaths {
+			viper.AddConfigPath(cfgPath)
 		}
+		if flags.VERBOSE {
+			colors.Faint.Printf("Using config paths: %s\n", strings.Join(configPaths, " "))
+		}
+		cfgFileName := ".autorestic"
+		viper.SetConfigName(cfgFileName)
 		viper.AutomaticEnv()
+	}
 }

cmd/uninstall.go

@@ -9,12 +9,12 @@ var uninstallCmd = &cobra.Command{
 	Use:   "uninstall",
 	Short: "Uninstall restic and autorestic",
 	Run: func(cmd *cobra.Command, args []string) {
-		noRestic, _ := cmd.Flags().GetBool("no-restic")
-		bins.Uninstall(!noRestic)
+		restic, _ := cmd.Flags().GetBool("restic")
+		bins.Uninstall(restic)
 	},
 }
 
 func init() {
 	rootCmd.AddCommand(uninstallCmd)
-	uninstallCmd.Flags().Bool("no-restic", false, "do not uninstall restic.")
+	uninstallCmd.Flags().Bool("restic", false, "also uninstall restic.")
 }

cmd/upgrade.go

@@ -9,13 +9,13 @@ var upgradeCmd = &cobra.Command{
 	Use:   "upgrade",
 	Short: "Upgrade autorestic and restic",
 	Run: func(cmd *cobra.Command, args []string) {
-		noRestic, _ := cmd.Flags().GetBool("no-restic")
-		err := bins.Upgrade(!noRestic)
+		restic, _ := cmd.Flags().GetBool("restic")
+		err := bins.Upgrade(restic)
 		CheckErr(err)
 	},
 }
 
 func init() {
 	rootCmd.AddCommand(upgradeCmd)
-	upgradeCmd.Flags().Bool("no-restic", false, "also update restic")
+	upgradeCmd.Flags().Bool("restic", true, "also update restic")
 }

docs/.codedoc/package-lock.json

@@ -5,7 +5,7 @@
   "packages": {
     "": {
       "dependencies": {
-        "@codedoc/core": "^0.2.23"
+        "@codedoc/core": "^0.2.24"
       }
     },
     "node_modules/@babel/runtime": {
@@ -17,9 +17,9 @@
       }
     },
     "node_modules/@codedoc/core": {
-      "version": "0.2.23",
-      "resolved": "https://registry.npmjs.org/@codedoc/core/-/core-0.2.23.tgz",
-      "integrity": "sha512-dp1ku5YkvV/AbCGHVwBVX2Mo85MeAOOxdvc3Q9VNe1OUcX6RKGWZLkBafo/bVfeBg0HVTwSWdDiYauCINon9kQ==",
+      "version": "0.2.24",
+      "resolved": "https://registry.npmjs.org/@codedoc/core/-/core-0.2.24.tgz",
+      "integrity": "sha512-5qJ+I9St+OV2Cql0IurPdQEqwlkWarAzouZniv70WLei50jJ+zMg36NpEvqEdOlZKTa3gR2M3IcVqeEG5UmTCw==",
       "dependencies": {
         "@connectv/html": "^0.2.6",
         "@connectv/jss-theme": "^0.2.0",
@@ -30,7 +30,7 @@
         "@types/express-ws": "^3.0.0",
         "@types/katex": "^0.11.0",
         "@types/prismjs": "^1.16.0",
-        "ansi_up": "^4.0.4",
+        "ansi_up": "^5.0.0",
         "chalk": "^4.0.0",
         "color": "^3.1.2",
         "express": "^4.17.1",
@@ -576,9 +576,9 @@
       }
     },
     "node_modules/ansi_up": {
-      "version": "4.0.4",
-      "resolved": "https://registry.npmjs.org/ansi_up/-/ansi_up-4.0.4.tgz",
-      "integrity": "sha512-vRxC8q6QY918MbehO869biJW4tiunJdjOhi5fpY6NLOliBQlZhOkKgABJKJqH+JZfb/WfjvjN1chLWI6tODerw==",
+      "version": "5.1.0",
+      "resolved": "https://registry.npmjs.org/ansi_up/-/ansi_up-5.1.0.tgz",
+      "integrity": "sha512-3wwu+nJCKBVBwOCurm0uv91lMoVkhFB+3qZQz3U11AmAdDJ4tkw1sNPWJQcVxMVYwe0pGEALOjSBOxdxNc+pNQ==",
       "engines": {
         "node": "*"
       }
@@ -5932,9 +5932,9 @@
       }
     },
     "@codedoc/core": {
-      "version": "0.2.23",
-      "resolved": "https://registry.npmjs.org/@codedoc/core/-/core-0.2.23.tgz",
-      "integrity": "sha512-dp1ku5YkvV/AbCGHVwBVX2Mo85MeAOOxdvc3Q9VNe1OUcX6RKGWZLkBafo/bVfeBg0HVTwSWdDiYauCINon9kQ==",
+      "version": "0.2.24",
+      "resolved": "https://registry.npmjs.org/@codedoc/core/-/core-0.2.24.tgz",
+      "integrity": "sha512-5qJ+I9St+OV2Cql0IurPdQEqwlkWarAzouZniv70WLei50jJ+zMg36NpEvqEdOlZKTa3gR2M3IcVqeEG5UmTCw==",
       "requires": {
         "@connectv/html": "^0.2.6",
         "@connectv/jss-theme": "^0.2.0",
@@ -5945,7 +5945,7 @@
         "@types/express-ws": "^3.0.0",
         "@types/katex": "^0.11.0",
         "@types/prismjs": "^1.16.0",
-        "ansi_up": "^4.0.4",
+        "ansi_up": "^5.0.0",
         "chalk": "^4.0.0",
         "color": "^3.1.2",
         "express": "^4.17.1",
@@ -6463,9 +6463,9 @@
       "requires": {}
     },
     "ansi_up": {
-      "version": "4.0.4",
-      "resolved": "https://registry.npmjs.org/ansi_up/-/ansi_up-4.0.4.tgz",
-      "integrity": "sha512-vRxC8q6QY918MbehO869biJW4tiunJdjOhi5fpY6NLOliBQlZhOkKgABJKJqH+JZfb/WfjvjN1chLWI6tODerw=="
+      "version": "5.1.0",
+      "resolved": "https://registry.npmjs.org/ansi_up/-/ansi_up-5.1.0.tgz",
+      "integrity": "sha512-3wwu+nJCKBVBwOCurm0uv91lMoVkhFB+3qZQz3U11AmAdDJ4tkw1sNPWJQcVxMVYwe0pGEALOjSBOxdxNc+pNQ=="
     },
     "ansi-styles": {
       "version": "4.3.0",

docs/.codedoc/package.json

@@ -1,5 +1,5 @@
 {
   "dependencies": {
-    "@codedoc/core": "^0.2.23"
+    "@codedoc/core": "^0.2.24"
   }
 }

docs/markdown/_toc.md

@@ -14,6 +14,7 @@
 > > [Overview](/location/options)
 > > [Excluding Files](/location/exclude)
 > > [Forget Policy](/location/forget)
+> > [Copy](/location/copy)
 >
 > [Cron](/location/cron)
 > [Docker Volumes](/location/docker)
@@ -40,7 +41,13 @@
 > [Uninstall](/cli/uninstall)
 > [Upgrade](/cli/upgrade)
 
+> :Collapse label=Migration
+>
+> [0.x → 1.0](/migration/0.x_1.0)
+> [1.4 → 1.5](/migration/1.4_1.5)
+
 [Examples](/examples)
+[Docker](/docker)
 [QA](/qa)
 [Community](/community)
 [Contributors](/contrib)

docs/markdown/backend/available.md

@@ -4,6 +4,8 @@ In theory [all the restic backends](https://restic.readthedocs.io/en/stable/030_
 
 Those tested are the following:
 
+> ℹ️ You can also [specify the `env` variables in a config file](/backend/env) to separate them from the config file.
+
 ## Local
 
 ```yaml

docs/markdown/backend/env.md

@@ -1,36 +1,67 @@
 # Environment
 
-> ⚠ Available since version `v1.3.0`
+> ⚠ Available since version `v1.4.0`
 
 Sometimes it's favorable not having the encryption keys in the config files.
-For that `autorestic` allows passing the backend keys as `ENV` variables, or through an env file.
+For that `autorestic` allows passing the env variables to backend password as `ENV` variables, or through an env file.
+You can also pass whatever `env` variable to restic by prefixing it with `AUTORESTIC_[BACKEND NAME]_`.
 
-The syntax for the `ENV` variables is as follows: `AUTORESTIC_[BACKEND NAME]_KEY`.
+> ℹ️ Env variables and file overwrite the config file in the following order:
+>
+> Env Variables > Env File (`.autorestic.env`) > Config file (`.autorestic.yaml`)
+
+## Env file
+
+Alternatively `autorestic` can load an env file, located next to `.autorestic.yml` called `.autorestic.env`.
+
+```
+AUTORESTIC_FOO_RESTIC_PASSWORD=secret123
+```
+
+### Example with repository password
+
+The syntax for the `ENV` variables is as follows: `AUTORESTIC_[BACKEND NAME]_RESTIC_PASSWORD`.
 
 ```yaml | autorestic.yaml
 backend:
   foo:
     type: ...
     path: ...
-    key: secret123 # => AUTORESTIC_FOO_KEY=secret123
+    key: secret123 # => AUTORESTIC_FOO_RESTIC_PASSWORD=secret123
 ```
 
-## Example
-
 This means we could remove `key: secret123` from `.autorestic.yaml` and execute as follows:
 
 ```bash
-AUTORESTIC_FOO_KEY=secret123 autorestic backup ...
+AUTORESTIC_FOO_RESTIC_PASSWORD=secret123 autorestic backup ...
 ```
 
-## Env file
+### Example with Backblaze B2
 
-Alternatively `autorestic` can load an env file, located next to `autorestic.yml` called `.autorestic.env`.
-
-```| .autorestic.env
-AUTORESTIC_FOO_KEY=secret123
+```yaml | autorestic.yaml
+backends:
+  bb:
+    type: b2
+    path: myBucket
+    key: myPassword
+    env:
+      B2_ACCOUNT_ID: 123
+      B2_ACCOUNT_KEY: 456
 ```
 
-after that you can simply use `autorestic` as your are used to.
+You could create an `.autorestic.env` or pass the following `ENV` variables to autorestic:
+
+```
+AUTORESTIC_BB_RESTIC_PASSWORD=myPassword
+AUTORESTIC_BB_B2_ACCOUNT_ID=123
+AUTORESTIC_BB_B2_ACCOUNT_KEY=456
+```
+
+```yaml | autorestic.yaml
+backends:
+  bb:
+    type: b2
+    path: myBucket
+```
 
 > :ToCPrevNext

docs/markdown/backend/options.md

@@ -1,8 +1,6 @@
 # Options
 
-For the `backup` and `forget` commands you can pass any native flags to `restic`.
-
-> It is also possible to set options for an [a specific location](/location/options).
+> ℹ️ For more detail see the [location docs](/location/options) for options, as they are the same.
 
 ```yaml
 backend:
@@ -18,8 +16,4 @@ backend:
 
 In this example, whenever `autorestic` runs `restic backup` it will append a `--tag abc --tag` to the native command.
 
-For more detail see the [location docs](/location/options) for options, as they are the same.
-
-> For flags without arguments you can set them to `true`. They will be handled accordingly.
-
 > :ToCPrevNext

docs/markdown/backend/overview.md

@@ -2,7 +2,11 @@
 
 Backends are the outputs of the backup process. Each location needs at least one.
 
+Note: names of backends MUST be lower case!
+
 ```yaml | .autorestic.yml
+version: 2
+
 backends:
   name-of-backend:
     type: local

docs/markdown/cli/backup.md

@@ -14,4 +14,12 @@ autorestic backup -a
 autorestic backup -l foo -l bar
 ```
 
+## Specific location
+
+`autorestic` also allows selecting specific backends for a location with the `location@backend` syntax.
+
+```bash
+autorestic backup -l location@backend
+```
+
 > :ToCPrevNext

docs/markdown/cli/general.md

@@ -2,7 +2,7 @@
 
 ## `-c, --config`
 
-Specify the config file to be used.
+Specify the config file to be used (must use .yml as an extension).
 If omitted `autorestic` will search for for a `.autorestic.yml` in the current directory and your home directory.
 
 ```bash

docs/markdown/cli/restore.md

@@ -1,12 +1,12 @@
 # Restore
 
 ```bash
-autorestic restore [-l, --location] [--from backend] [--to <out dir>] [-f, --force]
+autorestic restore [-l, --location] [--from backend] [--to <out dir>] [-f, --force] [snapshot]
 ```
 
-This will restore all the locations to the selected target. If for one location there are more than one backends specified autorestic will take the first one.
+This will restore the location to the selected target. If for one location there are more than one backends specified autorestic will take the first one. If no specific snapshot is specified `autorestic` will use `latest`.
 
-The `--to` path has to be empty as no data will be overwritten by default. If you are sure you can pass the `-f, --force` flag and the data will be overwritten in the destination. However note that this will overwrite all the data existent in the backup, not only the 1 file that is missing e.g.
+If you are sure you can pass the `-f, --force` flag and the data will be overwritten in the destination. However note that this will overwrite all the data existent in the backup, not only the 1 file that is missing e.g.
 
 ## Example
 

docs/markdown/community.md

@@ -2,10 +2,11 @@
 
 A list of community driven projects. (No official affiliation)
 
-- SystemD Units: https://gitlab.com/py_crash/autorestic-systemd-units
-- Docker image: https://github.com/pascaliske/docker-autorestic
-- Ansible Role: https://github.com/adsanz/ansible-restic-role
-- Ansible Role: https://github.com/ItsNotGoodName/ansible-role-autorestic
-- Ansible Role: https://github.com/FuzzyMistborn/ansible-role-autorestic
+- SystemD Units: <https://gitlab.com/py_crash/autorestic-systemd-units>
+- Docker image: <https://github.com/pascaliske/docker-autorestic>
+- Ansible Role: <https://github.com/adsanz/ansible-restic-role>
+- Ansible Role: <https://github.com/ItsNotGoodName/ansible-role-autorestic>
+- Ansible Role: <https://github.com/FuzzyMistborn/ansible-role-autorestic>
+- Ansible Role: <https://0xacab.org/varac-projects/ansible-role-autorestic>
 
 > :ToCPrevNext

docs/markdown/config.md

@@ -16,6 +16,8 @@ You can also specify a custom file with the `-c path/to/some/config.yml`
 ## Example configuration
 
 ```yaml | .autorestic.yml
+version: 2
+
 locations:
   home:
     from: /home/me
@@ -49,6 +51,8 @@ Aliases allow to reuse snippets of config throughout the same file.
 The following example shows how the locations `a` and `b` share the same hooks and forget policies.
 
 ```yaml | .autorestic.yml
+version: 2
+
 extras:
   hooks: &foo
     before:

docs/markdown/contrib.md

@@ -2,16 +2,20 @@
 
 This amazing people helped the project!
 
-- @agateblue - Docs, Pruning, S3
-- @david-boles - Docs
-- @SebDanielsson - Brew
-- @n194 - AUR Package
-- @jin-park-dev - Typos
-- @sumnerboy12 - Typos
-- @FuzzyMistborn - Typos
-- @ChanceM - Typos
-- @TheForcer - Typos
-- @themorlan - Typos
-- @somebox - Typos
+- @agateblue - Docs, Pruning, S3.
+- @g-a-c - Update/Install bugs.
+- @jjromannet - Bug fixes.
+- @fariszr - Docker image improvements.
+- @david-boles - Docs.
+- @SebDanielsson - Brew.
+- @n194 - AUR Package.
+- @olofvndrhr - Healthchecks example.
+- @jin-park-dev - Typos.
+- @sumnerboy12 - Typos.
+- @FuzzyMistborn - Typos.
+- @ChanceM - Typos.
+- @TheForcer - Typos.
+- @themorlan - Typos.
+- @somebox - Typos.
 
 > :ToCPrevNext

docs/markdown/docker.md

@@ -0,0 +1,28 @@
+# 🐳 Docker
+
+The docker image is build with rclone and restic already included. It's ment more as a utility image.
+
+## Remote hosts
+
+For remote backups (S3, B2, GCS, etc.) it's quite easy, as you only need to mount the config file and the data to backup.
+
+```bash
+docker run --rm \\
+  -v $(pwd):/data \\
+  cupcakearmy/autorestic \\
+  autorestic backup -va -c /data/.autorestic.yaml
+```
+
+## Rclone
+
+For rclone you will have to also mount the rclone config file to `/root/.config/rclone/rclone.conf`.
+
+To check where it is located you can run the following command: `rclone config file`.
+
+**Example**
+
+```bash
+docker run \\
+  -v /home/user/.config/rclone/rclone.conf:/root/.config/rclone/rclone.conf:ro \\
+  ...
+```

docs/markdown/examples.md

@@ -14,4 +14,27 @@ This can come in handy if a backup process crashed or if it was accidentally can
 autorestic exec -b my-backend -- unlock
 ```
 
+## Use hooks to integrate with [healthchecks](https://healthchecks.io/)
+
+> Thanks to @olofvndrhr for providing it ❤️
+
+```yaml
+extras:
+  healthchecks: &healthchecks
+    hooks:
+      before:
+        - 'curl -m 10 --retry 5 -X POST -H "Content-Type: text/plain" --data "Starting backup for location: ${AUTORESTIC_LOCATION}" https://<healthchecks-url>/ping/<uid>/start'
+      failure:
+        - 'curl -m 10 --retry 5 -X POST -H "Content-Type: text/plain" --data "Backup failed for location: ${AUTORESTIC_LOCATION}" https://<healthchecks-url>/ping/<uid>/fail'
+      success:
+        - 'curl -m 10 --retry 5 -X POST -H "Content-Type: text/plain" --data "Backup successful for location: ${AUTORESTIC_LOCATION}" https://<healthchecks-url>/ping/<uid>'
+
+locations:
+  something:
+    <<: *healthchecks
+    from: /somewhere
+    to:
+      - somewhere-else
+```
+
 > :ToCPrevNext

docs/markdown/installation.md

@@ -2,14 +2,20 @@
 
 Linux & macOS. Windows is not supported. If you have problems installing please open an issue :)
 
-Autorestic requires `curl`, `wget` and `bzip2` to be installed. For most systems these should be already installed.
+Autorestic requires `bash`, `wget` and `bzip2` to be installed. For most systems these should be already installed.
 
 ```bash
-curl -s https://raw.githubusercontent.com/CupCakeArmy/autorestic/master/install.sh | bash
+wget -qO - https://raw.githubusercontent.com/CupCakeArmy/autorestic/master/install.sh | bash
 ```
 
 ## Alternatives
 
+### Docker
+
+There is an official docker image over at [cupcakearmy/autorestic](https://hub.docker.com/r/cupcakearmy/autorestic).
+
+For some examples see [here](/docker).
+
 ### Manual
 
 You can download the right binary from the release page and simply copy it to `/usr/local/bin` or whatever path you prefer. Autoupdates will still work.
@@ -20,6 +26,6 @@ If you are on macOS you can install through brew: `brew install autorestic`.
 
 ### AUR
 
-If you are on Arch there is an [AUR Package](https://aur.archlinux.org/packages/autorestic-bin/) by @n194.
+~~If you are on Arch there is an [AUR Package](https://aur.archlinux.org/packages/autorestic-bin/) (looking for maintainers).~~ - Deprecated
 
 > :ToCPrevNext

docs/markdown/location/copy.md

@@ -0,0 +1,31 @@
+# Copy
+
+Instead of specifying multiple `to` backends for a given `location` you can also use the `copy` option. Instead of recalculating the backup multiple times, you can copy the freshly copied snapshot from one backend to the other, avoiding recomputation.
+
+###### Example
+
+```yaml | .autorestic.yml
+locations:
+  my-location:
+    from: /data
+    to:
+      - a #Fast
+      - b #Fast
+      - c #Slow
+```
+
+Becomes
+
+```yaml | .autorestic.yml
+locations:
+  my-location:
+    from: /data
+    to:
+      - a
+      - b
+    copy:
+      a:
+        - c
+```
+
+Instead of backing up to each backend separately, you can choose that the snapshot created to `a` will be copied over to `c`, avoiding heavy computation on `c`.

docs/markdown/location/docker.md

@@ -3,7 +3,7 @@
 autorestic supports docker volumes directly, without needing them to be mounted to the host filesystem.
 
 ```yaml | docker-compose.yml
-version: '3.7'
+version: '3.8'
 
 volumes:
   data:
@@ -18,13 +18,9 @@ services:
 
 ```yaml | .autorestic.yml
 locations:
-  - name: hello
-    from: volume:my-data
-    to:
-      - remote
-
-backends:
-  - name: remote
+  foo:
+    from: my-data
+    type: volume
     # ...
 ```
 

docs/markdown/location/forget.md

@@ -7,6 +7,8 @@ This is based on [Restic's snapshots policies](https://restic.readthedocs.io/en/
 > **Note** This is a full example, of course you also can specify only one of them
 
 ```yaml | .autorestic.yml
+version: 2
+
 locations:
   etc:
     from: /etc
@@ -19,7 +21,37 @@ locations:
         keep-weekly: 1 # keep 1 last weekly snapshots
         keep-monthly: 12 # keep 12 last monthly snapshots
         keep-yearly: 7 # keep 7 last yearly snapshots
-        keep-within: '2w' # keep snapshots from the last 2 weeks
+        keep-within: '14d' # keep snapshots from the last 14 days
+```
+
+## Globally
+
+You can specify global forget policies that would be applied to all locations:
+
+```yaml | .autorestic.yml
+version: 2
+
+global:
+  forget:
+    keep-daily: 30
+    keep-weekly: 52
+```
+
+## Automatically forget after backup
+
+You can also configure `autorestic` to automatically run the forget command for you after every backup. You can do that by specifying the `forget` option.
+
+```yaml | .autorestic.yml
+version: 2
+
+locations:
+  etc:
+    from: /etc
+    to: local
+    forget: prune # Or only "yes" if you don't want to prune
+    options:
+      forget:
+        keep-last: 5
 ```
 
 > :ToCPrevNext

docs/markdown/location/options.md

@@ -1,8 +1,32 @@
 # Options
 
-For the `backup` and `forget` commands you can pass any native flags to `restic`.
+For the `backup` and `forget` commands you can pass any native flags to `restic`. In addition you can specify flags for every command with `all`.
 
-> It is also possible to set options for an [entire backend](/backend/options).
+If flags don't start with `-` they will get prefixed with `--`.
+
+Flags without arguments can be set to `true`. They will be handled accordingly.
+
+> ℹ️ It is also possible to set options for an [entire backend](/backend/options) or globally (see below).
+
+```yaml
+locations:
+  foo:
+    # ...
+    options:
+      all:
+        some-flag: 123
+        # Equivalent to
+        --some-flag: 123
+      backup:
+        boolean-flag: true
+        tag:
+          - foo
+          - bar
+```
+
+## Example
+
+In this example, whenever `autorestic` runs `restic backup` it will append a `--tag foo --tag bar` to the native command.
 
 ```yaml
 locations:
@@ -16,8 +40,28 @@ locations:
           - bar
 ```
 
-In this example, whenever `autorestic` runs `restic backup` it will append a `--tag abc --tag` to the native command.
+## Priority
 
-> For flags without arguments you can set them to `true`. They will be handled accordingly.
+Options can be set globally, on the backends or on the locations.
+
+The priority is as follows: `location > backend > global`.
+
+## Global Options
+
+It is possible to specify global flags that will be run every time restic is invoked. To do so specify them under `global` in your config file.
+
+```yaml
+global:
+  all:
+    cache-dir: ~/restic
+  backup:
+    tag:
+      - foo
+
+backends:
+  # ...
+locations:
+  # ...
+```
 
 > :ToCPrevNext

docs/markdown/location/overview.md

@@ -3,10 +3,17 @@
 Locations can be seen as the input to the backup process. Generally this is simply a folder.
 The paths can be relative from the config file. A location can have multiple backends, so that the data is secured across multiple servers.
 
+Note: names of locations MUST be lower case!
 ```yaml | .autorestic.yml
+version: 2
+
 locations:
   my-location-name:
     from: path/to/backup
+    # Or multiple
+    # from:
+    #   - /a
+    #   - /b
     to:
       - name-of-backend
       - also-backup-to-this-backend
@@ -14,7 +21,7 @@ locations:
 
 ## `from`
 
-This is the source of the location.
+This is the source of the location. Can be an `array` for multiple sources.
 
 #### How are paths resolved?
 

docs/markdown/migration/0.x_1.0.md

@@ -1,6 +1,4 @@
-# Upgrade
-
-## From `0.x` to `1.0`
+# From `0.x` to `1.0`
 
 Most of the config file is remained compatible, however to clean up the backends custom environment variables were moved from the root object to an `env` object.
 

docs/markdown/migration/1.4_1.5.md

@@ -0,0 +1,68 @@
+# Migration from `1.4` to `1.5`
+
+## ⚠️ Important notes
+
+The way snapshots are referenced in the `restore` and `prune` commands has been changed. Before they were referenced by the path. Now every backup is tagged and those tags are then referenced in the cli. This means that when running restore and forget commands old backups are not taken into account anymore.
+
+## Config files
+
+- The config file now required to have a version number. This has to be added with `version: 2` at the root.
+- Hooks now optionally support `dir: /some/dir` in the [options object](https://pkg.go.dev/github.com/cupcakearmy/autorestic/internal#Hooks).
+- Docker volumes don't get prefixed with `volume:` anymore, rather you have to set the `type: volume` in the [location config](https://pkg.go.dev/github.com/cupcakearmy/autorestic/internal#Hooks).
+
+See detailed instructions below.
+
+## Config Version
+
+```yaml
+version: 2 # Added
+
+backends:
+  # ...
+```
+
+## Hooks
+
+Since `1.5` multiple sources for a location are possible.
+For this reason, while before hooks where executed in the folder of the source, now they are executed in the directory of the config `.autorestic.yaml`.
+
+You can overwrite this behavior with the new `dir` option in the hook section of the config.
+
+```yaml
+locations:
+  l1:
+    # ...
+    from: /foo/bar
+    hooks:
+      dir: /foo/bar
+      before: pwd
+```
+
+## Docker volumes
+
+The syntax with docker volumes has changed and needs to be adjusted.
+
+```yaml
+# Before
+locations:
+  foo:
+    from: volume:my-data
+```
+
+```yaml
+# After
+locations:
+  foo:
+    from: my-data
+    type: volume
+```
+
+## Tagging
+
+Autorestic changed the way backups are referenced. Before we took the paths as the identifying information. Now autorestic uses native restic tags to reference them. This means that old backups are not referenced. You can the old snapshots manually. An example can be shown below.
+
+```bash
+autorestic exec -va -- tag --add ar:location:LOCATION_NAME # Only if you have only one location
+```
+
+> :ToCPrevNext

docs/markdown/migration/index.md

@@ -0,0 +1,4 @@
+# Migration
+
+- [From 0.x to 1.0](/migration/0.x_1.0)
+- [From 1.4 to 1.5](/migration/1.4_1.5)

docs/markdown/quick.md

@@ -3,7 +3,7 @@
 ## Installation
 
 ```bash
-curl -s https://raw.githubusercontent.com/CupCakeArmy/autorestic/master/install.sh | bash
+wget -qO - https://raw.githubusercontent.com/CupCakeArmy/autorestic/master/install.sh | bash
 ```
 
 See [installation](/installation) for alternative options.
@@ -25,9 +25,15 @@ For a quick overview:
 > Note that the data is automatically encrypted on the server. The key will be generated and added to your config file. Every backend will have a separate key. **You should keep a copy of the keys or config file somewhere in case your server dies**. Otherwise DATA IS LOST!
 
 ```yaml | .autorestic.yml
+version: 2
+
 locations:
   home:
-    from: /home/me
+    from: /home
+    # Or multiple
+    # from:
+    #  - /foo
+    #  - /bar
     to: remote
 
   important:

docs/package-lock.json

@@ -118,9 +118,15 @@
       }
     },
     "node_modules/chokidar": {
-      "version": "3.5.2",
-      "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.5.2.tgz",
-      "integrity": "sha512-ekGhOnNVPgT77r4K/U3GDhu+FQ2S8TnK/s2KbIGXi0SZWuwkZ2QNyfWdZW+TVfn84DpEP7rLeCt2UI6bJ8GwbQ==",
+      "version": "3.5.3",
+      "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.5.3.tgz",
+      "integrity": "sha512-Dr3sfKRP6oTcjf2JmUmFJfeVMvXBdegxB0iVQ5eb2V10uFJUCAS8OByZdVAyVb8xXNz3GjjTgj9kLWsZTqE6kw==",
+      "funding": [
+        {
+          "type": "individual",
+          "url": "https://paulmillr.com/funding/"
+        }
+      ],
       "dependencies": {
         "anymatch": "~3.1.2",
         "braces": "~3.0.2",
@@ -296,9 +302,9 @@
       }
     },
     "node_modules/is-core-module": {
-      "version": "2.8.0",
-      "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.8.0.tgz",
-      "integrity": "sha512-vd15qHsaqrRL7dtH6QNuy0ndJmRDrS9HAM1CAiSifNUFv4x1a0CCVsj18hJ1mShxIG6T2i1sO78MkP56r0nYRw==",
+      "version": "2.8.1",
+      "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.8.1.tgz",
+      "integrity": "sha512-SdNCUs284hr40hFTFP6l0IfZ/RSrMXF3qgoRHd3/79unUTvrFO/JoXwkGm+5J/Oe3E/b5GsnG330uUNgRpu1PA==",
       "dependencies": {
         "has": "^1.0.3"
       },
@@ -339,9 +345,9 @@
       "integrity": "sha512-s8UhlNe7vPKomQhC1qFelMokr/Sc3AgNbso3n74mVPA5LTZwkB9NlXf4XPamLxJE8h0gh73rM94xvwRT2CVInw=="
     },
     "node_modules/minimatch": {
-      "version": "3.0.4",
-      "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz",
-      "integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==",
+      "version": "3.1.2",
+      "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz",
+      "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==",
       "dependencies": {
         "brace-expansion": "^1.1.7"
       },
@@ -350,9 +356,9 @@
       }
     },
     "node_modules/minimist": {
-      "version": "1.2.5",
-      "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz",
-      "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw=="
+      "version": "1.2.6",
+      "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.6.tgz",
+      "integrity": "sha512-Jsjnk4bw3YJqYzbdyBiNsPWHPfO++UGG749Cxs6peCu5Xg4nrena6OVxOYxrQTqww0Jmwt+Ref8rggumkTLz9Q=="
     },
     "node_modules/mkdirp": {
       "version": "1.0.4",
@@ -395,9 +401,9 @@
       "integrity": "sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw=="
     },
     "node_modules/picomatch": {
-      "version": "2.3.0",
-      "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.0.tgz",
-      "integrity": "sha512-lY1Q/PiJGC2zOv/z391WOTD+Z02bCgsFfvxoXXf6h7kv9o+WmsmzYqrAwY63sNgOxE4xEdq0WyUnXfKeBrSvYw==",
+      "version": "2.3.1",
+      "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz",
+      "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==",
       "engines": {
         "node": ">=8.6"
       },
@@ -428,12 +434,16 @@
       }
     },
     "node_modules/resolve": {
-      "version": "1.20.0",
-      "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.20.0.tgz",
-      "integrity": "sha512-wENBPt4ySzg4ybFQW2TT1zMQucPK95HSh/nq2CFTZVOGut2+pQvSsgtda4d26YrYcr067wjbmzOG8byDPBX63A==",
+      "version": "1.22.0",
+      "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.22.0.tgz",
+      "integrity": "sha512-Hhtrw0nLeSrFQ7phPp4OOcVjLPIeMnRlr5mcnVuMe7M/7eBn98A3hmFRLoFo3DLZkivSYwhRUJTyPyWAk56WLw==",
       "dependencies": {
-        "is-core-module": "^2.2.0",
-        "path-parse": "^1.0.6"
+        "is-core-module": "^2.8.1",
+        "path-parse": "^1.0.7",
+        "supports-preserve-symlinks-flag": "^1.0.0"
+      },
+      "bin": {
+        "resolve": "bin/resolve"
       },
       "funding": {
         "url": "https://github.com/sponsors/ljharb"
@@ -451,9 +461,9 @@
       }
     },
     "node_modules/shelljs": {
-      "version": "0.8.4",
-      "resolved": "https://registry.npmjs.org/shelljs/-/shelljs-0.8.4.tgz",
-      "integrity": "sha512-7gk3UZ9kOfPLIAbslLzyWeGiEqx9e3rxwZM0KE6EL8GlGwjym9Mrlx5/p33bWTu9YG6vcS4MBxYZDHYr5lr8BQ==",
+      "version": "0.8.5",
+      "resolved": "https://registry.npmjs.org/shelljs/-/shelljs-0.8.5.tgz",
+      "integrity": "sha512-TiwcRcrkhHvbrZbnRcFYMLl30Dfov3HKqzp5tO5b4pt6G/SezKcYhmDg15zXVBswHmctSAQKznqNW2LO5tTDow==",
       "dependencies": {
         "glob": "^7.0.0",
         "interpret": "^1.0.0",
@@ -475,9 +485,9 @@
       }
     },
     "node_modules/source-map-support": {
-      "version": "0.5.20",
-      "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.20.tgz",
-      "integrity": "sha512-n1lZZ8Ve4ksRqizaBQgxXDgKwttHDhyfQjA6YZZn8+AroHbsIz+JjwxQDxbp+7y5OYCI8t1Yk7etjD9CRd2hIw==",
+      "version": "0.5.21",
+      "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.21.tgz",
+      "integrity": "sha512-uBHU3L3czsIyYXKX88fdrGovxdSCoTGDRZ6SYXtSRxLZUzHg5P/66Ht6uoUlHu9EZod+inXhKo3qQgwXUT/y1w==",
       "dependencies": {
         "buffer-from": "^1.0.0",
         "source-map": "^0.6.0"
@@ -510,6 +520,17 @@
         "node": ">=8"
       }
     },
+    "node_modules/supports-preserve-symlinks-flag": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/supports-preserve-symlinks-flag/-/supports-preserve-symlinks-flag-1.0.0.tgz",
+      "integrity": "sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w==",
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
     "node_modules/to-regex-range": {
       "version": "5.0.1",
       "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz",
@@ -743,9 +764,9 @@
       }
     },
     "chokidar": {
-      "version": "3.5.2",
-      "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.5.2.tgz",
-      "integrity": "sha512-ekGhOnNVPgT77r4K/U3GDhu+FQ2S8TnK/s2KbIGXi0SZWuwkZ2QNyfWdZW+TVfn84DpEP7rLeCt2UI6bJ8GwbQ==",
+      "version": "3.5.3",
+      "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.5.3.tgz",
+      "integrity": "sha512-Dr3sfKRP6oTcjf2JmUmFJfeVMvXBdegxB0iVQ5eb2V10uFJUCAS8OByZdVAyVb8xXNz3GjjTgj9kLWsZTqE6kw==",
       "requires": {
         "anymatch": "~3.1.2",
         "braces": "~3.0.2",
@@ -879,9 +900,9 @@
       }
     },
     "is-core-module": {
-      "version": "2.8.0",
-      "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.8.0.tgz",
-      "integrity": "sha512-vd15qHsaqrRL7dtH6QNuy0ndJmRDrS9HAM1CAiSifNUFv4x1a0CCVsj18hJ1mShxIG6T2i1sO78MkP56r0nYRw==",
+      "version": "2.8.1",
+      "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.8.1.tgz",
+      "integrity": "sha512-SdNCUs284hr40hFTFP6l0IfZ/RSrMXF3qgoRHd3/79unUTvrFO/JoXwkGm+5J/Oe3E/b5GsnG330uUNgRpu1PA==",
       "requires": {
         "has": "^1.0.3"
       }
@@ -910,17 +931,17 @@
       "integrity": "sha512-s8UhlNe7vPKomQhC1qFelMokr/Sc3AgNbso3n74mVPA5LTZwkB9NlXf4XPamLxJE8h0gh73rM94xvwRT2CVInw=="
     },
     "minimatch": {
-      "version": "3.0.4",
-      "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz",
-      "integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==",
+      "version": "3.1.2",
+      "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz",
+      "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==",
       "requires": {
         "brace-expansion": "^1.1.7"
       }
     },
     "minimist": {
-      "version": "1.2.5",
-      "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz",
-      "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw=="
+      "version": "1.2.6",
+      "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.6.tgz",
+      "integrity": "sha512-Jsjnk4bw3YJqYzbdyBiNsPWHPfO++UGG749Cxs6peCu5Xg4nrena6OVxOYxrQTqww0Jmwt+Ref8rggumkTLz9Q=="
     },
     "mkdirp": {
       "version": "1.0.4",
@@ -951,9 +972,9 @@
       "integrity": "sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw=="
     },
     "picomatch": {
-      "version": "2.3.0",
-      "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.0.tgz",
-      "integrity": "sha512-lY1Q/PiJGC2zOv/z391WOTD+Z02bCgsFfvxoXXf6h7kv9o+WmsmzYqrAwY63sNgOxE4xEdq0WyUnXfKeBrSvYw=="
+      "version": "2.3.1",
+      "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz",
+      "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA=="
     },
     "readdirp": {
       "version": "3.6.0",
@@ -972,12 +993,13 @@
       }
     },
     "resolve": {
-      "version": "1.20.0",
-      "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.20.0.tgz",
-      "integrity": "sha512-wENBPt4ySzg4ybFQW2TT1zMQucPK95HSh/nq2CFTZVOGut2+pQvSsgtda4d26YrYcr067wjbmzOG8byDPBX63A==",
+      "version": "1.22.0",
+      "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.22.0.tgz",
+      "integrity": "sha512-Hhtrw0nLeSrFQ7phPp4OOcVjLPIeMnRlr5mcnVuMe7M/7eBn98A3hmFRLoFo3DLZkivSYwhRUJTyPyWAk56WLw==",
       "requires": {
-        "is-core-module": "^2.2.0",
-        "path-parse": "^1.0.6"
+        "is-core-module": "^2.8.1",
+        "path-parse": "^1.0.7",
+        "supports-preserve-symlinks-flag": "^1.0.0"
       }
     },
     "rimraf": {
@@ -989,9 +1011,9 @@
       }
     },
     "shelljs": {
-      "version": "0.8.4",
-      "resolved": "https://registry.npmjs.org/shelljs/-/shelljs-0.8.4.tgz",
-      "integrity": "sha512-7gk3UZ9kOfPLIAbslLzyWeGiEqx9e3rxwZM0KE6EL8GlGwjym9Mrlx5/p33bWTu9YG6vcS4MBxYZDHYr5lr8BQ==",
+      "version": "0.8.5",
+      "resolved": "https://registry.npmjs.org/shelljs/-/shelljs-0.8.5.tgz",
+      "integrity": "sha512-TiwcRcrkhHvbrZbnRcFYMLl30Dfov3HKqzp5tO5b4pt6G/SezKcYhmDg15zXVBswHmctSAQKznqNW2LO5tTDow==",
       "requires": {
         "glob": "^7.0.0",
         "interpret": "^1.0.0",
@@ -1004,9 +1026,9 @@
       "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g=="
     },
     "source-map-support": {
-      "version": "0.5.20",
-      "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.20.tgz",
-      "integrity": "sha512-n1lZZ8Ve4ksRqizaBQgxXDgKwttHDhyfQjA6YZZn8+AroHbsIz+JjwxQDxbp+7y5OYCI8t1Yk7etjD9CRd2hIw==",
+      "version": "0.5.21",
+      "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.21.tgz",
+      "integrity": "sha512-uBHU3L3czsIyYXKX88fdrGovxdSCoTGDRZ6SYXtSRxLZUzHg5P/66Ht6uoUlHu9EZod+inXhKo3qQgwXUT/y1w==",
       "requires": {
         "buffer-from": "^1.0.0",
         "source-map": "^0.6.0"
@@ -1030,6 +1052,11 @@
         "has-flag": "^4.0.0"
       }
     },
+    "supports-preserve-symlinks-flag": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/supports-preserve-symlinks-flag/-/supports-preserve-symlinks-flag-1.0.0.tgz",
+      "integrity": "sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w=="
+    },
     "to-regex-range": {
       "version": "5.0.1",
       "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz",

go.mod

@@ -1,14 +1,36 @@
 module github.com/cupcakearmy/autorestic
 
-go 1.16
+go 1.18
 
 require (
 	github.com/blang/semver/v4 v4.0.0
 	github.com/buger/goterm v1.0.0
-	github.com/fatih/color v1.10.0
+	github.com/fatih/color v1.13.0
 	github.com/joho/godotenv v1.4.0
 	github.com/mitchellh/go-homedir v1.1.0
 	github.com/robfig/cron v1.2.0
-	github.com/spf13/cobra v1.1.3
-	github.com/spf13/viper v1.7.1
+	github.com/spf13/cobra v1.4.0
+	github.com/spf13/viper v1.11.0
+)
+
+require (
+	github.com/fsnotify/fsnotify v1.5.1 // indirect
+	github.com/hashicorp/hcl v1.0.0 // indirect
+	github.com/inconshreveable/mousetrap v1.0.0 // indirect
+	github.com/magiconair/properties v1.8.6 // indirect
+	github.com/mattn/go-colorable v0.1.12 // indirect
+	github.com/mattn/go-isatty v0.0.14 // indirect
+	github.com/mitchellh/mapstructure v1.4.3 // indirect
+	github.com/pelletier/go-toml v1.9.4 // indirect
+	github.com/pelletier/go-toml/v2 v2.0.0-beta.8 // indirect
+	github.com/spf13/afero v1.8.2 // indirect
+	github.com/spf13/cast v1.4.1 // indirect
+	github.com/spf13/jwalterweatherman v1.1.0 // indirect
+	github.com/spf13/pflag v1.0.5 // indirect
+	github.com/subosito/gotenv v1.2.0 // indirect
+	golang.org/x/sys v0.0.0-20220412211240-33da011f77ad // indirect
+	golang.org/x/text v0.3.7 // indirect
+	gopkg.in/ini.v1 v1.66.4 // indirect
+	gopkg.in/yaml.v2 v2.4.0 // indirect
+	gopkg.in/yaml.v3 v3.0.0-20210107192922-496545a6307b // indirect
 )

go.sum

@@ -3,216 +3,216 @@ cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMT
 cloud.google.com/go v0.38.0/go.mod h1:990N+gfupTy94rShfmMCWGDn0LpTmnzTp2qbd1dvSRU=
 cloud.google.com/go v0.44.1/go.mod h1:iSa0KzasP4Uvy3f1mN/7PiObzGgflwredwwASm/v6AU=
 cloud.google.com/go v0.44.2/go.mod h1:60680Gw3Yr4ikxnPRS/oxxkBccT6SA1yMk63TGekxKY=
+cloud.google.com/go v0.44.3/go.mod h1:60680Gw3Yr4ikxnPRS/oxxkBccT6SA1yMk63TGekxKY=
 cloud.google.com/go v0.45.1/go.mod h1:RpBamKRgapWJb87xiFSdk4g1CME7QZg3uwTez+TSTjc=
 cloud.google.com/go v0.46.3/go.mod h1:a6bKKbmY7er1mI7TEI4lsAkts/mkhTSZK8w33B4RAg0=
+cloud.google.com/go v0.50.0/go.mod h1:r9sluTvynVuxRIOHXQEHMFffphuXHOMZMycpNR5e6To=
+cloud.google.com/go v0.52.0/go.mod h1:pXajvRH/6o3+F9jDHZWQ5PbGhn+o8w9qiu/CffaVdO4=
+cloud.google.com/go v0.53.0/go.mod h1:fp/UouUEsRkN6ryDKNW/Upv/JBKnv6WDthjR6+vze6M=
+cloud.google.com/go v0.54.0/go.mod h1:1rq2OEkV3YMf6n/9ZvGWI3GWw0VoqH/1x2nd8Is/bPc=
+cloud.google.com/go v0.56.0/go.mod h1:jr7tqZxxKOVYizybht9+26Z/gUq7tiRzu+ACVAMbKVk=
+cloud.google.com/go v0.57.0/go.mod h1:oXiQ6Rzq3RAkkY7N6t3TcE6jE+CIBBbA36lwQ1JyzZs=
+cloud.google.com/go v0.62.0/go.mod h1:jmCYTdRCQuc1PHIIJ/maLInMho30T/Y0M4hTdTShOYc=
+cloud.google.com/go v0.65.0/go.mod h1:O5N8zS7uWy9vkA9vayVHs65eM1ubvY4h553ofrNHObY=
+cloud.google.com/go v0.72.0/go.mod h1:M+5Vjvlc2wnp6tjzE102Dw08nGShTscUx2nZMufOKPI=
+cloud.google.com/go v0.74.0/go.mod h1:VV1xSbzvo+9QJOxLDaJfTjx5e+MePCpCWwvftOeQmWk=
+cloud.google.com/go v0.75.0/go.mod h1:VGuuCn7PG0dwsd5XPVm2Mm3wlh3EL55/79EKB6hlPTY=
 cloud.google.com/go/bigquery v1.0.1/go.mod h1:i/xbL2UlR5RvWAURpBYZTtm/cXjCha9lbfbpx4poX+o=
+cloud.google.com/go/bigquery v1.3.0/go.mod h1:PjpwJnslEMmckchkHFfq+HTD2DmtT67aNFKH1/VBDHE=
+cloud.google.com/go/bigquery v1.4.0/go.mod h1:S8dzgnTigyfTmLBfrtrhyYhwRxG72rYxvftPBK2Dvzc=
+cloud.google.com/go/bigquery v1.5.0/go.mod h1:snEHRnqQbz117VIFhE8bmtwIDY80NLUZUMb4Nv6dBIg=
+cloud.google.com/go/bigquery v1.7.0/go.mod h1://okPTzCYNXSlb24MZs83e2Do+h+VXtc4gLoIoXIAPc=
+cloud.google.com/go/bigquery v1.8.0/go.mod h1:J5hqkt3O0uAFnINi6JXValWIb1v0goeZM77hZzJN/fQ=
 cloud.google.com/go/datastore v1.0.0/go.mod h1:LXYbyblFSglQ5pkeyhO+Qmw7ukd3C+pD7TKLgZqpHYE=
-cloud.google.com/go/firestore v1.1.0/go.mod h1:ulACoGHTpvq5r8rxGJ4ddJZBZqakUQqClKRT5SZwBmk=
+cloud.google.com/go/datastore v1.1.0/go.mod h1:umbIZjpQpHh4hmRpGhH4tLFup+FVzqBi1b3c64qFpCk=
 cloud.google.com/go/pubsub v1.0.1/go.mod h1:R0Gpsv3s54REJCy4fxDixWD93lHJMoZTyQ2kNxGRt3I=
+cloud.google.com/go/pubsub v1.1.0/go.mod h1:EwwdRX2sKPjnvnqCa270oGRyludottCI76h+R3AArQw=
+cloud.google.com/go/pubsub v1.2.0/go.mod h1:jhfEVHT8odbXTkndysNHCcx0awwzvfOlguIAii9o8iA=
+cloud.google.com/go/pubsub v1.3.1/go.mod h1:i+ucay31+CNRpDW4Lu78I4xXG+O1r/MAHgjpRVR+TSU=
 cloud.google.com/go/storage v1.0.0/go.mod h1:IhtSnM/ZTZV8YYJWCY8RULGVqBDmpoyjwiyrjsg+URw=
+cloud.google.com/go/storage v1.5.0/go.mod h1:tpKbwo567HUNpVclU5sGELwQWBDZ8gh0ZeosJ0Rtdos=
+cloud.google.com/go/storage v1.6.0/go.mod h1:N7U0C8pVQ/+NIKOBQyamJIeKQKkZ+mxpohlUTyfDhBk=
+cloud.google.com/go/storage v1.8.0/go.mod h1:Wv1Oy7z6Yz3DshWRJFhqM/UCfaWIRTdp0RXyy7KQOVs=
+cloud.google.com/go/storage v1.10.0/go.mod h1:FLPqc6j+Ki4BU591ie1oL6qBQGu2Bl/tZ9ullr3+Kg0=
+cloud.google.com/go/storage v1.14.0/go.mod h1:GrKmX003DSIwi9o29oFT7YDnHYwZoctc3fOKtUw0Xmo=
 dmitri.shuralyov.com/gpu/mtl v0.0.0-20190408044501-666a987793e9/go.mod h1:H6x//7gZCb22OMCxBHrMx7a5I7Hp++hsVxbQ4BYO7hU=
-github.com/BurntSushi/toml v0.3.1 h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ=
 github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
 github.com/BurntSushi/xgb v0.0.0-20160522181843-27f122750802/go.mod h1:IVnqGOEym/WlBOVXweHU+Q+/VP0lqqI8lqeDx9IjBqo=
-github.com/OneOfOne/xxhash v1.2.2/go.mod h1:HSdplMjZKSmBqAxg5vPj2TmRDmfkzw+cTzAElWljhcU=
-github.com/alecthomas/template v0.0.0-20160405071501-a0175ee3bccc/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc=
-github.com/alecthomas/units v0.0.0-20151022065526-2efee857e7cf/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0=
-github.com/armon/circbuf v0.0.0-20150827004946-bbbad097214e/go.mod h1:3U/XgcO3hCbHZ8TKRvWD2dDTCfh9M9ya+I9JpbB7O8o=
-github.com/armon/go-metrics v0.0.0-20180917152333-f0300d1749da/go.mod h1:Q73ZrmVTwzkszR9V5SSuryQ31EELlFMUz1kKyl939pY=
-github.com/armon/go-radix v0.0.0-20180808171621-7fddfc383310/go.mod h1:ufUuZ+zHj4x4TnLV4JWEpy2hxWSpsRywHrMgIH9cCH8=
-github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q=
-github.com/beorn7/perks v1.0.0/go.mod h1:KWe93zE9D1o94FZ5RNwFwVgaQK1VOXiVxmqh+CedLV8=
-github.com/bgentry/speakeasy v0.1.0/go.mod h1:+zsyZBPWlz7T6j88CTgSN5bM796AkVf0kBD4zp0CCIs=
-github.com/bketelsen/crypt v0.0.3-0.20200106085610-5cbc8cc4026c/go.mod h1:MKsuJmJgSg28kpZDP6UIiPt0e0Oz0kqKNGyRaWEPv84=
 github.com/blang/semver/v4 v4.0.0 h1:1PFHFE6yCCTv8C1TeyNNarDzntLi7wMI5i/pzqYIsAM=
 github.com/blang/semver/v4 v4.0.0/go.mod h1:IbckMUScFkM3pff0VJDNKRiT6TG/YpiHIM2yvyW5YoQ=
 github.com/buger/goterm v1.0.0 h1:ZB6uUlY8+sjJyFGzz2WpRqX2XYPeXVgtZAOJMwOsTWM=
 github.com/buger/goterm v1.0.0/go.mod h1:16STi3LquiscTIHA8SXUNKEa/Cnu4ZHBH8NsCaWgso0=
-github.com/cespare/xxhash v1.1.0/go.mod h1:XrSqR1VqqWfGrhpAt58auRo0WTKS1nRRg3ghfAqPWnc=
+github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU=
+github.com/chzyer/logex v1.1.10/go.mod h1:+Ywpsq7O8HXn0nuIou7OrIPyXbp3wmkHB+jjWRnGsAI=
+github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e/go.mod h1:nSuG5e5PlCu98SY8svDHJxuZscDgtXS6KTTbou5AhLI=
+github.com/chzyer/test v0.0.0-20180213035817-a1ea475d72b1/go.mod h1:Q3SI9o4m/ZMnBNeIyt5eFwwo7qiLfzFZmjNmxjkiQlU=
 github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
-github.com/coreos/bbolt v1.3.2/go.mod h1:iRUV2dpdMOn7Bo10OQBFzIJO9kkE559Wcmn+qkEiiKk=
-github.com/coreos/etcd v3.3.13+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE=
-github.com/coreos/go-semver v0.3.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk=
-github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4=
-github.com/coreos/pkg v0.0.0-20180928190104-399ea9e2e55f/go.mod h1:E3G3o1h8I7cfcXa63jLwjI0eiQQMgzzUDFVpN/nH/eA=
-github.com/cpuguy83/go-md2man/v2 v2.0.0/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU=
+github.com/cncf/udpa/go v0.0.0-20191209042840-269d4d468f6f/go.mod h1:M8M6+tZqaGXZJjfX53e64911xZQV5JYwmTeXPW+k8Sc=
+github.com/cncf/udpa/go v0.0.0-20200629203442-efcf912fb354/go.mod h1:WmhPx2Nbnhtbo57+VJT5O0JRkEi1Wbu0z5j0R8u5Hbk=
+github.com/cncf/udpa/go v0.0.0-20201120205902-5459f2c99403/go.mod h1:WmhPx2Nbnhtbo57+VJT5O0JRkEi1Wbu0z5j0R8u5Hbk=
+github.com/cpuguy83/go-md2man/v2 v2.0.1/go.mod h1:tgQtvFlXSQOSOSIRvRPT7W67SCa46tRHOmNcaadrF8o=
 github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
 github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
 github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
-github.com/dgrijalva/jwt-go v3.2.0+incompatible/go.mod h1:E3ru+11k8xSBh+hMPgOLZmtrrCbhqsmaPHjLKYnJCaQ=
-github.com/dgryski/go-sip13 v0.0.0-20181026042036-e10d5fee7954/go.mod h1:vAd38F8PWV+bWy6jNmig1y/TA+kYO4g3RSRF0IAv0no=
-github.com/fatih/color v1.7.0/go.mod h1:Zm6kSWBoL9eyXnKyktHP6abPY2pDugNf5KwzbycvMj4=
-github.com/fatih/color v1.10.0 h1:s36xzo75JdqLaaWoiEHk767eHiwo0598uUxyfiPkDsg=
-github.com/fatih/color v1.10.0/go.mod h1:ELkj/draVOlAH/xkhN6mQ50Qd0MPOk5AAr3maGEBuJM=
-github.com/fsnotify/fsnotify v1.4.7 h1:IXs+QLmnXW2CcXuY+8Mzv/fWEsPGWxqefPtCP5CnV9I=
-github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo=
-github.com/ghodss/yaml v1.0.0/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04=
+github.com/envoyproxy/go-control-plane v0.9.0/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4=
+github.com/envoyproxy/go-control-plane v0.9.1-0.20191026205805-5f8ba28d4473/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4=
+github.com/envoyproxy/go-control-plane v0.9.4/go.mod h1:6rpuAdCZL397s3pYoYcLgu1mIlRU8Am5FuJP05cCM98=
+github.com/envoyproxy/go-control-plane v0.9.7/go.mod h1:cwu0lG7PUMfa9snN8LXBig5ynNVH9qI8YYLbd1fK2po=
+github.com/envoyproxy/go-control-plane v0.9.9-0.20201210154907-fd9021fe5dad/go.mod h1:cXg6YxExXjJnVBQHBLXeUAgxn2UodCpnH306RInaBQk=
+github.com/envoyproxy/protoc-gen-validate v0.1.0/go.mod h1:iSmxcyjqTsJpI2R4NaDN7+kN2VEUnK/pcBlmesArF7c=
+github.com/fatih/color v1.13.0 h1:8LOYc1KYPPmyKMuN8QV2DNRWNbLo6LZ0iLs8+mlH53w=
+github.com/fatih/color v1.13.0/go.mod h1:kLAiJbzzSOZDVNGyDpeOxJ47H46qBXwg5ILebYFFOfk=
+github.com/fsnotify/fsnotify v1.5.1 h1:mZcQUHVQUQWoPXXtuf9yuEXKudkV2sx1E06UadKWpgI=
+github.com/fsnotify/fsnotify v1.5.1/go.mod h1:T3375wBYaZdLLcVNkcVbzGHY7f1l/uK5T5Ai1i3InKU=
 github.com/go-gl/glfw v0.0.0-20190409004039-e6da0acd62b1/go.mod h1:vR7hzQXu2zJy9AVAgeJqvqgH9Q5CA+iKCZ2gyEVpxRU=
-github.com/go-kit/kit v0.8.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as=
-github.com/go-logfmt/logfmt v0.3.0/go.mod h1:Qt1PoO58o5twSAckw1HlFXLmHsOX5/0LbT9GBnD5lWE=
-github.com/go-logfmt/logfmt v0.4.0/go.mod h1:3RMwSq7FuexP4Kalkev3ejPJsZTpXXBr9+V4qmtdjCk=
-github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/melR3HDY=
-github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ=
-github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4=
+github.com/go-gl/glfw/v3.3/glfw v0.0.0-20191125211704-12ad95a8df72/go.mod h1:tQ2UAYgL5IevRw8kRxooKSPJfGvJ9fJQFa0TUsXzTg8=
+github.com/go-gl/glfw/v3.3/glfw v0.0.0-20200222043503-6f7a984d4dc4/go.mod h1:tQ2UAYgL5IevRw8kRxooKSPJfGvJ9fJQFa0TUsXzTg8=
 github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
-github.com/golang/groupcache v0.0.0-20190129154638-5b532d6fd5ef/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
+github.com/golang/groupcache v0.0.0-20190702054246-869f871628b6/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
+github.com/golang/groupcache v0.0.0-20191227052852-215e87163ea7/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
+github.com/golang/groupcache v0.0.0-20200121045136-8c9f03a8e57e/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
 github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
 github.com/golang/mock v1.2.0/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
 github.com/golang/mock v1.3.1/go.mod h1:sBzyDLLjw3U8JLTeZvSv8jJB+tU5PVekmnlKIyFUx0Y=
+github.com/golang/mock v1.4.0/go.mod h1:UOMv5ysSaYNkG+OFQykRIcU/QvvxJf3p21QfJ2Bt3cw=
+github.com/golang/mock v1.4.1/go.mod h1:UOMv5ysSaYNkG+OFQykRIcU/QvvxJf3p21QfJ2Bt3cw=
+github.com/golang/mock v1.4.3/go.mod h1:UOMv5ysSaYNkG+OFQykRIcU/QvvxJf3p21QfJ2Bt3cw=
+github.com/golang/mock v1.4.4/go.mod h1:l3mdAwkq5BuhzHwde/uurv3sEJeZMXNpwsxVWU71h+4=
 github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
 github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
 github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
+github.com/golang/protobuf v1.3.3/go.mod h1:vzj43D7+SQXF/4pzW/hwtAqwc6iTitCiVSaWz5lYuqw=
+github.com/golang/protobuf v1.3.4/go.mod h1:vzj43D7+SQXF/4pzW/hwtAqwc6iTitCiVSaWz5lYuqw=
+github.com/golang/protobuf v1.3.5/go.mod h1:6O5/vntMXwX2lRkT1hjjk0nAC1IDOTvTlVgjlRvqsdk=
+github.com/golang/protobuf v1.4.0-rc.1/go.mod h1:ceaxUfeHdC40wWswd/P6IGgMaK3YpKi5j83Wpe3EHw8=
+github.com/golang/protobuf v1.4.0-rc.1.0.20200221234624-67d41d38c208/go.mod h1:xKAWHe0F5eneWXFV3EuXVDTCmh+JuBKY0li0aMyXATA=
+github.com/golang/protobuf v1.4.0-rc.2/go.mod h1:LlEzMj4AhA7rCAGe4KMBDvJI+AwstrUpVNzEA03Pprs=
+github.com/golang/protobuf v1.4.0-rc.4.0.20200313231945-b860323f09d0/go.mod h1:WU3c8KckQ9AFe+yFwt9sWVRKCVIyN9cPHBJSNnbL67w=
+github.com/golang/protobuf v1.4.0/go.mod h1:jodUvKwWbYaEsadDk5Fwe5c77LiNKVO9IDvqG2KuDX0=
+github.com/golang/protobuf v1.4.1/go.mod h1:U8fpvMrcmy5pZrNK1lt4xCsGvpyWQ/VVv6QDs8UjoX8=
+github.com/golang/protobuf v1.4.2/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI=
+github.com/golang/protobuf v1.4.3/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI=
 github.com/google/btree v0.0.0-20180813153112-4030bb1f1f0c/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ=
 github.com/google/btree v1.0.0/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ=
 github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M=
 github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
+github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
+github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.4.1/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.1/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.2/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.4/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
 github.com/google/martian v2.1.0+incompatible/go.mod h1:9I4somxYTbIHy5NJKHRl3wXiIaQGbYVAs8BPL6v8lEs=
+github.com/google/martian/v3 v3.0.0/go.mod h1:y5Zk1BBys9G+gd6Jrk0W3cC1+ELVxBWuIGO+w/tUAp0=
+github.com/google/martian/v3 v3.1.0/go.mod h1:y5Zk1BBys9G+gd6Jrk0W3cC1+ELVxBWuIGO+w/tUAp0=
 github.com/google/pprof v0.0.0-20181206194817-3ea8567a2e57/go.mod h1:zfwlbNMJ+OItoe0UupaVj+oy1omPYYDuagoSzA8v9mc=
 github.com/google/pprof v0.0.0-20190515194954-54271f7e092f/go.mod h1:zfwlbNMJ+OItoe0UupaVj+oy1omPYYDuagoSzA8v9mc=
+github.com/google/pprof v0.0.0-20191218002539-d4f498aebedc/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
+github.com/google/pprof v0.0.0-20200212024743-f11f1df84d12/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
+github.com/google/pprof v0.0.0-20200229191704-1ebb73c60ed3/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
+github.com/google/pprof v0.0.0-20200430221834-fc25d7d30c6d/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
+github.com/google/pprof v0.0.0-20200708004538-1a94d8640e99/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
+github.com/google/pprof v0.0.0-20201023163331-3e6fc7fc9c4c/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE=
+github.com/google/pprof v0.0.0-20201203190320-1bf35d6f28c2/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE=
+github.com/google/pprof v0.0.0-20201218002935-b9804c9f04c2/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE=
 github.com/google/renameio v0.1.0/go.mod h1:KWCgfxg9yswjAJkECMjeO8J8rahYeXnNhOm40UhjYkI=
+github.com/google/uuid v1.1.2/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo=
 github.com/googleapis/gax-go/v2 v2.0.4/go.mod h1:0Wqv26UfaUD9n4G6kQubkQ+KchISgw+vpHVxEJEs9eg=
 github.com/googleapis/gax-go/v2 v2.0.5/go.mod h1:DWXyrwAJ9X0FpwwEdw+IPEYBICEFu5mhpdKc/us6bOk=
-github.com/gopherjs/gopherjs v0.0.0-20181017120253-0766667cb4d1 h1:EGx4pi6eqNxGaHF6qqu48+N2wcFQ5qg5FXgOdqsJ5d8=
-github.com/gopherjs/gopherjs v0.0.0-20181017120253-0766667cb4d1/go.mod h1:wJfORRmW1u3UXTncJ5qlYoELFm8eSnnEO6hX4iZ3EWY=
-github.com/gorilla/websocket v1.4.2/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE=
-github.com/grpc-ecosystem/go-grpc-middleware v1.0.0/go.mod h1:FiyG127CGDf3tlThmgyCl78X/SZQqEOJBCDaAfeWzPs=
-github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0/go.mod h1:8NvIoxWQoOIhqOTXgfV/d3M/q6VIi02HzZEHgUlZvzk=
-github.com/grpc-ecosystem/grpc-gateway v1.9.0/go.mod h1:vNeuVxBJEsws4ogUvrchl83t/GYV9WGTSLVdBhOQFDY=
-github.com/hashicorp/consul/api v1.1.0/go.mod h1:VmuI/Lkw1nC05EYQWNKwWGbkg+FbDBtguAZLlVdkD9Q=
-github.com/hashicorp/consul/sdk v0.1.1/go.mod h1:VKf9jXwCTEY1QZP2MOLRhb5i/I/ssyNV1vwHyQBF0x8=
-github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
-github.com/hashicorp/go-cleanhttp v0.5.1/go.mod h1:JpRdi6/HCYpAwUzNwuwqhbovhLtngrth3wmdIIUrZ80=
-github.com/hashicorp/go-immutable-radix v1.0.0/go.mod h1:0y9vanUI8NX6FsYoO3zeMjhV/C5i9g4Q3DwcSNZ4P60=
-github.com/hashicorp/go-msgpack v0.5.3/go.mod h1:ahLV/dePpqEmjfWmKiqvPkv/twdG7iPBM1vqhUKIvfM=
-github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk=
-github.com/hashicorp/go-rootcerts v1.0.0/go.mod h1:K6zTfqpRlCUIjkwsN4Z+hiSfzSTQa6eBIzfwKfwNnHU=
-github.com/hashicorp/go-sockaddr v1.0.0/go.mod h1:7Xibr9yA9JjQq1JpNB2Vw7kxv8xerXegt+ozgdvDeDU=
-github.com/hashicorp/go-syslog v1.0.0/go.mod h1:qPfqrKkXGihmCqbJM2mZgkZGvKG1dFdvsLplgctolz4=
-github.com/hashicorp/go-uuid v1.0.0/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro=
-github.com/hashicorp/go-uuid v1.0.1/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro=
-github.com/hashicorp/go.net v0.0.1/go.mod h1:hjKkEWcCURg++eb33jQU7oqQcI9XDCnUzHA0oac0k90=
+github.com/googleapis/google-cloud-go-testing v0.0.0-20200911160855-bcd43fbb19e8/go.mod h1:dvDLG8qkwmyD9a/MJJN3XJcT3xFxOKAvTZGvuZmac9g=
 github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
 github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
 github.com/hashicorp/hcl v1.0.0 h1:0Anlzjpi4vEasTeNFn2mLJgTSwt0+6sfsiTG8qcWGx4=
 github.com/hashicorp/hcl v1.0.0/go.mod h1:E5yfLk+7swimpb2L/Alb/PJmXilQ/rhwaUYs4T20WEQ=
-github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64=
-github.com/hashicorp/mdns v1.0.0/go.mod h1:tL+uN++7HEJ6SQLQ2/p+z2pH24WQKWjBPkE0mNTz8vQ=
-github.com/hashicorp/memberlist v0.1.3/go.mod h1:ajVTdAv/9Im8oMAAj5G31PhhMCZJV2pPBoIllUwCN7I=
-github.com/hashicorp/serf v0.8.2/go.mod h1:6hOLApaqBFA1NXqRQAsxw9QxuDEvNxSQRwA/JwenrHc=
+github.com/ianlancetaylor/demangle v0.0.0-20181102032728-5e5cf60278f6/go.mod h1:aSSvb/t6k1mPoxDqO4vJh6VOCGPwU4O0C2/Eqndh1Sc=
+github.com/ianlancetaylor/demangle v0.0.0-20200824232613-28f6c0f3b639/go.mod h1:aSSvb/t6k1mPoxDqO4vJh6VOCGPwU4O0C2/Eqndh1Sc=
 github.com/inconshreveable/mousetrap v1.0.0 h1:Z8tu5sraLXCXIcARxBp/8cbvlwVa7Z1NHg9XEKhtSvM=
 github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANytuPF1OarO4DADm73n8=
 github.com/joho/godotenv v1.4.0 h1:3l4+N6zfMWnkbPEXKng2o2/MR5mSwTrBih4ZEkkz1lg=
 github.com/joho/godotenv v1.4.0/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
-github.com/jonboulle/clockwork v0.1.0/go.mod h1:Ii8DK3G1RaLaWxj9trq07+26W01tbo22gdxWY5EU2bo=
-github.com/json-iterator/go v1.1.6/go.mod h1:+SdeFBvtyEkXs7REEP0seUULqWtbJapLOCVDaaPEHmU=
 github.com/jstemmer/go-junit-report v0.0.0-20190106144839-af01ea7f8024/go.mod h1:6v2b51hI/fHJwM22ozAgKL4VKDeJcHhJFhtBdhmNjmU=
-github.com/jtolds/gls v4.20.0+incompatible h1:xdiiI2gbIgH/gLH7ADydsJ1uDOEzR8yvV7C0MuV77Wo=
-github.com/jtolds/gls v4.20.0+incompatible/go.mod h1:QJZ7F/aHp+rZTRtaJ1ow/lLfFfVYBRgL+9YlvaHOwJU=
-github.com/julienschmidt/httprouter v1.2.0/go.mod h1:SYymIcj16QtmaHHD7aYtjjsJG7VTCxuUUipMqKk8s4w=
-github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q=
+github.com/jstemmer/go-junit-report v0.9.1/go.mod h1:Brl9GWCQeLvo8nXZwPNNblvFj/XSXhF0NWZEnDohbsk=
 github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck=
-github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
-github.com/kr/logfmt v0.0.0-20140226030751-b84e30acd515/go.mod h1:+0opPa2QZZtGFBFZlji/RkVcI2GknAs/DXo4wKdlNEc=
+github.com/kr/fs v0.1.0/go.mod h1:FFnZGqtBN9Gxj7eW1uZ42v5BccTP0vu6NEaFoC2HwRg=
 github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI=
 github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
 github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
 github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
 github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
-github.com/magiconair/properties v1.8.1 h1:ZC2Vc7/ZFkGmsVC9KvOjumD+G5lXy2RtTKyzRKO2BQ4=
-github.com/magiconair/properties v1.8.1/go.mod h1:PppfXfuXeibc/6YijjN8zIbojt8czPbwD3XqdrwzmxQ=
-github.com/mattn/go-colorable v0.0.9/go.mod h1:9vuHe8Xs5qXnSaW/c/ABM9alt+Vo+STaOChaDxuIBZU=
-github.com/mattn/go-colorable v0.1.8 h1:c1ghPdyEDarC70ftn0y+A/Ee++9zz8ljHG1b13eJ0s8=
-github.com/mattn/go-colorable v0.1.8/go.mod h1:u6P/XSegPjTcexA+o6vUJrdnUu04hMope9wVRipJSqc=
-github.com/mattn/go-isatty v0.0.3/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4=
-github.com/mattn/go-isatty v0.0.12 h1:wuysRhFDzyxgEmMf5xjvJ2M9dZoWAXNNr5LSBS7uHXY=
+github.com/magiconair/properties v1.8.6 h1:5ibWZ6iY0NctNGWo87LalDlEZ6R41TqbbDamhfG/Qzo=
+github.com/magiconair/properties v1.8.6/go.mod h1:y3VJvCyxH9uVvJTWEGAELF3aiYNyPKd5NZ3oSwXrF60=
+github.com/mattn/go-colorable v0.1.9/go.mod h1:u6P/XSegPjTcexA+o6vUJrdnUu04hMope9wVRipJSqc=
+github.com/mattn/go-colorable v0.1.12 h1:jF+Du6AlPIjs2BiUiQlKOX0rt3SujHxPnksPKZbaA40=
+github.com/mattn/go-colorable v0.1.12/go.mod h1:u5H1YNBxpqRaxsYJYSkiCWKzEfiAb1Gb520KVy5xxl4=
 github.com/mattn/go-isatty v0.0.12/go.mod h1:cbi8OIDigv2wuxKPP5vlRcQ1OAZbq2CE4Kysco4FUpU=
-github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0=
-github.com/miekg/dns v1.0.14/go.mod h1:W1PPwlIAgtquWBMBEV9nkV9Cazfe8ScdGz/Lj7v3Nrg=
-github.com/mitchellh/cli v1.0.0/go.mod h1:hNIlj7HEI86fIcpObd7a0FcrxTWetlwJDGcceTlRvqc=
-github.com/mitchellh/go-homedir v1.0.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0=
+github.com/mattn/go-isatty v0.0.14 h1:yVuAays6BHfxijgZPzw+3Zlu5yQgKGP2/hcQbHb7S9Y=
+github.com/mattn/go-isatty v0.0.14/go.mod h1:7GGIvUiUoEMVVmxf/4nioHXj79iQHKdU27kJ6hsGG94=
 github.com/mitchellh/go-homedir v1.1.0 h1:lukF9ziXFxDFPkA1vsr5zpc1XuPDn/wFntq5mG+4E0Y=
 github.com/mitchellh/go-homedir v1.1.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0=
-github.com/mitchellh/go-testing-interface v1.0.0/go.mod h1:kRemZodwjscx+RGhAo8eIhFbs2+BFgRtFPeD/KE+zxI=
-github.com/mitchellh/gox v0.4.0/go.mod h1:Sd9lOJ0+aimLBi73mGofS1ycjY8lL3uZM3JPS42BGNg=
-github.com/mitchellh/iochan v1.0.0/go.mod h1:JwYml1nuB7xOzsp52dPpHFffvOCDupsG0QubkSMEySY=
-github.com/mitchellh/mapstructure v0.0.0-20160808181253-ca63d7c062ee/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y=
-github.com/mitchellh/mapstructure v1.1.2 h1:fmNYVwqnSfB9mZU6OS2O6GsXM+wcskZDuKQzvN1EDeE=
-github.com/mitchellh/mapstructure v1.1.2/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y=
-github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q=
-github.com/modern-go/reflect2 v1.0.1/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0=
-github.com/mwitkow/go-conntrack v0.0.0-20161129095857-cc309e4a2223/go.mod h1:qRWi+5nqEBWmkhHvq77mSJWrCKwh8bxhgT7d/eI7P4U=
-github.com/oklog/ulid v1.3.1/go.mod h1:CirwcVhetQ6Lv90oh/F+FBtV6XMibvdAFo93nm5qn4U=
-github.com/pascaldekloe/goe v0.0.0-20180627143212-57f6aae5913c/go.mod h1:lzWF7FIEvWOWxwDKqyGYQf6ZUaNfKdP144TG7ZOy1lc=
-github.com/pelletier/go-toml v1.2.0 h1:T5zMGML61Wp+FlcbWjRDT7yAxhJNAiPPLOFECq181zc=
-github.com/pelletier/go-toml v1.2.0/go.mod h1:5z9KED0ma1S8pY6P1sdut58dfprrGBbd/94hg7ilaic=
-github.com/pkg/errors v0.8.0/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
-github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
+github.com/mitchellh/mapstructure v1.4.3 h1:OVowDSCllw/YjdLkam3/sm7wEtOy59d8ndGgCcyj8cs=
+github.com/mitchellh/mapstructure v1.4.3/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
+github.com/pelletier/go-toml v1.9.4 h1:tjENF6MfZAg8e4ZmZTeWaWiT2vXtsoO6+iuOjFhECwM=
+github.com/pelletier/go-toml v1.9.4/go.mod h1:u1nR/EPcESfeI/szUZKdtJ0xRNbUoANCkoOuaOx1Y+c=
+github.com/pelletier/go-toml/v2 v2.0.0-beta.8 h1:dy81yyLYJDwMTifq24Oi/IslOslRrDSb3jwDggjz3Z0=
+github.com/pelletier/go-toml/v2 v2.0.0-beta.8/go.mod h1:r9LEWfGN8R5k0VXJ+0BkIe7MYkRdwZOjgMj2KwnJFUo=
+github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
+github.com/pkg/sftp v1.13.1/go.mod h1:3HaPG6Dq1ILlpPZRO0HVMrsydcdLt6HRDccSgb87qRg=
 github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
 github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
-github.com/posener/complete v1.1.1/go.mod h1:em0nMJCgc9GFtwrmVmEMR/ZL6WyhyjMBndrE9hABlRI=
-github.com/prometheus/client_golang v0.9.1/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw=
-github.com/prometheus/client_golang v0.9.3/go.mod h1:/TN21ttK/J9q6uSwhBd54HahCDft0ttaMvbicHlPoso=
-github.com/prometheus/client_model v0.0.0-20180712105110-5c3871d89910/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo=
-github.com/prometheus/client_model v0.0.0-20190129233127-fd36f4220a90/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
-github.com/prometheus/common v0.0.0-20181113130724-41aa239b4cce/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro=
-github.com/prometheus/common v0.4.0/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4=
-github.com/prometheus/procfs v0.0.0-20181005140218-185b4288413d/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk=
-github.com/prometheus/procfs v0.0.0-20190507164030-5867b95ac084/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA=
-github.com/prometheus/tsdb v0.7.1/go.mod h1:qhTCs0VvXwvX/y3TZrWD7rabWM+ijKTux40TwIPHuXU=
+github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
 github.com/robfig/cron v1.2.0 h1:ZjScXvvxeQ63Dbyxy76Fj3AT3Ut0aKsyd2/tl3DTMuQ=
 github.com/robfig/cron v1.2.0/go.mod h1:JGuDeoQd7Z6yL4zQhZ3OPEVHB7fL6Ka6skscFHfmt2k=
-github.com/rogpeppe/fastuuid v0.0.0-20150106093220-6724a57986af/go.mod h1:XWv6SoW27p1b0cqNHllgS5HIMJraePCO15w5zCzIWYg=
 github.com/rogpeppe/go-internal v1.3.0/go.mod h1:M8bDsm7K2OlrFYOpmOWEs/qY81heoFRclV5y23lUDJ4=
-github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM=
-github.com/ryanuber/columnize v0.0.0-20160712163229-9b3edd62028f/go.mod h1:sm1tb6uqfes/u+d4ooFouqFdy9/2g9QGwK3SQygK0Ts=
-github.com/sean-/seed v0.0.0-20170313163322-e2103e2c3529/go.mod h1:DxrIzT+xaE7yg65j358z/aeFdxmN0P9QXhEzd20vsDc=
-github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc=
-github.com/sirupsen/logrus v1.2.0/go.mod h1:LxeOpSwHxABJmUn/MG1IvRgCAasNZTLOkJPxbbu5VWo=
-github.com/smartystreets/assertions v0.0.0-20180927180507-b2de0cb4f26d h1:zE9ykElWQ6/NYmHa3jpm/yHnI4xSofP+UP6SpjHcSeM=
-github.com/smartystreets/assertions v0.0.0-20180927180507-b2de0cb4f26d/go.mod h1:OnSkiWE9lh6wB0YB77sQom3nweQdgAjqCqsofrRNTgc=
-github.com/smartystreets/goconvey v1.6.4 h1:fv0U8FUIMPNf1L9lnHLvLhgicrIVChEkdzIKYqbNC9s=
-github.com/smartystreets/goconvey v1.6.4/go.mod h1:syvi0/a8iFYH4r/RixwvyeAJjdLS9QV7WQ/tjFTllLA=
-github.com/soheilhy/cmux v0.1.4/go.mod h1:IM3LyeVVIOuxMH7sFAkER9+bJ4dT7Ms6E4xg4kGIyLM=
-github.com/spaolacci/murmur3 v0.0.0-20180118202830-f09979ecbc72/go.mod h1:JwIasOWyU6f++ZhiEuf87xNszmSA2myDM2Kzu9HwQUA=
-github.com/spf13/afero v1.1.2 h1:m8/z1t7/fwjysjQRYbP0RD+bUIF/8tJwPdEZsI83ACI=
-github.com/spf13/afero v1.1.2/go.mod h1:j4pytiNVoe2o6bmDsKpLACNPDBIoEAkihy7loJ1B0CQ=
-github.com/spf13/cast v1.3.0 h1:oget//CVOEoFewqQxwr0Ej5yjygnqGkvggSE/gB35Q8=
-github.com/spf13/cast v1.3.0/go.mod h1:Qx5cxh0v+4UWYiBimWS+eyWzqEqokIECu5etghLkUJE=
-github.com/spf13/cobra v1.1.3 h1:xghbfqPkxzxP3C/f3n5DdpAbdKLj4ZE4BWQI362l53M=
-github.com/spf13/cobra v1.1.3/go.mod h1:pGADOWyqRD/YMrPZigI/zbliZ2wVD/23d+is3pSWzOo=
-github.com/spf13/jwalterweatherman v1.0.0 h1:XHEdyB+EcvlqZamSM4ZOMGlc93t6AcsBEu9Gc1vn7yk=
-github.com/spf13/jwalterweatherman v1.0.0/go.mod h1:cQK4TGJAtQXfYWX+Ddv3mKDzgVb68N+wFjFa4jdeBTo=
-github.com/spf13/pflag v1.0.3/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4=
+github.com/russross/blackfriday/v2 v2.1.0/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM=
+github.com/spf13/afero v1.8.2 h1:xehSyVa0YnHWsJ49JFljMpg1HX19V6NDZ1fkm1Xznbo=
+github.com/spf13/afero v1.8.2/go.mod h1:CtAatgMJh6bJEIs48Ay/FOnkljP3WeGUG0MC1RfAqwo=
+github.com/spf13/cast v1.4.1 h1:s0hze+J0196ZfEMTs80N7UlFt0BDuQ7Q+JDnHiMWKdA=
+github.com/spf13/cast v1.4.1/go.mod h1:Qx5cxh0v+4UWYiBimWS+eyWzqEqokIECu5etghLkUJE=
+github.com/spf13/cobra v1.4.0 h1:y+wJpx64xcgO1V+RcnwW0LEHxTKRi2ZDPSBjWnrg88Q=
+github.com/spf13/cobra v1.4.0/go.mod h1:Wo4iy3BUC+X2Fybo0PDqwJIv3dNRiZLHQymsfxlB84g=
+github.com/spf13/jwalterweatherman v1.1.0 h1:ue6voC5bR5F8YxI5S67j9i582FU4Qvo2bmqnqMYADFk=
+github.com/spf13/jwalterweatherman v1.1.0/go.mod h1:aNWZUN0dPAAO/Ljvb5BEdw96iTZ0EXowPYD95IqWIGo=
 github.com/spf13/pflag v1.0.5 h1:iy+VFUOCP1a+8yFto/drg2CJ5u0yRoB7fZw3DKv/JXA=
 github.com/spf13/pflag v1.0.5/go.mod h1:McXfInJRrz4CZXVZOBLb0bTZqETkiAhM9Iw0y3An2Bg=
-github.com/spf13/viper v1.7.0/go.mod h1:8WkrPz2fc9jxqZNCJI/76HCieCp4Q8HaLFoCha5qpdg=
-github.com/spf13/viper v1.7.1 h1:pM5oEahlgWv/WnHXpgbKz7iLIxRf65tye2Ci+XFK5sk=
-github.com/spf13/viper v1.7.1/go.mod h1:8WkrPz2fc9jxqZNCJI/76HCieCp4Q8HaLFoCha5qpdg=
+github.com/spf13/viper v1.11.0 h1:7OX/1FS6n7jHD1zGrZTM7WtY13ZELRyosK4k93oPr44=
+github.com/spf13/viper v1.11.0/go.mod h1:djo0X/bA5+tYVoCn+C7cAYJGcVn/qYLFTG8gdUsX7Zk=
 github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
-github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
 github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
-github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0Q=
-github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI=
+github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
+github.com/stretchr/testify v1.5.1/go.mod h1:5W2xD1RspED5o8YsWQXVCued0rvSQ+mT+I5cxcmMvtA=
+github.com/stretchr/testify v1.7.0/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
+github.com/stretchr/testify v1.7.1 h1:5TQK59W5E3v0r2duFAb7P95B6hEeOyEnHRa8MjYSMTY=
+github.com/stretchr/testify v1.7.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
 github.com/subosito/gotenv v1.2.0 h1:Slr1R9HxAlEKefgq5jn9U+DnETlIUa6HfgEzj0g5d7s=
 github.com/subosito/gotenv v1.2.0/go.mod h1:N0PQaV/YGNqwC0u51sEeR/aUtSLEXKX9iv69rRypqCw=
-github.com/tmc/grpc-websocket-proxy v0.0.0-20190109142713-0ad062ec5ee5/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U=
-github.com/xiang90/probing v0.0.0-20190116061207-43a291ad63a2/go.mod h1:UETIi67q53MR2AWcXfiuqkDkRtnGDLqkBTpCHuJHxtU=
-go.etcd.io/bbolt v1.3.2/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU=
+github.com/yuin/goldmark v1.1.25/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
+github.com/yuin/goldmark v1.1.27/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
+github.com/yuin/goldmark v1.1.32/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
+github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
 go.opencensus.io v0.21.0/go.mod h1:mSImk1erAIZhrmZN+AvHh14ztQfjbGwt4TtuofqLduU=
 go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8=
-go.uber.org/atomic v1.4.0/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE=
-go.uber.org/multierr v1.1.0/go.mod h1:wR5kodmAFQ0UK8QlbwjlSNy0Z68gJhDJUG5sjR94q/0=
-go.uber.org/zap v1.10.0/go.mod h1:vwi/ZaCAaUcBkycHslxD9B2zi4UTXhF60s6SWpuDF0Q=
-golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
-golang.org/x/crypto v0.0.0-20181029021203-45a5f77698d3/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
+go.opencensus.io v0.22.2/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw=
+go.opencensus.io v0.22.3/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw=
+go.opencensus.io v0.22.4/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw=
+go.opencensus.io v0.22.5/go.mod h1:5pWMHQbX5EPX2/62yrJeAkowc+lfs/XD7Uxpq3pI6kk=
 golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
 golang.org/x/crypto v0.0.0-20190510104115-cbcb75029529/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
 golang.org/x/crypto v0.0.0-20190605123033-f99c8df09eb5/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
+golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
+golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
+golang.org/x/crypto v0.0.0-20210421170649-83a5a9bb288b/go.mod h1:T9bdIzuCu7OtxOm1hfPfRQxPLYneinmdGuTeoZ9dtd4=
+golang.org/x/crypto v0.0.0-20211108221036-ceb1ce70b4fa/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc=
 golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
 golang.org/x/exp v0.0.0-20190306152737-a1d7652674e8/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
 golang.org/x/exp v0.0.0-20190510132918-efd6b22b2522/go.mod h1:ZjyILWgesfNpC6sMxTJOJm9Kp84zZh5NQWvqDGG3Qr8=
 golang.org/x/exp v0.0.0-20190829153037-c13cbed26979/go.mod h1:86+5VVa7VpoJ4kLfm080zCjGlMRFzhUhsZKEZO7MGek=
 golang.org/x/exp v0.0.0-20191030013958-a1ab85dbe136/go.mod h1:JXzH8nQsPlswgeRAPE3MuO9GYsAcnJvJ4vnMwN/5qkY=
+golang.org/x/exp v0.0.0-20191129062945-2f5052295587/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4=
+golang.org/x/exp v0.0.0-20191227195350-da58074b4299/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4=
+golang.org/x/exp v0.0.0-20200119233911-0405dc783f0a/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4=
+golang.org/x/exp v0.0.0-20200207192155-f17229e696bd/go.mod h1:J/WKrq2StrnmMY6+EHIKF9dgMWnmCNThgcyBT1FY9mM=
+golang.org/x/exp v0.0.0-20200224162631-6cc2880d07d6/go.mod h1:3jZMyOhIsHpP37uCMkUooju7aAi5cS1Q23tOzKc+0MU=
 golang.org/x/image v0.0.0-20190227222117-0694c2d4d067/go.mod h1:kZ7UVZpmo3dzQBMxlp+ypCbDeSB+sBbTgSJuh5dn5js=
 golang.org/x/image v0.0.0-20190802002840-cff245a6509b/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0=
 golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
@@ -222,16 +222,22 @@ golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHl
 golang.org/x/lint v0.0.0-20190409202823-959b441ac422/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
 golang.org/x/lint v0.0.0-20190909230951-414d861bb4ac/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
 golang.org/x/lint v0.0.0-20190930215403-16217165b5de/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
+golang.org/x/lint v0.0.0-20191125180803-fdd1cda4f05f/go.mod h1:5qLYkcX4OjUUV8bRuDixDT3tpyyb+LUpUlRWLxfhWrs=
+golang.org/x/lint v0.0.0-20200130185559-910be7a94367/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY=
+golang.org/x/lint v0.0.0-20200302205851-738671d3881b/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY=
+golang.org/x/lint v0.0.0-20201208152925-83fdc39ff7b5/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY=
 golang.org/x/mobile v0.0.0-20190312151609-d3739f865fa6/go.mod h1:z+o9i4GpDbdi3rU15maQ/Ox0txvL9dWGYEHz965HBQE=
 golang.org/x/mobile v0.0.0-20190719004257-d2bd2a29d028/go.mod h1:E/iHnbuqvinMTCcRqshq8CkpyQDoeVncDDYHnLhea+o=
 golang.org/x/mod v0.0.0-20190513183733-4bf6d317e70e/go.mod h1:mXi4GBBbnImb6dmsKGUJ2LatrhH/nqhxcFungHvyanc=
 golang.org/x/mod v0.1.0/go.mod h1:0QHyrYULN0/3qlju5TqG8bIK38QM8yzMo5ekMj3DlcY=
+golang.org/x/mod v0.1.1-0.20191105210325-c90efee705ee/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg=
+golang.org/x/mod v0.1.1-0.20191107180719-034126e5016b/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg=
+golang.org/x/mod v0.2.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
+golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
+golang.org/x/mod v0.4.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
+golang.org/x/mod v0.4.1/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
 golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
 golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
-golang.org/x/net v0.0.0-20181023162649-9b4f9f5ad519/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
-golang.org/x/net v0.0.0-20181114220301-adae6a3d119a/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
-golang.org/x/net v0.0.0-20181201002055-351d144fa1fc/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
-golang.org/x/net v0.0.0-20181220203305-927f97764cc3/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
 golang.org/x/net v0.0.0-20190108225652-1e06a53dbb7e/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
 golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
 golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
@@ -240,20 +246,47 @@ golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn
 golang.org/x/net v0.0.0-20190503192946-f4e77d36d62c/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
 golang.org/x/net v0.0.0-20190603091049-60506f45cf65/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks=
 golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20190628185345-da137c7871d7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20190724013045-ca1201d0de80/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20191209160850-c0dbc17a3553/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20200114155413-6afb5195e5aa/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20200202094626-16171245cfb2/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20200222125558-5a598a2470a0/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20200226121028-0de0cce0169b/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20200301022130-244492dfa37a/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20200324143707-d3edc9973b7e/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
+golang.org/x/net v0.0.0-20200501053045-e0ff5e5a1de5/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
+golang.org/x/net v0.0.0-20200506145744-7e3656a0809f/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
+golang.org/x/net v0.0.0-20200513185701-a91f0712d120/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
+golang.org/x/net v0.0.0-20200520182314-0ba52f642ac2/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
+golang.org/x/net v0.0.0-20200625001655-4c5254603344/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA=
+golang.org/x/net v0.0.0-20200707034311-ab3426394381/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA=
+golang.org/x/net v0.0.0-20200822124328-c89045814202/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA=
+golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU=
+golang.org/x/net v0.0.0-20201031054903-ff519b6c9102/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU=
+golang.org/x/net v0.0.0-20201209123823-ac852fbbde11/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg=
+golang.org/x/net v0.0.0-20201224014010-6772e930b67b/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg=
+golang.org/x/net v0.0.0-20210226172049-e18ecbb05110/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg=
 golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
 golang.org/x/oauth2 v0.0.0-20190226205417-e64efc72b421/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
 golang.org/x/oauth2 v0.0.0-20190604053449-0f29369cfe45/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
+golang.org/x/oauth2 v0.0.0-20191202225959-858c2ad4c8b6/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
+golang.org/x/oauth2 v0.0.0-20200107190931-bf48bf16ab8d/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
+golang.org/x/oauth2 v0.0.0-20200902213428-5d25da1a8d43/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.0.0-20201109201403-9fd604954f58/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.0.0-20201208152858-08078c50e5b5/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.0.0-20210218202405-ba52d332ba99/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
 golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
-golang.org/x/sys v0.0.0-20180823144017-11551d06cbcc/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sync v0.0.0-20190911185100-cd5d95a43a6e/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20200317015054-43a5402ce75a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20200625203802-6e8e738ad208/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20201207232520-09787c993a3a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
-golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
-golang.org/x/sys v0.0.0-20181026203630-95b1ffbd15a5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
-golang.org/x/sys v0.0.0-20181107165924-66b7b1311ac8/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
-golang.org/x/sys v0.0.0-20181116152217-5ac8a444bdc5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
 golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
 golang.org/x/sys v0.0.0-20190312061237-fead79001313/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
@@ -261,43 +294,127 @@ golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7w
 golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190606165138-5da285871e9c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190624142023-c5567b49c5d0/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190726091711-fc99dfbffb4e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20191001151750-bb3f8db39f24/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20191204072324-ce4227a45e2e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20191228213918-04cbcbbfeed8/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200113162924-86b910548bc1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20200116001909-b77594299b42/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200122134326-e047566fdf82/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200202164722-d101bd2416d5/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200212091648-12a6c2dcc1e4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
-golang.org/x/sys v0.0.0-20210331175145-43e1dd70ce54 h1:rF3Ohx8DRyl8h2zw9qojyLHLhrJpEMgyPOImREEryf0=
+golang.org/x/sys v0.0.0-20200302150141-5c8b2ff67527/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200331124033-c3d80250170d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200501052902-10377860bb8e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200511232937-7e40ca221e25/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200515095857-1151b9dac4a9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200523222454-059865788121/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200803210538-64077c9b5642/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200905004654-be1d3432aa8f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20201201145000-ef89a241ccb3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210104204734-6f8348627aad/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210119212857-b64e53b001e4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210225134936-a50acf3fe073/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20210331175145-43e1dd70ce54/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210423185535-09eb48e85fd7/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210630005230-0f9fa26af87c/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210927094055-39ccf1dd6fa6/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20220412211240-33da011f77ad h1:ntjMns5wyP/fN65tdBD4g8J5w8n015+iIIs9rtjXkY0=
+golang.org/x/sys v0.0.0-20220412211240-33da011f77ad/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo=
+golang.org/x/text v0.0.0-20170915032832-14c0d48ead0c/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
 golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
 golang.org/x/text v0.3.1-0.20180807135948-17ff2d5776d2/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
-golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs=
 golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
+golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
+golang.org/x/text v0.3.4/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
+golang.org/x/text v0.3.7 h1:olpwvP2KacW1ZWvsR7uQhoyTYvKAupfQrRGBFM352Gk=
+golang.org/x/text v0.3.7/go.mod h1:u+2+/6zg+i71rQMx5EYifcz6MCKuco9NR6JIITiCfzQ=
 golang.org/x/time v0.0.0-20181108054448-85acf8d2951c/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
 golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
-golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+golang.org/x/time v0.0.0-20191024005414-555d28b269f0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
 golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
 golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
 golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY=
 golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
 golang.org/x/tools v0.0.0-20190312151545-0bb0c0a6e846/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
 golang.org/x/tools v0.0.0-20190312170243-e65039ee4138/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
-golang.org/x/tools v0.0.0-20190328211700-ab21143f2384/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
 golang.org/x/tools v0.0.0-20190425150028-36563e24a262/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
 golang.org/x/tools v0.0.0-20190506145303-2d16b83fe98c/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
+golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
 golang.org/x/tools v0.0.0-20190606124116-d0a3d012864b/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc=
 golang.org/x/tools v0.0.0-20190621195816-6e04913cbbac/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc=
 golang.org/x/tools v0.0.0-20190628153133-6cdbf07be9d0/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc=
 golang.org/x/tools v0.0.0-20190816200558-6889da9d5479/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
 golang.org/x/tools v0.0.0-20190911174233-4f2ddba30aff/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
 golang.org/x/tools v0.0.0-20191012152004-8de300cfc20a/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
-golang.org/x/tools v0.0.0-20191112195655-aa38f8e97acc/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20191113191852-77e3bb0ad9e7/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20191115202509-3a792d9c32b2/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20191119224855-298f0cb1881e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20191125144606-a911d9008d1f/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20191130070609-6e064ea0cf2d/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20191216173652-a0e659d51361/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20191227053925-7b8e75db28f4/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200117161641-43d50277825c/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200122220014-bf1340f18c4a/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200130002326-2f3ba24bd6e7/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200204074204-1cc6d1ef6c74/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200207183749-b753a1ba74fa/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200212150539-ea181f53ac56/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200224181240-023911ca70b2/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200227222343-706bc42d1f0d/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200304193943-95d2e580d8eb/go.mod h1:o4KQGtdN14AW+yjsvvwRTJJuXz8XRtIHtEnmAXLyFUw=
+golang.org/x/tools v0.0.0-20200312045724-11d5b4c81c7d/go.mod h1:o4KQGtdN14AW+yjsvvwRTJJuXz8XRtIHtEnmAXLyFUw=
+golang.org/x/tools v0.0.0-20200331025713-a30bf2db82d4/go.mod h1:Sl4aGygMT6LrqrWclx+PTx3U+LnKx/seiNR+3G19Ar8=
+golang.org/x/tools v0.0.0-20200501065659-ab2804fb9c9d/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE=
+golang.org/x/tools v0.0.0-20200512131952-2bc93b1c0c88/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE=
+golang.org/x/tools v0.0.0-20200515010526-7d3b6ebf133d/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE=
+golang.org/x/tools v0.0.0-20200618134242-20370b0cb4b2/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE=
+golang.org/x/tools v0.0.0-20200729194436-6467de6f59a7/go.mod h1:njjCfa9FT2d7l9Bc6FUM5FLjQPp3cFF28FI3qnDFljA=
+golang.org/x/tools v0.0.0-20200804011535-6c149bb5ef0d/go.mod h1:njjCfa9FT2d7l9Bc6FUM5FLjQPp3cFF28FI3qnDFljA=
+golang.org/x/tools v0.0.0-20200825202427-b303f430e36d/go.mod h1:njjCfa9FT2d7l9Bc6FUM5FLjQPp3cFF28FI3qnDFljA=
+golang.org/x/tools v0.0.0-20200904185747-39188db58858/go.mod h1:Cj7w3i3Rnn0Xh82ur9kSqwfTHTeVxaDqrfMjpcNT6bE=
+golang.org/x/tools v0.0.0-20201110124207-079ba7bd75cd/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
+golang.org/x/tools v0.0.0-20201201161351-ac6f37ff4c2a/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
+golang.org/x/tools v0.0.0-20201208233053-a543418bbed2/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
+golang.org/x/tools v0.0.0-20210105154028-b0ab187a4818/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
+golang.org/x/tools v0.0.0-20210108195828-e2f9c7f1fc8e/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
+golang.org/x/tools v0.1.0/go.mod h1:xkSsbof2nBLbhDlRMhhhyNLN/zl3eTqcnHD5viDpcZ0=
 golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
+golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
+golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
+golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
 google.golang.org/api v0.4.0/go.mod h1:8k5glujaEP+g9n7WNsDg8QP6cUVNI86fCNMcbazEtwE=
 google.golang.org/api v0.7.0/go.mod h1:WtwebWUNSVBH/HAw79HIFXZNqEvBhG+Ra+ax0hx3E3M=
 google.golang.org/api v0.8.0/go.mod h1:o4eAsZoiT+ibD93RtjEohWalFOjRDx6CVaqeizhEnKg=
 google.golang.org/api v0.9.0/go.mod h1:o4eAsZoiT+ibD93RtjEohWalFOjRDx6CVaqeizhEnKg=
 google.golang.org/api v0.13.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI=
+google.golang.org/api v0.14.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI=
+google.golang.org/api v0.15.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI=
+google.golang.org/api v0.17.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
+google.golang.org/api v0.18.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
+google.golang.org/api v0.19.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
+google.golang.org/api v0.20.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
+google.golang.org/api v0.22.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
+google.golang.org/api v0.24.0/go.mod h1:lIXQywCXRcnZPGlsd8NbLnOjtAoL6em04bJ9+z0MncE=
+google.golang.org/api v0.28.0/go.mod h1:lIXQywCXRcnZPGlsd8NbLnOjtAoL6em04bJ9+z0MncE=
+google.golang.org/api v0.29.0/go.mod h1:Lcubydp8VUV7KeIHD9z2Bys/sm/vGKnG1UHuDBSrHWM=
+google.golang.org/api v0.30.0/go.mod h1:QGmEvQ87FHZNiUVJkT14jQNYJ4ZJjdRF23ZXz5138Fc=
+google.golang.org/api v0.35.0/go.mod h1:/XrVsuzM0rZmrsbjJutiuftIzeuTQcEeaYcSk/mQ1dg=
+google.golang.org/api v0.36.0/go.mod h1:+z5ficQTmoYpPn8LCUNVpK5I7hwkpjbcgqA7I34qYtE=
+google.golang.org/api v0.40.0/go.mod h1:fYKFpnQN0DsDSKRVRcQSDQNtqWPfM9i+zNPxepjRCQ8=
 google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
 google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
 google.golang.org/appengine v1.5.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
 google.golang.org/appengine v1.6.1/go.mod h1:i06prIuMbXzDqacNJfV5OdTW448YApPu5ww/cMBSeb0=
+google.golang.org/appengine v1.6.5/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc=
+google.golang.org/appengine v1.6.6/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc=
+google.golang.org/appengine v1.6.7/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc=
 google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
 google.golang.org/genproto v0.0.0-20190307195333-5fe7a883aa19/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
 google.golang.org/genproto v0.0.0-20190418145605-e7d98fc518a7/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
@@ -307,24 +424,78 @@ google.golang.org/genproto v0.0.0-20190801165951-fa694d86fc64/go.mod h1:DMBHOl98
 google.golang.org/genproto v0.0.0-20190819201941-24fa4b261c55/go.mod h1:DMBHOl98Agz4BDEuKkezgsaosCRResVns1a3J2ZsMNc=
 google.golang.org/genproto v0.0.0-20190911173649-1774047e7e51/go.mod h1:IbNlFCBrqXvoKpeg0TB2l7cyZUmoaFKYIwrEpbDKLA8=
 google.golang.org/genproto v0.0.0-20191108220845-16a3f7862a1a/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
+google.golang.org/genproto v0.0.0-20191115194625-c23dd37a84c9/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
+google.golang.org/genproto v0.0.0-20191216164720-4f79533eabd1/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
+google.golang.org/genproto v0.0.0-20191230161307-f3c370f40bfb/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
+google.golang.org/genproto v0.0.0-20200115191322-ca5a22157cba/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
+google.golang.org/genproto v0.0.0-20200122232147-0452cf42e150/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
+google.golang.org/genproto v0.0.0-20200204135345-fa8e72b47b90/go.mod h1:GmwEX6Z4W5gMy59cAlVYjN9JhxgbQH6Gn+gFDQe2lzA=
+google.golang.org/genproto v0.0.0-20200212174721-66ed5ce911ce/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200224152610-e50cd9704f63/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200228133532-8c2c7df3a383/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200305110556-506484158171/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200312145019-da6875a35672/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200331122359-1ee6d9798940/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200430143042-b979b6f78d84/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200511104702-f5ebc3bea380/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200515170657-fc4c6c6a6587/go.mod h1:YsZOwe1myG/8QRHRsmBRE1LrgQY60beZKjly0O1fX9U=
+google.golang.org/genproto v0.0.0-20200526211855-cb27e3aa2013/go.mod h1:NbSheEEYHJ7i3ixzK3sjbqSGDJWnxyFXZblF3eUsNvo=
+google.golang.org/genproto v0.0.0-20200618031413-b414f8b61790/go.mod h1:jDfRM7FcilCzHH/e9qn6dsT145K34l5v+OpcnNgKAAA=
+google.golang.org/genproto v0.0.0-20200729003335-053ba62fc06f/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20200804131852-c06518451d9c/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20200825200019-8632dd797987/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20200904004341-0bd0a958aa1d/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20201109203340-2640f1f9cdfb/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20201201144952-b05cb90ed32e/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20201210142538-e3217bee35cc/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20201214200347-8c77b98c765d/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20210108203827-ffc7fda8c3d7/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20210226172003-ab064af71705/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
 google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c=
 google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38=
 google.golang.org/grpc v1.21.1/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM=
-gopkg.in/alecthomas/kingpin.v2 v2.2.6/go.mod h1:FMv+mEhP44yOT+4EoQTLFTRgOQ1FBLkstjWtayDeSgw=
+google.golang.org/grpc v1.23.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg=
+google.golang.org/grpc v1.25.1/go.mod h1:c3i+UQWmh7LiEpx4sFZnkU36qjEYZ0imhYfXVyQciAY=
+google.golang.org/grpc v1.26.0/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk=
+google.golang.org/grpc v1.27.0/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk=
+google.golang.org/grpc v1.27.1/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk=
+google.golang.org/grpc v1.28.0/go.mod h1:rpkK4SK4GF4Ach/+MFLZUBavHOvF2JJB5uozKKal+60=
+google.golang.org/grpc v1.29.1/go.mod h1:itym6AZVZYACWQqET3MqgPpjcuV5QH3BxFS3IjizoKk=
+google.golang.org/grpc v1.30.0/go.mod h1:N36X2cJ7JwdamYAgDz+s+rVMFjt3numwzf/HckM8pak=
+google.golang.org/grpc v1.31.0/go.mod h1:N36X2cJ7JwdamYAgDz+s+rVMFjt3numwzf/HckM8pak=
+google.golang.org/grpc v1.31.1/go.mod h1:N36X2cJ7JwdamYAgDz+s+rVMFjt3numwzf/HckM8pak=
+google.golang.org/grpc v1.33.2/go.mod h1:JMHMWHQWaTccqQQlmk3MJZS+GWXOdAesneDmEnv2fbc=
+google.golang.org/grpc v1.34.0/go.mod h1:WotjhfgOW/POjDeRt8vscBtXq+2VjORFy659qA51WJ8=
+google.golang.org/grpc v1.35.0/go.mod h1:qjiiYl8FncCW8feJPdyg3v6XW24KsRHe+dy9BAGRRjU=
+google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8=
+google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0=
+google.golang.org/protobuf v0.0.0-20200228230310-ab0ca4ff8a60/go.mod h1:cfTl7dwQJ+fmap5saPgwCLgHXTUD7jkjRqWcaiX5VyM=
+google.golang.org/protobuf v1.20.1-0.20200309200217-e05f789c0967/go.mod h1:A+miEFZTKqfCUM6K7xSMQL9OKL/b6hQv+e19PK+JZNE=
+google.golang.org/protobuf v1.21.0/go.mod h1:47Nbq4nVaFHyn7ilMalzfO3qCViNmqZ2kzikPIcrTAo=
+google.golang.org/protobuf v1.22.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
+google.golang.org/protobuf v1.23.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
+google.golang.org/protobuf v1.23.1-0.20200526195155-81db48ad09cc/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
+google.golang.org/protobuf v1.24.0/go.mod h1:r/3tXBNzIEhYS9I1OUVjXDlt8tc493IdKGjtUeSXeh4=
+google.golang.org/protobuf v1.25.0/go.mod h1:9JNX74DMeImyA3h4bdi1ymwjUzf21/xIlbajtzgsN7c=
 gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
 gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127 h1:qIbj1fsPNlZgppZ+VLlY7N33q108Sa+fhmuc+sWQYwY=
 gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
 gopkg.in/errgo.v2 v2.1.0/go.mod h1:hNsd1EY+bozCKY1Ytp96fpM3vjJbqLJn88ws8XvfDNI=
-gopkg.in/ini.v1 v1.51.0 h1:AQvPpx3LzTDM0AjnIRlVFwFFGC+npRopjZxLJj6gdno=
-gopkg.in/ini.v1 v1.51.0/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k=
-gopkg.in/resty.v1 v1.12.0/go.mod h1:mDo4pnntr5jdWRML875a/NmxYqAlA73dVijT2AXvQQo=
-gopkg.in/yaml.v2 v2.0.0-20170812160011-eb3733d160e7/go.mod h1:JAlM8MvJe8wmxCU4Bli9HhUf9+ttbYbLASfIpnQbh74=
-gopkg.in/yaml.v2 v2.2.1/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
-gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
+gopkg.in/ini.v1 v1.66.4 h1:SsAcf+mM7mRZo2nJNGt8mZCjG8ZRaNGMURJw7BsIST4=
+gopkg.in/ini.v1 v1.66.4/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k=
+gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
 gopkg.in/yaml.v2 v2.4.0 h1:D8xgwECY7CYvx+Y2n4sBz93Jn9JRvxdiyyo8CTfuKaY=
 gopkg.in/yaml.v2 v2.4.0/go.mod h1:RDklbk79AGWmwhnvt/jBztapEOGDOx6ZbXqjP6csGnQ=
+gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
+gopkg.in/yaml.v3 v3.0.0-20210107192922-496545a6307b h1:h8qDotaEPuJATrMmW04NCwg7v22aHH28wwpauUhK9Oo=
+gopkg.in/yaml.v3 v3.0.0-20210107192922-496545a6307b/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
 honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
 honnef.co/go/tools v0.0.0-20190106161140-3f1c8253044a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
 honnef.co/go/tools v0.0.0-20190418001031-e561f6794a2a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
+honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
 honnef.co/go/tools v0.0.1-2019.2.3/go.mod h1:a3bituU0lyd329TUQxRnasdCoJDkEUEAqEt0JzvZhAg=
+honnef.co/go/tools v0.0.1-2020.1.3/go.mod h1:X/FiERA/W4tHapMX5mGpAtMSVEeEUOyHaw9vFzvIQ3k=
+honnef.co/go/tools v0.0.1-2020.1.4/go.mod h1:X/FiERA/W4tHapMX5mGpAtMSVEeEUOyHaw9vFzvIQ3k=
 rsc.io/binaryregexp v0.2.0/go.mod h1:qTv7/COck+e2FymRvadv62gMdZztPaShugOCi3I+8D8=
+rsc.io/quote/v3 v3.1.0/go.mod h1:yEA65RcK8LyAZtP9Kv3t0HmxON59tX3rD+tICJqUlj0=
+rsc.io/sampler v1.3.0/go.mod h1:T1hPZKmBbMNahiBKFy5HrXp6adAjACjK9JXDnKaTXpA=

install.sh

@@ -31,7 +31,7 @@ else
 fi
 echo $ARCH
 
-curl -s https://api.github.com/repos/cupcakearmy/autorestic/releases/latest \
+wget -qO - https://api.github.com/repos/cupcakearmy/autorestic/releases/latest \
 | grep "browser_download_url.*_${OS}_${ARCH}" \
 | cut -d : -f 2,3 \
 | tr -d \" \

internal/backend.go

@@ -9,21 +9,22 @@ import (
 	"strings"
 
 	"github.com/cupcakearmy/autorestic/internal/colors"
+	"github.com/cupcakearmy/autorestic/internal/flags"
 )
 
 type BackendRest struct {
-	User     string `yaml:"user,omitempty"`
-	Password string `yaml:"password,omitempty"`
+	User     string `mapstructure:"user,omitempty"`
+	Password string `mapstructure:"password,omitempty"`
 }
 
 type Backend struct {
 	name    string
-	Type    string            `yaml:"type,omitempty"`
-	Path    string            `yaml:"path,omitempty"`
-	Key     string            `yaml:"key,omitempty"`
-	Env     map[string]string `yaml:"env,omitempty"`
-	Rest    BackendRest       `yaml:"rest,omitempty"`
-	Options Options           `yaml:"options,omitempty"`
+	Type    string            `mapstructure:"type,omitempty"`
+	Path    string            `mapstructure:"path,omitempty"`
+	Key     string            `mapstructure:"key,omitempty"`
+	Env     map[string]string `mapstructure:"env,omitempty"`
+	Rest    BackendRest       `mapstructure:"rest,omitempty"`
+	Options Options           `mapstructure:"options,omitempty"`
 }
 
 func GetBackend(name string) (Backend, bool) {
@@ -58,20 +59,27 @@ func (b Backend) generateRepo() (string, error) {
 
 func (b Backend) getEnv() (map[string]string, error) {
 	env := make(map[string]string)
+	// Key
 	if b.Key != "" {
 		env["RESTIC_PASSWORD"] = b.Key
-	} else {
-		key, err := b.getKey()
-		if err != nil {
-			return nil, err
-		}
-		env["RESTIC_PASSWORD"] = key
 	}
+
+	// From config file
 	repo, err := b.generateRepo()
 	env["RESTIC_REPOSITORY"] = repo
 	for key, value := range b.Env {
 		env[strings.ToUpper(key)] = value
 	}
+
+	// From Envfile and passed as env
+	var prefix = "AUTORESTIC_" + strings.ToUpper(b.name) + "_"
+	for _, variable := range os.Environ() {
+		var splitted = strings.SplitN(variable, "=", 2)
+		if strings.HasPrefix(splitted[0], prefix) {
+			env[strings.TrimPrefix(splitted[0], prefix)] = splitted[1]
+		}
+	}
+
 	return env, err
 }
 
@@ -85,17 +93,6 @@ func generateRandomKey() string {
 	return key
 }
 
-func (b Backend) getKey() (string, error) {
-	if b.Key != "" {
-		return b.Key, nil
-	}
-	keyName := "AUTORESTIC_" + strings.ToUpper(b.name) + "_KEY"
-	if key, found := os.LookupEnv(keyName); found {
-		return key, nil
-	}
-	return "", fmt.Errorf("no key found for backend \"%s\"", b.name)
-}
-
 func (b Backend) validate() error {
 	if b.Type == "" {
 		return fmt.Errorf(`Backend "%s" has no "type"`, b.name)
@@ -105,8 +102,9 @@ func (b Backend) validate() error {
 	}
 	if b.Key == "" {
 		// Check if key is set in environment
-		if _, err := b.getKey(); err != nil {
-			// If not generate a new one
+		env, _ := b.getEnv()
+		if _, found := env["RESTIC_PASSWORD"]; !found {
+			// No key set in config file or env => generate random key and save file
 			key := generateRandomKey()
 			b.Key = key
 			c := GetConfig()
@@ -122,18 +120,19 @@ func (b Backend) validate() error {
 	if err != nil {
 		return err
 	}
-	options := ExecuteOptions{Envs: env}
+	options := ExecuteOptions{Envs: env, Silent: true}
 	// Check if already initialized
-	_, err = ExecuteResticCommand(options, "snapshots")
+	cmd := []string{"check"}
+	cmd = append(cmd, combineBackendOptions("check", b)...)
+	_, _, err = ExecuteResticCommand(options, cmd...)
 	if err == nil {
 		return nil
 	} else {
 		// If not initialize
 		colors.Body.Printf("Initializing backend \"%s\"...\n", b.name)
-		out, err := ExecuteResticCommand(options, "init")
-		if VERBOSE {
-			colors.Faint.Println(out)
-		}
+		cmd := []string{"init"}
+		cmd = append(cmd, combineBackendOptions("init", b)...)
+		_, _, err := ExecuteResticCommand(options, cmd...)
 		return err
 	}
 }
@@ -144,46 +143,62 @@ func (b Backend) Exec(args []string) error {
 		return err
 	}
 	options := ExecuteOptions{Envs: env}
-	out, err := ExecuteResticCommand(options, args...)
+	_, out, err := ExecuteResticCommand(options, args...)
 	if err != nil {
 		colors.Error.Println(out)
 		return err
 	}
-	if VERBOSE {
-		colors.Faint.Println(out)
-	}
 	return nil
 }
 
-func (b Backend) ExecDocker(l Location, args []string) (string, error) {
+func (b Backend) ExecDocker(l Location, args []string) (int, string, error) {
 	env, err := b.getEnv()
 	if err != nil {
-		return "", err
+		return -1, "", err
 	}
-	volume := l.getVolumeName()
-	path, _ := l.getPath()
+	volume := l.From[0]
 	options := ExecuteOptions{
 		Command: "docker",
 		Envs:    env,
 	}
+	dir := "/data"
+	args = append([]string{"restic"}, args...)
 	docker := []string{
 		"run", "--rm",
 		"--entrypoint", "ash",
-		"--workdir", path,
-		"--volume", volume + ":" + path,
+		"--workdir", dir,
+		"--volume", volume + ":" + dir,
 	}
+	// Use of docker host, not the container host
 	if hostname, err := os.Hostname(); err == nil {
 		docker = append(docker, "--hostname", hostname)
 	}
-	if b.Type == "local" {
+	switch b.Type {
+	case "local":
 		actual := env["RESTIC_REPOSITORY"]
 		docker = append(docker, "--volume", actual+":"+"/repo")
 		env["RESTIC_REPOSITORY"] = "/repo"
+	case "b2":
+	case "s3":
+	case "azure":
+	case "gs":
+		// No additional setup needed
+	case "rclone":
+		// Read host rclone config and mount it into the container
+		code, configFile, err := ExecuteCommand(ExecuteOptions{Command: "rclone"}, "config", "file")
+		if err != nil {
+			return code, "", err
+		}
+		splitted := strings.Split(strings.TrimSpace(configFile), "\n")
+		configFilePath := splitted[len(splitted)-1]
+		docker = append(docker, "--volume", configFilePath+":"+"/root/.config/rclone/rclone.conf:ro")
+	default:
+		return -1, "", fmt.Errorf("Backend type \"%s\" is not supported as volume endpoint", b.Type)
 	}
 	for key, value := range env {
 		docker = append(docker, "--env", key+"="+value)
 	}
-	docker = append(docker, "restic/restic", "-c", "restic "+strings.Join(args, " "))
-	out, err := ExecuteCommand(options, docker...)
-	return out, err
+
+	docker = append(docker, flags.DOCKER_IMAGE, "-c", strings.Join(args, " "))
+	return ExecuteCommand(options, docker...)
 }

internal/backend_test.go

@@ -0,0 +1,225 @@
+package internal
+
+import (
+	"fmt"
+	"os"
+	"testing"
+
+	"github.com/spf13/viper"
+)
+
+func TestGenerateRepo(t *testing.T) {
+
+	t.Run("empty backend", func(t *testing.T) {
+		b := Backend{
+			name: "empty backend",
+			Type: "",
+		}
+		_, err := b.generateRepo()
+		if err == nil {
+			t.Errorf("Error expected for empty backend type")
+		}
+	})
+
+	t.Run("local backend", func(t *testing.T) {
+		b := Backend{
+			name: "local backend",
+			Type: "local",
+			Path: "/foo/bar",
+		}
+		result, err := b.generateRepo()
+		if err != nil {
+			t.Errorf("unexpected error %v", err)
+		}
+		assertEqual(t, result, "/foo/bar")
+	})
+
+	t.Run("local backend with homedir prefix", func(t *testing.T) {
+		b := Backend{
+			name: "local backend",
+			Type: "local",
+			Path: "~/foo/bar",
+		}
+		result, err := b.generateRepo()
+		if err != nil {
+			t.Errorf("unexpected error %v", err)
+		}
+		assertEqual(t, result, fmt.Sprintf("%s/foo/bar", os.Getenv("HOME")))
+	})
+
+	t.Run("local backend with config file", func(t *testing.T) {
+		// config file path should always be present from initConfig
+		viper.SetConfigFile("/tmp/.autorestic.yml")
+		defer viper.Reset()
+
+		b := Backend{
+			name: "local backend",
+			Type: "local",
+		}
+		result, err := b.generateRepo()
+		if err != nil {
+			t.Errorf("unexpected error %v", err)
+		}
+		assertEqual(t, result, "/tmp")
+	})
+
+	t.Run("rest backend with valid path", func(t *testing.T) {
+		b := Backend{
+			name: "rest backend",
+			Type: "rest",
+			Path: "http://localhost:8000/foo",
+		}
+		result, err := b.generateRepo()
+		if err != nil {
+			t.Errorf("unexpected error %v", err)
+		}
+		assertEqual(t, result, "rest:http://localhost:8000/foo")
+	})
+
+	t.Run("rest backend with user", func(t *testing.T) {
+		b := Backend{
+			name: "rest backend",
+			Type: "rest",
+			Path: "http://localhost:8000/foo",
+			Rest: BackendRest{
+				User:     "user",
+				Password: "",
+			},
+		}
+		result, err := b.generateRepo()
+		if err != nil {
+			t.Errorf("unexpected error %v", err)
+		}
+		assertEqual(t, result, "rest:http://user@localhost:8000/foo")
+	})
+
+	t.Run("rest backend with user and password", func(t *testing.T) {
+		b := Backend{
+			name: "rest backend",
+			Type: "rest",
+			Path: "http://localhost:8000/foo",
+			Rest: BackendRest{
+				User:     "user",
+				Password: "pass",
+			},
+		}
+		result, err := b.generateRepo()
+		if err != nil {
+			t.Errorf("unexpected error %v", err)
+		}
+		assertEqual(t, result, "rest:http://user:pass@localhost:8000/foo")
+	})
+
+	backendTests := []struct {
+		name    string
+		backend Backend
+		want    string
+	}{
+		{name: "b2 backend", backend: Backend{name: "b2", Type: "b2", Path: "foo"}, want: "b2:foo"},
+		{name: "azure backend", backend: Backend{name: "azure", Type: "azure", Path: "foo"}, want: "azure:foo"},
+		{name: "gs backend", backend: Backend{name: "gs", Type: "gs", Path: "foo"}, want: "gs:foo"},
+		{name: "s3 backend", backend: Backend{name: "s3", Type: "s3", Path: "foo"}, want: "s3:foo"},
+		{name: "sftp backend", backend: Backend{name: "sftp", Type: "sftp", Path: "foo"}, want: "sftp:foo"},
+		{name: "rclone backend", backend: Backend{name: "rclone", Type: "rclone", Path: "foo"}, want: "rclone:foo"},
+	}
+
+	for _, tt := range backendTests {
+		t.Run(tt.name, func(t *testing.T) {
+			got, err := tt.backend.generateRepo()
+			if err != nil {
+				t.Errorf("unexpected error %v", err)
+			}
+			assertEqual(t, got, tt.want)
+		})
+	}
+}
+
+func TestGetEnv(t *testing.T) {
+	t.Run("env in key field", func(t *testing.T) {
+		b := Backend{
+			name: "",
+			Type: "local",
+			Path: "/foo/bar",
+			Key:  "secret123",
+		}
+		result, err := b.getEnv()
+		if err != nil {
+			t.Errorf("unexpected error %v", err)
+		}
+		assertEqual(t, result["RESTIC_REPOSITORY"], "/foo/bar")
+		assertEqual(t, result["RESTIC_PASSWORD"], "secret123")
+	})
+
+	t.Run("env in config file", func(t *testing.T) {
+		b := Backend{
+			name: "",
+			Type: "local",
+			Path: "/foo/bar",
+			Env: map[string]string{
+				"B2_ACCOUNT_ID":  "foo123",
+				"B2_ACCOUNT_KEY": "foo456",
+			},
+		}
+		result, err := b.getEnv()
+		if err != nil {
+			t.Errorf("unexpected error %v", err)
+		}
+		assertEqual(t, result["RESTIC_REPOSITORY"], "/foo/bar")
+		assertEqual(t, result["RESTIC_PASSWORD"], "")
+		assertEqual(t, result["B2_ACCOUNT_ID"], "foo123")
+		assertEqual(t, result["B2_ACCOUNT_KEY"], "foo456")
+	})
+
+	t.Run("env in Envfile or env vars", func(t *testing.T) {
+		// generate env variables
+		// TODO better way to teardown
+		defer os.Unsetenv("AUTORESTIC_FOO_RESTIC_PASSWORD")
+		defer os.Unsetenv("AUTORESTIC_FOO_B2_ACCOUNT_ID")
+		defer os.Unsetenv("AUTORESTIC_FOO_B2_ACCOUNT_KEY")
+		os.Setenv("AUTORESTIC_FOO_RESTIC_PASSWORD", "secret123")
+		os.Setenv("AUTORESTIC_FOO_B2_ACCOUNT_ID", "foo123")
+		os.Setenv("AUTORESTIC_FOO_B2_ACCOUNT_KEY", "foo456")
+
+		b := Backend{
+			name: "foo",
+			Type: "local",
+			Path: "/foo/bar",
+		}
+		result, err := b.getEnv()
+		if err != nil {
+			t.Errorf("unexpected error %v", err)
+		}
+		assertEqual(t, result["RESTIC_REPOSITORY"], "/foo/bar")
+		assertEqual(t, result["RESTIC_PASSWORD"], "secret123")
+		assertEqual(t, result["B2_ACCOUNT_ID"], "foo123")
+		assertEqual(t, result["B2_ACCOUNT_KEY"], "foo456")
+	})
+}
+
+func TestValidate(t *testing.T) {
+	t.Run("no type given", func(t *testing.T) {
+		b := Backend{
+			name: "foo",
+			Type: "",
+			Path: "/foo/bar",
+		}
+		err := b.validate()
+		if err == nil {
+			t.Error("expected to get error")
+		}
+		assertEqual(t, err.Error(), "Backend \"foo\" has no \"type\"")
+	})
+
+	t.Run("no path given", func(t *testing.T) {
+		b := Backend{
+			name: "foo",
+			Type: "local",
+			Path: "",
+		}
+		err := b.validate()
+		if err == nil {
+			t.Error("expected to get error")
+		}
+		assertEqual(t, err.Error(), "Backend \"foo\" has no \"path\"")
+	})
+}

internal/bins/bins.go

@@ -16,6 +16,7 @@ import (
 	"github.com/blang/semver/v4"
 	"github.com/cupcakearmy/autorestic/internal"
 	"github.com/cupcakearmy/autorestic/internal/colors"
+	"github.com/cupcakearmy/autorestic/internal/flags"
 )
 
 const INSTALL_PATH = "/usr/local/bin"
@@ -47,11 +48,11 @@ func dlJSON(url string) (GithubRelease, error) {
 
 func Uninstall(restic bool) error {
 	if err := os.Remove(path.Join(INSTALL_PATH, "autorestic")); err != nil {
-		colors.Error.Println(err)
+		return err
 	}
 	if restic {
 		if err := os.Remove(path.Join(INSTALL_PATH, "restic")); err != nil {
-			colors.Error.Println(err)
+			return err
 		}
 	}
 	return nil
@@ -79,13 +80,31 @@ func downloadAndInstallAsset(body GithubRelease, name string) error {
 				return err
 			}
 			defer tmp.Close()
-			tmp.Chmod(0755)
-			io.Copy(tmp, bz)
+			if err := tmp.Chmod(0755); err != nil {
+				return err
+			}
+			if _, err := io.Copy(tmp, bz); err != nil {
+				return err
+			}
 
 			to := path.Join(INSTALL_PATH, name)
-			os.Remove(to) // Delete if current, ignore error if file does not exits.
+			defer os.Remove(tmp.Name()) // Cleanup temporary file after thread exits
 			if err := os.Rename(tmp.Name(), to); err != nil {
-				return nil
+				colors.Error.Printf("os.Rename() failed (%v), retrying with io.Copy()\n", err.Error())
+				var src *os.File
+				var dst *os.File
+				if src, err = os.Open(tmp.Name()); err != nil {
+					return err
+				}
+				if dst, err = os.Create(to); err != nil {
+					return err
+				}
+				if _, err := io.Copy(dst, src); err != nil {
+					return err
+				}
+				if err := os.Chmod(to, 0755); err != nil {
+					return err
+				}
 			}
 
 			colors.Success.Printf("Successfully installed '%s' under %s\n", name, INSTALL_PATH)
@@ -110,10 +129,9 @@ func InstallRestic() error {
 }
 
 func upgradeRestic() error {
-	out, err := internal.ExecuteCommand(internal.ExecuteOptions{
-		Command: "restic",
+	_, _, err := internal.ExecuteCommand(internal.ExecuteOptions{
+		Command: flags.RESTIC_BIN,
 	}, "self-update")
-	colors.Faint.Println(out)
 	return err
 }
 
@@ -121,9 +139,11 @@ func Upgrade(restic bool) error {
 	// Upgrade restic
 	if restic {
 		if err := InstallRestic(); err != nil {
-			colors.Error.Println(err)
+			return err
+		}
+		if err := upgradeRestic(); err != nil {
+			return err
 		}
-		upgradeRestic()
 	}
 
 	// Upgrade self
@@ -140,7 +160,9 @@ func Upgrade(restic bool) error {
 		return err
 	}
 	if current.LT(latest) {
-		downloadAndInstallAsset(body, "autorestic")
+		if err := downloadAndInstallAsset(body, "autorestic"); err != nil {
+			return err
+		}
 		colors.Success.Println("Updated autorestic")
 	} else {
 		colors.Body.Println("Already up to date")

internal/config.go

@@ -9,6 +9,7 @@ import (
 	"sync"
 
 	"github.com/cupcakearmy/autorestic/internal/colors"
+	"github.com/cupcakearmy/autorestic/internal/flags"
 	"github.com/cupcakearmy/autorestic/internal/lock"
 	"github.com/joho/godotenv"
 	"github.com/mitchellh/go-homedir"
@@ -16,44 +17,80 @@ import (
 	"github.com/spf13/viper"
 )
 
-const VERSION = "1.3.0"
+const VERSION = "1.7.4"
 
-var CI bool = false
-var VERBOSE bool = false
-var CRON_LEAN bool = false
+type OptionMap map[string][]interface{}
+type Options map[string]OptionMap
 
 type Config struct {
-	Extras    interface{}         `yaml:"extras"`
-	Locations map[string]Location `yaml:"locations"`
-	Backends  map[string]Backend  `yaml:"backends"`
+	Version   string              `mapstructure:"version"`
+	Extras    interface{}         `mapstructure:"extras"`
+	Locations map[string]Location `mapstructure:"locations"`
+	Backends  map[string]Backend  `mapstructure:"backends"`
+	Global    Options             `mapstructure:"global"`
 }
 
 var once sync.Once
 var config *Config
 
+func exitConfig(err error, msg string) {
+	if err != nil {
+		colors.Error.Println(err)
+	}
+	if msg != "" {
+		colors.Error.Println(msg)
+	}
+	lock.Unlock()
+	os.Exit(1)
+}
+
 func GetConfig() *Config {
+
 	if config == nil {
 		once.Do(func() {
 			if err := viper.ReadInConfig(); err == nil {
-				if !CRON_LEAN {
 				absConfig, _ := filepath.Abs(viper.ConfigFileUsed())
+				if !flags.CRON_LEAN {
 					colors.Faint.Println("Using config: \t", absConfig)
+				}
 				// Load env file
 				envFile := filepath.Join(filepath.Dir(absConfig), ".autorestic.env")
 				err = godotenv.Load(envFile)
-					if err == nil {
+				if err == nil && !flags.CRON_LEAN {
 					colors.Faint.Println("Using env:\t", envFile)
 				}
-				}
 			} else {
-				return
+				text := err.Error()
+				if strings.Contains(text, "no such file or directory") {
+					cfgFileName := ".autorestic"
+					colors.Error.Println(
+						fmt.Sprintf(
+							"cannot find configuration file '%s.yml' or '%s.yaml'.",
+							cfgFileName, cfgFileName))
+				} else {
+					colors.Error.Println("could not load config file\n" + text)
+				}
+				os.Exit(1)
+			}
+
+			var versionConfig interface{}
+			viper.UnmarshalKey("version", &versionConfig)
+			if versionConfig == nil {
+				exitConfig(nil, "no version specified in config file. please see docs on how to migrate")
+			}
+			version, ok := versionConfig.(int)
+			if !ok {
+				exitConfig(nil, "version specified in config file is not an int")
+			} else {
+				// Check for version
+				if version != 2 {
+					exitConfig(nil, "unsupported config version number. please check the docs for migration\nhttps://autorestic.vercel.app/migration/")
+				}
 			}
 
 			config = &Config{}
 			if err := viper.UnmarshalExact(config); err != nil {
-				colors.Error.Println("Could not parse config file!")
-				lock.Unlock()
-				os.Exit(1)
+				exitConfig(err, "Could not parse config file!")
 			}
 		})
 	}
@@ -77,7 +114,11 @@ func (c *Config) Describe() {
 		var tmp string
 		colors.PrimaryPrint(`Location: "%s"`, name)
 
-		colors.PrintDescription("From", l.From)
+		tmp = ""
+		for _, path := range l.From {
+			tmp += fmt.Sprintf("\t%s %s\n", colors.Success.Sprint("←"), path)
+		}
+		colors.PrintDescription("From", tmp)
 
 		tmp = ""
 		for _, to := range l.To {
@@ -144,7 +185,7 @@ func CheckConfig() error {
 		return fmt.Errorf("config could not be loaded/found")
 	}
 	if !CheckIfResticIsCallable() {
-		return fmt.Errorf(`%s was not found. Install either with "autorestic install" or manually`, RESTIC_BIN)
+		return fmt.Errorf(`%s was not found. Install either with "autorestic install" or manually`, flags.RESTIC_BIN)
 	}
 	for name, backend := range c.Backends {
 		backend.name = name
@@ -185,20 +226,18 @@ func GetAllOrSelected(cmd *cobra.Command, backends bool) ([]string, error) {
 		selected, _ = cmd.Flags().GetStringSlice("location")
 	}
 	for _, s := range selected {
-		found := false
+		var splitted = strings.Split(s, "@")
 		for _, l := range list {
-			if l == s {
-				found = true
-				break
+			if l == splitted[0] {
+				goto found
 			}
 		}
-		if !found {
 		if backends {
 			return nil, fmt.Errorf("invalid backend \"%s\"", s)
 		} else {
 			return nil, fmt.Errorf("invalid location \"%s\"", s)
 		}
-		}
+	found:
 	}
 
 	if len(selected) == 0 {
@@ -227,7 +266,7 @@ func (c *Config) SaveConfig() error {
 	if err := CopyFile(file, file+".old"); err != nil {
 		return err
 	}
-	colors.Secondary.Println("Saved a backup copy of your file next the the original.")
+	colors.Secondary.Println("Saved a backup copy of your file next to the original.")
 
 	viper.Set("backends", c.Backends)
 	viper.Set("locations", c.Locations)
@@ -235,23 +274,53 @@ func (c *Config) SaveConfig() error {
 	return viper.WriteConfig()
 }
 
-func getOptions(options Options, key string) []string {
-	var selected []string
-	for k, values := range options[key] {
+func optionToString(option string) string {
+	if !strings.HasPrefix(option, "-") {
+		return "--" + option
+	}
+	return option
+}
+
+func appendOptionsToSlice(str *[]string, options OptionMap) {
+	for key, values := range options {
 		for _, value := range values {
 			// Bool
 			asBool, ok := value.(bool)
 			if ok && asBool {
-				selected = append(selected, fmt.Sprintf("--%s", k))
+				*str = append(*str, optionToString(key))
 				continue
 			}
-			// String
-			asString, ok := value.(string)
-			if ok {
-				selected = append(selected, fmt.Sprintf("--%s", k), asString)
-				continue
+			*str = append(*str, optionToString(key), fmt.Sprint(value))
 		}
 	}
+}
+
+func getOptions(options Options, keys []string) []string {
+	var selected []string
+	for _, key := range keys {
+		appendOptionsToSlice(&selected, options[key])
 	}
 	return selected
 }
+
+func combineBackendOptions(key string, b Backend) []string {
+	// Priority: backend > global
+	var options []string
+	gFlags := getOptions(GetConfig().Global, []string{key})
+	bFlags := getOptions(b.Options, []string{"all", key})
+	options = append(options, gFlags...)
+	options = append(options, bFlags...)
+	return options
+}
+
+func combineAllOptions(key string, l Location, b Backend) []string {
+	// Priority: location > backend > global
+	var options []string
+	gFlags := getOptions(GetConfig().Global, []string{key})
+	bFlags := getOptions(b.Options, []string{"all", key})
+	lFlags := getOptions(l.Options, []string{"all", key})
+	options = append(options, gFlags...)
+	options = append(options, bFlags...)
+	options = append(options, lFlags...)
+	return options
+}

internal/config_test.go

@@ -0,0 +1,164 @@
+package internal
+
+import (
+	"reflect"
+	"strconv"
+	"strings"
+	"testing"
+)
+
+func TestOptionToString(t *testing.T) {
+	t.Run("no prefix", func(t *testing.T) {
+		opt := "test"
+		result := optionToString(opt)
+		assertEqual(t, result, "--test")
+	})
+
+	t.Run("single prefix", func(t *testing.T) {
+		opt := "-test"
+		result := optionToString(opt)
+		assertEqual(t, result, "-test")
+	})
+
+	t.Run("double prefix", func(t *testing.T) {
+		opt := "--test"
+		result := optionToString(opt)
+		assertEqual(t, result, "--test")
+	})
+}
+
+func TestAppendOneOptionToSlice(t *testing.T) {
+	t.Run("string flag", func(t *testing.T) {
+		result := []string{}
+		optionMap := OptionMap{"string-flag": []interface{}{"/root"}}
+
+		appendOptionsToSlice(&result, optionMap)
+		expected := []string{
+			"--string-flag", "/root",
+		}
+		assertSliceEqual(t, result, expected)
+	})
+
+	t.Run("bool flag", func(t *testing.T) {
+		result := []string{}
+		optionMap := OptionMap{"boolean-flag": []interface{}{true}}
+
+		appendOptionsToSlice(&result, optionMap)
+		expected := []string{
+			"--boolean-flag",
+		}
+		assertSliceEqual(t, result, expected)
+	})
+
+	t.Run("int flag", func(t *testing.T) {
+		result := []string{}
+		optionMap := OptionMap{"int-flag": []interface{}{123}}
+
+		appendOptionsToSlice(&result, optionMap)
+		expected := []string{
+			"--int-flag", "123",
+		}
+		assertSliceEqual(t, result, expected)
+	})
+}
+
+func TestAppendMultipleOptionsToSlice(t *testing.T) {
+	result := []string{}
+	optionMap := OptionMap{
+		"string-flag": []interface{}{"/root"},
+		"int-flag":    []interface{}{123},
+	}
+
+	appendOptionsToSlice(&result, optionMap)
+	expected := []string{
+		"--string-flag", "/root",
+		"--int-flag", "123",
+	}
+	if len(result) != len(expected) {
+		t.Errorf("got length %d, want length %d", len(result), len(expected))
+	}
+
+	// checks that expected option comes after flag, regardless of key order in map
+	for i, v := range expected {
+		v = strings.TrimPrefix(v, "--")
+
+		if value, ok := optionMap[v]; ok {
+			if val, ok := value[0].(int); ok {
+				if expected[i+1] != strconv.Itoa(val) {
+					t.Errorf("Flags and options order are mismatched. got %v, want %v", result, expected)
+				}
+			}
+		}
+	}
+}
+
+func TestAppendOptionWithMultipleValuesToSlice(t *testing.T) {
+	result := []string{}
+	optionMap := OptionMap{
+		"string-flag": []interface{}{"/root", "/bin"},
+	}
+
+	appendOptionsToSlice(&result, optionMap)
+	expected := []string{
+		"--string-flag", "/root",
+		"--string-flag", "/bin",
+	}
+	assertSliceEqual(t, result, expected)
+}
+
+func TestGetOptionsOneKey(t *testing.T) {
+	optionMap := OptionMap{
+		"string-flag": []interface{}{"/root"},
+	}
+	options := Options{"backend": optionMap}
+	keys := []string{"backend"}
+
+	result := getOptions(options, keys)
+	expected := []string{
+		"--string-flag", "/root",
+	}
+	assertSliceEqual(t, result, expected)
+}
+
+func TestGetOptionsMultipleKeys(t *testing.T) {
+	firstOptionMap := OptionMap{
+		"string-flag": []interface{}{"/root"},
+	}
+	secondOptionMap := OptionMap{
+		"boolean-flag": []interface{}{true},
+		"int-flag":     []interface{}{123},
+	}
+	options := Options{
+		"all":    firstOptionMap,
+		"forget": secondOptionMap,
+	}
+	keys := []string{"all", "forget"}
+
+	result := getOptions(options, keys)
+	expected := []string{
+		"--string-flag", "/root",
+		"--boolean-flag",
+		"--int-flag", "123",
+	}
+	reflect.DeepEqual(result, expected)
+}
+
+func assertEqual[T comparable](t testing.TB, result, expected T) {
+	t.Helper()
+
+	if result != expected {
+		t.Errorf("got %v, want %v", result, expected)
+	}
+}
+
+func assertSliceEqual(t testing.TB, result, expected []string) {
+	t.Helper()
+
+	if len(result) != len(expected) {
+		t.Errorf("got length %d, want length %d", len(result), len(expected))
+	}
+
+	for i := range result {
+		assertEqual(t, result[i], expected[i])
+	}
+}

internal/flags/flags.go

@@ -0,0 +1,9 @@
+package flags
+
+var (
+	CI         bool = false
+	VERBOSE    bool = false
+	CRON_LEAN  bool = false
+	RESTIC_BIN string
+	DOCKER_IMAGE string
+)

internal/location.go

@@ -9,6 +9,7 @@ import (
 	"time"
 
 	"github.com/cupcakearmy/autorestic/internal/colors"
+	"github.com/cupcakearmy/autorestic/internal/flags"
 	"github.com/cupcakearmy/autorestic/internal/lock"
 	"github.com/cupcakearmy/autorestic/internal/metadata"
 	"github.com/robfig/cron"
@@ -19,27 +20,38 @@ type LocationType string
 const (
 	TypeLocal  LocationType = "local"
 	TypeVolume LocationType = "volume"
-	VolumePrefix string       = "volume:"
 )
 
 type HookArray = []string
 
+type LocationForgetOption string
+
+const (
+	LocationForgetYes   LocationForgetOption = "yes"
+	LocationForgetNo    LocationForgetOption = "no"
+	LocationForgetPrune LocationForgetOption = "prune"
+)
+
 type Hooks struct {
-	Before  HookArray `yaml:"before,omitempty"`
-	After   HookArray `yaml:"after,omitempty"`
-	Success HookArray `yaml:"success,omitempty"`
-	Failure HookArray `yaml:"failure,omitempty"`
+	Dir     string    `mapstructure:"dir"`
+	Before  HookArray `mapstructure:"before,omitempty"`
+	After   HookArray `mapstructure:"after,omitempty"`
+	Success HookArray `mapstructure:"success,omitempty"`
+	Failure HookArray `mapstructure:"failure,omitempty"`
 }
 
-type Options map[string]map[string][]interface{}
+type LocationCopy = map[string][]string
 
 type Location struct {
-	name    string   `yaml:",omitempty"`
-	From    string   `yaml:"from,omitempty"`
-	To      []string `yaml:"to,omitempty"`
-	Hooks   Hooks    `yaml:"hooks,omitempty"`
-	Cron    string   `yaml:"cron,omitempty"`
-	Options Options  `yaml:"options,omitempty"`
+	name         string               `mapstructure:",omitempty"`
+	From         []string             `mapstructure:"from,omitempty"`
+	Type         string               `mapstructure:"type,omitempty"`
+	To           []string             `mapstructure:"to,omitempty"`
+	Hooks        Hooks                `mapstructure:"hooks,omitempty"`
+	Cron         string               `mapstructure:"cron,omitempty"`
+	Options      Options              `mapstructure:"options,omitempty"`
+	ForgetOption LocationForgetOption `mapstructure:"forget,omitempty"`
+	CopyOption   LocationCopy         `mapstructure:"copy,omitempty"`
 }
 
 func GetLocation(name string) (Location, bool) {
@@ -49,88 +61,124 @@ func GetLocation(name string) (Location, bool) {
 }
 
 func (l Location) validate() error {
-	if l.From == "" {
+	if len(l.From) == 0 {
 		return fmt.Errorf(`Location "%s" is missing "from" key`, l.name)
 	}
-	if l.getType() == TypeLocal {
-		if from, err := GetPathRelativeToConfig(l.From); err != nil {
+	t, err := l.getType()
+	if err != nil {
+		return err
+	}
+	switch t {
+	case TypeLocal:
+		for _, path := range l.From {
+			if from, err := GetPathRelativeToConfig(path); err != nil {
 				return err
 			} else {
-			if stat, err := os.Stat(from); err != nil {
+				if _, err := os.Stat(from); err != nil {
 					return err
-			} else {
-				if !stat.IsDir() {
-					return fmt.Errorf("\"%s\" is not valid directory for location \"%s\"", from, l.name)
 				}
 			}
 		}
+	case TypeVolume:
+		if len(l.From) > 1 {
+			return fmt.Errorf(`location "%s" has more than one docker volume`, l.name)
+		}
 	}
 
 	if len(l.To) == 0 {
-		return fmt.Errorf(`Location "%s" has no "to" targets`, l.name)
+		return fmt.Errorf(`location "%s" has no "to" targets`, l.name)
 	}
 	// Check if backends are all valid
 	for _, to := range l.To {
 		_, ok := GetBackend(to)
 		if !ok {
-			return fmt.Errorf("invalid backend `%s`", to)
+			return fmt.Errorf(`location "%s" has an invalid backend "%s"`, l.name, to)
+		}
+	}
+
+	// Check copy option
+	for copyFrom, copyTo := range l.CopyOption {
+		if _, ok := GetBackend(copyFrom); !ok {
+			return fmt.Errorf(`location "%s" has an invalid backend "%s" in copy option`, l.name, copyFrom)
+		}
+		if !ArrayContains(l.To, copyFrom) {
+			return fmt.Errorf(`location "%s" has an invalid copy from "%s"`, l.name, copyFrom)
+		}
+		for _, copyToTarget := range copyTo {
+			if _, ok := GetBackend(copyToTarget); !ok {
+				return fmt.Errorf(`location "%s" has an invalid backend "%s" in copy option`, l.name, copyToTarget)
+			}
+			if ArrayContains(l.To, copyToTarget) {
+				return fmt.Errorf(`location "%s" cannot copy to "%s" as it's already a target`, l.name, copyToTarget)
+			}
+		}
+	}
+
+	// Check if forget type is correct
+	if l.ForgetOption != "" {
+		if l.ForgetOption != LocationForgetYes && l.ForgetOption != LocationForgetNo && l.ForgetOption != LocationForgetPrune {
+			return fmt.Errorf("invalid value for forget option: %s", l.ForgetOption)
 		}
 	}
 	return nil
 }
 
-func ExecuteHooks(commands []string, options ExecuteOptions) error {
+func (l Location) ExecuteHooks(commands []string, options ExecuteOptions) error {
 	if len(commands) == 0 {
 		return nil
 	}
+	if l.Hooks.Dir != "" {
+		if dir, err := GetPathRelativeToConfig(l.Hooks.Dir); err != nil {
+			return err
+		} else {
+			options.Dir = dir
+		}
+	}
 	colors.Secondary.Println("\nRunning hooks")
 	for _, command := range commands {
 		colors.Body.Println("> " + command)
-		out, err := ExecuteCommand(options, "-c", command)
+		_, out, err := ExecuteCommand(options, "-c", command)
 		if err != nil {
 			colors.Error.Println(out)
 			return err
 		}
-		if VERBOSE {
-			colors.Faint.Println(out)
-		}
 	}
 	colors.Body.Println("")
 	return nil
 }
 
-func (l Location) getType() LocationType {
-	if strings.HasPrefix(l.From, VolumePrefix) {
-		return TypeVolume
+func (l Location) getType() (LocationType, error) {
+	t := strings.ToLower(l.Type)
+	if t == "" || t == "local" {
+		return TypeLocal, nil
+	} else if t == "volume" {
+		return TypeVolume, nil
 	}
-	return TypeLocal
+	return "", fmt.Errorf("invalid location type \"%s\"", l.Type)
 }
 
-func (l Location) getVolumeName() string {
-	return strings.TrimPrefix(l.From, VolumePrefix)
+func buildTag(parts ...string) string {
+	parts = append([]string{"ar"}, parts...)
+	return strings.Join(parts, ":")
 }
 
-func (l Location) getPath() (string, error) {
-	t := l.getType()
-	switch t {
-	case TypeLocal:
-		if path, err := GetPathRelativeToConfig(l.From); err != nil {
-			return "", err
-		} else {
-			return path, nil
-		}
-	case TypeVolume:
-		return "/volume/" + l.name + "/" + l.getVolumeName(), nil
-	}
-	return "", fmt.Errorf("could not get path for location \"%s\"", l.name)
+func (l Location) getLocationTags() string {
+	return buildTag("location", l.name)
 }
 
-func (l Location) Backup(cron bool) []error {
+func (l Location) Backup(cron bool, specificBackend string) []error {
 	var errors []error
+	var backends []string
 	colors.PrimaryPrint("  Backing up location \"%s\"  ", l.name)
-	t := l.getType()
+	t, err := l.getType()
+	if err != nil {
+		errors = append(errors, err)
+		return errors
+	}
+	cwd, _ := GetPathRelativeToConfig(".")
 	options := ExecuteOptions{
 		Command: "bash",
+		Dir:     cwd,
 		Envs: map[string]string{
 			"AUTORESTIC_LOCATION": l.name,
 		},
@@ -138,24 +186,27 @@ func (l Location) Backup(cron bool) []error {
 
 	if err := l.validate(); err != nil {
 		errors = append(errors, err)
-		colors.Error.Print(err)
 		goto after
 	}
 
-	if t == TypeLocal {
-		dir, _ := GetPathRelativeToConfig(l.From)
-		colors.Faint.Printf("Executing under: \"%s\"\n", dir)
-		options.Dir = dir
-	}
-
 	// Hooks
-	if err := ExecuteHooks(l.Hooks.Before, options); err != nil {
+	if err := l.ExecuteHooks(l.Hooks.Before, options); err != nil {
 		errors = append(errors, err)
 		goto after
 	}
 
 	// Backup
-	for i, to := range l.To {
+	if specificBackend == "" {
+		backends = l.To
+	} else {
+		if l.hasBackend(specificBackend) {
+			backends = []string{specificBackend}
+		} else {
+			errors = append(errors, fmt.Errorf("backup location \"%s\" has no backend \"%s\"", l.name, specificBackend))
+			return errors
+		}
+	}
+	for i, to := range backends {
 		backend, _ := GetBackend(to)
 		colors.Secondary.Printf("Backend: %s\n", backend.name)
 		env, err := backend.getEnv()
@@ -164,74 +215,120 @@ func (l Location) Backup(cron bool) []error {
 			continue
 		}
 
-		lFlags := getOptions(l.Options, "backup")
-		bFlags := getOptions(backend.Options, "backup")
 		cmd := []string{"backup"}
-		cmd = append(cmd, lFlags...)
-		cmd = append(cmd, bFlags...)
+		cmd = append(cmd, combineAllOptions("backup", l, backend)...)
 		if cron {
-			cmd = append(cmd, "--tag", "cron")
+			cmd = append(cmd, "--tag", buildTag("cron"))
 		}
-		cmd = append(cmd, ".")
+		cmd = append(cmd, "--tag", l.getLocationTags())
 		backupOptions := ExecuteOptions{
-			Dir:  options.Dir,
 			Envs: env,
 		}
 
+		var code int = 0
 		var out string
-
 		switch t {
 		case TypeLocal:
-			out, err = ExecuteResticCommand(backupOptions, cmd...)
-		case TypeVolume:
-			out, err = backend.ExecDocker(l, cmd)
-		}
+			for _, from := range l.From {
+				path, err := GetPathRelativeToConfig(from)
 				if err != nil {
-			colors.Error.Println(out)
 					errors = append(errors, err)
+					goto after
+				}
+				cmd = append(cmd, path)
+			}
+			code, out, err = ExecuteResticCommand(backupOptions, cmd...)
+		case TypeVolume:
+			ok := CheckIfVolumeExists(l.From[0])
+			if !ok {
+				errors = append(errors, fmt.Errorf("volume \"%s\" does not exist", l.From[0]))
 				continue
 			}
+			cmd = append(cmd, "/data")
+			code, out, err = backend.ExecDocker(l, cmd)
+		}
 
+		// Extract metadata
 		md := metadata.ExtractMetadataFromBackupLog(out)
+		md.ExitCode = fmt.Sprint(code)
 		mdEnv := metadata.MakeEnvFromMetadata(&md)
 		for k, v := range mdEnv {
 			options.Envs[k+"_"+fmt.Sprint(i)] = v
 			options.Envs[k+"_"+strings.ToUpper(backend.name)] = v
 		}
-		if VERBOSE {
-			colors.Faint.Println(out)
+
+		// If error save it and continue
+		if err != nil {
+			colors.Error.Println(out)
+			errors = append(errors, fmt.Errorf("%s@%s:\n%s%s", l.name, backend.name, out, err))
+			continue
+		}
+
+		// Copy
+		if md.SnapshotID != "" {
+			for copyFrom, copyTo := range l.CopyOption {
+				b1, _ := GetBackend(copyFrom)
+				for _, copyToTarget := range copyTo {
+					b2, _ := GetBackend(copyToTarget)
+					colors.Secondary.Println("Copying " + copyFrom + " → " + copyToTarget)
+					env, _ := b1.getEnv()
+					env2, _ := b2.getEnv()
+					// Add the second repo to the env with a "2" suffix
+					for k, v := range env2 {
+						env[k+"2"] = v
+					}
+					_, _, err := ExecuteResticCommand(ExecuteOptions{
+						Envs: env,
+					}, "copy", md.SnapshotID)
+
+					if err != nil {
+						errors = append(errors, err)
+					}
+				}
+			}
 		}
 	}
 
 	// After hooks
-	if err := ExecuteHooks(l.Hooks.After, options); err != nil {
+	if err := l.ExecuteHooks(l.Hooks.After, options); err != nil {
 		errors = append(errors, err)
 	}
 
 after:
 	var commands []string
-	if len(errors) > 0 {
-		commands = l.Hooks.Failure
-	} else {
+	var isSuccess = len(errors) == 0
+	if isSuccess {
 		commands = l.Hooks.Success
+	} else {
+		commands = l.Hooks.Failure
 	}
-	if err := ExecuteHooks(commands, options); err != nil {
+	if err := l.ExecuteHooks(commands, options); err != nil {
 		errors = append(errors, err)
 	}
 
+	// Forget and optionally prune
+	if isSuccess && l.ForgetOption != "" && l.ForgetOption != LocationForgetNo {
+		err := l.Forget(l.ForgetOption == LocationForgetPrune, false)
+		if err != nil {
+			errors = append(errors, err)
+		}
+	}
+
+	if len(errors) == 0 {
 		colors.Success.Println("Done")
+	}
 	return errors
 }
 
 func (l Location) Forget(prune bool, dry bool) error {
 	colors.PrimaryPrint("Forgetting for location \"%s\"", l.name)
 
-	path, err := l.getPath()
-	if err != nil {
-		return err
+	backendsToForget := l.To
+	for _, copyBackends := range l.CopyOption {
+		backendsToForget = append(backendsToForget, copyBackends...)
 	}
 
-	for _, to := range l.To {
+	for _, to := range backendsToForget {
 		backend, _ := GetBackend(to)
 		colors.Secondary.Printf("For backend \"%s\"\n", backend.name)
 		env, err := backend.getEnv()
@@ -241,21 +338,15 @@ func (l Location) Forget(prune bool, dry bool) error {
 		options := ExecuteOptions{
 			Envs: env,
 		}
-		lFlags := getOptions(l.Options, "forget")
-		bFlags := getOptions(backend.Options, "forget")
-		cmd := []string{"forget", "--path", path}
+		cmd := []string{"forget", "--tag", l.getLocationTags()}
 		if prune {
 			cmd = append(cmd, "--prune")
 		}
 		if dry {
 			cmd = append(cmd, "--dry-run")
 		}
-		cmd = append(cmd, lFlags...)
-		cmd = append(cmd, bFlags...)
-		out, err := ExecuteResticCommand(options, cmd...)
-		if VERBOSE {
-			colors.Faint.Println(out)
-		}
+		cmd = append(cmd, combineAllOptions("forget", l, backend)...)
+		_, _, err = ExecuteResticCommand(options, cmd...)
 		if err != nil {
 			return err
 		}
@@ -273,28 +364,37 @@ func (l Location) hasBackend(backend string) bool {
 	return false
 }
 
-func (l Location) Restore(to, from string, force bool) error {
+func buildRestoreCommand(l Location, to string, snapshot string, options []string) []string {
+	base := []string{"restore", "--target", to, "--tag", l.getLocationTags(), snapshot}
+	base = append(base, options...)
+	return base
+}
+
+func (l Location) Restore(to, from string, force bool, snapshot string, options []string) error {
 	if from == "" {
 		from = l.To[0]
 	} else if !l.hasBackend(from) {
 		return fmt.Errorf("invalid backend: \"%s\"", from)
 	}
 
-	to, err := filepath.Abs(to)
+	if snapshot == "" {
+		snapshot = "latest"
+	}
+
+	colors.PrimaryPrint("Restoring location \"%s\"", l.name)
+	backend, _ := GetBackend(from)
+	colors.Secondary.Printf("Restoring %s@%s → %s\n", snapshot, backend.name, to)
+
+	t, err := l.getType()
 	if err != nil {
 		return err
 	}
-	colors.PrimaryPrint("Restoring location \"%s\"", l.name)
-
-	backend, _ := GetBackend(from)
-	path, err := l.getPath()
-	if err != nil {
-		return nil
-	}
-	colors.Secondary.Println("Restoring lastest snapshot")
-	colors.Body.Printf("%s → %s.\n", from, path)
-	switch l.getType() {
+	switch t {
 	case TypeLocal:
+		to, err = filepath.Abs(to)
+		if err != nil {
+			return err
+		}
 		// Check if target is empty
 		if !force {
 			notEmptyError := fmt.Errorf("target %s is not empty", to)
@@ -313,9 +413,9 @@ func (l Location) Restore(to, from string, force bool) error {
 				}
 			}
 		}
-		err = backend.Exec([]string{"restore", "--target", to, "--path", path, "latest"})
+		err = backend.Exec(buildRestoreCommand(l, to, snapshot, options))
 	case TypeVolume:
-		_, err = backend.ExecDocker(l, []string{"restore", "--target", ".", "--path", path, "latest"})
+		_, _, err = backend.ExecDocker(l, buildRestoreCommand(l, "/", snapshot, options))
 	}
 	if err != nil {
 		return err
@@ -338,9 +438,9 @@ func (l Location) RunCron() error {
 	now := time.Now()
 	if now.After(next) {
 		lock.SetCron(l.name, now.Unix())
-		l.Backup(true)
+		l.Backup(true, "")
 	} else {
-		if !CRON_LEAN {
+		if !flags.CRON_LEAN {
 			colors.Body.Printf("Skipping \"%s\", not due yet.\n", l.name)
 		}
 	}

internal/location_test.go

@@ -0,0 +1,93 @@
+package internal
+
+import "testing"
+
+func TestGetType(t *testing.T) {
+
+	t.Run("TypeLocal", func(t *testing.T) {
+		l := Location{
+			Type: "local",
+		}
+		result, err := l.getType()
+		if err != nil {
+			t.Errorf("unexpected error: %v", err)
+		}
+		assertEqual(t, result, TypeLocal)
+	})
+
+	t.Run("TypeVolume", func(t *testing.T) {
+		l := Location{
+			Type: "volume",
+		}
+		result, err := l.getType()
+		if err != nil {
+			t.Errorf("unexpected error: %v", err)
+		}
+		assertEqual(t, result, TypeVolume)
+	})
+
+	t.Run("Empty type", func(t *testing.T) {
+		l := Location{
+			Type: "",
+		}
+		result, err := l.getType()
+		if err != nil {
+			t.Errorf("unexpected error: %v", err)
+		}
+		assertEqual(t, result, TypeLocal)
+	})
+
+	t.Run("Invalid type", func(t *testing.T) {
+		l := Location{
+			Type: "foo",
+		}
+		_, err := l.getType()
+		if err == nil {
+			t.Error("expected error")
+		}
+	})
+}
+
+func TestBuildTag(t *testing.T) {
+	result := buildTag("foo", "bar")
+	expected := "ar:foo:bar"
+	assertEqual(t, result, expected)
+}
+
+func TestGetLocationTags(t *testing.T) {
+	l := Location{
+		name: "foo",
+	}
+	result := l.getLocationTags()
+	expected := "ar:location:foo"
+	assertEqual(t, result, expected)
+}
+
+func TestHasBackend(t *testing.T) {
+	t.Run("backend present", func(t *testing.T) {
+		l := Location{
+			name: "foo",
+			To:   []string{"foo", "bar"},
+		}
+		result := l.hasBackend("foo")
+		assertEqual(t, result, true)
+	})
+
+	t.Run("backend absent", func(t *testing.T) {
+		l := Location{
+			name: "foo",
+			To:   []string{"bar", "baz"},
+		}
+		result := l.hasBackend("foo")
+		assertEqual(t, result, false)
+	})
+}
+
+func TestBuildRestoreCommand(t *testing.T) {
+	l := Location{
+		name: "foo",
+	}
+	result := buildRestoreCommand(l, "to", "snapshot", []string{"options"})
+	expected := []string{"restore", "--target", "to", "--tag", "ar:location:foo", "snapshot", "options"}
+	assertSliceEqual(t, result, expected)
+}

internal/lock/lock.go

@@ -6,6 +6,7 @@ import (
 	"sync"
 
 	"github.com/cupcakearmy/autorestic/internal/colors"
+	"github.com/cupcakearmy/autorestic/internal/flags"
 	"github.com/spf13/viper"
 )
 
@@ -13,14 +14,25 @@ var lock *viper.Viper
 var file string
 var once sync.Once
 
+const (
+	RUNNING = "running"
+)
+
 func getLock() *viper.Viper {
 	if lock == nil {
 
 		once.Do(func() {
 			lock = viper.New()
 			lock.SetDefault("running", false)
-			p := path.Dir(viper.ConfigFileUsed())
-			file = path.Join(p, ".autorestic.lock.yml")
+			p := viper.ConfigFileUsed()
+			if p == "" {
+				colors.Error.Println("cannot lock before reading config location")
+				os.Exit(1)
+			}
+			file = path.Join(path.Dir(p), ".autorestic.lock.yml")
+			if !flags.CRON_LEAN {
+				colors.Faint.Println("Using lock:\t", file)
+			}
 			lock.SetConfigFile(file)
 			lock.SetConfigType("yml")
 			lock.ReadInConfig()
@@ -29,36 +41,38 @@ func getLock() *viper.Viper {
 	return lock
 }
 
-func setLock(locked bool) error {
+func setLockValue(key string, value interface{}) (*viper.Viper, error) {
 	lock := getLock()
-	if locked {
-		running := lock.GetBool("running")
-		if running {
+
+	if key == RUNNING {
+		value := value.(bool)
+		if value && lock.GetBool(key) {
 			colors.Error.Println("an instance is already running. exiting")
 			os.Exit(1)
 		}
 	}
-	lock.Set("running", locked)
+
+	lock.Set(key, value)
 	if err := lock.WriteConfigAs(file); err != nil {
-		return err
+		return nil, err
 	}
-	return nil
+	return lock, nil
 }
 
 func GetCron(location string) int64 {
-	lock := getLock()
-	return lock.GetInt64("cron." + location)
+	return getLock().GetInt64("cron." + location)
 }
 
 func SetCron(location string, value int64) {
-	lock.Set("cron."+location, value)
-	lock.WriteConfigAs(file)
+	setLockValue("cron."+location, value)
 }
 
 func Lock() error {
-	return setLock(true)
+	_, err := setLockValue(RUNNING, true)
+	return err
 }
 
 func Unlock() error {
-	return setLock(false)
+	_, err := setLockValue(RUNNING, false)
+	return err
 }

internal/lock/lock_test.go

@@ -0,0 +1,114 @@
+package lock
+
+import (
+	"log"
+	"os"
+	"os/exec"
+	"strconv"
+	"testing"
+
+	"github.com/spf13/viper"
+)
+
+var testDirectory = "autorestic_test_tmp"
+
+// All tests must share the same lock file as it is only initialized once
+func setup(t *testing.T) {
+	d, err := os.MkdirTemp("", testDirectory)
+	if err != nil {
+		log.Fatalf("error creating temp dir: %v", err)
+		return
+	}
+	// set config file location
+	viper.SetConfigFile(d + "/.autorestic.yml")
+
+	t.Cleanup(func() {
+		os.RemoveAll(d)
+		viper.Reset()
+	})
+}
+
+func TestLock(t *testing.T) {
+	setup(t)
+
+	t.Run("getLock", func(t *testing.T) {
+		result := getLock().GetBool(RUNNING)
+
+		if result {
+			t.Errorf("got %v, want %v", result, false)
+		}
+	})
+
+	t.Run("lock", func(t *testing.T) {
+		lock, err := setLockValue(RUNNING, true)
+		if err != nil {
+			t.Errorf("unexpected error: %v", err)
+		}
+
+		result := lock.GetBool(RUNNING)
+		if !result {
+			t.Errorf("got %v, want %v", result, true)
+		}
+	})
+
+	t.Run("unlock", func(t *testing.T) {
+		lock, err := setLockValue(RUNNING, false)
+		if err != nil {
+			t.Errorf("unexpected error: %v", err)
+		}
+
+		result := lock.GetBool(RUNNING)
+		if result {
+			t.Errorf("got %v, want %v", result, false)
+		}
+	})
+
+	// locking a locked instance exits the instance
+	// this trick to capture os.Exit(1) is discussed here:
+	// https://talks.golang.org/2014/testing.slide#23
+	t.Run("lock twice", func(t *testing.T) {
+		if os.Getenv("CRASH") == "1" {
+			err := Lock()
+			if err != nil {
+				t.Errorf("unexpected error: %v", err)
+			}
+			// should fail
+			Lock()
+		}
+
+		cmd := exec.Command(os.Args[0], "-test.run=TestLock/lock_twice")
+		cmd.Env = append(os.Environ(), "CRASH=1")
+		err := cmd.Run()
+
+		err, ok := err.(*exec.ExitError)
+		if !ok {
+			t.Error("unexpected error")
+		}
+		expected := "exit status 1"
+		if err.Error() != expected {
+			t.Errorf("got %q, want %q", err.Error(), expected)
+		}
+	})
+
+	t.Run("set cron", func(t *testing.T) {
+		expected := int64(5)
+		SetCron("foo", expected)
+
+		result, err := strconv.ParseInt(getLock().GetString("cron.foo"), 10, 64)
+		if err != nil {
+			t.Errorf("unexpected error: %v", err)
+		}
+		if result != expected {
+			t.Errorf("got %d, want %d", result, expected)
+		}
+	})
+
+	t.Run("get cron", func(t *testing.T) {
+		expected := int64(5)
+		result := GetCron("foo")
+
+		if result != expected {
+			t.Errorf("got %d, want %d", result, expected)
+		}
+	})
+}

internal/metadata/metadata.go

@@ -21,6 +21,7 @@ type BackupLogMetadata struct {
 	AddedSize        string
 	Processed        BackupLogMetadataProcessed
 	SnapshotID       string
+	ExitCode         string
 }
 
 type MetadatExtractor interface {
@@ -67,6 +68,7 @@ func MakeEnvFromMetadata(metadata *BackupLogMetadata) map[string]string {
 	env[prefix+"PROCESSED_FILES"] = metadata.Processed.Files
 	env[prefix+"PROCESSED_SIZE"] = metadata.Processed.Size
 	env[prefix+"PROCESSED_DURATION"] = metadata.Processed.Duration
+	env[prefix+"EXIT_CODE"] = metadata.ExitCode
 
 	return env
 }

internal/utils.go

@@ -8,26 +8,38 @@ import (
 	"os/exec"
 
 	"github.com/cupcakearmy/autorestic/internal/colors"
+	"github.com/cupcakearmy/autorestic/internal/flags"
+	"github.com/fatih/color"
 )
 
-var RESTIC_BIN string
-
 func CheckIfCommandIsCallable(cmd string) bool {
 	_, err := exec.LookPath(cmd)
 	return err == nil
 }
 
 func CheckIfResticIsCallable() bool {
-	return CheckIfCommandIsCallable(RESTIC_BIN)
+	return CheckIfCommandIsCallable(flags.RESTIC_BIN)
 }
 
 type ExecuteOptions struct {
 	Command string
 	Envs    map[string]string
 	Dir     string
+	Silent  bool
 }
 
-func ExecuteCommand(options ExecuteOptions, args ...string) (string, error) {
+type ColoredWriter struct {
+	target io.Writer
+	color  *color.Color
+}
+
+func (w ColoredWriter) Write(p []byte) (n int, err error) {
+	colored := []byte(w.color.Sprint(string(p)))
+	w.target.Write(colored)
+	return len(p), nil
+}
+
+func ExecuteCommand(options ExecuteOptions, args ...string) (int, string, error) {
 	cmd := exec.Command(options.Command, args...)
 	env := os.Environ()
 	for k, v := range options.Envs {
@@ -36,34 +48,50 @@ func ExecuteCommand(options ExecuteOptions, args ...string) (string, error) {
 	cmd.Env = env
 	cmd.Dir = options.Dir
 
-	if VERBOSE {
+	if flags.VERBOSE {
 		colors.Faint.Printf("> Executing: %s\n", cmd)
 	}
 
 	var out bytes.Buffer
 	var error bytes.Buffer
+	if flags.VERBOSE && !options.Silent {
+		var colored ColoredWriter = ColoredWriter{
+			target: os.Stdout,
+			color:  colors.Faint,
+		}
+		mw := io.MultiWriter(colored, &out)
+		cmd.Stdout = mw
+	} else {
 		cmd.Stdout = &out
+	}
 	cmd.Stderr = &error
 	err := cmd.Run()
 	if err != nil {
-		return error.String(), err
+		code := -1
+		if exitError, ok := err.(*exec.ExitError); ok {
+			code = exitError.ExitCode()
 		}
-	return out.String(), nil
+		return code, error.String(), err
+	}
+	return 0, out.String(), nil
 }
 
-func ExecuteResticCommand(options ExecuteOptions, args ...string) (string, error) {
-	options.Command = RESTIC_BIN
+func ExecuteResticCommand(options ExecuteOptions, args ...string) (int, string, error) {
+	options.Command = flags.RESTIC_BIN
+	var c = GetConfig()
+	var optionsAsString = getOptions(c.Global, []string{"all"})
+	args = append(optionsAsString, args...)
 	return ExecuteCommand(options, args...)
 }
 
 func CopyFile(from, to string) error {
-	original, err := os.Open("original.txt")
+	original, err := os.Open(from)
 	if err != nil {
 		return nil
 	}
 	defer original.Close()
 
-	new, err := os.Create("new.txt")
+	new, err := os.Create(to)
 	if err != nil {
 		return nil
 	}
@@ -74,3 +102,17 @@ func CopyFile(from, to string) error {
 	}
 	return nil
 }
+
+func CheckIfVolumeExists(volume string) bool {
+	_, _, err := ExecuteCommand(ExecuteOptions{Command: "docker"}, "volume", "inspect", volume)
+	return err == nil
+}
+
+func ArrayContains[T comparable](arr []T, needle T) bool {
+	for _, item := range arr {
+		if item == needle {
+			return true
+		}
+	}
+	return false
+}