mirror of
https://github.com/cupcakearmy/autorestic.git
synced 2026-02-05 08:49:16 +00:00
Compare commits
231 Commits
v1.0.4
...
fc2756124e
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
fc2756124e | ||
|
|
3b57602fe8 | ||
|
|
045513234f | ||
|
|
78b0db50e0 | ||
|
|
62dd371d51 | ||
|
|
08766b75db | ||
| b3b7c8df95 | |||
| 2c5266c9a0 | |||
| 087b293c39 | |||
|
|
112a69d743 | ||
|
|
37d55c691f | ||
|
|
715b6f791c | ||
|
|
38b38c6805 | ||
| c82db56069 | |||
| 27821dc3ef | |||
| 866975d32d | |||
|
|
955ac0e323 | ||
|
|
1512db5b55 | ||
|
|
046331748c | ||
| 72a40eaaa2 | |||
| ec61effe22 | |||
| d6acab94a5 | |||
|
|
cbe506b28a | ||
|
|
d0d2fcf0f2 | ||
| 58fd41fafb | |||
|
|
d0c4a32879 | ||
| 74979e9a2a | |||
|
|
3732dcf6ff | ||
|
|
874ed52e3b | ||
| 4d9a2b828e | |||
|
|
b830667264 | ||
|
|
83eeb847ac | ||
|
|
a89ba5a40a | ||
|
|
6990bf6adc | ||
|
|
2f407cf211 | ||
| 489f3078fe | |||
|
|
e07dd0d991 | ||
|
|
2b9dc9f17c | ||
|
|
465bc037c2 | ||
|
|
37a043afff | ||
|
|
e91b632181 | ||
|
|
2b30998b9a | ||
|
|
49b37a0a9a | ||
| 3bc091f826 | |||
| 5bcf5c9217 | |||
| ff2e3714d1 | |||
| 2e6764223d | |||
| 434862ed4e | |||
| 2da440a1cd | |||
| 0f6c34dc6b | |||
| 3457fc01bf | |||
|
|
1e62f6cb05 | ||
| 8112aceb30 | |||
|
|
b4cc0f0ab1 | ||
|
|
a3e539b0b7 | ||
|
|
79164e3de0 | ||
| 8b74a98836 | |||
| 8a713e497d | |||
| 71601ae7a6 | |||
|
|
85d3f06b79 | ||
| 5afad86e37 | |||
| ba9e090695 | |||
|
|
05def04770 | ||
| d85470459f | |||
| 1f69a7974a | |||
| db9f5dea66 | |||
| 75160d4d6a | |||
| 92feaef5bb | |||
| 2a7e233cdb | |||
| a373c07fb0 | |||
| ec9e2aebcd | |||
| 7d87160706 | |||
| 8e1fe6af65 | |||
|
|
65ba1f6ac1 | ||
|
|
6bf4953003 | ||
| 27758a03fa | |||
| bbdae05199 | |||
| 389490c4ea | |||
| 21b83b4c89 | |||
| 982f9e0b5c | |||
| 0c37af5588 | |||
| e3c378f2a1 | |||
| 3b541665ae | |||
| e0b2c99ccd | |||
| 2b14e6b1af | |||
| 1810af8d02 | |||
| 252968e15e | |||
| 26de4385ea | |||
| 0c71bea93e | |||
| 3029259d82 | |||
|
|
389f7c25dd | ||
| e055e28cfe | |||
| ed3c17d678 | |||
| 8802b74b47 | |||
| e94e7030fc | |||
| c55e91b8ff | |||
| 170bdb81ad | |||
| 4126436f7f | |||
| 113a97c283 | |||
| c250391f67 | |||
| d3b4915d25 | |||
| cd7a5cbc13 | |||
| 3dd3956d64 | |||
| 59035da46a | |||
| 90914d2078 | |||
| 0ae374cd45 | |||
| 3665cea62d | |||
| cf92d400c2 | |||
| 696bd14ac7 | |||
| a68e3e426e | |||
| 27e82c8529 | |||
| 7f9251f06b | |||
| 09cfa4a98e | |||
| 05c3458a95 | |||
| 2826f9586d | |||
| 4fe241e6f3 | |||
| d0b1b86fdd | |||
| 14dd41d60d | |||
| bcfc734cd1 | |||
| 6817f494ef | |||
| 2c46f0da0c | |||
| ac756dfbde | |||
| f71425be5b | |||
|
|
d78fbb6650 | ||
| 7ad6f7ce9e | |||
| de663f287c | |||
| 439076d7ab | |||
| 8c30134f7c | |||
| 11d1da7468 | |||
| 92b1577634 | |||
| a7944aed1f | |||
| 3b99e301e9 | |||
| 246e6fc0d8 | |||
| c2f9ed9204 | |||
| 4055ebf8e8 | |||
| 6be0a80b29 | |||
| efd4a7dfea | |||
| 440609220c | |||
| fb6217d868 | |||
| 1628384e1f | |||
| 3e80e6d18e | |||
| 83905d2993 | |||
| ddc3accb30 | |||
| 7874512ec0 | |||
| 0b5f4017e4 | |||
| 88198c4fcb | |||
| 8cd759105f | |||
| 6137e31c3b | |||
| 2789502c89 | |||
| b87381cd3b | |||
| 048a5ffed8 | |||
| 02a8e461d4 | |||
| a1abe13a39 | |||
| ddf287f6f5 | |||
| 56f82ae656 | |||
| 95b1ca3297 | |||
|
|
7a8830cb2f | ||
| 959d19cbdb | |||
| 9dc7763445 | |||
|
|
50984f6771 | ||
| e80f200873 | |||
| 86ae70672a | |||
| 5c0788900f | |||
| 20334a7e83 | |||
| 7bebd04482 | |||
| b9b8857bf4 | |||
| dd6e618161 | |||
| a4b54f9f64 | |||
| c2e88193cd | |||
| a2ef69d96d | |||
|
|
d45949b028 | ||
| 77d47cc697 | |||
| a3239c0f3b | |||
| 90cd3171e5 | |||
| 61673bd88b | |||
| 41736ea3c4 | |||
| a7779e04bd | |||
|
|
1326e7e53c | ||
| 478e193d78 | |||
| 11d4c67dce | |||
| 1643309957 | |||
| e05386b0b5 | |||
| aebaf0a225 | |||
| c090013bf5 | |||
| 88c6949208 | |||
| 9256cdc38c | |||
| a8c611e8ce | |||
| d4522c7ffe | |||
| 21185d894e | |||
| b119fc7ea5 | |||
|
|
73f4bcfd48 | ||
|
|
3567319314 | ||
|
|
bf19c983d1 | ||
|
|
12e4de110b | ||
| c9f425ef64 | |||
| 974f555dff | |||
| 1688c1f3c3 | |||
| 29e46d3b5c | |||
| 0335abb669 | |||
| b2f9b9a54e | |||
| 2b13a6e13d | |||
| cc293ea256 | |||
| a4ddd5bbcb | |||
| 7cbf43b75d | |||
| bae77c4673 | |||
| 12adeb2b06 | |||
| 37b26dfc31 | |||
| c1795b2acc | |||
| b8d12e518c | |||
| 50060cf539 | |||
| c33aac42dc | |||
| c359053e0e | |||
| c16340ab26 | |||
| edc85c4ac3 | |||
| 68682777f2 | |||
|
|
b6c7922df5 | ||
|
|
991b8bec22 | ||
| bbc32568ad | |||
| f3c038c716 | |||
| 59612a97b6 | |||
| 33319a00ef | |||
| 8eb14ea14f | |||
| 70eb9e441f | |||
| be25af2d76 | |||
| 1c436369f0 | |||
| 6efcce07b7 | |||
|
|
dc6dd2e712 | ||
|
|
68628d3776 | ||
| 40988ef3b4 | |||
| fad33fcdaa | |||
|
|
8cf8a77558 |
6
.dockerignore
Normal file
6
.dockerignore
Normal file
@@ -0,0 +1,6 @@
|
|||||||
|
*
|
||||||
|
!**/*.go
|
||||||
|
!build
|
||||||
|
!cmd
|
||||||
|
!internal
|
||||||
|
!go.*
|
||||||
8
.github/dependabot.yml
vendored
Normal file
8
.github/dependabot.yml
vendored
Normal file
@@ -0,0 +1,8 @@
|
|||||||
|
# https://docs.github.com/github/administering-a-repository/configuration-options-for-dependency-updates
|
||||||
|
|
||||||
|
version: 2
|
||||||
|
updates:
|
||||||
|
- package-ecosystem: "docker"
|
||||||
|
directory: "/"
|
||||||
|
schedule:
|
||||||
|
interval: "weekly"
|
||||||
40
.github/workflows/build.yml
vendored
40
.github/workflows/build.yml
vendored
@@ -3,16 +3,44 @@ name: Main
|
|||||||
on:
|
on:
|
||||||
push:
|
push:
|
||||||
tags:
|
tags:
|
||||||
- 'v*.*.*'
|
- "v*.*.*"
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
build:
|
docker:
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- name: Set up QEMU
|
||||||
- uses: actions/setup-go@v2
|
uses: docker/setup-qemu-action@v2
|
||||||
|
- name: Set up Docker Buildx
|
||||||
|
uses: docker/setup-buildx-action@v2
|
||||||
|
- name: Docker Labels
|
||||||
|
id: meta
|
||||||
|
uses: crazy-max/ghaction-docker-meta@v4
|
||||||
with:
|
with:
|
||||||
go-version: '^1.16.3'
|
images: cupcakearmy/autorestic
|
||||||
|
tags: |
|
||||||
|
type=semver,pattern={{version}}
|
||||||
|
type=semver,pattern={{major}}.{{minor}}
|
||||||
|
type=semver,pattern={{major}}
|
||||||
|
- name: Login to DockerHub
|
||||||
|
uses: docker/login-action@v2
|
||||||
|
with:
|
||||||
|
username: ${{ secrets.DOCKERHUB_USERNAME }}
|
||||||
|
password: ${{ secrets.DOCKERHUB_TOKEN }}
|
||||||
|
- name: Build and push
|
||||||
|
uses: docker/build-push-action@v3
|
||||||
|
with:
|
||||||
|
platforms: linux/amd64,linux/arm64
|
||||||
|
push: true
|
||||||
|
tags: ${{ steps.meta.outputs.tags }}
|
||||||
|
|
||||||
|
release:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@v3
|
||||||
|
- uses: actions/setup-go@v3
|
||||||
|
with:
|
||||||
|
go-version: "^1.20"
|
||||||
- name: Build
|
- name: Build
|
||||||
run: go run build/build.go
|
run: go run build/build.go
|
||||||
- name: Release
|
- name: Release
|
||||||
@@ -20,4 +48,4 @@ jobs:
|
|||||||
with:
|
with:
|
||||||
files: dist/*
|
files: dist/*
|
||||||
env:
|
env:
|
||||||
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
|
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
|
||||||
|
|||||||
248
CHANGELOG.md
248
CHANGELOG.md
@@ -5,21 +5,261 @@ All notable changes to this project will be documented in this file.
|
|||||||
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||||
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||||
|
|
||||||
|
## [1.7.4] - 2023-01-18
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Transformer for extracting information. @11mariom
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Bump docker restic version.
|
||||||
|
- Docs dependencies updated.
|
||||||
|
|
||||||
|
## [1.7.1] - 2022-04-27
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- #178 Lean flag not working properly.
|
||||||
|
|
||||||
|
## [1.7.0] - 2022-04-27
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- #147 Stream output instead of buffering.
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- #184 duplicate global options.
|
||||||
|
- #154 add docs for migration.
|
||||||
|
- #182 fix bug with upgrading custom restic with custom path.
|
||||||
|
|
||||||
|
## [1.6.2] - 2022-04-14
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Version bump in code.
|
||||||
|
|
||||||
|
## [1.6.1] - 2022-04-14
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Bump go version in docker file to 18.
|
||||||
|
|
||||||
|
## [1.6.0] - 2022-04-14
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- support for copy command #145
|
||||||
|
- partial restore with `--include`, `--exclude`, `--iinclude`, `--iexclude` flags #161
|
||||||
|
- run forget automatically after backup #158
|
||||||
|
- exit codes to hooks as env variable #142
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Lean flag not removing all output #178
|
||||||
|
|
||||||
|
## [1.5.8] - 2022-03-18
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Better error handling for bad config files.
|
||||||
|
|
||||||
|
## [1.5.7] - 2022-03-11
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- SSH in docker image. @fariszr
|
||||||
|
|
||||||
|
### Security
|
||||||
|
|
||||||
|
- Updated dependencies
|
||||||
|
|
||||||
|
## [1.5.6] - 2022-03-10
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Add bash in docker image for hooks. @fariszr
|
||||||
|
|
||||||
|
## [1.5.5] - 2022-02-16
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Go version was updated from `1.16` to `1.17`
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Home directory was not being taken into account for loading configs.
|
||||||
|
|
||||||
|
## [1.5.4] - 2022-02-16
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Lean flag not omitting all output.
|
||||||
|
|
||||||
|
## [1.5.3] - 2022-02-16
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Error throwing not finding config even it's not being used.
|
||||||
|
|
||||||
|
## [1.5.2] - 2022-02-13
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Config loading @jjromannet
|
||||||
|
- Making a backup of the file @jjromannet
|
||||||
|
|
||||||
|
## [1.5.1] - 2021-12-06
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- use official docker image instead of installing rclone every time docker is used.
|
||||||
|
- docker docs
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- lock file not always next to the config file.
|
||||||
|
- update / install bugs.
|
||||||
|
- lock docker image tag to the current autorestic version
|
||||||
|
- better error logging
|
||||||
|
|
||||||
|
## [1.5.0] - 2021-11-20
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Support for multiple paths.
|
||||||
|
- Improved error handling.
|
||||||
|
- Allow for specific snapshot to be restored.
|
||||||
|
- Docker image.
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- rclone in docker volumes.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- [Breaking Change] Declaration of docker volumes. See: https://autorestic.vercel.app/migration/1.4_1.5.
|
||||||
|
- [Breaking Change] Hooks default executing directory now defaults to the config file directory. See: https://autorestic.vercel.app/migration/1.4_1.5.
|
||||||
|
|
||||||
|
## [1.4.1] - 2021-10-31
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Numeric values from config files not being passed to env.
|
||||||
|
|
||||||
|
## [1.4.0] - 2021-10-30
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Allow specify to specify a backend for location backup.
|
||||||
|
- Global restic flags.
|
||||||
|
- Generic ENV support for backends.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Install now only requires `wget`.
|
||||||
|
- Env variable for the `KEY` has been renamed from `AUTORESTIC_[BACKEND NAME]_KEY` -> `AUTORESTIC_[BACKEND NAME]_RESTIC_PASSWORD`.
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Error handling during upgrade & uninstall.
|
||||||
|
|
||||||
|
## [1.3.0] - 2021-10-26
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Pass restic backup metadata as ENV to hooks.
|
||||||
|
- Support for `XDG_CONFIG_HOME` and `${HOME}/.config` as default locations for `.autorestic.yaml` file.
|
||||||
|
- Binary restic flags are now supported.
|
||||||
|
- Pass encryption keys from env variables or files.
|
||||||
|
|
||||||
|
## [1.2.0] - 2021-08-05
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Community page
|
||||||
|
- Support for yaml references and aliases.
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Better verbose output for hooks.
|
||||||
|
- Better error message for bad formatted configs.
|
||||||
|
|
||||||
|
## [1.1.2] - 2021-07-11
|
||||||
|
|
||||||
|
### Fixes
|
||||||
|
|
||||||
|
Don't check all backend when running `forget` or `exec` commands.
|
||||||
|
|
||||||
|
## [1.1.1] - 2021-05-17
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Options for backends.
|
||||||
|
|
||||||
|
## [1.1.0] - 2021-05-06
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- use custom restic binary.
|
||||||
|
- success & failure hooks.
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- don't skip other locations on failure.
|
||||||
|
|
||||||
|
## [1.0.9] - 2021-05-01
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Validation for docker volumes.
|
||||||
|
|
||||||
|
## [1.0.8] - 2021-04-28
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- `--lean` flag to cron command for less output about skipping backups.
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- consistent lower casing in usage descriptions.
|
||||||
|
|
||||||
|
## [1.0.7] - 2021-04-26
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Support for `darwin/arm64` aka Apple Silicon.
|
||||||
|
- Added support for `arm64` and `aarch64` in install scripts.
|
||||||
|
|
||||||
|
## [1.0.6] - 2021-04-24
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Support for rclone.
|
||||||
|
|
||||||
|
## [1.0.5] - 2021-04-24
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Correct exit code on backup failure and better logging/output/feedback.
|
||||||
|
- Check if `from` key is an actual directory.
|
||||||
|
|
||||||
## [1.0.4] - 2021-04-23
|
## [1.0.4] - 2021-04-23
|
||||||
|
|
||||||
### Added
|
### Added
|
||||||
|
|
||||||
- Options to add rest username and password in config
|
- Options to add rest username and password in config.
|
||||||
|
|
||||||
### Fixed
|
### Fixed
|
||||||
|
|
||||||
- Don't add empty strings when saving config
|
- Don't add empty strings when saving config.
|
||||||
|
|
||||||
## [1.0.3] - 2021-04-20
|
## [1.0.3] - 2021-04-20
|
||||||
|
|
||||||
### Fixed
|
### Fixed
|
||||||
|
|
||||||
- Auto upgrade script was not working on linux as linux does not support writing to the binary that is being executed
|
- Auto upgrade script was not working on linux as linux does not support writing to the binary that is being executed.
|
||||||
|
|
||||||
## [1.0.2] - 2021-04-20
|
## [1.0.2] - 2021-04-20
|
||||||
|
|
||||||
@@ -35,7 +275,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
|||||||
|
|
||||||
### Added
|
### Added
|
||||||
|
|
||||||
- Completion command for various shells
|
- Completion command for various shells.
|
||||||
|
|
||||||
## [1.0.0] - 2021-04-17
|
## [1.0.0] - 2021-04-17
|
||||||
|
|
||||||
|
|||||||
@@ -19,5 +19,12 @@ Releases are automatically built by the github workflow and uploaded to the rele
|
|||||||
1. Bump `VERSION` in `internal/config.go`.
|
1. Bump `VERSION` in `internal/config.go`.
|
||||||
2. Update `CHANGELOG.md`
|
2. Update `CHANGELOG.md`
|
||||||
3. Commit to master
|
3. Commit to master
|
||||||
4. Create a new release with the `v1.2.3` tag and mark as draft.
|
4. Create a new release with the `v1.2.3` tag and mark as pre-release.
|
||||||
5. The Github action will build the binaries, upload and mark the release as ready when done.
|
5. The Github action will build the binaries, upload and mark the release as ready when done.
|
||||||
|
|
||||||
|
### Brew
|
||||||
|
|
||||||
|
1. Download the latest release.
|
||||||
|
2. Check the checksum with `shasum -a 256 autorestic-1.2.3.tar.gz`
|
||||||
|
3. Update `url` and `sha256` in the brew repo.
|
||||||
|
4. Submit PR
|
||||||
|
|||||||
13
Dockerfile
Normal file
13
Dockerfile
Normal file
@@ -0,0 +1,13 @@
|
|||||||
|
FROM golang:1.20-alpine as builder
|
||||||
|
|
||||||
|
WORKDIR /app
|
||||||
|
COPY go.* .
|
||||||
|
RUN go mod download
|
||||||
|
COPY . .
|
||||||
|
RUN go build
|
||||||
|
|
||||||
|
FROM restic/restic:0.15.1
|
||||||
|
RUN apk add --no-cache rclone bash
|
||||||
|
COPY --from=builder /app/autorestic /usr/bin/autorestic
|
||||||
|
ENTRYPOINT []
|
||||||
|
CMD [ "autorestic" ]
|
||||||
11
README.md
11
README.md
@@ -10,6 +10,13 @@
|
|||||||
Config driven, easy backup cli for <a href="https://restic.net/">restic</a>.
|
Config driven, easy backup cli for <a href="https://restic.net/">restic</a>.
|
||||||
<br>
|
<br>
|
||||||
<strong><a href="https://autorestic.vercel.app/">»»» Docs & Getting Started »»»</a></strong>
|
<strong><a href="https://autorestic.vercel.app/">»»» Docs & Getting Started »»»</a></strong>
|
||||||
|
<br><br>
|
||||||
|
<a target="_blank" href="https://discord.gg/wS7RpYTYd2">
|
||||||
|
<img src="https://img.shields.io/discord/252403122348097536" alt="discord badge" />
|
||||||
|
<img src="https://img.shields.io/github/contributors/cupcakearmy/autorestic" alt="contributor badge" />
|
||||||
|
<img src="https://img.shields.io/github/downloads/cupcakearmy/autorestic/total" alt="downloads badge" />
|
||||||
|
<img src="https://img.shields.io/github/v/release/cupcakearmy/autorestic" alt="version badge" />
|
||||||
|
</a>
|
||||||
</p>
|
</p>
|
||||||
</p>
|
</p>
|
||||||
|
|
||||||
@@ -18,7 +25,7 @@
|
|||||||
|
|
||||||
### 💭 Why / What?
|
### 💭 Why / What?
|
||||||
|
|
||||||
Autorestic is a wrapper around the amazing [restic](https://restic.net/). While being amazing the restic cli can be a bit overwhelming and difficult to manage if you have many different location that you want to backup to multiple locations. This utility is aimed at making this easier 🙂
|
Autorestic is a wrapper around the amazing [restic](https://restic.net/). While being amazing the restic cli can be a bit overwhelming and difficult to manage if you have many different locations that you want to backup to multiple locations. This utility is aimed at making this easier 🙂.
|
||||||
|
|
||||||
### 🌈 Features
|
### 🌈 Features
|
||||||
|
|
||||||
@@ -35,7 +42,7 @@ Autorestic is a wrapper around the amazing [restic](https://restic.net/). While
|
|||||||
|
|
||||||
### ❓ Questions / Support
|
### ❓ Questions / Support
|
||||||
|
|
||||||
Check the [discussions page](https://github.com/cupcakearmy/autorestic/discussions)
|
Check the [discussions page](https://github.com/cupcakearmy/autorestic/discussions) or [join on discord](https://discord.gg/wS7RpYTYd2)
|
||||||
|
|
||||||
## Contributing / Developing
|
## Contributing / Developing
|
||||||
|
|
||||||
|
|||||||
@@ -4,11 +4,16 @@
|
|||||||
package main
|
package main
|
||||||
|
|
||||||
import (
|
import (
|
||||||
|
"crypto/md5"
|
||||||
|
"crypto/sha1"
|
||||||
|
"crypto/sha256"
|
||||||
"fmt"
|
"fmt"
|
||||||
|
"io/ioutil"
|
||||||
"os"
|
"os"
|
||||||
"os/exec"
|
"os/exec"
|
||||||
"path"
|
"path"
|
||||||
"path/filepath"
|
"path/filepath"
|
||||||
|
"sync"
|
||||||
|
|
||||||
"github.com/cupcakearmy/autorestic/internal"
|
"github.com/cupcakearmy/autorestic/internal"
|
||||||
)
|
)
|
||||||
@@ -16,23 +21,51 @@ import (
|
|||||||
var DIR, _ = filepath.Abs("./dist")
|
var DIR, _ = filepath.Abs("./dist")
|
||||||
|
|
||||||
var targets = map[string][]string{
|
var targets = map[string][]string{
|
||||||
"darwin": {"amd64"},
|
// "aix": {"ppc64"}, // Not supported by fsnotify
|
||||||
|
"darwin": {"amd64", "arm64"},
|
||||||
"freebsd": {"386", "amd64", "arm"},
|
"freebsd": {"386", "amd64", "arm"},
|
||||||
"linux": {"386", "amd64", "arm", "arm64"},
|
"linux": {"386", "amd64", "arm", "arm64", "ppc64le", "mips", "mipsle", "mips64", "mips64le", "s390x"},
|
||||||
"netbsd": {"386", "amd64"},
|
"netbsd": {"386", "amd64"},
|
||||||
"openbsd": {"386", "amd64"},
|
"openbsd": {"386", "amd64"},
|
||||||
|
// "windows": {"386", "amd64"}, // Not supported by autorestic
|
||||||
|
"solaris": {"amd64"},
|
||||||
}
|
}
|
||||||
|
|
||||||
type buildOptions struct {
|
type buildOptions struct {
|
||||||
Target, Arch, Version string
|
Target, Arch, Version string
|
||||||
}
|
}
|
||||||
|
|
||||||
func build(options buildOptions) error {
|
const (
|
||||||
fmt.Printf("Building %s %s\n", options.Target, options.Arch)
|
CHECKSUM_MD5 = "MD5SUMS"
|
||||||
|
CHECKSUM_SHA_1 = "SHA1SUMS"
|
||||||
|
CHECKSUM_SHA_256 = "SHA256SUMS"
|
||||||
|
)
|
||||||
|
|
||||||
|
type Checksums struct {
|
||||||
|
filename, md5, sha1, sha256 string
|
||||||
|
}
|
||||||
|
|
||||||
|
func writeChecksums(checksums *[]Checksums) {
|
||||||
|
FILE_MD5, _ := os.OpenFile(path.Join(DIR, CHECKSUM_MD5), os.O_CREATE|os.O_APPEND|os.O_WRONLY, 0600)
|
||||||
|
defer FILE_MD5.Close()
|
||||||
|
FILE_SHA1, _ := os.OpenFile(path.Join(DIR, CHECKSUM_SHA_1), os.O_CREATE|os.O_APPEND|os.O_WRONLY, 0600)
|
||||||
|
defer FILE_SHA1.Close()
|
||||||
|
FILE_SHA256, _ := os.OpenFile(path.Join(DIR, CHECKSUM_SHA_256), os.O_CREATE|os.O_APPEND|os.O_WRONLY, 0600)
|
||||||
|
defer FILE_SHA256.Close()
|
||||||
|
|
||||||
|
for _, checksum := range *checksums {
|
||||||
|
fmt.Fprintf(FILE_MD5, "%s %s\n", checksum.md5, checksum.filename)
|
||||||
|
fmt.Fprintf(FILE_SHA1, "%s %s\n", checksum.sha1, checksum.filename)
|
||||||
|
fmt.Fprintf(FILE_SHA256, "%s %s\n", checksum.sha256, checksum.filename)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func build(options buildOptions, wg *sync.WaitGroup, checksums *[]Checksums) {
|
||||||
|
defer wg.Done()
|
||||||
|
|
||||||
|
fmt.Printf("Building: %s %s\n", options.Target, options.Arch)
|
||||||
out := fmt.Sprintf("autorestic_%s_%s_%s", options.Version, options.Target, options.Arch)
|
out := fmt.Sprintf("autorestic_%s_%s_%s", options.Version, options.Target, options.Arch)
|
||||||
out = path.Join(DIR, out)
|
out = path.Join(DIR, out)
|
||||||
out, _ = filepath.Abs(out)
|
|
||||||
fmt.Println(out)
|
|
||||||
|
|
||||||
// Build
|
// Build
|
||||||
{
|
{
|
||||||
@@ -46,7 +79,7 @@ func build(options buildOptions) error {
|
|||||||
)
|
)
|
||||||
err := c.Run()
|
err := c.Run()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
panic(err)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -58,26 +91,42 @@ func build(options buildOptions) error {
|
|||||||
c.Stderr = os.Stderr
|
c.Stderr = os.Stderr
|
||||||
err := c.Run()
|
err := c.Run()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
panic(err)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil
|
// Checksum
|
||||||
|
{
|
||||||
|
file := out + ".bz2"
|
||||||
|
content, _ := ioutil.ReadFile(file)
|
||||||
|
*checksums = append(*checksums, Checksums{
|
||||||
|
filename: path.Base(file),
|
||||||
|
md5: fmt.Sprintf("%x", md5.Sum(content)),
|
||||||
|
sha1: fmt.Sprintf("%x", sha1.Sum(content)),
|
||||||
|
sha256: fmt.Sprintf("%x", sha256.Sum256(content)),
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Printf("Built: %s\n", path.Base(out))
|
||||||
}
|
}
|
||||||
|
|
||||||
func main() {
|
func main() {
|
||||||
os.RemoveAll(DIR)
|
os.RemoveAll(DIR)
|
||||||
v := internal.VERSION
|
v := internal.VERSION
|
||||||
|
checksums := []Checksums{}
|
||||||
|
|
||||||
|
// Build async
|
||||||
|
var wg sync.WaitGroup
|
||||||
for target, archs := range targets {
|
for target, archs := range targets {
|
||||||
for _, arch := range archs {
|
for _, arch := range archs {
|
||||||
err := build(buildOptions{
|
wg.Add(1)
|
||||||
|
go build(buildOptions{
|
||||||
Target: target,
|
Target: target,
|
||||||
Arch: arch,
|
Arch: arch,
|
||||||
Version: v,
|
Version: v,
|
||||||
})
|
}, &wg, &checksums)
|
||||||
if err != nil {
|
|
||||||
panic(err)
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
wg.Wait()
|
||||||
|
writeChecksums(&checksums)
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,7 +1,11 @@
|
|||||||
package cmd
|
package cmd
|
||||||
|
|
||||||
import (
|
import (
|
||||||
|
"fmt"
|
||||||
|
"strings"
|
||||||
|
|
||||||
"github.com/cupcakearmy/autorestic/internal"
|
"github.com/cupcakearmy/autorestic/internal"
|
||||||
|
"github.com/cupcakearmy/autorestic/internal/colors"
|
||||||
"github.com/cupcakearmy/autorestic/internal/lock"
|
"github.com/cupcakearmy/autorestic/internal/lock"
|
||||||
"github.com/spf13/cobra"
|
"github.com/spf13/cobra"
|
||||||
)
|
)
|
||||||
@@ -10,17 +14,29 @@ var backupCmd = &cobra.Command{
|
|||||||
Use: "backup",
|
Use: "backup",
|
||||||
Short: "Create backups for given locations",
|
Short: "Create backups for given locations",
|
||||||
Run: func(cmd *cobra.Command, args []string) {
|
Run: func(cmd *cobra.Command, args []string) {
|
||||||
|
internal.GetConfig()
|
||||||
err := lock.Lock()
|
err := lock.Lock()
|
||||||
CheckErr(err)
|
CheckErr(err)
|
||||||
defer lock.Unlock()
|
defer lock.Unlock()
|
||||||
|
|
||||||
CheckErr(internal.CheckConfig())
|
|
||||||
|
|
||||||
selected, err := internal.GetAllOrSelected(cmd, false)
|
selected, err := internal.GetAllOrSelected(cmd, false)
|
||||||
CheckErr(err)
|
CheckErr(err)
|
||||||
|
errors := 0
|
||||||
for _, name := range selected {
|
for _, name := range selected {
|
||||||
location, _ := internal.GetLocation(name)
|
var splitted = strings.Split(name, "@")
|
||||||
location.Backup(false)
|
var specificBackend = ""
|
||||||
|
if len(splitted) > 1 {
|
||||||
|
specificBackend = splitted[1]
|
||||||
|
}
|
||||||
|
location, _ := internal.GetLocation(splitted[0])
|
||||||
|
errs := location.Backup(false, specificBackend)
|
||||||
|
for _, err := range errs {
|
||||||
|
colors.Error.Printf("%s\n\n", err)
|
||||||
|
errors++
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if errors > 0 {
|
||||||
|
CheckErr(fmt.Errorf("%d errors were found", errors))
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -11,13 +11,14 @@ var checkCmd = &cobra.Command{
|
|||||||
Use: "check",
|
Use: "check",
|
||||||
Short: "Check if everything is setup",
|
Short: "Check if everything is setup",
|
||||||
Run: func(cmd *cobra.Command, args []string) {
|
Run: func(cmd *cobra.Command, args []string) {
|
||||||
|
internal.GetConfig()
|
||||||
err := lock.Lock()
|
err := lock.Lock()
|
||||||
CheckErr(err)
|
CheckErr(err)
|
||||||
defer lock.Unlock()
|
defer lock.Unlock()
|
||||||
|
|
||||||
CheckErr(internal.CheckConfig())
|
CheckErr(internal.CheckConfig())
|
||||||
|
|
||||||
colors.Success.Println("Everyting is fine.")
|
colors.Success.Println("Everything is fine.")
|
||||||
},
|
},
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -2,6 +2,7 @@ package cmd
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"github.com/cupcakearmy/autorestic/internal"
|
"github.com/cupcakearmy/autorestic/internal"
|
||||||
|
"github.com/cupcakearmy/autorestic/internal/flags"
|
||||||
"github.com/cupcakearmy/autorestic/internal/lock"
|
"github.com/cupcakearmy/autorestic/internal/lock"
|
||||||
"github.com/spf13/cobra"
|
"github.com/spf13/cobra"
|
||||||
)
|
)
|
||||||
@@ -11,6 +12,7 @@ var cronCmd = &cobra.Command{
|
|||||||
Short: "Run cron job for automated backups",
|
Short: "Run cron job for automated backups",
|
||||||
Long: `Intended to be mainly triggered by an automated system like systemd or crontab. For each location checks if a cron backup is due and runs it.`,
|
Long: `Intended to be mainly triggered by an automated system like systemd or crontab. For each location checks if a cron backup is due and runs it.`,
|
||||||
Run: func(cmd *cobra.Command, args []string) {
|
Run: func(cmd *cobra.Command, args []string) {
|
||||||
|
internal.GetConfig()
|
||||||
err := lock.Lock()
|
err := lock.Lock()
|
||||||
CheckErr(err)
|
CheckErr(err)
|
||||||
defer lock.Unlock()
|
defer lock.Unlock()
|
||||||
@@ -22,4 +24,5 @@ var cronCmd = &cobra.Command{
|
|||||||
|
|
||||||
func init() {
|
func init() {
|
||||||
rootCmd.AddCommand(cronCmd)
|
rootCmd.AddCommand(cronCmd)
|
||||||
|
cronCmd.Flags().BoolVar(&flags.CRON_LEAN, "lean", false, "only output information about actual backups")
|
||||||
}
|
}
|
||||||
|
|||||||
20
cmd/exec.go
20
cmd/exec.go
@@ -1,6 +1,8 @@
|
|||||||
package cmd
|
package cmd
|
||||||
|
|
||||||
import (
|
import (
|
||||||
|
"fmt"
|
||||||
|
|
||||||
"github.com/cupcakearmy/autorestic/internal"
|
"github.com/cupcakearmy/autorestic/internal"
|
||||||
"github.com/cupcakearmy/autorestic/internal/colors"
|
"github.com/cupcakearmy/autorestic/internal/colors"
|
||||||
"github.com/cupcakearmy/autorestic/internal/lock"
|
"github.com/cupcakearmy/autorestic/internal/lock"
|
||||||
@@ -11,18 +13,30 @@ var execCmd = &cobra.Command{
|
|||||||
Use: "exec",
|
Use: "exec",
|
||||||
Short: "Execute arbitrary native restic commands for given backends",
|
Short: "Execute arbitrary native restic commands for given backends",
|
||||||
Run: func(cmd *cobra.Command, args []string) {
|
Run: func(cmd *cobra.Command, args []string) {
|
||||||
|
internal.GetConfig()
|
||||||
err := lock.Lock()
|
err := lock.Lock()
|
||||||
CheckErr(err)
|
CheckErr(err)
|
||||||
defer lock.Unlock()
|
defer lock.Unlock()
|
||||||
|
|
||||||
CheckErr(internal.CheckConfig())
|
|
||||||
|
|
||||||
selected, err := internal.GetAllOrSelected(cmd, true)
|
selected, err := internal.GetAllOrSelected(cmd, true)
|
||||||
CheckErr(err)
|
CheckErr(err)
|
||||||
|
|
||||||
|
var errors []error
|
||||||
for _, name := range selected {
|
for _, name := range selected {
|
||||||
colors.PrimaryPrint(" Executing on \"%s\" ", name)
|
colors.PrimaryPrint(" Executing on \"%s\" ", name)
|
||||||
backend, _ := internal.GetBackend(name)
|
backend, _ := internal.GetBackend(name)
|
||||||
backend.Exec(args)
|
err := backend.Exec(args)
|
||||||
|
if err != nil {
|
||||||
|
errors = append(errors, err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if len(errors) > 0 {
|
||||||
|
for _, err := range errors {
|
||||||
|
colors.Error.Printf("%s\n\n", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
CheckErr(fmt.Errorf("%d errors were found", len(errors)))
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -10,12 +10,11 @@ var forgetCmd = &cobra.Command{
|
|||||||
Use: "forget",
|
Use: "forget",
|
||||||
Short: "Forget and optionally prune snapshots according the specified policies",
|
Short: "Forget and optionally prune snapshots according the specified policies",
|
||||||
Run: func(cmd *cobra.Command, args []string) {
|
Run: func(cmd *cobra.Command, args []string) {
|
||||||
|
internal.GetConfig()
|
||||||
err := lock.Lock()
|
err := lock.Lock()
|
||||||
CheckErr(err)
|
CheckErr(err)
|
||||||
defer lock.Unlock()
|
defer lock.Unlock()
|
||||||
|
|
||||||
CheckErr(internal.CheckConfig())
|
|
||||||
|
|
||||||
selected, err := internal.GetAllOrSelected(cmd, false)
|
selected, err := internal.GetAllOrSelected(cmd, false)
|
||||||
CheckErr(err)
|
CheckErr(err)
|
||||||
prune, _ := cmd.Flags().GetBool("prune")
|
prune, _ := cmd.Flags().GetBool("prune")
|
||||||
@@ -31,6 +30,6 @@ var forgetCmd = &cobra.Command{
|
|||||||
func init() {
|
func init() {
|
||||||
rootCmd.AddCommand(forgetCmd)
|
rootCmd.AddCommand(forgetCmd)
|
||||||
internal.AddFlagsToCommand(forgetCmd, false)
|
internal.AddFlagsToCommand(forgetCmd, false)
|
||||||
forgetCmd.Flags().Bool("prune", false, "Also prune repository")
|
forgetCmd.Flags().Bool("prune", false, "also prune repository")
|
||||||
forgetCmd.Flags().Bool("dry-run", false, "Do not write changes, show what would be affected")
|
forgetCmd.Flags().Bool("dry-run", false, "do not write changes, show what would be affected")
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -9,9 +9,11 @@ import (
|
|||||||
)
|
)
|
||||||
|
|
||||||
var restoreCmd = &cobra.Command{
|
var restoreCmd = &cobra.Command{
|
||||||
Use: "restore",
|
Use: "restore [snapshot id]",
|
||||||
Short: "Restore backup for location",
|
Short: "Restore backup for location",
|
||||||
|
Args: cobra.MaximumNArgs(1),
|
||||||
Run: func(cmd *cobra.Command, args []string) {
|
Run: func(cmd *cobra.Command, args []string) {
|
||||||
|
internal.GetConfig()
|
||||||
err := lock.Lock()
|
err := lock.Lock()
|
||||||
CheckErr(err)
|
CheckErr(err)
|
||||||
defer lock.Unlock()
|
defer lock.Unlock()
|
||||||
@@ -24,7 +26,23 @@ var restoreCmd = &cobra.Command{
|
|||||||
target, _ := cmd.Flags().GetString("to")
|
target, _ := cmd.Flags().GetString("to")
|
||||||
from, _ := cmd.Flags().GetString("from")
|
from, _ := cmd.Flags().GetString("from")
|
||||||
force, _ := cmd.Flags().GetBool("force")
|
force, _ := cmd.Flags().GetBool("force")
|
||||||
err = l.Restore(target, from, force)
|
snapshot := ""
|
||||||
|
if len(args) > 0 {
|
||||||
|
snapshot = args[0]
|
||||||
|
}
|
||||||
|
|
||||||
|
// Get optional flags
|
||||||
|
optional := []string{}
|
||||||
|
for _, flag := range []string{"include", "exclude", "iinclude", "iexclude"} {
|
||||||
|
values, err := cmd.Flags().GetStringSlice(flag)
|
||||||
|
if err == nil {
|
||||||
|
for _, value := range values {
|
||||||
|
optional = append(optional, "--"+flag, value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
err = l.Restore(target, from, force, snapshot, optional)
|
||||||
CheckErr(err)
|
CheckErr(err)
|
||||||
},
|
},
|
||||||
}
|
}
|
||||||
@@ -36,4 +54,10 @@ func init() {
|
|||||||
restoreCmd.Flags().String("to", "", "Where to restore the data")
|
restoreCmd.Flags().String("to", "", "Where to restore the data")
|
||||||
restoreCmd.Flags().StringP("location", "l", "", "Location to be restored")
|
restoreCmd.Flags().StringP("location", "l", "", "Location to be restored")
|
||||||
restoreCmd.MarkFlagRequired("location")
|
restoreCmd.MarkFlagRequired("location")
|
||||||
|
|
||||||
|
// Passed on flags
|
||||||
|
restoreCmd.Flags().StringSliceP("include", "i", []string{}, "Include a pattern")
|
||||||
|
restoreCmd.Flags().StringSliceP("exclude", "e", []string{}, "Exclude a pattern")
|
||||||
|
restoreCmd.Flags().StringSlice("iinclude", []string{}, "Include a pattern, case insensitive")
|
||||||
|
restoreCmd.Flags().StringSlice("iexclude", []string{}, "Exclude a pattern, case insensitive")
|
||||||
}
|
}
|
||||||
|
|||||||
51
cmd/root.go
51
cmd/root.go
@@ -2,9 +2,12 @@ package cmd
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"os"
|
"os"
|
||||||
|
"path/filepath"
|
||||||
|
"strings"
|
||||||
|
|
||||||
"github.com/cupcakearmy/autorestic/internal"
|
"github.com/cupcakearmy/autorestic/internal"
|
||||||
"github.com/cupcakearmy/autorestic/internal/colors"
|
"github.com/cupcakearmy/autorestic/internal/colors"
|
||||||
|
"github.com/cupcakearmy/autorestic/internal/flags"
|
||||||
"github.com/cupcakearmy/autorestic/internal/lock"
|
"github.com/cupcakearmy/autorestic/internal/lock"
|
||||||
"github.com/spf13/cobra"
|
"github.com/spf13/cobra"
|
||||||
|
|
||||||
@@ -26,7 +29,7 @@ var rootCmd = &cobra.Command{
|
|||||||
Version: internal.VERSION,
|
Version: internal.VERSION,
|
||||||
Use: "autorestic",
|
Use: "autorestic",
|
||||||
Short: "CLI Wrapper for restic",
|
Short: "CLI Wrapper for restic",
|
||||||
Long: "Documentation: https://autorestic.vercel.app",
|
Long: "Documentation:\thttps://autorestic.vercel.app\nSupport:\thttps://discord.gg/wS7RpYTYd2",
|
||||||
}
|
}
|
||||||
|
|
||||||
func Execute() {
|
func Execute() {
|
||||||
@@ -35,27 +38,53 @@ func Execute() {
|
|||||||
|
|
||||||
func init() {
|
func init() {
|
||||||
rootCmd.PersistentFlags().StringVarP(&cfgFile, "config", "c", "", "config file (default is $HOME/.autorestic.yml or ./.autorestic.yml)")
|
rootCmd.PersistentFlags().StringVarP(&cfgFile, "config", "c", "", "config file (default is $HOME/.autorestic.yml or ./.autorestic.yml)")
|
||||||
rootCmd.PersistentFlags().BoolVar(&internal.CI, "ci", false, "CI mode disabled interactive mode and colors and enables verbosity")
|
rootCmd.PersistentFlags().BoolVar(&flags.CI, "ci", false, "CI mode disabled interactive mode and colors and enables verbosity")
|
||||||
rootCmd.PersistentFlags().BoolVarP(&internal.VERBOSE, "verbose", "v", false, "verbose mode")
|
rootCmd.PersistentFlags().BoolVarP(&flags.VERBOSE, "verbose", "v", false, "verbose mode")
|
||||||
|
rootCmd.PersistentFlags().StringVar(&flags.RESTIC_BIN, "restic-bin", "restic", "specify custom restic binary")
|
||||||
|
rootCmd.PersistentFlags().StringVar(&flags.DOCKER_IMAGE, "docker-image", "cupcakearmy/autorestic:"+internal.VERSION, "specify a custom docker image")
|
||||||
cobra.OnInitialize(initConfig)
|
cobra.OnInitialize(initConfig)
|
||||||
}
|
}
|
||||||
|
|
||||||
func initConfig() {
|
func initConfig() {
|
||||||
if ci, _ := rootCmd.Flags().GetBool("ci"); ci {
|
if ci, _ := rootCmd.Flags().GetBool("ci"); ci {
|
||||||
colors.DisableColors(true)
|
colors.DisableColors(true)
|
||||||
internal.VERBOSE = true
|
flags.VERBOSE = true
|
||||||
}
|
}
|
||||||
|
|
||||||
if cfgFile != "" {
|
if cfgFile != "" {
|
||||||
viper.SetConfigFile(cfgFile)
|
viper.SetConfigFile(cfgFile)
|
||||||
|
viper.AutomaticEnv()
|
||||||
|
if viper.ConfigFileUsed() == "" {
|
||||||
|
colors.Error.Printf("cannot read config file %s\n", cfgFile)
|
||||||
|
os.Exit(1)
|
||||||
|
}
|
||||||
} else {
|
} else {
|
||||||
home, err := homedir.Dir()
|
configPaths := []string{"."}
|
||||||
CheckErr(err)
|
|
||||||
|
|
||||||
viper.AddConfigPath(".")
|
// Home
|
||||||
viper.AddConfigPath(home)
|
if home, err := homedir.Dir(); err == nil {
|
||||||
viper.SetConfigName(".autorestic")
|
configPaths = append(configPaths, home)
|
||||||
|
}
|
||||||
|
|
||||||
|
// XDG_CONFIG_HOME
|
||||||
|
{
|
||||||
|
prefix, found := os.LookupEnv("XDG_CONFIG_HOME")
|
||||||
|
if !found {
|
||||||
|
if home, err := homedir.Dir(); err != nil {
|
||||||
|
prefix = filepath.Join(home, ".config")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
xdgConfig := filepath.Join(prefix, "autorestic")
|
||||||
|
configPaths = append(configPaths, xdgConfig)
|
||||||
|
}
|
||||||
|
for _, cfgPath := range configPaths {
|
||||||
|
viper.AddConfigPath(cfgPath)
|
||||||
|
}
|
||||||
|
if flags.VERBOSE {
|
||||||
|
colors.Faint.Printf("Using config paths: %s\n", strings.Join(configPaths, " "))
|
||||||
|
}
|
||||||
|
cfgFileName := ".autorestic"
|
||||||
|
viper.SetConfigName(cfgFileName)
|
||||||
|
viper.AutomaticEnv()
|
||||||
}
|
}
|
||||||
viper.AutomaticEnv()
|
|
||||||
internal.GetConfig()
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -9,12 +9,12 @@ var uninstallCmd = &cobra.Command{
|
|||||||
Use: "uninstall",
|
Use: "uninstall",
|
||||||
Short: "Uninstall restic and autorestic",
|
Short: "Uninstall restic and autorestic",
|
||||||
Run: func(cmd *cobra.Command, args []string) {
|
Run: func(cmd *cobra.Command, args []string) {
|
||||||
noRestic, _ := cmd.Flags().GetBool("no-restic")
|
restic, _ := cmd.Flags().GetBool("restic")
|
||||||
bins.Uninstall(!noRestic)
|
bins.Uninstall(restic)
|
||||||
},
|
},
|
||||||
}
|
}
|
||||||
|
|
||||||
func init() {
|
func init() {
|
||||||
rootCmd.AddCommand(uninstallCmd)
|
rootCmd.AddCommand(uninstallCmd)
|
||||||
uninstallCmd.Flags().Bool("no-restic", false, "Do not uninstall restic.")
|
uninstallCmd.Flags().Bool("restic", false, "also uninstall restic.")
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -9,13 +9,13 @@ var upgradeCmd = &cobra.Command{
|
|||||||
Use: "upgrade",
|
Use: "upgrade",
|
||||||
Short: "Upgrade autorestic and restic",
|
Short: "Upgrade autorestic and restic",
|
||||||
Run: func(cmd *cobra.Command, args []string) {
|
Run: func(cmd *cobra.Command, args []string) {
|
||||||
noRestic, _ := cmd.Flags().GetBool("no-restic")
|
restic, _ := cmd.Flags().GetBool("restic")
|
||||||
err := bins.Upgrade(!noRestic)
|
err := bins.Upgrade(restic)
|
||||||
CheckErr(err)
|
CheckErr(err)
|
||||||
},
|
},
|
||||||
}
|
}
|
||||||
|
|
||||||
func init() {
|
func init() {
|
||||||
rootCmd.AddCommand(upgradeCmd)
|
rootCmd.AddCommand(upgradeCmd)
|
||||||
upgradeCmd.Flags().Bool("no-restic", false, "Also update restic. Default: true")
|
upgradeCmd.Flags().Bool("restic", true, "also update restic")
|
||||||
}
|
}
|
||||||
|
|||||||
9771
docs/.codedoc/package-lock.json
generated
9771
docs/.codedoc/package-lock.json
generated
File diff suppressed because it is too large
Load Diff
@@ -1,5 +1,5 @@
|
|||||||
{
|
{
|
||||||
"dependencies": {
|
"dependencies": {
|
||||||
"@codedoc/core": "^0.2.23"
|
"@codedoc/core": "^0.3.2"
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,5 +1,6 @@
|
|||||||
[Home](/)
|
[Home](/)
|
||||||
[Quick Start](/quick)
|
[Quick Start](/quick)
|
||||||
|
[Installation](/installation)
|
||||||
[Configuration](/config)
|
[Configuration](/config)
|
||||||
[Upgrade](/upgrade)
|
[Upgrade](/upgrade)
|
||||||
|
|
||||||
@@ -7,8 +8,14 @@
|
|||||||
>
|
>
|
||||||
> [Overview](/location/overview)
|
> [Overview](/location/overview)
|
||||||
> [Hooks](/location/hooks)
|
> [Hooks](/location/hooks)
|
||||||
> [Excluding Files](/location/exclude)
|
>
|
||||||
> [Forget Policy](/location/forget)
|
> > :Collapse label=Options
|
||||||
|
> >
|
||||||
|
> > [Overview](/location/options)
|
||||||
|
> > [Excluding Files](/location/exclude)
|
||||||
|
> > [Forget Policy](/location/forget)
|
||||||
|
> > [Copy](/location/copy)
|
||||||
|
>
|
||||||
> [Cron](/location/cron)
|
> [Cron](/location/cron)
|
||||||
> [Docker Volumes](/location/docker)
|
> [Docker Volumes](/location/docker)
|
||||||
|
|
||||||
@@ -16,12 +23,15 @@
|
|||||||
>
|
>
|
||||||
> [Overview](/backend/overview)
|
> [Overview](/backend/overview)
|
||||||
> [Available Backends](/backend/available)
|
> [Available Backends](/backend/available)
|
||||||
|
> [Options](/backend/options)
|
||||||
|
> [Environment](/backend/env)
|
||||||
|
|
||||||
> :Collapse label=CLI
|
> :Collapse label=CLI
|
||||||
>
|
>
|
||||||
> [General](/cli/general)
|
> [General](/cli/general)
|
||||||
> [Info](/cli/info)
|
> [Info](/cli/info)
|
||||||
> [Check](/cli/check)
|
> [Check](/cli/check)
|
||||||
|
> [Completion](/cli/completion)
|
||||||
> [Backup](/cli/backup)
|
> [Backup](/cli/backup)
|
||||||
> [Restore](/cli/restore)
|
> [Restore](/cli/restore)
|
||||||
> [Forget](/cli/forget)
|
> [Forget](/cli/forget)
|
||||||
@@ -29,10 +39,16 @@
|
|||||||
> [Exec](/cli/exec)
|
> [Exec](/cli/exec)
|
||||||
> [Install](/cli/install)
|
> [Install](/cli/install)
|
||||||
> [Uninstall](/cli/uninstall)
|
> [Uninstall](/cli/uninstall)
|
||||||
> [Update](/cli/update)
|
> [Upgrade](/cli/upgrade)
|
||||||
|
|
||||||
|
> :Collapse label=Migration
|
||||||
|
>
|
||||||
|
> [0.x → 1.0](/migration/0.x_1.0)
|
||||||
|
> [1.4 → 1.5](/migration/1.4_1.5)
|
||||||
|
|
||||||
[Examples](/examples)
|
[Examples](/examples)
|
||||||
|
[Docker](/docker)
|
||||||
[QA](/qa)
|
[QA](/qa)
|
||||||
|
[Community](/community)
|
||||||
[Contributors](/contrib)
|
[Contributors](/contrib)
|
||||||
|
|
||||||
|
|||||||
@@ -4,6 +4,8 @@ In theory [all the restic backends](https://restic.readthedocs.io/en/stable/030_
|
|||||||
|
|
||||||
Those tested are the following:
|
Those tested are the following:
|
||||||
|
|
||||||
|
> ℹ️ You can also [specify the `env` variables in a config file](/backend/env) to separate them from the config file.
|
||||||
|
|
||||||
## Local
|
## Local
|
||||||
|
|
||||||
```yaml
|
```yaml
|
||||||
@@ -19,16 +21,17 @@ backends:
|
|||||||
backends:
|
backends:
|
||||||
name-of-backend:
|
name-of-backend:
|
||||||
type: b2
|
type: b2
|
||||||
path: 'myAccount:myBucket/my/path'
|
path: 'bucket_name'
|
||||||
|
# Or With a path
|
||||||
|
# path: 'bucket_name:/some/path'
|
||||||
env:
|
env:
|
||||||
B2_ACCOUNT_ID: backblaze_account_id
|
B2_ACCOUNT_ID: 'backblaze_keyID'
|
||||||
B2_ACCOUNT_KEY: backblaze_account_key
|
B2_ACCOUNT_KEY: 'backblaze_applicationKey'
|
||||||
```
|
```
|
||||||
|
|
||||||
#### API Keys gotcha
|
#### API Keys gotcha
|
||||||
|
|
||||||
When creating API make sure you check _Allow List All Bucket Names_ if you allow access to a single bucket only.
|
If you use a _File name prefix_ when making the application key, do not include a leading slash. Make sure to include this prefix in the path (e.g. `path: 'bucket_name:my/path'`).
|
||||||
Also make sure that the _File name prefix_ (if used) does not includes a leading slash.
|
|
||||||
|
|
||||||
## S3 / Minio
|
## S3 / Minio
|
||||||
|
|
||||||
|
|||||||
67
docs/markdown/backend/env.md
Normal file
67
docs/markdown/backend/env.md
Normal file
@@ -0,0 +1,67 @@
|
|||||||
|
# Environment
|
||||||
|
|
||||||
|
> ⚠ Available since version `v1.4.0`
|
||||||
|
|
||||||
|
Sometimes it's favorable not having the encryption keys in the config files.
|
||||||
|
For that `autorestic` allows passing the env variables to backend password as `ENV` variables, or through an env file.
|
||||||
|
You can also pass whatever `env` variable to restic by prefixing it with `AUTORESTIC_[BACKEND NAME]_`.
|
||||||
|
|
||||||
|
> ℹ️ Env variables and file overwrite the config file in the following order:
|
||||||
|
>
|
||||||
|
> Env Variables > Env File (`.autorestic.env`) > Config file (`.autorestic.yaml`)
|
||||||
|
|
||||||
|
## Env file
|
||||||
|
|
||||||
|
Alternatively `autorestic` can load an env file, located next to `.autorestic.yml` called `.autorestic.env`.
|
||||||
|
|
||||||
|
```
|
||||||
|
AUTORESTIC_FOO_RESTIC_PASSWORD=secret123
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example with repository password
|
||||||
|
|
||||||
|
The syntax for the `ENV` variables is as follows: `AUTORESTIC_[BACKEND NAME]_RESTIC_PASSWORD`.
|
||||||
|
|
||||||
|
```yaml | autorestic.yaml
|
||||||
|
backend:
|
||||||
|
foo:
|
||||||
|
type: ...
|
||||||
|
path: ...
|
||||||
|
key: secret123 # => AUTORESTIC_FOO_RESTIC_PASSWORD=secret123
|
||||||
|
```
|
||||||
|
|
||||||
|
This means we could remove `key: secret123` from `.autorestic.yaml` and execute as follows:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
AUTORESTIC_FOO_RESTIC_PASSWORD=secret123 autorestic backup ...
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example with Backblaze B2
|
||||||
|
|
||||||
|
```yaml | autorestic.yaml
|
||||||
|
backends:
|
||||||
|
bb:
|
||||||
|
type: b2
|
||||||
|
path: myBucket
|
||||||
|
key: myPassword
|
||||||
|
env:
|
||||||
|
B2_ACCOUNT_ID: 123
|
||||||
|
B2_ACCOUNT_KEY: 456
|
||||||
|
```
|
||||||
|
|
||||||
|
You could create an `.autorestic.env` or pass the following `ENV` variables to autorestic:
|
||||||
|
|
||||||
|
```
|
||||||
|
AUTORESTIC_BB_RESTIC_PASSWORD=myPassword
|
||||||
|
AUTORESTIC_BB_B2_ACCOUNT_ID=123
|
||||||
|
AUTORESTIC_BB_B2_ACCOUNT_KEY=456
|
||||||
|
```
|
||||||
|
|
||||||
|
```yaml | autorestic.yaml
|
||||||
|
backends:
|
||||||
|
bb:
|
||||||
|
type: b2
|
||||||
|
path: myBucket
|
||||||
|
```
|
||||||
|
|
||||||
|
> :ToCPrevNext
|
||||||
19
docs/markdown/backend/options.md
Normal file
19
docs/markdown/backend/options.md
Normal file
@@ -0,0 +1,19 @@
|
|||||||
|
# Options
|
||||||
|
|
||||||
|
> ℹ️ For more detail see the [location docs](/location/options) for options, as they are the same.
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
backend:
|
||||||
|
foo:
|
||||||
|
type: ...
|
||||||
|
path: ...
|
||||||
|
options:
|
||||||
|
backup:
|
||||||
|
tag:
|
||||||
|
- foo
|
||||||
|
- bar
|
||||||
|
```
|
||||||
|
|
||||||
|
In this example, whenever `autorestic` runs `restic backup` it will append a `--tag abc --tag` to the native command.
|
||||||
|
|
||||||
|
> :ToCPrevNext
|
||||||
@@ -2,7 +2,11 @@
|
|||||||
|
|
||||||
Backends are the outputs of the backup process. Each location needs at least one.
|
Backends are the outputs of the backup process. Each location needs at least one.
|
||||||
|
|
||||||
|
Note: names of backends MUST be lower case!
|
||||||
|
|
||||||
```yaml | .autorestic.yml
|
```yaml | .autorestic.yml
|
||||||
|
version: 2
|
||||||
|
|
||||||
backends:
|
backends:
|
||||||
name-of-backend:
|
name-of-backend:
|
||||||
type: local
|
type: local
|
||||||
|
|||||||
@@ -14,4 +14,12 @@ autorestic backup -a
|
|||||||
autorestic backup -l foo -l bar
|
autorestic backup -l foo -l bar
|
||||||
```
|
```
|
||||||
|
|
||||||
|
## Specific location
|
||||||
|
|
||||||
|
`autorestic` also allows selecting specific backends for a location with the `location@backend` syntax.
|
||||||
|
|
||||||
|
```bash
|
||||||
|
autorestic backup -l location@backend
|
||||||
|
```
|
||||||
|
|
||||||
> :ToCPrevNext
|
> :ToCPrevNext
|
||||||
|
|||||||
17
docs/markdown/cli/completion.md
Normal file
17
docs/markdown/cli/completion.md
Normal file
@@ -0,0 +1,17 @@
|
|||||||
|
# Completion
|
||||||
|
|
||||||
|
```bash
|
||||||
|
autorestic completion [bash|zsh|fish|powershell]
|
||||||
|
```
|
||||||
|
|
||||||
|
Autorestic can generate shell completions automatically to make the experience even easier.
|
||||||
|
Supported shells are
|
||||||
|
|
||||||
|
- bash
|
||||||
|
- zsh
|
||||||
|
- fish
|
||||||
|
- powershell
|
||||||
|
|
||||||
|
To see how to install run `autorestic help completion` and follow the instructions for your specific shell
|
||||||
|
|
||||||
|
> :ToCPrevNext
|
||||||
@@ -1,11 +1,13 @@
|
|||||||
# Cron
|
# Cron
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
autorestic cron
|
autorestic cron [--lean]
|
||||||
```
|
```
|
||||||
|
|
||||||
This command is mostly intended to be triggered by an automated system like systemd or crontab.
|
This command is mostly intended to be triggered by an automated system like systemd or crontab.
|
||||||
|
|
||||||
It will run cron jobs es [specified in the cron section](/locations/cron) of a specific location.
|
It will run cron jobs as [specified in the cron section](/location/cron) of a specific location.
|
||||||
|
|
||||||
|
The `--lean` flag will omit output like _skipping location x: not due yet_. This can be useful if you are dumping the output of the cron job to a log file and don't want to be overwhelmed by the output log.
|
||||||
|
|
||||||
> :ToCPrevNext
|
> :ToCPrevNext
|
||||||
|
|||||||
@@ -4,10 +4,10 @@
|
|||||||
autorestic exec [-b, --backend] [-a, --all] <command> -- [native options]
|
autorestic exec [-b, --backend] [-a, --all] <command> -- [native options]
|
||||||
```
|
```
|
||||||
|
|
||||||
This is avery handy command which enables you to run any native restic command on desired backends. An example would be listing all the snapshots of all your backends:
|
This is a very handy command which enables you to run any native restic command on desired backends. Generally you will want to include the verbose flag `-v, --verbose` to see the output. An example would be listing all the snapshots of all your backends:
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
autorestic exec -a -- snapshots
|
autorestic exec -av -- snapshots
|
||||||
```
|
```
|
||||||
|
|
||||||
With `exec` you can basically run every cli command that you would be able to run with the restic cli. It only pre-fills path, key, etc.
|
With `exec` you can basically run every cli command that you would be able to run with the restic cli. It only pre-fills path, key, etc.
|
||||||
|
|||||||
@@ -4,7 +4,7 @@
|
|||||||
autorestic forget [-l, --location] [-a, --all] [--dry-run] [--prune]
|
autorestic forget [-l, --location] [-a, --all] [--dry-run] [--prune]
|
||||||
```
|
```
|
||||||
|
|
||||||
This will prune and remove old data form the backends according to the [keep policy you have specified for the location](/location/forget)
|
This will prune and remove old data form the backends according to the [keep policy you have specified for the location](/location/forget).
|
||||||
|
|
||||||
The `--dry-run` flag will do a dry run showing what would have been deleted, but won't touch the actual data.
|
The `--dry-run` flag will do a dry run showing what would have been deleted, but won't touch the actual data.
|
||||||
|
|
||||||
|
|||||||
@@ -2,7 +2,7 @@
|
|||||||
|
|
||||||
## `-c, --config`
|
## `-c, --config`
|
||||||
|
|
||||||
Specify the config file to be used.
|
Specify the config file to be used (must use .yml as an extension).
|
||||||
If omitted `autorestic` will search for for a `.autorestic.yml` in the current directory and your home directory.
|
If omitted `autorestic` will search for for a `.autorestic.yml` in the current directory and your home directory.
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
@@ -27,4 +27,12 @@ Verbose mode will show the output of the native restic commands that are otherwi
|
|||||||
autorestic --verbose backup -a
|
autorestic --verbose backup -a
|
||||||
```
|
```
|
||||||
|
|
||||||
|
## `--restic-bin`
|
||||||
|
|
||||||
|
With `--restic-bin` you can specify to run a specific restic binary. This can be useful if you want to [create a custom binary with root access that can be executed by any user](https://restic.readthedocs.io/en/stable/080_examples.html#full-backup-without-root).
|
||||||
|
|
||||||
|
```bash
|
||||||
|
autorestic --restic-bin /some/path/to/my/custom/restic/binary
|
||||||
|
```
|
||||||
|
|
||||||
> :ToCPrevNext
|
> :ToCPrevNext
|
||||||
|
|||||||
@@ -1,12 +1,12 @@
|
|||||||
# Restore
|
# Restore
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
autorestic restore [-l, --location] [--from backend] [--to <out dir>] [-f, --force]
|
autorestic restore [-l, --location] [--from backend] [--to <out dir>] [-f, --force] [snapshot]
|
||||||
```
|
```
|
||||||
|
|
||||||
This will restore all the locations to the selected target. If for one location there are more than one backends specified autorestic will take the first one.
|
This will restore the location to the selected target. If for one location there are more than one backends specified autorestic will take the first one. If no specific snapshot is specified `autorestic` will use `latest`.
|
||||||
|
|
||||||
The `--to` path das to be empty as no data will be overwritten by default. If you are sure you can pass the `-f, --force` flag and the data will be overwritten in the destination. However note that this will overwrite all the data existent in the backup, not only the 1 file that is missing e.g.
|
If you are sure you can pass the `-f, --force` flag and the data will be overwritten in the destination. However note that this will overwrite all the data existent in the backup, not only the 1 file that is missing e.g.
|
||||||
|
|
||||||
## Example
|
## Example
|
||||||
|
|
||||||
|
|||||||
@@ -1,6 +1,6 @@
|
|||||||
# Uninstall
|
# Uninstall
|
||||||
|
|
||||||
Installs both restic and autorestic from `/usr/local/bin`.
|
Uninstalls both restic and autorestic from `/usr/local/bin`.
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
autorestic uninstall
|
autorestic uninstall
|
||||||
|
|||||||
@@ -1,11 +0,0 @@
|
|||||||
# Update
|
|
||||||
|
|
||||||
Autorestic can update itself! Super handy right? Simply run autorestic update and we will check for you if there are updates for restic and autorestic and install them if necessary.
|
|
||||||
|
|
||||||
```bash
|
|
||||||
autorestic update
|
|
||||||
```
|
|
||||||
|
|
||||||
Updates both restic and autorestic automagically.
|
|
||||||
|
|
||||||
> :ToCPrevNext
|
|
||||||
11
docs/markdown/cli/upgrade.md
Normal file
11
docs/markdown/cli/upgrade.md
Normal file
@@ -0,0 +1,11 @@
|
|||||||
|
# Upgrade
|
||||||
|
|
||||||
|
Autorestic can upgrade itself! Super handy right? Simply run autorestic upgrade and we will check for you if there are updates for restic and autorestic and install them if necessary.
|
||||||
|
|
||||||
|
```bash
|
||||||
|
autorestic upgrade
|
||||||
|
```
|
||||||
|
|
||||||
|
Updates both restic and autorestic automagically.
|
||||||
|
|
||||||
|
> :ToCPrevNext
|
||||||
13
docs/markdown/community.md
Normal file
13
docs/markdown/community.md
Normal file
@@ -0,0 +1,13 @@
|
|||||||
|
# 🏘 Community
|
||||||
|
|
||||||
|
A list of community driven projects. (No official affiliation)
|
||||||
|
|
||||||
|
- SystemD Units: <https://gitlab.com/py_crash/autorestic-systemd-units>
|
||||||
|
- Docker image: <https://github.com/pascaliske/docker-autorestic>
|
||||||
|
- Ansible Role: <https://github.com/adsanz/ansible-restic-role>
|
||||||
|
- Ansible Role: <https://github.com/ItsNotGoodName/ansible-role-autorestic>
|
||||||
|
- Ansible Role: <https://github.com/FuzzyMistborn/ansible-role-autorestic>
|
||||||
|
- Ansible Role: <https://0xacab.org/varac-projects/ansible-role-autorestic>
|
||||||
|
- Ansible Role: <https://github.com/dbrennand/ansible-role-autorestic>
|
||||||
|
|
||||||
|
> :ToCPrevNext
|
||||||
@@ -16,6 +16,8 @@ You can also specify a custom file with the `-c path/to/some/config.yml`
|
|||||||
## Example configuration
|
## Example configuration
|
||||||
|
|
||||||
```yaml | .autorestic.yml
|
```yaml | .autorestic.yml
|
||||||
|
version: 2
|
||||||
|
|
||||||
locations:
|
locations:
|
||||||
home:
|
home:
|
||||||
from: /home/me
|
from: /home/me
|
||||||
@@ -31,12 +33,55 @@ backends:
|
|||||||
remote:
|
remote:
|
||||||
type: b2
|
type: b2
|
||||||
path: 'myBucket:backup/home'
|
path: 'myBucket:backup/home'
|
||||||
B2_ACCOUNT_ID: account_id
|
env:
|
||||||
B2_ACCOUNT_KEY: account_key
|
B2_ACCOUNT_ID: account_id
|
||||||
|
B2_ACCOUNT_KEY: account_key
|
||||||
|
|
||||||
hdd:
|
hdd:
|
||||||
type: local
|
type: local
|
||||||
path: /mnt/my_external_storage
|
path: /mnt/my_external_storage
|
||||||
```
|
```
|
||||||
|
|
||||||
|
## Aliases
|
||||||
|
|
||||||
|
A handy tool for more advanced configurations is to use yaml aliases.
|
||||||
|
These must be specified under the global `extras` key in the `.autorestic.yml` config file.
|
||||||
|
Aliases allow to reuse snippets of config throughout the same file.
|
||||||
|
|
||||||
|
The following example shows how the locations `a` and `b` share the same hooks and forget policies.
|
||||||
|
|
||||||
|
```yaml | .autorestic.yml
|
||||||
|
version: 2
|
||||||
|
|
||||||
|
extras:
|
||||||
|
hooks: &foo
|
||||||
|
before:
|
||||||
|
- echo "Hello"
|
||||||
|
after:
|
||||||
|
- echo "kthxbye"
|
||||||
|
policies: &bar
|
||||||
|
keep-daily: 14
|
||||||
|
keep-weekly: 52
|
||||||
|
|
||||||
|
backends:
|
||||||
|
# ...
|
||||||
|
locations:
|
||||||
|
a:
|
||||||
|
from: /data/a
|
||||||
|
to: some
|
||||||
|
hooks:
|
||||||
|
<<: *foo
|
||||||
|
options:
|
||||||
|
forget:
|
||||||
|
<<: *bar
|
||||||
|
b:
|
||||||
|
from: data/b
|
||||||
|
to: some
|
||||||
|
hooks:
|
||||||
|
<<: *foo
|
||||||
|
options:
|
||||||
|
forget:
|
||||||
|
<<: *bar
|
||||||
|
```
|
||||||
|
|
||||||
> :ToCPrevNext
|
> :ToCPrevNext
|
||||||
|
|||||||
@@ -2,10 +2,20 @@
|
|||||||
|
|
||||||
This amazing people helped the project!
|
This amazing people helped the project!
|
||||||
|
|
||||||
- @agateblue - Docs, Pruning, S3
|
- @agateblue - Docs, Pruning, S3.
|
||||||
- @jin-park-dev - Typos
|
- @g-a-c - Update/Install bugs.
|
||||||
- @sumnerboy12 - Typos
|
- @jjromannet - Bug fixes.
|
||||||
- @FuzzyMistborn - Typos
|
- @fariszr - Docker image improvements.
|
||||||
- @ChanceM - Typos
|
- @david-boles - Docs.
|
||||||
|
- @SebDanielsson - Brew.
|
||||||
|
- @n194 - AUR Package.
|
||||||
|
- @olofvndrhr - Healthchecks example.
|
||||||
|
- @jin-park-dev - Typos.
|
||||||
|
- @sumnerboy12 - Typos.
|
||||||
|
- @FuzzyMistborn - Typos.
|
||||||
|
- @ChanceM - Typos.
|
||||||
|
- @TheForcer - Typos.
|
||||||
|
- @themorlan - Typos.
|
||||||
|
- @somebox - Typos.
|
||||||
|
|
||||||
> :ToCPrevNext
|
> :ToCPrevNext
|
||||||
|
|||||||
28
docs/markdown/docker.md
Normal file
28
docs/markdown/docker.md
Normal file
@@ -0,0 +1,28 @@
|
|||||||
|
# 🐳 Docker
|
||||||
|
|
||||||
|
The docker image is build with rclone and restic already included. It's ment more as a utility image.
|
||||||
|
|
||||||
|
## Remote hosts
|
||||||
|
|
||||||
|
For remote backups (S3, B2, GCS, etc.) it's quite easy, as you only need to mount the config file and the data to backup.
|
||||||
|
|
||||||
|
```bash
|
||||||
|
docker run --rm \\
|
||||||
|
-v $(pwd):/data \\
|
||||||
|
cupcakearmy/autorestic \\
|
||||||
|
autorestic backup -va -c /data/.autorestic.yaml
|
||||||
|
```
|
||||||
|
|
||||||
|
## Rclone
|
||||||
|
|
||||||
|
For rclone you will have to also mount the rclone config file to `/root/.config/rclone/rclone.conf`.
|
||||||
|
|
||||||
|
To check where it is located you can run the following command: `rclone config file`.
|
||||||
|
|
||||||
|
**Example**
|
||||||
|
|
||||||
|
```bash
|
||||||
|
docker run \\
|
||||||
|
-v /home/user/.config/rclone/rclone.conf:/root/.config/rclone/rclone.conf:ro \\
|
||||||
|
...
|
||||||
|
```
|
||||||
@@ -8,10 +8,33 @@ autorestic exec -av -- snapshots
|
|||||||
|
|
||||||
## Unlock a locked repository
|
## Unlock a locked repository
|
||||||
|
|
||||||
This can come in handy if a backup process crashed or if it was accidentally cancelled. Then the repository would still be locked without an actual process using it. Only do this if you know what you are sure no other process is actually reading/writing to the repository of course.
|
This can come in handy if a backup process crashed or if it was accidentally cancelled. Then the repository would still be locked without an actual process using it. Only do this if you know what you are doing and are sure no other process is actually reading/writing to the repository of course.
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
autorestic exec -b my-backend -- unlock
|
autorestic exec -b my-backend -- unlock
|
||||||
```
|
```
|
||||||
|
|
||||||
|
## Use hooks to integrate with [healthchecks](https://healthchecks.io/)
|
||||||
|
|
||||||
|
> Thanks to @olofvndrhr for providing it ❤️
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
extras:
|
||||||
|
healthchecks: &healthchecks
|
||||||
|
hooks:
|
||||||
|
before:
|
||||||
|
- 'curl -m 10 --retry 5 -X POST -H "Content-Type: text/plain" --data "Starting backup for location: ${AUTORESTIC_LOCATION}" https://<healthchecks-url>/ping/<uid>/start'
|
||||||
|
failure:
|
||||||
|
- 'curl -m 10 --retry 5 -X POST -H "Content-Type: text/plain" --data "Backup failed for location: ${AUTORESTIC_LOCATION}" https://<healthchecks-url>/ping/<uid>/fail'
|
||||||
|
success:
|
||||||
|
- 'curl -m 10 --retry 5 -X POST -H "Content-Type: text/plain" --data "Backup successful for location: ${AUTORESTIC_LOCATION}" https://<healthchecks-url>/ping/<uid>'
|
||||||
|
|
||||||
|
locations:
|
||||||
|
something:
|
||||||
|
<<: *healthchecks
|
||||||
|
from: /somewhere
|
||||||
|
to:
|
||||||
|
- somewhere-else
|
||||||
|
```
|
||||||
|
|
||||||
> :ToCPrevNext
|
> :ToCPrevNext
|
||||||
|
|||||||
@@ -2,10 +2,34 @@
|
|||||||
|
|
||||||
Linux & macOS. Windows is not supported. If you have problems installing please open an issue :)
|
Linux & macOS. Windows is not supported. If you have problems installing please open an issue :)
|
||||||
|
|
||||||
Autorestic requires `curl`, `wget` and `bzip2` to be installed. For most systems these should be already installed.
|
Autorestic requires `bash`, `wget` and `bzip2` to be installed. For most systems these should be already installed.
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
curl -s https://raw.githubusercontent.com/CupCakeArmy/autorestic/master/install.sh | bash
|
wget -qO - https://raw.githubusercontent.com/cupcakearmy/autorestic/master/install.sh | bash
|
||||||
```
|
```
|
||||||
|
|
||||||
|
## Alternatives
|
||||||
|
|
||||||
|
### Docker
|
||||||
|
|
||||||
|
There is an official docker image over at [cupcakearmy/autorestic](https://hub.docker.com/r/cupcakearmy/autorestic).
|
||||||
|
|
||||||
|
For some examples see [here](/docker).
|
||||||
|
|
||||||
|
### Manual
|
||||||
|
|
||||||
|
You can download the right binary from the release page and simply copy it to `/usr/local/bin` or whatever path you prefer. Autoupdates will still work.
|
||||||
|
|
||||||
|
### Brew
|
||||||
|
|
||||||
|
If you are on macOS you can install through brew: `brew install autorestic`.
|
||||||
|
|
||||||
|
### Fedora
|
||||||
|
|
||||||
|
Fedora users can install the [autorestic](https://src.fedoraproject.org/rpms/autorestic/) package with `dnf install autorestic`.
|
||||||
|
|
||||||
|
### AUR
|
||||||
|
|
||||||
|
~~If you are on Arch there is an [AUR Package](https://aur.archlinux.org/packages/autorestic-bin/) (looking for maintainers).~~ - Deprecated
|
||||||
|
|
||||||
> :ToCPrevNext
|
> :ToCPrevNext
|
||||||
|
|||||||
31
docs/markdown/location/copy.md
Normal file
31
docs/markdown/location/copy.md
Normal file
@@ -0,0 +1,31 @@
|
|||||||
|
# Copy
|
||||||
|
|
||||||
|
Instead of specifying multiple `to` backends for a given `location` you can also use the `copy` option. Instead of recalculating the backup multiple times, you can copy the freshly copied snapshot from one backend to the other, avoiding recomputation.
|
||||||
|
|
||||||
|
###### Example
|
||||||
|
|
||||||
|
```yaml | .autorestic.yml
|
||||||
|
locations:
|
||||||
|
my-location:
|
||||||
|
from: /data
|
||||||
|
to:
|
||||||
|
- a #Fast
|
||||||
|
- b #Fast
|
||||||
|
- c #Slow
|
||||||
|
```
|
||||||
|
|
||||||
|
Becomes
|
||||||
|
|
||||||
|
```yaml | .autorestic.yml
|
||||||
|
locations:
|
||||||
|
my-location:
|
||||||
|
from: /data
|
||||||
|
to:
|
||||||
|
- a
|
||||||
|
- b
|
||||||
|
copy:
|
||||||
|
a:
|
||||||
|
- c
|
||||||
|
```
|
||||||
|
|
||||||
|
Instead of backing up to each backend separately, you can choose that the snapshot created to `a` will be copied over to `c`, avoiding heavy computation on `c`.
|
||||||
@@ -30,18 +30,24 @@ First, open your crontab in edit mode
|
|||||||
crontab -e
|
crontab -e
|
||||||
```
|
```
|
||||||
|
|
||||||
Then paste this at the bottom of the file and save it. Note that in this specific example the `.autorestic.yml` is located in `/srv/`. You need to modify that part of course to fit your config file.
|
Then paste this at the bottom of the file and save it. Note that in this specific example the config file is located at one of the default locations (e.g. `~/.autorestic.yml`). If your config is somewhere else you'll need to specify it using the `-c` option.
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
# This is required, as it otherwise cannot find restic as a command.
|
# This is required, as it otherwise cannot find restic as a command.
|
||||||
PATH="/usr/local/bin:/usr/bin:/bin"
|
PATH="/usr/local/bin:/usr/bin:/bin"
|
||||||
|
|
||||||
# Example running every 5 minutes
|
# Example running every 5 minutes
|
||||||
*/5 * * * * autorestic -c /srv/.autorestic.yml --ci cron
|
*/5 * * * * autorestic -c /path/to/my/.autorestic.yml --ci cron
|
||||||
```
|
```
|
||||||
|
|
||||||
> The `--ci` option is not required, but recommended
|
> The `--ci` option is not required, but recommended
|
||||||
|
|
||||||
|
To debug a cron job you can use
|
||||||
|
|
||||||
|
```bash
|
||||||
|
*/5 * * * * autorestic -c /path/to/my/.autorestic.yml --ci cron > /tmp/autorestic.log 2>&1
|
||||||
|
```
|
||||||
|
|
||||||
Now you can add as many `cron` attributes as you wish in the config file ⏱
|
Now you can add as many `cron` attributes as you wish in the config file ⏱
|
||||||
|
|
||||||
> Also note that manually triggered backups with `autorestic backup` will not influence the cron timeline, they are willingly not linked.
|
> Also note that manually triggered backups with `autorestic backup` will not influence the cron timeline, they are willingly not linked.
|
||||||
|
|||||||
@@ -3,7 +3,7 @@
|
|||||||
autorestic supports docker volumes directly, without needing them to be mounted to the host filesystem.
|
autorestic supports docker volumes directly, without needing them to be mounted to the host filesystem.
|
||||||
|
|
||||||
```yaml | docker-compose.yml
|
```yaml | docker-compose.yml
|
||||||
version: '3.7'
|
version: '3.8'
|
||||||
|
|
||||||
volumes:
|
volumes:
|
||||||
data:
|
data:
|
||||||
@@ -18,13 +18,9 @@ services:
|
|||||||
|
|
||||||
```yaml | .autorestic.yml
|
```yaml | .autorestic.yml
|
||||||
locations:
|
locations:
|
||||||
- name: hello
|
foo:
|
||||||
from: volume:my-data
|
from: my-data
|
||||||
to:
|
type: volume
|
||||||
- remote
|
|
||||||
|
|
||||||
backends:
|
|
||||||
- name: remote
|
|
||||||
# ...
|
# ...
|
||||||
```
|
```
|
||||||
|
|
||||||
|
|||||||
@@ -7,6 +7,8 @@ This is based on [Restic's snapshots policies](https://restic.readthedocs.io/en/
|
|||||||
> **Note** This is a full example, of course you also can specify only one of them
|
> **Note** This is a full example, of course you also can specify only one of them
|
||||||
|
|
||||||
```yaml | .autorestic.yml
|
```yaml | .autorestic.yml
|
||||||
|
version: 2
|
||||||
|
|
||||||
locations:
|
locations:
|
||||||
etc:
|
etc:
|
||||||
from: /etc
|
from: /etc
|
||||||
@@ -19,7 +21,37 @@ locations:
|
|||||||
keep-weekly: 1 # keep 1 last weekly snapshots
|
keep-weekly: 1 # keep 1 last weekly snapshots
|
||||||
keep-monthly: 12 # keep 12 last monthly snapshots
|
keep-monthly: 12 # keep 12 last monthly snapshots
|
||||||
keep-yearly: 7 # keep 7 last yearly snapshots
|
keep-yearly: 7 # keep 7 last yearly snapshots
|
||||||
keep-within: '2w' # keep snapshots from the last 2 weeks
|
keep-within: '14d' # keep snapshots from the last 14 days
|
||||||
|
```
|
||||||
|
|
||||||
|
## Globally
|
||||||
|
|
||||||
|
You can specify global forget policies that would be applied to all locations:
|
||||||
|
|
||||||
|
```yaml | .autorestic.yml
|
||||||
|
version: 2
|
||||||
|
|
||||||
|
global:
|
||||||
|
forget:
|
||||||
|
keep-daily: 30
|
||||||
|
keep-weekly: 52
|
||||||
|
```
|
||||||
|
|
||||||
|
## Automatically forget after backup
|
||||||
|
|
||||||
|
You can also configure `autorestic` to automatically run the forget command for you after every backup. You can do that by specifying the `forget` option.
|
||||||
|
|
||||||
|
```yaml | .autorestic.yml
|
||||||
|
version: 2
|
||||||
|
|
||||||
|
locations:
|
||||||
|
etc:
|
||||||
|
from: /etc
|
||||||
|
to: local
|
||||||
|
forget: prune # Or only "yes" if you don't want to prune
|
||||||
|
options:
|
||||||
|
forget:
|
||||||
|
keep-last: 5
|
||||||
```
|
```
|
||||||
|
|
||||||
> :ToCPrevNext
|
> :ToCPrevNext
|
||||||
|
|||||||
@@ -2,7 +2,14 @@
|
|||||||
|
|
||||||
If you want to perform some commands before and/or after a backup, you can use hooks.
|
If you want to perform some commands before and/or after a backup, you can use hooks.
|
||||||
|
|
||||||
They consist of a list of `before`/`after` commands that will be executed in the same directory as the target `from`.
|
They consist of a list of commands that will be executed in the same directory as the target `from`.
|
||||||
|
|
||||||
|
The following hooks groups are supported, none are required:
|
||||||
|
|
||||||
|
- `before`
|
||||||
|
- `after`
|
||||||
|
- `failure`
|
||||||
|
- `success`
|
||||||
|
|
||||||
```yml | .autorestic.yml
|
```yml | .autorestic.yml
|
||||||
locations:
|
locations:
|
||||||
@@ -11,10 +18,63 @@ locations:
|
|||||||
to: my-backend
|
to: my-backend
|
||||||
hooks:
|
hooks:
|
||||||
before:
|
before:
|
||||||
- echo "Hello"
|
- echo "One"
|
||||||
- echo "Human"
|
- echo "Two"
|
||||||
|
- echo "Three"
|
||||||
after:
|
after:
|
||||||
- echo "kthxbye"
|
- echo "Byte"
|
||||||
|
failure:
|
||||||
|
- echo "Something went wrong"
|
||||||
|
success:
|
||||||
|
- echo "Well done!"
|
||||||
|
```
|
||||||
|
|
||||||
|
## Flowchart
|
||||||
|
|
||||||
|
1. `before` hook
|
||||||
|
2. Run backup
|
||||||
|
3. `after` hook
|
||||||
|
4. - `success` hook if no errors were found
|
||||||
|
- `failure` hook if at least one error was encountered
|
||||||
|
|
||||||
|
If the `before` hook encounters errors the backup and `after` hooks will be skipped and only the `failed` hooks will run.
|
||||||
|
|
||||||
|
## Environment variables
|
||||||
|
|
||||||
|
All hooks are exposed to the `AUTORESTIC_LOCATION` environment variable, which contains the location name.
|
||||||
|
|
||||||
|
The `after` and `success` hooks have access to additional information with the following syntax:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
AUTORESTIC_[TYPE]_[I]
|
||||||
|
AUTORESTIC_[TYPE]_[BACKEND_NAME]
|
||||||
|
```
|
||||||
|
|
||||||
|
Every type of metadata is appended with both the name of the backend associated with and the number in which the backends where executed.
|
||||||
|
|
||||||
|
### Available Metadata Types
|
||||||
|
|
||||||
|
- `SNAPSHOT_ID`
|
||||||
|
- `PARENT_SNAPSHOT_ID`
|
||||||
|
- `FILES_ADDED`
|
||||||
|
- `FILES_CHANGED`
|
||||||
|
- `FILES_UNMODIFIED`
|
||||||
|
- `DIRS_ADDED`
|
||||||
|
- `DIRS_CHANGED`
|
||||||
|
- `DIRS_UNMODIFIED`
|
||||||
|
- `ADDED_SIZE`
|
||||||
|
- `PROCESSED_FILES`
|
||||||
|
- `PROCESSED_SIZE`
|
||||||
|
- `PROCESSED_DURATION`
|
||||||
|
|
||||||
|
#### Example
|
||||||
|
|
||||||
|
Assuming you have a location `bar` that backs up to a single backend named `foo` you could expect the following env variables:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
AUTORESTIC_LOCATION=bar
|
||||||
|
AUTORESTIC_FILES_ADDED_0=42
|
||||||
|
AUTORESTIC_FILES_ADDED_FOO=42
|
||||||
```
|
```
|
||||||
|
|
||||||
> :ToCPrevNext
|
> :ToCPrevNext
|
||||||
|
|||||||
67
docs/markdown/location/options.md
Normal file
67
docs/markdown/location/options.md
Normal file
@@ -0,0 +1,67 @@
|
|||||||
|
# Options
|
||||||
|
|
||||||
|
For the `backup` and `forget` commands you can pass any native flags to `restic`. In addition you can specify flags for every command with `all`.
|
||||||
|
|
||||||
|
If flags don't start with `-` they will get prefixed with `--`.
|
||||||
|
|
||||||
|
Flags without arguments can be set to `true`. They will be handled accordingly.
|
||||||
|
|
||||||
|
> ℹ️ It is also possible to set options for an [entire backend](/backend/options) or globally (see below).
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
locations:
|
||||||
|
foo:
|
||||||
|
# ...
|
||||||
|
options:
|
||||||
|
all:
|
||||||
|
some-flag: 123
|
||||||
|
# Equivalent to
|
||||||
|
--some-flag: 123
|
||||||
|
backup:
|
||||||
|
boolean-flag: true
|
||||||
|
tag:
|
||||||
|
- foo
|
||||||
|
- bar
|
||||||
|
```
|
||||||
|
|
||||||
|
## Example
|
||||||
|
|
||||||
|
In this example, whenever `autorestic` runs `restic backup` it will append a `--tag foo --tag bar` to the native command.
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
locations:
|
||||||
|
foo:
|
||||||
|
path: ...
|
||||||
|
to: ...
|
||||||
|
options:
|
||||||
|
backup:
|
||||||
|
tag:
|
||||||
|
- foo
|
||||||
|
- bar
|
||||||
|
```
|
||||||
|
|
||||||
|
## Priority
|
||||||
|
|
||||||
|
Options can be set globally, on the backends or on the locations.
|
||||||
|
|
||||||
|
The priority is as follows: `location > backend > global`.
|
||||||
|
|
||||||
|
## Global Options
|
||||||
|
|
||||||
|
It is possible to specify global flags that will be run every time restic is invoked. To do so specify them under `global` in your config file.
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
global:
|
||||||
|
all:
|
||||||
|
cache-dir: ~/restic
|
||||||
|
backup:
|
||||||
|
tag:
|
||||||
|
- foo
|
||||||
|
|
||||||
|
backends:
|
||||||
|
# ...
|
||||||
|
locations:
|
||||||
|
# ...
|
||||||
|
```
|
||||||
|
|
||||||
|
> :ToCPrevNext
|
||||||
@@ -3,10 +3,17 @@
|
|||||||
Locations can be seen as the input to the backup process. Generally this is simply a folder.
|
Locations can be seen as the input to the backup process. Generally this is simply a folder.
|
||||||
The paths can be relative from the config file. A location can have multiple backends, so that the data is secured across multiple servers.
|
The paths can be relative from the config file. A location can have multiple backends, so that the data is secured across multiple servers.
|
||||||
|
|
||||||
|
Note: names of locations MUST be lower case!
|
||||||
```yaml | .autorestic.yml
|
```yaml | .autorestic.yml
|
||||||
|
version: 2
|
||||||
|
|
||||||
locations:
|
locations:
|
||||||
my-location-name:
|
my-location-name:
|
||||||
from: path/to/backup
|
from: path/to/backup
|
||||||
|
# Or multiple
|
||||||
|
# from:
|
||||||
|
# - /a
|
||||||
|
# - /b
|
||||||
to:
|
to:
|
||||||
- name-of-backend
|
- name-of-backend
|
||||||
- also-backup-to-this-backend
|
- also-backup-to-this-backend
|
||||||
@@ -14,7 +21,7 @@ locations:
|
|||||||
|
|
||||||
## `from`
|
## `from`
|
||||||
|
|
||||||
This is the source of the location.
|
This is the source of the location. Can be an `array` for multiple sources.
|
||||||
|
|
||||||
#### How are paths resolved?
|
#### How are paths resolved?
|
||||||
|
|
||||||
|
|||||||
@@ -1,6 +1,4 @@
|
|||||||
# Update
|
# From `0.x` to `1.0`
|
||||||
|
|
||||||
## From `0.x` to `1.0`
|
|
||||||
|
|
||||||
Most of the config file is remained compatible, however to clean up the backends custom environment variables were moved from the root object to an `env` object.
|
Most of the config file is remained compatible, however to clean up the backends custom environment variables were moved from the root object to an `env` object.
|
||||||
|
|
||||||
68
docs/markdown/migration/1.4_1.5.md
Normal file
68
docs/markdown/migration/1.4_1.5.md
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
# Migration from `1.4` to `1.5`
|
||||||
|
|
||||||
|
## ⚠️ Important notes
|
||||||
|
|
||||||
|
The way snapshots are referenced in the `restore` and `prune` commands has been changed. Before they were referenced by the path. Now every backup is tagged and those tags are then referenced in the cli. This means that when running restore and forget commands old backups are not taken into account anymore.
|
||||||
|
|
||||||
|
## Config files
|
||||||
|
|
||||||
|
- The config file now required to have a version number. This has to be added with `version: 2` at the root.
|
||||||
|
- Hooks now optionally support `dir: /some/dir` in the [options object](https://pkg.go.dev/github.com/cupcakearmy/autorestic/internal#Hooks).
|
||||||
|
- Docker volumes don't get prefixed with `volume:` anymore, rather you have to set the `type: volume` in the [location config](https://pkg.go.dev/github.com/cupcakearmy/autorestic/internal#Hooks).
|
||||||
|
|
||||||
|
See detailed instructions below.
|
||||||
|
|
||||||
|
## Config Version
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
version: 2 # Added
|
||||||
|
|
||||||
|
backends:
|
||||||
|
# ...
|
||||||
|
```
|
||||||
|
|
||||||
|
## Hooks
|
||||||
|
|
||||||
|
Since `1.5` multiple sources for a location are possible.
|
||||||
|
For this reason, while before hooks where executed in the folder of the source, now they are executed in the directory of the config `.autorestic.yaml`.
|
||||||
|
|
||||||
|
You can overwrite this behavior with the new `dir` option in the hook section of the config.
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
locations:
|
||||||
|
l1:
|
||||||
|
# ...
|
||||||
|
from: /foo/bar
|
||||||
|
hooks:
|
||||||
|
dir: /foo/bar
|
||||||
|
before: pwd
|
||||||
|
```
|
||||||
|
|
||||||
|
## Docker volumes
|
||||||
|
|
||||||
|
The syntax with docker volumes has changed and needs to be adjusted.
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
# Before
|
||||||
|
locations:
|
||||||
|
foo:
|
||||||
|
from: volume:my-data
|
||||||
|
```
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
# After
|
||||||
|
locations:
|
||||||
|
foo:
|
||||||
|
from: my-data
|
||||||
|
type: volume
|
||||||
|
```
|
||||||
|
|
||||||
|
## Tagging
|
||||||
|
|
||||||
|
Autorestic changed the way backups are referenced. Before we took the paths as the identifying information. Now autorestic uses native restic tags to reference them. This means that old backups are not referenced. You can the old snapshots manually. An example can be shown below.
|
||||||
|
|
||||||
|
```bash
|
||||||
|
autorestic exec -va -- tag --add ar:location:LOCATION_NAME # Only if you have only one location
|
||||||
|
```
|
||||||
|
|
||||||
|
> :ToCPrevNext
|
||||||
4
docs/markdown/migration/index.md
Normal file
4
docs/markdown/migration/index.md
Normal file
@@ -0,0 +1,4 @@
|
|||||||
|
# Migration
|
||||||
|
|
||||||
|
- [From 0.x to 1.0](/migration/0.x_1.0)
|
||||||
|
- [From 1.4 to 1.5](/migration/1.4_1.5)
|
||||||
@@ -3,13 +3,15 @@
|
|||||||
## Installation
|
## Installation
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
curl -s https://raw.githubusercontent.com/CupCakeArmy/autorestic/master/install.sh | bash
|
wget -qO - https://raw.githubusercontent.com/cupcakearmy/autorestic/master/install.sh | bash
|
||||||
```
|
```
|
||||||
|
|
||||||
|
See [installation](/installation) for alternative options.
|
||||||
|
|
||||||
## Write a simple config file
|
## Write a simple config file
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
vim .autorestic.yml
|
vim ~/.autorestic.yml
|
||||||
```
|
```
|
||||||
|
|
||||||
For a quick overview:
|
For a quick overview:
|
||||||
@@ -23,9 +25,15 @@ For a quick overview:
|
|||||||
> Note that the data is automatically encrypted on the server. The key will be generated and added to your config file. Every backend will have a separate key. **You should keep a copy of the keys or config file somewhere in case your server dies**. Otherwise DATA IS LOST!
|
> Note that the data is automatically encrypted on the server. The key will be generated and added to your config file. Every backend will have a separate key. **You should keep a copy of the keys or config file somewhere in case your server dies**. Otherwise DATA IS LOST!
|
||||||
|
|
||||||
```yaml | .autorestic.yml
|
```yaml | .autorestic.yml
|
||||||
|
version: 2
|
||||||
|
|
||||||
locations:
|
locations:
|
||||||
home:
|
home:
|
||||||
from: /home/me
|
from: /home
|
||||||
|
# Or multiple
|
||||||
|
# from:
|
||||||
|
# - /foo
|
||||||
|
# - /bar
|
||||||
to: remote
|
to: remote
|
||||||
|
|
||||||
important:
|
important:
|
||||||
@@ -35,7 +43,7 @@ locations:
|
|||||||
- hdd
|
- hdd
|
||||||
|
|
||||||
backends:
|
backends:
|
||||||
- name: remote
|
remote:
|
||||||
type: s3
|
type: s3
|
||||||
path: 's3.amazonaws.com/bucket_name'
|
path: 's3.amazonaws.com/bucket_name'
|
||||||
key: some-random-password-198rc79r8y1029c8yfewj8f1u0ef87yh198uoieufy
|
key: some-random-password-198rc79r8y1029c8yfewj8f1u0ef87yh198uoieufy
|
||||||
@@ -43,7 +51,7 @@ backends:
|
|||||||
AWS_ACCESS_KEY_ID: account_id
|
AWS_ACCESS_KEY_ID: account_id
|
||||||
AWS_SECRET_ACCESS_KEY: account_key
|
AWS_SECRET_ACCESS_KEY: account_key
|
||||||
|
|
||||||
- name: hdd
|
hdd:
|
||||||
type: local
|
type: local
|
||||||
path: /mnt/my_external_storage
|
path: /mnt/my_external_storage
|
||||||
key: 'if not key is set it will be generated for you'
|
key: 'if not key is set it will be generated for you'
|
||||||
@@ -52,7 +60,7 @@ backends:
|
|||||||
## Check
|
## Check
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
autorestic check -a
|
autorestic check
|
||||||
```
|
```
|
||||||
|
|
||||||
This checks if the config file has any issues. If this is the first time this can take longer as autorestic will setup the backends.
|
This checks if the config file has any issues. If this is the first time this can take longer as autorestic will setup the backends.
|
||||||
|
|||||||
2611
docs/package-lock.json
generated
2611
docs/package-lock.json
generated
File diff suppressed because it is too large
Load Diff
@@ -5,6 +5,6 @@
|
|||||||
"dev": "codedoc serve"
|
"dev": "codedoc serve"
|
||||||
},
|
},
|
||||||
"dependencies": {
|
"dependencies": {
|
||||||
"@codedoc/cli": "^0.2.8"
|
"@codedoc/cli": "^0.3.0"
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
31
go.mod
31
go.mod
@@ -1,13 +1,36 @@
|
|||||||
module github.com/cupcakearmy/autorestic
|
module github.com/cupcakearmy/autorestic
|
||||||
|
|
||||||
go 1.16
|
go 1.20
|
||||||
|
|
||||||
require (
|
require (
|
||||||
github.com/blang/semver/v4 v4.0.0
|
github.com/blang/semver/v4 v4.0.0
|
||||||
github.com/buger/goterm v1.0.0
|
github.com/buger/goterm v1.0.0
|
||||||
github.com/fatih/color v1.10.0
|
github.com/fatih/color v1.13.0
|
||||||
|
github.com/joho/godotenv v1.4.0
|
||||||
github.com/mitchellh/go-homedir v1.1.0
|
github.com/mitchellh/go-homedir v1.1.0
|
||||||
github.com/robfig/cron v1.2.0
|
github.com/robfig/cron v1.2.0
|
||||||
github.com/spf13/cobra v1.1.3
|
github.com/spf13/cobra v1.4.0
|
||||||
github.com/spf13/viper v1.7.1
|
github.com/spf13/viper v1.11.0
|
||||||
|
)
|
||||||
|
|
||||||
|
require (
|
||||||
|
github.com/fsnotify/fsnotify v1.5.1 // indirect
|
||||||
|
github.com/hashicorp/hcl v1.0.0 // indirect
|
||||||
|
github.com/inconshreveable/mousetrap v1.0.0 // indirect
|
||||||
|
github.com/magiconair/properties v1.8.6 // indirect
|
||||||
|
github.com/mattn/go-colorable v0.1.12 // indirect
|
||||||
|
github.com/mattn/go-isatty v0.0.14 // indirect
|
||||||
|
github.com/mitchellh/mapstructure v1.4.3 // indirect
|
||||||
|
github.com/pelletier/go-toml v1.9.4 // indirect
|
||||||
|
github.com/pelletier/go-toml/v2 v2.0.0-beta.8 // indirect
|
||||||
|
github.com/spf13/afero v1.8.2 // indirect
|
||||||
|
github.com/spf13/cast v1.4.1 // indirect
|
||||||
|
github.com/spf13/jwalterweatherman v1.1.0 // indirect
|
||||||
|
github.com/spf13/pflag v1.0.5 // indirect
|
||||||
|
github.com/subosito/gotenv v1.2.0 // indirect
|
||||||
|
golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f // indirect
|
||||||
|
golang.org/x/text v0.3.8 // indirect
|
||||||
|
gopkg.in/ini.v1 v1.66.4 // indirect
|
||||||
|
gopkg.in/yaml.v2 v2.4.0 // indirect
|
||||||
|
gopkg.in/yaml.v3 v3.0.0-20210107192922-496545a6307b // indirect
|
||||||
)
|
)
|
||||||
|
|||||||
487
go.sum
487
go.sum
@@ -3,214 +3,216 @@ cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMT
|
|||||||
cloud.google.com/go v0.38.0/go.mod h1:990N+gfupTy94rShfmMCWGDn0LpTmnzTp2qbd1dvSRU=
|
cloud.google.com/go v0.38.0/go.mod h1:990N+gfupTy94rShfmMCWGDn0LpTmnzTp2qbd1dvSRU=
|
||||||
cloud.google.com/go v0.44.1/go.mod h1:iSa0KzasP4Uvy3f1mN/7PiObzGgflwredwwASm/v6AU=
|
cloud.google.com/go v0.44.1/go.mod h1:iSa0KzasP4Uvy3f1mN/7PiObzGgflwredwwASm/v6AU=
|
||||||
cloud.google.com/go v0.44.2/go.mod h1:60680Gw3Yr4ikxnPRS/oxxkBccT6SA1yMk63TGekxKY=
|
cloud.google.com/go v0.44.2/go.mod h1:60680Gw3Yr4ikxnPRS/oxxkBccT6SA1yMk63TGekxKY=
|
||||||
|
cloud.google.com/go v0.44.3/go.mod h1:60680Gw3Yr4ikxnPRS/oxxkBccT6SA1yMk63TGekxKY=
|
||||||
cloud.google.com/go v0.45.1/go.mod h1:RpBamKRgapWJb87xiFSdk4g1CME7QZg3uwTez+TSTjc=
|
cloud.google.com/go v0.45.1/go.mod h1:RpBamKRgapWJb87xiFSdk4g1CME7QZg3uwTez+TSTjc=
|
||||||
cloud.google.com/go v0.46.3/go.mod h1:a6bKKbmY7er1mI7TEI4lsAkts/mkhTSZK8w33B4RAg0=
|
cloud.google.com/go v0.46.3/go.mod h1:a6bKKbmY7er1mI7TEI4lsAkts/mkhTSZK8w33B4RAg0=
|
||||||
|
cloud.google.com/go v0.50.0/go.mod h1:r9sluTvynVuxRIOHXQEHMFffphuXHOMZMycpNR5e6To=
|
||||||
|
cloud.google.com/go v0.52.0/go.mod h1:pXajvRH/6o3+F9jDHZWQ5PbGhn+o8w9qiu/CffaVdO4=
|
||||||
|
cloud.google.com/go v0.53.0/go.mod h1:fp/UouUEsRkN6ryDKNW/Upv/JBKnv6WDthjR6+vze6M=
|
||||||
|
cloud.google.com/go v0.54.0/go.mod h1:1rq2OEkV3YMf6n/9ZvGWI3GWw0VoqH/1x2nd8Is/bPc=
|
||||||
|
cloud.google.com/go v0.56.0/go.mod h1:jr7tqZxxKOVYizybht9+26Z/gUq7tiRzu+ACVAMbKVk=
|
||||||
|
cloud.google.com/go v0.57.0/go.mod h1:oXiQ6Rzq3RAkkY7N6t3TcE6jE+CIBBbA36lwQ1JyzZs=
|
||||||
|
cloud.google.com/go v0.62.0/go.mod h1:jmCYTdRCQuc1PHIIJ/maLInMho30T/Y0M4hTdTShOYc=
|
||||||
|
cloud.google.com/go v0.65.0/go.mod h1:O5N8zS7uWy9vkA9vayVHs65eM1ubvY4h553ofrNHObY=
|
||||||
|
cloud.google.com/go v0.72.0/go.mod h1:M+5Vjvlc2wnp6tjzE102Dw08nGShTscUx2nZMufOKPI=
|
||||||
|
cloud.google.com/go v0.74.0/go.mod h1:VV1xSbzvo+9QJOxLDaJfTjx5e+MePCpCWwvftOeQmWk=
|
||||||
|
cloud.google.com/go v0.75.0/go.mod h1:VGuuCn7PG0dwsd5XPVm2Mm3wlh3EL55/79EKB6hlPTY=
|
||||||
cloud.google.com/go/bigquery v1.0.1/go.mod h1:i/xbL2UlR5RvWAURpBYZTtm/cXjCha9lbfbpx4poX+o=
|
cloud.google.com/go/bigquery v1.0.1/go.mod h1:i/xbL2UlR5RvWAURpBYZTtm/cXjCha9lbfbpx4poX+o=
|
||||||
|
cloud.google.com/go/bigquery v1.3.0/go.mod h1:PjpwJnslEMmckchkHFfq+HTD2DmtT67aNFKH1/VBDHE=
|
||||||
|
cloud.google.com/go/bigquery v1.4.0/go.mod h1:S8dzgnTigyfTmLBfrtrhyYhwRxG72rYxvftPBK2Dvzc=
|
||||||
|
cloud.google.com/go/bigquery v1.5.0/go.mod h1:snEHRnqQbz117VIFhE8bmtwIDY80NLUZUMb4Nv6dBIg=
|
||||||
|
cloud.google.com/go/bigquery v1.7.0/go.mod h1://okPTzCYNXSlb24MZs83e2Do+h+VXtc4gLoIoXIAPc=
|
||||||
|
cloud.google.com/go/bigquery v1.8.0/go.mod h1:J5hqkt3O0uAFnINi6JXValWIb1v0goeZM77hZzJN/fQ=
|
||||||
cloud.google.com/go/datastore v1.0.0/go.mod h1:LXYbyblFSglQ5pkeyhO+Qmw7ukd3C+pD7TKLgZqpHYE=
|
cloud.google.com/go/datastore v1.0.0/go.mod h1:LXYbyblFSglQ5pkeyhO+Qmw7ukd3C+pD7TKLgZqpHYE=
|
||||||
cloud.google.com/go/firestore v1.1.0/go.mod h1:ulACoGHTpvq5r8rxGJ4ddJZBZqakUQqClKRT5SZwBmk=
|
cloud.google.com/go/datastore v1.1.0/go.mod h1:umbIZjpQpHh4hmRpGhH4tLFup+FVzqBi1b3c64qFpCk=
|
||||||
cloud.google.com/go/pubsub v1.0.1/go.mod h1:R0Gpsv3s54REJCy4fxDixWD93lHJMoZTyQ2kNxGRt3I=
|
cloud.google.com/go/pubsub v1.0.1/go.mod h1:R0Gpsv3s54REJCy4fxDixWD93lHJMoZTyQ2kNxGRt3I=
|
||||||
|
cloud.google.com/go/pubsub v1.1.0/go.mod h1:EwwdRX2sKPjnvnqCa270oGRyludottCI76h+R3AArQw=
|
||||||
|
cloud.google.com/go/pubsub v1.2.0/go.mod h1:jhfEVHT8odbXTkndysNHCcx0awwzvfOlguIAii9o8iA=
|
||||||
|
cloud.google.com/go/pubsub v1.3.1/go.mod h1:i+ucay31+CNRpDW4Lu78I4xXG+O1r/MAHgjpRVR+TSU=
|
||||||
cloud.google.com/go/storage v1.0.0/go.mod h1:IhtSnM/ZTZV8YYJWCY8RULGVqBDmpoyjwiyrjsg+URw=
|
cloud.google.com/go/storage v1.0.0/go.mod h1:IhtSnM/ZTZV8YYJWCY8RULGVqBDmpoyjwiyrjsg+URw=
|
||||||
|
cloud.google.com/go/storage v1.5.0/go.mod h1:tpKbwo567HUNpVclU5sGELwQWBDZ8gh0ZeosJ0Rtdos=
|
||||||
|
cloud.google.com/go/storage v1.6.0/go.mod h1:N7U0C8pVQ/+NIKOBQyamJIeKQKkZ+mxpohlUTyfDhBk=
|
||||||
|
cloud.google.com/go/storage v1.8.0/go.mod h1:Wv1Oy7z6Yz3DshWRJFhqM/UCfaWIRTdp0RXyy7KQOVs=
|
||||||
|
cloud.google.com/go/storage v1.10.0/go.mod h1:FLPqc6j+Ki4BU591ie1oL6qBQGu2Bl/tZ9ullr3+Kg0=
|
||||||
|
cloud.google.com/go/storage v1.14.0/go.mod h1:GrKmX003DSIwi9o29oFT7YDnHYwZoctc3fOKtUw0Xmo=
|
||||||
dmitri.shuralyov.com/gpu/mtl v0.0.0-20190408044501-666a987793e9/go.mod h1:H6x//7gZCb22OMCxBHrMx7a5I7Hp++hsVxbQ4BYO7hU=
|
dmitri.shuralyov.com/gpu/mtl v0.0.0-20190408044501-666a987793e9/go.mod h1:H6x//7gZCb22OMCxBHrMx7a5I7Hp++hsVxbQ4BYO7hU=
|
||||||
github.com/BurntSushi/toml v0.3.1 h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ=
|
|
||||||
github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
|
github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
|
||||||
github.com/BurntSushi/xgb v0.0.0-20160522181843-27f122750802/go.mod h1:IVnqGOEym/WlBOVXweHU+Q+/VP0lqqI8lqeDx9IjBqo=
|
github.com/BurntSushi/xgb v0.0.0-20160522181843-27f122750802/go.mod h1:IVnqGOEym/WlBOVXweHU+Q+/VP0lqqI8lqeDx9IjBqo=
|
||||||
github.com/OneOfOne/xxhash v1.2.2/go.mod h1:HSdplMjZKSmBqAxg5vPj2TmRDmfkzw+cTzAElWljhcU=
|
|
||||||
github.com/alecthomas/template v0.0.0-20160405071501-a0175ee3bccc/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc=
|
|
||||||
github.com/alecthomas/units v0.0.0-20151022065526-2efee857e7cf/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0=
|
|
||||||
github.com/armon/circbuf v0.0.0-20150827004946-bbbad097214e/go.mod h1:3U/XgcO3hCbHZ8TKRvWD2dDTCfh9M9ya+I9JpbB7O8o=
|
|
||||||
github.com/armon/go-metrics v0.0.0-20180917152333-f0300d1749da/go.mod h1:Q73ZrmVTwzkszR9V5SSuryQ31EELlFMUz1kKyl939pY=
|
|
||||||
github.com/armon/go-radix v0.0.0-20180808171621-7fddfc383310/go.mod h1:ufUuZ+zHj4x4TnLV4JWEpy2hxWSpsRywHrMgIH9cCH8=
|
|
||||||
github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q=
|
|
||||||
github.com/beorn7/perks v1.0.0/go.mod h1:KWe93zE9D1o94FZ5RNwFwVgaQK1VOXiVxmqh+CedLV8=
|
|
||||||
github.com/bgentry/speakeasy v0.1.0/go.mod h1:+zsyZBPWlz7T6j88CTgSN5bM796AkVf0kBD4zp0CCIs=
|
|
||||||
github.com/bketelsen/crypt v0.0.3-0.20200106085610-5cbc8cc4026c/go.mod h1:MKsuJmJgSg28kpZDP6UIiPt0e0Oz0kqKNGyRaWEPv84=
|
|
||||||
github.com/blang/semver/v4 v4.0.0 h1:1PFHFE6yCCTv8C1TeyNNarDzntLi7wMI5i/pzqYIsAM=
|
github.com/blang/semver/v4 v4.0.0 h1:1PFHFE6yCCTv8C1TeyNNarDzntLi7wMI5i/pzqYIsAM=
|
||||||
github.com/blang/semver/v4 v4.0.0/go.mod h1:IbckMUScFkM3pff0VJDNKRiT6TG/YpiHIM2yvyW5YoQ=
|
github.com/blang/semver/v4 v4.0.0/go.mod h1:IbckMUScFkM3pff0VJDNKRiT6TG/YpiHIM2yvyW5YoQ=
|
||||||
github.com/buger/goterm v1.0.0 h1:ZB6uUlY8+sjJyFGzz2WpRqX2XYPeXVgtZAOJMwOsTWM=
|
github.com/buger/goterm v1.0.0 h1:ZB6uUlY8+sjJyFGzz2WpRqX2XYPeXVgtZAOJMwOsTWM=
|
||||||
github.com/buger/goterm v1.0.0/go.mod h1:16STi3LquiscTIHA8SXUNKEa/Cnu4ZHBH8NsCaWgso0=
|
github.com/buger/goterm v1.0.0/go.mod h1:16STi3LquiscTIHA8SXUNKEa/Cnu4ZHBH8NsCaWgso0=
|
||||||
github.com/cespare/xxhash v1.1.0/go.mod h1:XrSqR1VqqWfGrhpAt58auRo0WTKS1nRRg3ghfAqPWnc=
|
github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU=
|
||||||
|
github.com/chzyer/logex v1.1.10/go.mod h1:+Ywpsq7O8HXn0nuIou7OrIPyXbp3wmkHB+jjWRnGsAI=
|
||||||
|
github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e/go.mod h1:nSuG5e5PlCu98SY8svDHJxuZscDgtXS6KTTbou5AhLI=
|
||||||
|
github.com/chzyer/test v0.0.0-20180213035817-a1ea475d72b1/go.mod h1:Q3SI9o4m/ZMnBNeIyt5eFwwo7qiLfzFZmjNmxjkiQlU=
|
||||||
github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
|
github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
|
||||||
github.com/coreos/bbolt v1.3.2/go.mod h1:iRUV2dpdMOn7Bo10OQBFzIJO9kkE559Wcmn+qkEiiKk=
|
github.com/cncf/udpa/go v0.0.0-20191209042840-269d4d468f6f/go.mod h1:M8M6+tZqaGXZJjfX53e64911xZQV5JYwmTeXPW+k8Sc=
|
||||||
github.com/coreos/etcd v3.3.13+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE=
|
github.com/cncf/udpa/go v0.0.0-20200629203442-efcf912fb354/go.mod h1:WmhPx2Nbnhtbo57+VJT5O0JRkEi1Wbu0z5j0R8u5Hbk=
|
||||||
github.com/coreos/go-semver v0.3.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk=
|
github.com/cncf/udpa/go v0.0.0-20201120205902-5459f2c99403/go.mod h1:WmhPx2Nbnhtbo57+VJT5O0JRkEi1Wbu0z5j0R8u5Hbk=
|
||||||
github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4=
|
github.com/cpuguy83/go-md2man/v2 v2.0.1/go.mod h1:tgQtvFlXSQOSOSIRvRPT7W67SCa46tRHOmNcaadrF8o=
|
||||||
github.com/coreos/pkg v0.0.0-20180928190104-399ea9e2e55f/go.mod h1:E3G3o1h8I7cfcXa63jLwjI0eiQQMgzzUDFVpN/nH/eA=
|
|
||||||
github.com/cpuguy83/go-md2man/v2 v2.0.0/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU=
|
|
||||||
github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||||
github.com/dgrijalva/jwt-go v3.2.0+incompatible/go.mod h1:E3ru+11k8xSBh+hMPgOLZmtrrCbhqsmaPHjLKYnJCaQ=
|
github.com/envoyproxy/go-control-plane v0.9.0/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4=
|
||||||
github.com/dgryski/go-sip13 v0.0.0-20181026042036-e10d5fee7954/go.mod h1:vAd38F8PWV+bWy6jNmig1y/TA+kYO4g3RSRF0IAv0no=
|
github.com/envoyproxy/go-control-plane v0.9.1-0.20191026205805-5f8ba28d4473/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4=
|
||||||
github.com/fatih/color v1.7.0/go.mod h1:Zm6kSWBoL9eyXnKyktHP6abPY2pDugNf5KwzbycvMj4=
|
github.com/envoyproxy/go-control-plane v0.9.4/go.mod h1:6rpuAdCZL397s3pYoYcLgu1mIlRU8Am5FuJP05cCM98=
|
||||||
github.com/fatih/color v1.10.0 h1:s36xzo75JdqLaaWoiEHk767eHiwo0598uUxyfiPkDsg=
|
github.com/envoyproxy/go-control-plane v0.9.7/go.mod h1:cwu0lG7PUMfa9snN8LXBig5ynNVH9qI8YYLbd1fK2po=
|
||||||
github.com/fatih/color v1.10.0/go.mod h1:ELkj/draVOlAH/xkhN6mQ50Qd0MPOk5AAr3maGEBuJM=
|
github.com/envoyproxy/go-control-plane v0.9.9-0.20201210154907-fd9021fe5dad/go.mod h1:cXg6YxExXjJnVBQHBLXeUAgxn2UodCpnH306RInaBQk=
|
||||||
github.com/fsnotify/fsnotify v1.4.7 h1:IXs+QLmnXW2CcXuY+8Mzv/fWEsPGWxqefPtCP5CnV9I=
|
github.com/envoyproxy/protoc-gen-validate v0.1.0/go.mod h1:iSmxcyjqTsJpI2R4NaDN7+kN2VEUnK/pcBlmesArF7c=
|
||||||
github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo=
|
github.com/fatih/color v1.13.0 h1:8LOYc1KYPPmyKMuN8QV2DNRWNbLo6LZ0iLs8+mlH53w=
|
||||||
github.com/ghodss/yaml v1.0.0/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04=
|
github.com/fatih/color v1.13.0/go.mod h1:kLAiJbzzSOZDVNGyDpeOxJ47H46qBXwg5ILebYFFOfk=
|
||||||
|
github.com/fsnotify/fsnotify v1.5.1 h1:mZcQUHVQUQWoPXXtuf9yuEXKudkV2sx1E06UadKWpgI=
|
||||||
|
github.com/fsnotify/fsnotify v1.5.1/go.mod h1:T3375wBYaZdLLcVNkcVbzGHY7f1l/uK5T5Ai1i3InKU=
|
||||||
github.com/go-gl/glfw v0.0.0-20190409004039-e6da0acd62b1/go.mod h1:vR7hzQXu2zJy9AVAgeJqvqgH9Q5CA+iKCZ2gyEVpxRU=
|
github.com/go-gl/glfw v0.0.0-20190409004039-e6da0acd62b1/go.mod h1:vR7hzQXu2zJy9AVAgeJqvqgH9Q5CA+iKCZ2gyEVpxRU=
|
||||||
github.com/go-kit/kit v0.8.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as=
|
github.com/go-gl/glfw/v3.3/glfw v0.0.0-20191125211704-12ad95a8df72/go.mod h1:tQ2UAYgL5IevRw8kRxooKSPJfGvJ9fJQFa0TUsXzTg8=
|
||||||
github.com/go-logfmt/logfmt v0.3.0/go.mod h1:Qt1PoO58o5twSAckw1HlFXLmHsOX5/0LbT9GBnD5lWE=
|
github.com/go-gl/glfw/v3.3/glfw v0.0.0-20200222043503-6f7a984d4dc4/go.mod h1:tQ2UAYgL5IevRw8kRxooKSPJfGvJ9fJQFa0TUsXzTg8=
|
||||||
github.com/go-logfmt/logfmt v0.4.0/go.mod h1:3RMwSq7FuexP4Kalkev3ejPJsZTpXXBr9+V4qmtdjCk=
|
|
||||||
github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/melR3HDY=
|
|
||||||
github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ=
|
|
||||||
github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4=
|
|
||||||
github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
|
github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
|
||||||
github.com/golang/groupcache v0.0.0-20190129154638-5b532d6fd5ef/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
|
github.com/golang/groupcache v0.0.0-20190702054246-869f871628b6/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
|
||||||
|
github.com/golang/groupcache v0.0.0-20191227052852-215e87163ea7/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
|
||||||
|
github.com/golang/groupcache v0.0.0-20200121045136-8c9f03a8e57e/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
|
||||||
github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
|
github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
|
||||||
github.com/golang/mock v1.2.0/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
|
github.com/golang/mock v1.2.0/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
|
||||||
github.com/golang/mock v1.3.1/go.mod h1:sBzyDLLjw3U8JLTeZvSv8jJB+tU5PVekmnlKIyFUx0Y=
|
github.com/golang/mock v1.3.1/go.mod h1:sBzyDLLjw3U8JLTeZvSv8jJB+tU5PVekmnlKIyFUx0Y=
|
||||||
|
github.com/golang/mock v1.4.0/go.mod h1:UOMv5ysSaYNkG+OFQykRIcU/QvvxJf3p21QfJ2Bt3cw=
|
||||||
|
github.com/golang/mock v1.4.1/go.mod h1:UOMv5ysSaYNkG+OFQykRIcU/QvvxJf3p21QfJ2Bt3cw=
|
||||||
|
github.com/golang/mock v1.4.3/go.mod h1:UOMv5ysSaYNkG+OFQykRIcU/QvvxJf3p21QfJ2Bt3cw=
|
||||||
|
github.com/golang/mock v1.4.4/go.mod h1:l3mdAwkq5BuhzHwde/uurv3sEJeZMXNpwsxVWU71h+4=
|
||||||
github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||||
github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||||
github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||||
|
github.com/golang/protobuf v1.3.3/go.mod h1:vzj43D7+SQXF/4pzW/hwtAqwc6iTitCiVSaWz5lYuqw=
|
||||||
|
github.com/golang/protobuf v1.3.4/go.mod h1:vzj43D7+SQXF/4pzW/hwtAqwc6iTitCiVSaWz5lYuqw=
|
||||||
|
github.com/golang/protobuf v1.3.5/go.mod h1:6O5/vntMXwX2lRkT1hjjk0nAC1IDOTvTlVgjlRvqsdk=
|
||||||
|
github.com/golang/protobuf v1.4.0-rc.1/go.mod h1:ceaxUfeHdC40wWswd/P6IGgMaK3YpKi5j83Wpe3EHw8=
|
||||||
|
github.com/golang/protobuf v1.4.0-rc.1.0.20200221234624-67d41d38c208/go.mod h1:xKAWHe0F5eneWXFV3EuXVDTCmh+JuBKY0li0aMyXATA=
|
||||||
|
github.com/golang/protobuf v1.4.0-rc.2/go.mod h1:LlEzMj4AhA7rCAGe4KMBDvJI+AwstrUpVNzEA03Pprs=
|
||||||
|
github.com/golang/protobuf v1.4.0-rc.4.0.20200313231945-b860323f09d0/go.mod h1:WU3c8KckQ9AFe+yFwt9sWVRKCVIyN9cPHBJSNnbL67w=
|
||||||
|
github.com/golang/protobuf v1.4.0/go.mod h1:jodUvKwWbYaEsadDk5Fwe5c77LiNKVO9IDvqG2KuDX0=
|
||||||
|
github.com/golang/protobuf v1.4.1/go.mod h1:U8fpvMrcmy5pZrNK1lt4xCsGvpyWQ/VVv6QDs8UjoX8=
|
||||||
|
github.com/golang/protobuf v1.4.2/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI=
|
||||||
|
github.com/golang/protobuf v1.4.3/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI=
|
||||||
github.com/google/btree v0.0.0-20180813153112-4030bb1f1f0c/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ=
|
github.com/google/btree v0.0.0-20180813153112-4030bb1f1f0c/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ=
|
||||||
github.com/google/btree v1.0.0/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ=
|
github.com/google/btree v1.0.0/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ=
|
||||||
github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M=
|
github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M=
|
||||||
github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
|
github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
|
||||||
|
github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
|
||||||
|
github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
|
||||||
|
github.com/google/go-cmp v0.4.1/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
|
||||||
|
github.com/google/go-cmp v0.5.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
|
||||||
|
github.com/google/go-cmp v0.5.1/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
|
||||||
|
github.com/google/go-cmp v0.5.2/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
|
||||||
|
github.com/google/go-cmp v0.5.4/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
|
||||||
github.com/google/martian v2.1.0+incompatible/go.mod h1:9I4somxYTbIHy5NJKHRl3wXiIaQGbYVAs8BPL6v8lEs=
|
github.com/google/martian v2.1.0+incompatible/go.mod h1:9I4somxYTbIHy5NJKHRl3wXiIaQGbYVAs8BPL6v8lEs=
|
||||||
|
github.com/google/martian/v3 v3.0.0/go.mod h1:y5Zk1BBys9G+gd6Jrk0W3cC1+ELVxBWuIGO+w/tUAp0=
|
||||||
|
github.com/google/martian/v3 v3.1.0/go.mod h1:y5Zk1BBys9G+gd6Jrk0W3cC1+ELVxBWuIGO+w/tUAp0=
|
||||||
github.com/google/pprof v0.0.0-20181206194817-3ea8567a2e57/go.mod h1:zfwlbNMJ+OItoe0UupaVj+oy1omPYYDuagoSzA8v9mc=
|
github.com/google/pprof v0.0.0-20181206194817-3ea8567a2e57/go.mod h1:zfwlbNMJ+OItoe0UupaVj+oy1omPYYDuagoSzA8v9mc=
|
||||||
github.com/google/pprof v0.0.0-20190515194954-54271f7e092f/go.mod h1:zfwlbNMJ+OItoe0UupaVj+oy1omPYYDuagoSzA8v9mc=
|
github.com/google/pprof v0.0.0-20190515194954-54271f7e092f/go.mod h1:zfwlbNMJ+OItoe0UupaVj+oy1omPYYDuagoSzA8v9mc=
|
||||||
|
github.com/google/pprof v0.0.0-20191218002539-d4f498aebedc/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
|
||||||
|
github.com/google/pprof v0.0.0-20200212024743-f11f1df84d12/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
|
||||||
|
github.com/google/pprof v0.0.0-20200229191704-1ebb73c60ed3/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
|
||||||
|
github.com/google/pprof v0.0.0-20200430221834-fc25d7d30c6d/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
|
||||||
|
github.com/google/pprof v0.0.0-20200708004538-1a94d8640e99/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
|
||||||
|
github.com/google/pprof v0.0.0-20201023163331-3e6fc7fc9c4c/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE=
|
||||||
|
github.com/google/pprof v0.0.0-20201203190320-1bf35d6f28c2/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE=
|
||||||
|
github.com/google/pprof v0.0.0-20201218002935-b9804c9f04c2/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE=
|
||||||
github.com/google/renameio v0.1.0/go.mod h1:KWCgfxg9yswjAJkECMjeO8J8rahYeXnNhOm40UhjYkI=
|
github.com/google/renameio v0.1.0/go.mod h1:KWCgfxg9yswjAJkECMjeO8J8rahYeXnNhOm40UhjYkI=
|
||||||
|
github.com/google/uuid v1.1.2/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo=
|
||||||
github.com/googleapis/gax-go/v2 v2.0.4/go.mod h1:0Wqv26UfaUD9n4G6kQubkQ+KchISgw+vpHVxEJEs9eg=
|
github.com/googleapis/gax-go/v2 v2.0.4/go.mod h1:0Wqv26UfaUD9n4G6kQubkQ+KchISgw+vpHVxEJEs9eg=
|
||||||
github.com/googleapis/gax-go/v2 v2.0.5/go.mod h1:DWXyrwAJ9X0FpwwEdw+IPEYBICEFu5mhpdKc/us6bOk=
|
github.com/googleapis/gax-go/v2 v2.0.5/go.mod h1:DWXyrwAJ9X0FpwwEdw+IPEYBICEFu5mhpdKc/us6bOk=
|
||||||
github.com/gopherjs/gopherjs v0.0.0-20181017120253-0766667cb4d1 h1:EGx4pi6eqNxGaHF6qqu48+N2wcFQ5qg5FXgOdqsJ5d8=
|
github.com/googleapis/google-cloud-go-testing v0.0.0-20200911160855-bcd43fbb19e8/go.mod h1:dvDLG8qkwmyD9a/MJJN3XJcT3xFxOKAvTZGvuZmac9g=
|
||||||
github.com/gopherjs/gopherjs v0.0.0-20181017120253-0766667cb4d1/go.mod h1:wJfORRmW1u3UXTncJ5qlYoELFm8eSnnEO6hX4iZ3EWY=
|
|
||||||
github.com/gorilla/websocket v1.4.2/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE=
|
|
||||||
github.com/grpc-ecosystem/go-grpc-middleware v1.0.0/go.mod h1:FiyG127CGDf3tlThmgyCl78X/SZQqEOJBCDaAfeWzPs=
|
|
||||||
github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0/go.mod h1:8NvIoxWQoOIhqOTXgfV/d3M/q6VIi02HzZEHgUlZvzk=
|
|
||||||
github.com/grpc-ecosystem/grpc-gateway v1.9.0/go.mod h1:vNeuVxBJEsws4ogUvrchl83t/GYV9WGTSLVdBhOQFDY=
|
|
||||||
github.com/hashicorp/consul/api v1.1.0/go.mod h1:VmuI/Lkw1nC05EYQWNKwWGbkg+FbDBtguAZLlVdkD9Q=
|
|
||||||
github.com/hashicorp/consul/sdk v0.1.1/go.mod h1:VKf9jXwCTEY1QZP2MOLRhb5i/I/ssyNV1vwHyQBF0x8=
|
|
||||||
github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
|
|
||||||
github.com/hashicorp/go-cleanhttp v0.5.1/go.mod h1:JpRdi6/HCYpAwUzNwuwqhbovhLtngrth3wmdIIUrZ80=
|
|
||||||
github.com/hashicorp/go-immutable-radix v1.0.0/go.mod h1:0y9vanUI8NX6FsYoO3zeMjhV/C5i9g4Q3DwcSNZ4P60=
|
|
||||||
github.com/hashicorp/go-msgpack v0.5.3/go.mod h1:ahLV/dePpqEmjfWmKiqvPkv/twdG7iPBM1vqhUKIvfM=
|
|
||||||
github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk=
|
|
||||||
github.com/hashicorp/go-rootcerts v1.0.0/go.mod h1:K6zTfqpRlCUIjkwsN4Z+hiSfzSTQa6eBIzfwKfwNnHU=
|
|
||||||
github.com/hashicorp/go-sockaddr v1.0.0/go.mod h1:7Xibr9yA9JjQq1JpNB2Vw7kxv8xerXegt+ozgdvDeDU=
|
|
||||||
github.com/hashicorp/go-syslog v1.0.0/go.mod h1:qPfqrKkXGihmCqbJM2mZgkZGvKG1dFdvsLplgctolz4=
|
|
||||||
github.com/hashicorp/go-uuid v1.0.0/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro=
|
|
||||||
github.com/hashicorp/go-uuid v1.0.1/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro=
|
|
||||||
github.com/hashicorp/go.net v0.0.1/go.mod h1:hjKkEWcCURg++eb33jQU7oqQcI9XDCnUzHA0oac0k90=
|
|
||||||
github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
|
github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
|
||||||
github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
|
github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
|
||||||
github.com/hashicorp/hcl v1.0.0 h1:0Anlzjpi4vEasTeNFn2mLJgTSwt0+6sfsiTG8qcWGx4=
|
github.com/hashicorp/hcl v1.0.0 h1:0Anlzjpi4vEasTeNFn2mLJgTSwt0+6sfsiTG8qcWGx4=
|
||||||
github.com/hashicorp/hcl v1.0.0/go.mod h1:E5yfLk+7swimpb2L/Alb/PJmXilQ/rhwaUYs4T20WEQ=
|
github.com/hashicorp/hcl v1.0.0/go.mod h1:E5yfLk+7swimpb2L/Alb/PJmXilQ/rhwaUYs4T20WEQ=
|
||||||
github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64=
|
github.com/ianlancetaylor/demangle v0.0.0-20181102032728-5e5cf60278f6/go.mod h1:aSSvb/t6k1mPoxDqO4vJh6VOCGPwU4O0C2/Eqndh1Sc=
|
||||||
github.com/hashicorp/mdns v1.0.0/go.mod h1:tL+uN++7HEJ6SQLQ2/p+z2pH24WQKWjBPkE0mNTz8vQ=
|
github.com/ianlancetaylor/demangle v0.0.0-20200824232613-28f6c0f3b639/go.mod h1:aSSvb/t6k1mPoxDqO4vJh6VOCGPwU4O0C2/Eqndh1Sc=
|
||||||
github.com/hashicorp/memberlist v0.1.3/go.mod h1:ajVTdAv/9Im8oMAAj5G31PhhMCZJV2pPBoIllUwCN7I=
|
|
||||||
github.com/hashicorp/serf v0.8.2/go.mod h1:6hOLApaqBFA1NXqRQAsxw9QxuDEvNxSQRwA/JwenrHc=
|
|
||||||
github.com/inconshreveable/mousetrap v1.0.0 h1:Z8tu5sraLXCXIcARxBp/8cbvlwVa7Z1NHg9XEKhtSvM=
|
github.com/inconshreveable/mousetrap v1.0.0 h1:Z8tu5sraLXCXIcARxBp/8cbvlwVa7Z1NHg9XEKhtSvM=
|
||||||
github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANytuPF1OarO4DADm73n8=
|
github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANytuPF1OarO4DADm73n8=
|
||||||
github.com/jonboulle/clockwork v0.1.0/go.mod h1:Ii8DK3G1RaLaWxj9trq07+26W01tbo22gdxWY5EU2bo=
|
github.com/joho/godotenv v1.4.0 h1:3l4+N6zfMWnkbPEXKng2o2/MR5mSwTrBih4ZEkkz1lg=
|
||||||
github.com/json-iterator/go v1.1.6/go.mod h1:+SdeFBvtyEkXs7REEP0seUULqWtbJapLOCVDaaPEHmU=
|
github.com/joho/godotenv v1.4.0/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
|
||||||
github.com/jstemmer/go-junit-report v0.0.0-20190106144839-af01ea7f8024/go.mod h1:6v2b51hI/fHJwM22ozAgKL4VKDeJcHhJFhtBdhmNjmU=
|
github.com/jstemmer/go-junit-report v0.0.0-20190106144839-af01ea7f8024/go.mod h1:6v2b51hI/fHJwM22ozAgKL4VKDeJcHhJFhtBdhmNjmU=
|
||||||
github.com/jtolds/gls v4.20.0+incompatible h1:xdiiI2gbIgH/gLH7ADydsJ1uDOEzR8yvV7C0MuV77Wo=
|
github.com/jstemmer/go-junit-report v0.9.1/go.mod h1:Brl9GWCQeLvo8nXZwPNNblvFj/XSXhF0NWZEnDohbsk=
|
||||||
github.com/jtolds/gls v4.20.0+incompatible/go.mod h1:QJZ7F/aHp+rZTRtaJ1ow/lLfFfVYBRgL+9YlvaHOwJU=
|
|
||||||
github.com/julienschmidt/httprouter v1.2.0/go.mod h1:SYymIcj16QtmaHHD7aYtjjsJG7VTCxuUUipMqKk8s4w=
|
|
||||||
github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q=
|
|
||||||
github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck=
|
github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck=
|
||||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
github.com/kr/fs v0.1.0/go.mod h1:FFnZGqtBN9Gxj7eW1uZ42v5BccTP0vu6NEaFoC2HwRg=
|
||||||
github.com/kr/logfmt v0.0.0-20140226030751-b84e30acd515/go.mod h1:+0opPa2QZZtGFBFZlji/RkVcI2GknAs/DXo4wKdlNEc=
|
|
||||||
github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI=
|
github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI=
|
||||||
github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
|
github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
|
||||||
github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
|
github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
|
||||||
github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
|
github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
|
||||||
github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
|
github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
|
||||||
github.com/magiconair/properties v1.8.1 h1:ZC2Vc7/ZFkGmsVC9KvOjumD+G5lXy2RtTKyzRKO2BQ4=
|
github.com/magiconair/properties v1.8.6 h1:5ibWZ6iY0NctNGWo87LalDlEZ6R41TqbbDamhfG/Qzo=
|
||||||
github.com/magiconair/properties v1.8.1/go.mod h1:PppfXfuXeibc/6YijjN8zIbojt8czPbwD3XqdrwzmxQ=
|
github.com/magiconair/properties v1.8.6/go.mod h1:y3VJvCyxH9uVvJTWEGAELF3aiYNyPKd5NZ3oSwXrF60=
|
||||||
github.com/mattn/go-colorable v0.0.9/go.mod h1:9vuHe8Xs5qXnSaW/c/ABM9alt+Vo+STaOChaDxuIBZU=
|
github.com/mattn/go-colorable v0.1.9/go.mod h1:u6P/XSegPjTcexA+o6vUJrdnUu04hMope9wVRipJSqc=
|
||||||
github.com/mattn/go-colorable v0.1.8 h1:c1ghPdyEDarC70ftn0y+A/Ee++9zz8ljHG1b13eJ0s8=
|
github.com/mattn/go-colorable v0.1.12 h1:jF+Du6AlPIjs2BiUiQlKOX0rt3SujHxPnksPKZbaA40=
|
||||||
github.com/mattn/go-colorable v0.1.8/go.mod h1:u6P/XSegPjTcexA+o6vUJrdnUu04hMope9wVRipJSqc=
|
github.com/mattn/go-colorable v0.1.12/go.mod h1:u5H1YNBxpqRaxsYJYSkiCWKzEfiAb1Gb520KVy5xxl4=
|
||||||
github.com/mattn/go-isatty v0.0.3/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4=
|
|
||||||
github.com/mattn/go-isatty v0.0.12 h1:wuysRhFDzyxgEmMf5xjvJ2M9dZoWAXNNr5LSBS7uHXY=
|
|
||||||
github.com/mattn/go-isatty v0.0.12/go.mod h1:cbi8OIDigv2wuxKPP5vlRcQ1OAZbq2CE4Kysco4FUpU=
|
github.com/mattn/go-isatty v0.0.12/go.mod h1:cbi8OIDigv2wuxKPP5vlRcQ1OAZbq2CE4Kysco4FUpU=
|
||||||
github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0=
|
github.com/mattn/go-isatty v0.0.14 h1:yVuAays6BHfxijgZPzw+3Zlu5yQgKGP2/hcQbHb7S9Y=
|
||||||
github.com/miekg/dns v1.0.14/go.mod h1:W1PPwlIAgtquWBMBEV9nkV9Cazfe8ScdGz/Lj7v3Nrg=
|
github.com/mattn/go-isatty v0.0.14/go.mod h1:7GGIvUiUoEMVVmxf/4nioHXj79iQHKdU27kJ6hsGG94=
|
||||||
github.com/mitchellh/cli v1.0.0/go.mod h1:hNIlj7HEI86fIcpObd7a0FcrxTWetlwJDGcceTlRvqc=
|
|
||||||
github.com/mitchellh/go-homedir v1.0.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0=
|
|
||||||
github.com/mitchellh/go-homedir v1.1.0 h1:lukF9ziXFxDFPkA1vsr5zpc1XuPDn/wFntq5mG+4E0Y=
|
github.com/mitchellh/go-homedir v1.1.0 h1:lukF9ziXFxDFPkA1vsr5zpc1XuPDn/wFntq5mG+4E0Y=
|
||||||
github.com/mitchellh/go-homedir v1.1.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0=
|
github.com/mitchellh/go-homedir v1.1.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0=
|
||||||
github.com/mitchellh/go-testing-interface v1.0.0/go.mod h1:kRemZodwjscx+RGhAo8eIhFbs2+BFgRtFPeD/KE+zxI=
|
github.com/mitchellh/mapstructure v1.4.3 h1:OVowDSCllw/YjdLkam3/sm7wEtOy59d8ndGgCcyj8cs=
|
||||||
github.com/mitchellh/gox v0.4.0/go.mod h1:Sd9lOJ0+aimLBi73mGofS1ycjY8lL3uZM3JPS42BGNg=
|
github.com/mitchellh/mapstructure v1.4.3/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
|
||||||
github.com/mitchellh/iochan v1.0.0/go.mod h1:JwYml1nuB7xOzsp52dPpHFffvOCDupsG0QubkSMEySY=
|
github.com/pelletier/go-toml v1.9.4 h1:tjENF6MfZAg8e4ZmZTeWaWiT2vXtsoO6+iuOjFhECwM=
|
||||||
github.com/mitchellh/mapstructure v0.0.0-20160808181253-ca63d7c062ee/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y=
|
github.com/pelletier/go-toml v1.9.4/go.mod h1:u1nR/EPcESfeI/szUZKdtJ0xRNbUoANCkoOuaOx1Y+c=
|
||||||
github.com/mitchellh/mapstructure v1.1.2 h1:fmNYVwqnSfB9mZU6OS2O6GsXM+wcskZDuKQzvN1EDeE=
|
github.com/pelletier/go-toml/v2 v2.0.0-beta.8 h1:dy81yyLYJDwMTifq24Oi/IslOslRrDSb3jwDggjz3Z0=
|
||||||
github.com/mitchellh/mapstructure v1.1.2/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y=
|
github.com/pelletier/go-toml/v2 v2.0.0-beta.8/go.mod h1:r9LEWfGN8R5k0VXJ+0BkIe7MYkRdwZOjgMj2KwnJFUo=
|
||||||
github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q=
|
github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||||
github.com/modern-go/reflect2 v1.0.1/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0=
|
github.com/pkg/sftp v1.13.1/go.mod h1:3HaPG6Dq1ILlpPZRO0HVMrsydcdLt6HRDccSgb87qRg=
|
||||||
github.com/mwitkow/go-conntrack v0.0.0-20161129095857-cc309e4a2223/go.mod h1:qRWi+5nqEBWmkhHvq77mSJWrCKwh8bxhgT7d/eI7P4U=
|
|
||||||
github.com/oklog/ulid v1.3.1/go.mod h1:CirwcVhetQ6Lv90oh/F+FBtV6XMibvdAFo93nm5qn4U=
|
|
||||||
github.com/pascaldekloe/goe v0.0.0-20180627143212-57f6aae5913c/go.mod h1:lzWF7FIEvWOWxwDKqyGYQf6ZUaNfKdP144TG7ZOy1lc=
|
|
||||||
github.com/pelletier/go-toml v1.2.0 h1:T5zMGML61Wp+FlcbWjRDT7yAxhJNAiPPLOFECq181zc=
|
|
||||||
github.com/pelletier/go-toml v1.2.0/go.mod h1:5z9KED0ma1S8pY6P1sdut58dfprrGBbd/94hg7ilaic=
|
|
||||||
github.com/pkg/errors v0.8.0/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
|
||||||
github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
|
||||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||||
github.com/posener/complete v1.1.1/go.mod h1:em0nMJCgc9GFtwrmVmEMR/ZL6WyhyjMBndrE9hABlRI=
|
github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
|
||||||
github.com/prometheus/client_golang v0.9.1/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw=
|
|
||||||
github.com/prometheus/client_golang v0.9.3/go.mod h1:/TN21ttK/J9q6uSwhBd54HahCDft0ttaMvbicHlPoso=
|
|
||||||
github.com/prometheus/client_model v0.0.0-20180712105110-5c3871d89910/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo=
|
|
||||||
github.com/prometheus/client_model v0.0.0-20190129233127-fd36f4220a90/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
|
|
||||||
github.com/prometheus/common v0.0.0-20181113130724-41aa239b4cce/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro=
|
|
||||||
github.com/prometheus/common v0.4.0/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4=
|
|
||||||
github.com/prometheus/procfs v0.0.0-20181005140218-185b4288413d/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk=
|
|
||||||
github.com/prometheus/procfs v0.0.0-20190507164030-5867b95ac084/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA=
|
|
||||||
github.com/prometheus/tsdb v0.7.1/go.mod h1:qhTCs0VvXwvX/y3TZrWD7rabWM+ijKTux40TwIPHuXU=
|
|
||||||
github.com/robfig/cron v1.2.0 h1:ZjScXvvxeQ63Dbyxy76Fj3AT3Ut0aKsyd2/tl3DTMuQ=
|
github.com/robfig/cron v1.2.0 h1:ZjScXvvxeQ63Dbyxy76Fj3AT3Ut0aKsyd2/tl3DTMuQ=
|
||||||
github.com/robfig/cron v1.2.0/go.mod h1:JGuDeoQd7Z6yL4zQhZ3OPEVHB7fL6Ka6skscFHfmt2k=
|
github.com/robfig/cron v1.2.0/go.mod h1:JGuDeoQd7Z6yL4zQhZ3OPEVHB7fL6Ka6skscFHfmt2k=
|
||||||
github.com/rogpeppe/fastuuid v0.0.0-20150106093220-6724a57986af/go.mod h1:XWv6SoW27p1b0cqNHllgS5HIMJraePCO15w5zCzIWYg=
|
|
||||||
github.com/rogpeppe/go-internal v1.3.0/go.mod h1:M8bDsm7K2OlrFYOpmOWEs/qY81heoFRclV5y23lUDJ4=
|
github.com/rogpeppe/go-internal v1.3.0/go.mod h1:M8bDsm7K2OlrFYOpmOWEs/qY81heoFRclV5y23lUDJ4=
|
||||||
github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM=
|
github.com/russross/blackfriday/v2 v2.1.0/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM=
|
||||||
github.com/ryanuber/columnize v0.0.0-20160712163229-9b3edd62028f/go.mod h1:sm1tb6uqfes/u+d4ooFouqFdy9/2g9QGwK3SQygK0Ts=
|
github.com/spf13/afero v1.8.2 h1:xehSyVa0YnHWsJ49JFljMpg1HX19V6NDZ1fkm1Xznbo=
|
||||||
github.com/sean-/seed v0.0.0-20170313163322-e2103e2c3529/go.mod h1:DxrIzT+xaE7yg65j358z/aeFdxmN0P9QXhEzd20vsDc=
|
github.com/spf13/afero v1.8.2/go.mod h1:CtAatgMJh6bJEIs48Ay/FOnkljP3WeGUG0MC1RfAqwo=
|
||||||
github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc=
|
github.com/spf13/cast v1.4.1 h1:s0hze+J0196ZfEMTs80N7UlFt0BDuQ7Q+JDnHiMWKdA=
|
||||||
github.com/sirupsen/logrus v1.2.0/go.mod h1:LxeOpSwHxABJmUn/MG1IvRgCAasNZTLOkJPxbbu5VWo=
|
github.com/spf13/cast v1.4.1/go.mod h1:Qx5cxh0v+4UWYiBimWS+eyWzqEqokIECu5etghLkUJE=
|
||||||
github.com/smartystreets/assertions v0.0.0-20180927180507-b2de0cb4f26d h1:zE9ykElWQ6/NYmHa3jpm/yHnI4xSofP+UP6SpjHcSeM=
|
github.com/spf13/cobra v1.4.0 h1:y+wJpx64xcgO1V+RcnwW0LEHxTKRi2ZDPSBjWnrg88Q=
|
||||||
github.com/smartystreets/assertions v0.0.0-20180927180507-b2de0cb4f26d/go.mod h1:OnSkiWE9lh6wB0YB77sQom3nweQdgAjqCqsofrRNTgc=
|
github.com/spf13/cobra v1.4.0/go.mod h1:Wo4iy3BUC+X2Fybo0PDqwJIv3dNRiZLHQymsfxlB84g=
|
||||||
github.com/smartystreets/goconvey v1.6.4 h1:fv0U8FUIMPNf1L9lnHLvLhgicrIVChEkdzIKYqbNC9s=
|
github.com/spf13/jwalterweatherman v1.1.0 h1:ue6voC5bR5F8YxI5S67j9i582FU4Qvo2bmqnqMYADFk=
|
||||||
github.com/smartystreets/goconvey v1.6.4/go.mod h1:syvi0/a8iFYH4r/RixwvyeAJjdLS9QV7WQ/tjFTllLA=
|
github.com/spf13/jwalterweatherman v1.1.0/go.mod h1:aNWZUN0dPAAO/Ljvb5BEdw96iTZ0EXowPYD95IqWIGo=
|
||||||
github.com/soheilhy/cmux v0.1.4/go.mod h1:IM3LyeVVIOuxMH7sFAkER9+bJ4dT7Ms6E4xg4kGIyLM=
|
|
||||||
github.com/spaolacci/murmur3 v0.0.0-20180118202830-f09979ecbc72/go.mod h1:JwIasOWyU6f++ZhiEuf87xNszmSA2myDM2Kzu9HwQUA=
|
|
||||||
github.com/spf13/afero v1.1.2 h1:m8/z1t7/fwjysjQRYbP0RD+bUIF/8tJwPdEZsI83ACI=
|
|
||||||
github.com/spf13/afero v1.1.2/go.mod h1:j4pytiNVoe2o6bmDsKpLACNPDBIoEAkihy7loJ1B0CQ=
|
|
||||||
github.com/spf13/cast v1.3.0 h1:oget//CVOEoFewqQxwr0Ej5yjygnqGkvggSE/gB35Q8=
|
|
||||||
github.com/spf13/cast v1.3.0/go.mod h1:Qx5cxh0v+4UWYiBimWS+eyWzqEqokIECu5etghLkUJE=
|
|
||||||
github.com/spf13/cobra v1.1.3 h1:xghbfqPkxzxP3C/f3n5DdpAbdKLj4ZE4BWQI362l53M=
|
|
||||||
github.com/spf13/cobra v1.1.3/go.mod h1:pGADOWyqRD/YMrPZigI/zbliZ2wVD/23d+is3pSWzOo=
|
|
||||||
github.com/spf13/jwalterweatherman v1.0.0 h1:XHEdyB+EcvlqZamSM4ZOMGlc93t6AcsBEu9Gc1vn7yk=
|
|
||||||
github.com/spf13/jwalterweatherman v1.0.0/go.mod h1:cQK4TGJAtQXfYWX+Ddv3mKDzgVb68N+wFjFa4jdeBTo=
|
|
||||||
github.com/spf13/pflag v1.0.3/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4=
|
|
||||||
github.com/spf13/pflag v1.0.5 h1:iy+VFUOCP1a+8yFto/drg2CJ5u0yRoB7fZw3DKv/JXA=
|
github.com/spf13/pflag v1.0.5 h1:iy+VFUOCP1a+8yFto/drg2CJ5u0yRoB7fZw3DKv/JXA=
|
||||||
github.com/spf13/pflag v1.0.5/go.mod h1:McXfInJRrz4CZXVZOBLb0bTZqETkiAhM9Iw0y3An2Bg=
|
github.com/spf13/pflag v1.0.5/go.mod h1:McXfInJRrz4CZXVZOBLb0bTZqETkiAhM9Iw0y3An2Bg=
|
||||||
github.com/spf13/viper v1.7.0/go.mod h1:8WkrPz2fc9jxqZNCJI/76HCieCp4Q8HaLFoCha5qpdg=
|
github.com/spf13/viper v1.11.0 h1:7OX/1FS6n7jHD1zGrZTM7WtY13ZELRyosK4k93oPr44=
|
||||||
github.com/spf13/viper v1.7.1 h1:pM5oEahlgWv/WnHXpgbKz7iLIxRf65tye2Ci+XFK5sk=
|
github.com/spf13/viper v1.11.0/go.mod h1:djo0X/bA5+tYVoCn+C7cAYJGcVn/qYLFTG8gdUsX7Zk=
|
||||||
github.com/spf13/viper v1.7.1/go.mod h1:8WkrPz2fc9jxqZNCJI/76HCieCp4Q8HaLFoCha5qpdg=
|
|
||||||
github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||||
github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
|
||||||
github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
|
github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
|
||||||
github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0Q=
|
github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
|
||||||
github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI=
|
github.com/stretchr/testify v1.5.1/go.mod h1:5W2xD1RspED5o8YsWQXVCued0rvSQ+mT+I5cxcmMvtA=
|
||||||
|
github.com/stretchr/testify v1.7.0/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
|
||||||
|
github.com/stretchr/testify v1.7.1 h1:5TQK59W5E3v0r2duFAb7P95B6hEeOyEnHRa8MjYSMTY=
|
||||||
|
github.com/stretchr/testify v1.7.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
|
||||||
github.com/subosito/gotenv v1.2.0 h1:Slr1R9HxAlEKefgq5jn9U+DnETlIUa6HfgEzj0g5d7s=
|
github.com/subosito/gotenv v1.2.0 h1:Slr1R9HxAlEKefgq5jn9U+DnETlIUa6HfgEzj0g5d7s=
|
||||||
github.com/subosito/gotenv v1.2.0/go.mod h1:N0PQaV/YGNqwC0u51sEeR/aUtSLEXKX9iv69rRypqCw=
|
github.com/subosito/gotenv v1.2.0/go.mod h1:N0PQaV/YGNqwC0u51sEeR/aUtSLEXKX9iv69rRypqCw=
|
||||||
github.com/tmc/grpc-websocket-proxy v0.0.0-20190109142713-0ad062ec5ee5/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U=
|
github.com/yuin/goldmark v1.1.25/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
|
||||||
github.com/xiang90/probing v0.0.0-20190116061207-43a291ad63a2/go.mod h1:UETIi67q53MR2AWcXfiuqkDkRtnGDLqkBTpCHuJHxtU=
|
github.com/yuin/goldmark v1.1.27/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
|
||||||
go.etcd.io/bbolt v1.3.2/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU=
|
github.com/yuin/goldmark v1.1.32/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
|
||||||
|
github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
|
||||||
go.opencensus.io v0.21.0/go.mod h1:mSImk1erAIZhrmZN+AvHh14ztQfjbGwt4TtuofqLduU=
|
go.opencensus.io v0.21.0/go.mod h1:mSImk1erAIZhrmZN+AvHh14ztQfjbGwt4TtuofqLduU=
|
||||||
go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8=
|
go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8=
|
||||||
go.uber.org/atomic v1.4.0/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE=
|
go.opencensus.io v0.22.2/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw=
|
||||||
go.uber.org/multierr v1.1.0/go.mod h1:wR5kodmAFQ0UK8QlbwjlSNy0Z68gJhDJUG5sjR94q/0=
|
go.opencensus.io v0.22.3/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw=
|
||||||
go.uber.org/zap v1.10.0/go.mod h1:vwi/ZaCAaUcBkycHslxD9B2zi4UTXhF60s6SWpuDF0Q=
|
go.opencensus.io v0.22.4/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw=
|
||||||
golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
|
go.opencensus.io v0.22.5/go.mod h1:5pWMHQbX5EPX2/62yrJeAkowc+lfs/XD7Uxpq3pI6kk=
|
||||||
golang.org/x/crypto v0.0.0-20181029021203-45a5f77698d3/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
|
|
||||||
golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
|
golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
|
||||||
golang.org/x/crypto v0.0.0-20190510104115-cbcb75029529/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
|
golang.org/x/crypto v0.0.0-20190510104115-cbcb75029529/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
|
||||||
golang.org/x/crypto v0.0.0-20190605123033-f99c8df09eb5/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
|
golang.org/x/crypto v0.0.0-20190605123033-f99c8df09eb5/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
|
||||||
|
golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
|
||||||
|
golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
|
||||||
|
golang.org/x/crypto v0.0.0-20210421170649-83a5a9bb288b/go.mod h1:T9bdIzuCu7OtxOm1hfPfRQxPLYneinmdGuTeoZ9dtd4=
|
||||||
|
golang.org/x/crypto v0.0.0-20211108221036-ceb1ce70b4fa/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc=
|
||||||
golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
|
golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
|
||||||
golang.org/x/exp v0.0.0-20190306152737-a1d7652674e8/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
|
golang.org/x/exp v0.0.0-20190306152737-a1d7652674e8/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
|
||||||
golang.org/x/exp v0.0.0-20190510132918-efd6b22b2522/go.mod h1:ZjyILWgesfNpC6sMxTJOJm9Kp84zZh5NQWvqDGG3Qr8=
|
golang.org/x/exp v0.0.0-20190510132918-efd6b22b2522/go.mod h1:ZjyILWgesfNpC6sMxTJOJm9Kp84zZh5NQWvqDGG3Qr8=
|
||||||
golang.org/x/exp v0.0.0-20190829153037-c13cbed26979/go.mod h1:86+5VVa7VpoJ4kLfm080zCjGlMRFzhUhsZKEZO7MGek=
|
golang.org/x/exp v0.0.0-20190829153037-c13cbed26979/go.mod h1:86+5VVa7VpoJ4kLfm080zCjGlMRFzhUhsZKEZO7MGek=
|
||||||
golang.org/x/exp v0.0.0-20191030013958-a1ab85dbe136/go.mod h1:JXzH8nQsPlswgeRAPE3MuO9GYsAcnJvJ4vnMwN/5qkY=
|
golang.org/x/exp v0.0.0-20191030013958-a1ab85dbe136/go.mod h1:JXzH8nQsPlswgeRAPE3MuO9GYsAcnJvJ4vnMwN/5qkY=
|
||||||
|
golang.org/x/exp v0.0.0-20191129062945-2f5052295587/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4=
|
||||||
|
golang.org/x/exp v0.0.0-20191227195350-da58074b4299/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4=
|
||||||
|
golang.org/x/exp v0.0.0-20200119233911-0405dc783f0a/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4=
|
||||||
|
golang.org/x/exp v0.0.0-20200207192155-f17229e696bd/go.mod h1:J/WKrq2StrnmMY6+EHIKF9dgMWnmCNThgcyBT1FY9mM=
|
||||||
|
golang.org/x/exp v0.0.0-20200224162631-6cc2880d07d6/go.mod h1:3jZMyOhIsHpP37uCMkUooju7aAi5cS1Q23tOzKc+0MU=
|
||||||
golang.org/x/image v0.0.0-20190227222117-0694c2d4d067/go.mod h1:kZ7UVZpmo3dzQBMxlp+ypCbDeSB+sBbTgSJuh5dn5js=
|
golang.org/x/image v0.0.0-20190227222117-0694c2d4d067/go.mod h1:kZ7UVZpmo3dzQBMxlp+ypCbDeSB+sBbTgSJuh5dn5js=
|
||||||
golang.org/x/image v0.0.0-20190802002840-cff245a6509b/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0=
|
golang.org/x/image v0.0.0-20190802002840-cff245a6509b/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0=
|
||||||
golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
|
golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
|
||||||
@@ -220,16 +222,22 @@ golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHl
|
|||||||
golang.org/x/lint v0.0.0-20190409202823-959b441ac422/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
|
golang.org/x/lint v0.0.0-20190409202823-959b441ac422/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
|
||||||
golang.org/x/lint v0.0.0-20190909230951-414d861bb4ac/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
|
golang.org/x/lint v0.0.0-20190909230951-414d861bb4ac/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
|
||||||
golang.org/x/lint v0.0.0-20190930215403-16217165b5de/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
|
golang.org/x/lint v0.0.0-20190930215403-16217165b5de/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
|
||||||
|
golang.org/x/lint v0.0.0-20191125180803-fdd1cda4f05f/go.mod h1:5qLYkcX4OjUUV8bRuDixDT3tpyyb+LUpUlRWLxfhWrs=
|
||||||
|
golang.org/x/lint v0.0.0-20200130185559-910be7a94367/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY=
|
||||||
|
golang.org/x/lint v0.0.0-20200302205851-738671d3881b/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY=
|
||||||
|
golang.org/x/lint v0.0.0-20201208152925-83fdc39ff7b5/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY=
|
||||||
golang.org/x/mobile v0.0.0-20190312151609-d3739f865fa6/go.mod h1:z+o9i4GpDbdi3rU15maQ/Ox0txvL9dWGYEHz965HBQE=
|
golang.org/x/mobile v0.0.0-20190312151609-d3739f865fa6/go.mod h1:z+o9i4GpDbdi3rU15maQ/Ox0txvL9dWGYEHz965HBQE=
|
||||||
golang.org/x/mobile v0.0.0-20190719004257-d2bd2a29d028/go.mod h1:E/iHnbuqvinMTCcRqshq8CkpyQDoeVncDDYHnLhea+o=
|
golang.org/x/mobile v0.0.0-20190719004257-d2bd2a29d028/go.mod h1:E/iHnbuqvinMTCcRqshq8CkpyQDoeVncDDYHnLhea+o=
|
||||||
golang.org/x/mod v0.0.0-20190513183733-4bf6d317e70e/go.mod h1:mXi4GBBbnImb6dmsKGUJ2LatrhH/nqhxcFungHvyanc=
|
golang.org/x/mod v0.0.0-20190513183733-4bf6d317e70e/go.mod h1:mXi4GBBbnImb6dmsKGUJ2LatrhH/nqhxcFungHvyanc=
|
||||||
golang.org/x/mod v0.1.0/go.mod h1:0QHyrYULN0/3qlju5TqG8bIK38QM8yzMo5ekMj3DlcY=
|
golang.org/x/mod v0.1.0/go.mod h1:0QHyrYULN0/3qlju5TqG8bIK38QM8yzMo5ekMj3DlcY=
|
||||||
|
golang.org/x/mod v0.1.1-0.20191105210325-c90efee705ee/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg=
|
||||||
|
golang.org/x/mod v0.1.1-0.20191107180719-034126e5016b/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg=
|
||||||
|
golang.org/x/mod v0.2.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
|
||||||
|
golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
|
||||||
|
golang.org/x/mod v0.4.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
|
||||||
|
golang.org/x/mod v0.4.1/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
|
||||||
golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||||
golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||||
golang.org/x/net v0.0.0-20181023162649-9b4f9f5ad519/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
|
||||||
golang.org/x/net v0.0.0-20181114220301-adae6a3d119a/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
|
||||||
golang.org/x/net v0.0.0-20181201002055-351d144fa1fc/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
|
||||||
golang.org/x/net v0.0.0-20181220203305-927f97764cc3/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
|
||||||
golang.org/x/net v0.0.0-20190108225652-1e06a53dbb7e/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
golang.org/x/net v0.0.0-20190108225652-1e06a53dbb7e/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||||
golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||||
golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||||
@@ -238,20 +246,47 @@ golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn
|
|||||||
golang.org/x/net v0.0.0-20190503192946-f4e77d36d62c/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
golang.org/x/net v0.0.0-20190503192946-f4e77d36d62c/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||||
golang.org/x/net v0.0.0-20190603091049-60506f45cf65/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks=
|
golang.org/x/net v0.0.0-20190603091049-60506f45cf65/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks=
|
||||||
golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||||
|
golang.org/x/net v0.0.0-20190628185345-da137c7871d7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||||
|
golang.org/x/net v0.0.0-20190724013045-ca1201d0de80/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||||
|
golang.org/x/net v0.0.0-20191209160850-c0dbc17a3553/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||||
|
golang.org/x/net v0.0.0-20200114155413-6afb5195e5aa/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||||
|
golang.org/x/net v0.0.0-20200202094626-16171245cfb2/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||||
|
golang.org/x/net v0.0.0-20200222125558-5a598a2470a0/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||||
|
golang.org/x/net v0.0.0-20200226121028-0de0cce0169b/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||||
|
golang.org/x/net v0.0.0-20200301022130-244492dfa37a/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||||
|
golang.org/x/net v0.0.0-20200324143707-d3edc9973b7e/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
|
||||||
|
golang.org/x/net v0.0.0-20200501053045-e0ff5e5a1de5/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
|
||||||
|
golang.org/x/net v0.0.0-20200506145744-7e3656a0809f/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
|
||||||
|
golang.org/x/net v0.0.0-20200513185701-a91f0712d120/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
|
||||||
|
golang.org/x/net v0.0.0-20200520182314-0ba52f642ac2/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
|
||||||
|
golang.org/x/net v0.0.0-20200625001655-4c5254603344/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA=
|
||||||
|
golang.org/x/net v0.0.0-20200707034311-ab3426394381/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA=
|
||||||
|
golang.org/x/net v0.0.0-20200822124328-c89045814202/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA=
|
||||||
|
golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU=
|
||||||
|
golang.org/x/net v0.0.0-20201031054903-ff519b6c9102/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU=
|
||||||
|
golang.org/x/net v0.0.0-20201209123823-ac852fbbde11/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg=
|
||||||
|
golang.org/x/net v0.0.0-20201224014010-6772e930b67b/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg=
|
||||||
|
golang.org/x/net v0.0.0-20210226172049-e18ecbb05110/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg=
|
||||||
golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
|
golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
|
||||||
golang.org/x/oauth2 v0.0.0-20190226205417-e64efc72b421/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
|
golang.org/x/oauth2 v0.0.0-20190226205417-e64efc72b421/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
|
||||||
golang.org/x/oauth2 v0.0.0-20190604053449-0f29369cfe45/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
|
golang.org/x/oauth2 v0.0.0-20190604053449-0f29369cfe45/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
|
||||||
|
golang.org/x/oauth2 v0.0.0-20191202225959-858c2ad4c8b6/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
|
||||||
|
golang.org/x/oauth2 v0.0.0-20200107190931-bf48bf16ab8d/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
|
||||||
|
golang.org/x/oauth2 v0.0.0-20200902213428-5d25da1a8d43/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
|
||||||
|
golang.org/x/oauth2 v0.0.0-20201109201403-9fd604954f58/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
|
||||||
|
golang.org/x/oauth2 v0.0.0-20201208152858-08078c50e5b5/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
|
||||||
|
golang.org/x/oauth2 v0.0.0-20210218202405-ba52d332ba99/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
|
||||||
golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||||
golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||||
golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||||
golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||||
golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||||
golang.org/x/sys v0.0.0-20180823144017-11551d06cbcc/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
golang.org/x/sync v0.0.0-20190911185100-cd5d95a43a6e/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||||
|
golang.org/x/sync v0.0.0-20200317015054-43a5402ce75a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||||
|
golang.org/x/sync v0.0.0-20200625203802-6e8e738ad208/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||||
|
golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||||
|
golang.org/x/sync v0.0.0-20201207232520-09787c993a3a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||||
golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||||
golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
|
||||||
golang.org/x/sys v0.0.0-20181026203630-95b1ffbd15a5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
|
||||||
golang.org/x/sys v0.0.0-20181107165924-66b7b1311ac8/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
|
||||||
golang.org/x/sys v0.0.0-20181116152217-5ac8a444bdc5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
|
||||||
golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||||
golang.org/x/sys v0.0.0-20190312061237-fead79001313/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
golang.org/x/sys v0.0.0-20190312061237-fead79001313/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
@@ -259,43 +294,127 @@ golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7w
|
|||||||
golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
golang.org/x/sys v0.0.0-20190606165138-5da285871e9c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
golang.org/x/sys v0.0.0-20190606165138-5da285871e9c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
golang.org/x/sys v0.0.0-20190624142023-c5567b49c5d0/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
golang.org/x/sys v0.0.0-20190624142023-c5567b49c5d0/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20190726091711-fc99dfbffb4e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20191001151750-bb3f8db39f24/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20191204072324-ce4227a45e2e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20191228213918-04cbcbbfeed8/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20200113162924-86b910548bc1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
golang.org/x/sys v0.0.0-20200116001909-b77594299b42/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
golang.org/x/sys v0.0.0-20200116001909-b77594299b42/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20200122134326-e047566fdf82/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20200202164722-d101bd2416d5/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20200212091648-12a6c2dcc1e4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
golang.org/x/sys v0.0.0-20210331175145-43e1dd70ce54 h1:rF3Ohx8DRyl8h2zw9qojyLHLhrJpEMgyPOImREEryf0=
|
golang.org/x/sys v0.0.0-20200302150141-5c8b2ff67527/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20200331124033-c3d80250170d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20200501052902-10377860bb8e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20200511232937-7e40ca221e25/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20200515095857-1151b9dac4a9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20200523222454-059865788121/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20200803210538-64077c9b5642/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20200905004654-be1d3432aa8f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20201201145000-ef89a241ccb3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20210104204734-6f8348627aad/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20210119212857-b64e53b001e4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20210225134936-a50acf3fe073/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
golang.org/x/sys v0.0.0-20210331175145-43e1dd70ce54/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
golang.org/x/sys v0.0.0-20210331175145-43e1dd70ce54/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20210423185535-09eb48e85fd7/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||||
|
golang.org/x/sys v0.0.0-20210630005230-0f9fa26af87c/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||||
|
golang.org/x/sys v0.0.0-20210927094055-39ccf1dd6fa6/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||||
|
golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f h1:v4INt8xihDGvnrfjMDVXGxw9wrfxYyCjk0KbXjhR55s=
|
||||||
|
golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||||
|
golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo=
|
||||||
|
golang.org/x/text v0.0.0-20170915032832-14c0d48ead0c/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
||||||
golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
||||||
golang.org/x/text v0.3.1-0.20180807135948-17ff2d5776d2/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
golang.org/x/text v0.3.1-0.20180807135948-17ff2d5776d2/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
||||||
golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs=
|
|
||||||
golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
|
golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
|
||||||
|
golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
|
||||||
|
golang.org/x/text v0.3.4/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
|
||||||
|
golang.org/x/text v0.3.8 h1:nAL+RVCQ9uMn3vJZbV+MRnydTJFPf8qqY42YiA6MrqY=
|
||||||
|
golang.org/x/text v0.3.8/go.mod h1:E6s5w1FMmriuDzIBO73fBruAKo1PCIq6d2Q6DHfQ8WQ=
|
||||||
golang.org/x/time v0.0.0-20181108054448-85acf8d2951c/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
|
golang.org/x/time v0.0.0-20181108054448-85acf8d2951c/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
|
||||||
golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
|
golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
|
||||||
golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
golang.org/x/time v0.0.0-20191024005414-555d28b269f0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
|
||||||
golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||||
golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||||
golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY=
|
golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY=
|
||||||
golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
|
golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
|
||||||
golang.org/x/tools v0.0.0-20190312151545-0bb0c0a6e846/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
|
golang.org/x/tools v0.0.0-20190312151545-0bb0c0a6e846/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
|
||||||
golang.org/x/tools v0.0.0-20190312170243-e65039ee4138/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
|
golang.org/x/tools v0.0.0-20190312170243-e65039ee4138/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
|
||||||
golang.org/x/tools v0.0.0-20190328211700-ab21143f2384/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
|
|
||||||
golang.org/x/tools v0.0.0-20190425150028-36563e24a262/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
|
golang.org/x/tools v0.0.0-20190425150028-36563e24a262/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
|
||||||
golang.org/x/tools v0.0.0-20190506145303-2d16b83fe98c/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
|
golang.org/x/tools v0.0.0-20190506145303-2d16b83fe98c/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
|
||||||
|
golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
|
||||||
golang.org/x/tools v0.0.0-20190606124116-d0a3d012864b/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc=
|
golang.org/x/tools v0.0.0-20190606124116-d0a3d012864b/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc=
|
||||||
golang.org/x/tools v0.0.0-20190621195816-6e04913cbbac/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc=
|
golang.org/x/tools v0.0.0-20190621195816-6e04913cbbac/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc=
|
||||||
golang.org/x/tools v0.0.0-20190628153133-6cdbf07be9d0/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc=
|
golang.org/x/tools v0.0.0-20190628153133-6cdbf07be9d0/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc=
|
||||||
golang.org/x/tools v0.0.0-20190816200558-6889da9d5479/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
golang.org/x/tools v0.0.0-20190816200558-6889da9d5479/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
||||||
golang.org/x/tools v0.0.0-20190911174233-4f2ddba30aff/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
golang.org/x/tools v0.0.0-20190911174233-4f2ddba30aff/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
||||||
golang.org/x/tools v0.0.0-20191012152004-8de300cfc20a/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
golang.org/x/tools v0.0.0-20191012152004-8de300cfc20a/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
||||||
golang.org/x/tools v0.0.0-20191112195655-aa38f8e97acc/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
golang.org/x/tools v0.0.0-20191113191852-77e3bb0ad9e7/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
||||||
|
golang.org/x/tools v0.0.0-20191115202509-3a792d9c32b2/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
||||||
|
golang.org/x/tools v0.0.0-20191119224855-298f0cb1881e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
||||||
|
golang.org/x/tools v0.0.0-20191125144606-a911d9008d1f/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
||||||
|
golang.org/x/tools v0.0.0-20191130070609-6e064ea0cf2d/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
||||||
|
golang.org/x/tools v0.0.0-20191216173652-a0e659d51361/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
|
||||||
|
golang.org/x/tools v0.0.0-20191227053925-7b8e75db28f4/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
|
||||||
|
golang.org/x/tools v0.0.0-20200117161641-43d50277825c/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
|
||||||
|
golang.org/x/tools v0.0.0-20200122220014-bf1340f18c4a/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
|
||||||
|
golang.org/x/tools v0.0.0-20200130002326-2f3ba24bd6e7/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
|
||||||
|
golang.org/x/tools v0.0.0-20200204074204-1cc6d1ef6c74/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
|
||||||
|
golang.org/x/tools v0.0.0-20200207183749-b753a1ba74fa/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
|
||||||
|
golang.org/x/tools v0.0.0-20200212150539-ea181f53ac56/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
|
||||||
|
golang.org/x/tools v0.0.0-20200224181240-023911ca70b2/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
|
||||||
|
golang.org/x/tools v0.0.0-20200227222343-706bc42d1f0d/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
|
||||||
|
golang.org/x/tools v0.0.0-20200304193943-95d2e580d8eb/go.mod h1:o4KQGtdN14AW+yjsvvwRTJJuXz8XRtIHtEnmAXLyFUw=
|
||||||
|
golang.org/x/tools v0.0.0-20200312045724-11d5b4c81c7d/go.mod h1:o4KQGtdN14AW+yjsvvwRTJJuXz8XRtIHtEnmAXLyFUw=
|
||||||
|
golang.org/x/tools v0.0.0-20200331025713-a30bf2db82d4/go.mod h1:Sl4aGygMT6LrqrWclx+PTx3U+LnKx/seiNR+3G19Ar8=
|
||||||
|
golang.org/x/tools v0.0.0-20200501065659-ab2804fb9c9d/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE=
|
||||||
|
golang.org/x/tools v0.0.0-20200512131952-2bc93b1c0c88/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE=
|
||||||
|
golang.org/x/tools v0.0.0-20200515010526-7d3b6ebf133d/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE=
|
||||||
|
golang.org/x/tools v0.0.0-20200618134242-20370b0cb4b2/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE=
|
||||||
|
golang.org/x/tools v0.0.0-20200729194436-6467de6f59a7/go.mod h1:njjCfa9FT2d7l9Bc6FUM5FLjQPp3cFF28FI3qnDFljA=
|
||||||
|
golang.org/x/tools v0.0.0-20200804011535-6c149bb5ef0d/go.mod h1:njjCfa9FT2d7l9Bc6FUM5FLjQPp3cFF28FI3qnDFljA=
|
||||||
|
golang.org/x/tools v0.0.0-20200825202427-b303f430e36d/go.mod h1:njjCfa9FT2d7l9Bc6FUM5FLjQPp3cFF28FI3qnDFljA=
|
||||||
|
golang.org/x/tools v0.0.0-20200904185747-39188db58858/go.mod h1:Cj7w3i3Rnn0Xh82ur9kSqwfTHTeVxaDqrfMjpcNT6bE=
|
||||||
|
golang.org/x/tools v0.0.0-20201110124207-079ba7bd75cd/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
|
||||||
|
golang.org/x/tools v0.0.0-20201201161351-ac6f37ff4c2a/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
|
||||||
|
golang.org/x/tools v0.0.0-20201208233053-a543418bbed2/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
|
||||||
|
golang.org/x/tools v0.0.0-20210105154028-b0ab187a4818/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
|
||||||
|
golang.org/x/tools v0.0.0-20210108195828-e2f9c7f1fc8e/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
|
||||||
|
golang.org/x/tools v0.1.0/go.mod h1:xkSsbof2nBLbhDlRMhhhyNLN/zl3eTqcnHD5viDpcZ0=
|
||||||
golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||||
|
golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||||
|
golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||||
|
golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||||
google.golang.org/api v0.4.0/go.mod h1:8k5glujaEP+g9n7WNsDg8QP6cUVNI86fCNMcbazEtwE=
|
google.golang.org/api v0.4.0/go.mod h1:8k5glujaEP+g9n7WNsDg8QP6cUVNI86fCNMcbazEtwE=
|
||||||
google.golang.org/api v0.7.0/go.mod h1:WtwebWUNSVBH/HAw79HIFXZNqEvBhG+Ra+ax0hx3E3M=
|
google.golang.org/api v0.7.0/go.mod h1:WtwebWUNSVBH/HAw79HIFXZNqEvBhG+Ra+ax0hx3E3M=
|
||||||
google.golang.org/api v0.8.0/go.mod h1:o4eAsZoiT+ibD93RtjEohWalFOjRDx6CVaqeizhEnKg=
|
google.golang.org/api v0.8.0/go.mod h1:o4eAsZoiT+ibD93RtjEohWalFOjRDx6CVaqeizhEnKg=
|
||||||
google.golang.org/api v0.9.0/go.mod h1:o4eAsZoiT+ibD93RtjEohWalFOjRDx6CVaqeizhEnKg=
|
google.golang.org/api v0.9.0/go.mod h1:o4eAsZoiT+ibD93RtjEohWalFOjRDx6CVaqeizhEnKg=
|
||||||
google.golang.org/api v0.13.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI=
|
google.golang.org/api v0.13.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI=
|
||||||
|
google.golang.org/api v0.14.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI=
|
||||||
|
google.golang.org/api v0.15.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI=
|
||||||
|
google.golang.org/api v0.17.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
|
||||||
|
google.golang.org/api v0.18.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
|
||||||
|
google.golang.org/api v0.19.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
|
||||||
|
google.golang.org/api v0.20.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
|
||||||
|
google.golang.org/api v0.22.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
|
||||||
|
google.golang.org/api v0.24.0/go.mod h1:lIXQywCXRcnZPGlsd8NbLnOjtAoL6em04bJ9+z0MncE=
|
||||||
|
google.golang.org/api v0.28.0/go.mod h1:lIXQywCXRcnZPGlsd8NbLnOjtAoL6em04bJ9+z0MncE=
|
||||||
|
google.golang.org/api v0.29.0/go.mod h1:Lcubydp8VUV7KeIHD9z2Bys/sm/vGKnG1UHuDBSrHWM=
|
||||||
|
google.golang.org/api v0.30.0/go.mod h1:QGmEvQ87FHZNiUVJkT14jQNYJ4ZJjdRF23ZXz5138Fc=
|
||||||
|
google.golang.org/api v0.35.0/go.mod h1:/XrVsuzM0rZmrsbjJutiuftIzeuTQcEeaYcSk/mQ1dg=
|
||||||
|
google.golang.org/api v0.36.0/go.mod h1:+z5ficQTmoYpPn8LCUNVpK5I7hwkpjbcgqA7I34qYtE=
|
||||||
|
google.golang.org/api v0.40.0/go.mod h1:fYKFpnQN0DsDSKRVRcQSDQNtqWPfM9i+zNPxepjRCQ8=
|
||||||
google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
|
google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
|
||||||
google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
|
google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
|
||||||
google.golang.org/appengine v1.5.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
|
google.golang.org/appengine v1.5.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
|
||||||
google.golang.org/appengine v1.6.1/go.mod h1:i06prIuMbXzDqacNJfV5OdTW448YApPu5ww/cMBSeb0=
|
google.golang.org/appengine v1.6.1/go.mod h1:i06prIuMbXzDqacNJfV5OdTW448YApPu5ww/cMBSeb0=
|
||||||
|
google.golang.org/appengine v1.6.5/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc=
|
||||||
|
google.golang.org/appengine v1.6.6/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc=
|
||||||
|
google.golang.org/appengine v1.6.7/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc=
|
||||||
google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
|
google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
|
||||||
google.golang.org/genproto v0.0.0-20190307195333-5fe7a883aa19/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
|
google.golang.org/genproto v0.0.0-20190307195333-5fe7a883aa19/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
|
||||||
google.golang.org/genproto v0.0.0-20190418145605-e7d98fc518a7/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
|
google.golang.org/genproto v0.0.0-20190418145605-e7d98fc518a7/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
|
||||||
@@ -305,24 +424,78 @@ google.golang.org/genproto v0.0.0-20190801165951-fa694d86fc64/go.mod h1:DMBHOl98
|
|||||||
google.golang.org/genproto v0.0.0-20190819201941-24fa4b261c55/go.mod h1:DMBHOl98Agz4BDEuKkezgsaosCRResVns1a3J2ZsMNc=
|
google.golang.org/genproto v0.0.0-20190819201941-24fa4b261c55/go.mod h1:DMBHOl98Agz4BDEuKkezgsaosCRResVns1a3J2ZsMNc=
|
||||||
google.golang.org/genproto v0.0.0-20190911173649-1774047e7e51/go.mod h1:IbNlFCBrqXvoKpeg0TB2l7cyZUmoaFKYIwrEpbDKLA8=
|
google.golang.org/genproto v0.0.0-20190911173649-1774047e7e51/go.mod h1:IbNlFCBrqXvoKpeg0TB2l7cyZUmoaFKYIwrEpbDKLA8=
|
||||||
google.golang.org/genproto v0.0.0-20191108220845-16a3f7862a1a/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
|
google.golang.org/genproto v0.0.0-20191108220845-16a3f7862a1a/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
|
||||||
|
google.golang.org/genproto v0.0.0-20191115194625-c23dd37a84c9/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
|
||||||
|
google.golang.org/genproto v0.0.0-20191216164720-4f79533eabd1/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
|
||||||
|
google.golang.org/genproto v0.0.0-20191230161307-f3c370f40bfb/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
|
||||||
|
google.golang.org/genproto v0.0.0-20200115191322-ca5a22157cba/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
|
||||||
|
google.golang.org/genproto v0.0.0-20200122232147-0452cf42e150/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
|
||||||
|
google.golang.org/genproto v0.0.0-20200204135345-fa8e72b47b90/go.mod h1:GmwEX6Z4W5gMy59cAlVYjN9JhxgbQH6Gn+gFDQe2lzA=
|
||||||
|
google.golang.org/genproto v0.0.0-20200212174721-66ed5ce911ce/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
|
||||||
|
google.golang.org/genproto v0.0.0-20200224152610-e50cd9704f63/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
|
||||||
|
google.golang.org/genproto v0.0.0-20200228133532-8c2c7df3a383/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
|
||||||
|
google.golang.org/genproto v0.0.0-20200305110556-506484158171/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
|
||||||
|
google.golang.org/genproto v0.0.0-20200312145019-da6875a35672/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
|
||||||
|
google.golang.org/genproto v0.0.0-20200331122359-1ee6d9798940/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
|
||||||
|
google.golang.org/genproto v0.0.0-20200430143042-b979b6f78d84/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
|
||||||
|
google.golang.org/genproto v0.0.0-20200511104702-f5ebc3bea380/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
|
||||||
|
google.golang.org/genproto v0.0.0-20200515170657-fc4c6c6a6587/go.mod h1:YsZOwe1myG/8QRHRsmBRE1LrgQY60beZKjly0O1fX9U=
|
||||||
|
google.golang.org/genproto v0.0.0-20200526211855-cb27e3aa2013/go.mod h1:NbSheEEYHJ7i3ixzK3sjbqSGDJWnxyFXZblF3eUsNvo=
|
||||||
|
google.golang.org/genproto v0.0.0-20200618031413-b414f8b61790/go.mod h1:jDfRM7FcilCzHH/e9qn6dsT145K34l5v+OpcnNgKAAA=
|
||||||
|
google.golang.org/genproto v0.0.0-20200729003335-053ba62fc06f/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
|
||||||
|
google.golang.org/genproto v0.0.0-20200804131852-c06518451d9c/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
|
||||||
|
google.golang.org/genproto v0.0.0-20200825200019-8632dd797987/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
|
||||||
|
google.golang.org/genproto v0.0.0-20200904004341-0bd0a958aa1d/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
|
||||||
|
google.golang.org/genproto v0.0.0-20201109203340-2640f1f9cdfb/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
|
||||||
|
google.golang.org/genproto v0.0.0-20201201144952-b05cb90ed32e/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
|
||||||
|
google.golang.org/genproto v0.0.0-20201210142538-e3217bee35cc/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
|
||||||
|
google.golang.org/genproto v0.0.0-20201214200347-8c77b98c765d/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
|
||||||
|
google.golang.org/genproto v0.0.0-20210108203827-ffc7fda8c3d7/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
|
||||||
|
google.golang.org/genproto v0.0.0-20210226172003-ab064af71705/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
|
||||||
google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c=
|
google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c=
|
||||||
google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38=
|
google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38=
|
||||||
google.golang.org/grpc v1.21.1/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM=
|
google.golang.org/grpc v1.21.1/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM=
|
||||||
gopkg.in/alecthomas/kingpin.v2 v2.2.6/go.mod h1:FMv+mEhP44yOT+4EoQTLFTRgOQ1FBLkstjWtayDeSgw=
|
google.golang.org/grpc v1.23.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg=
|
||||||
|
google.golang.org/grpc v1.25.1/go.mod h1:c3i+UQWmh7LiEpx4sFZnkU36qjEYZ0imhYfXVyQciAY=
|
||||||
|
google.golang.org/grpc v1.26.0/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk=
|
||||||
|
google.golang.org/grpc v1.27.0/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk=
|
||||||
|
google.golang.org/grpc v1.27.1/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk=
|
||||||
|
google.golang.org/grpc v1.28.0/go.mod h1:rpkK4SK4GF4Ach/+MFLZUBavHOvF2JJB5uozKKal+60=
|
||||||
|
google.golang.org/grpc v1.29.1/go.mod h1:itym6AZVZYACWQqET3MqgPpjcuV5QH3BxFS3IjizoKk=
|
||||||
|
google.golang.org/grpc v1.30.0/go.mod h1:N36X2cJ7JwdamYAgDz+s+rVMFjt3numwzf/HckM8pak=
|
||||||
|
google.golang.org/grpc v1.31.0/go.mod h1:N36X2cJ7JwdamYAgDz+s+rVMFjt3numwzf/HckM8pak=
|
||||||
|
google.golang.org/grpc v1.31.1/go.mod h1:N36X2cJ7JwdamYAgDz+s+rVMFjt3numwzf/HckM8pak=
|
||||||
|
google.golang.org/grpc v1.33.2/go.mod h1:JMHMWHQWaTccqQQlmk3MJZS+GWXOdAesneDmEnv2fbc=
|
||||||
|
google.golang.org/grpc v1.34.0/go.mod h1:WotjhfgOW/POjDeRt8vscBtXq+2VjORFy659qA51WJ8=
|
||||||
|
google.golang.org/grpc v1.35.0/go.mod h1:qjiiYl8FncCW8feJPdyg3v6XW24KsRHe+dy9BAGRRjU=
|
||||||
|
google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8=
|
||||||
|
google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0=
|
||||||
|
google.golang.org/protobuf v0.0.0-20200228230310-ab0ca4ff8a60/go.mod h1:cfTl7dwQJ+fmap5saPgwCLgHXTUD7jkjRqWcaiX5VyM=
|
||||||
|
google.golang.org/protobuf v1.20.1-0.20200309200217-e05f789c0967/go.mod h1:A+miEFZTKqfCUM6K7xSMQL9OKL/b6hQv+e19PK+JZNE=
|
||||||
|
google.golang.org/protobuf v1.21.0/go.mod h1:47Nbq4nVaFHyn7ilMalzfO3qCViNmqZ2kzikPIcrTAo=
|
||||||
|
google.golang.org/protobuf v1.22.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
|
||||||
|
google.golang.org/protobuf v1.23.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
|
||||||
|
google.golang.org/protobuf v1.23.1-0.20200526195155-81db48ad09cc/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
|
||||||
|
google.golang.org/protobuf v1.24.0/go.mod h1:r/3tXBNzIEhYS9I1OUVjXDlt8tc493IdKGjtUeSXeh4=
|
||||||
|
google.golang.org/protobuf v1.25.0/go.mod h1:9JNX74DMeImyA3h4bdi1ymwjUzf21/xIlbajtzgsN7c=
|
||||||
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||||
gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127 h1:qIbj1fsPNlZgppZ+VLlY7N33q108Sa+fhmuc+sWQYwY=
|
gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127 h1:qIbj1fsPNlZgppZ+VLlY7N33q108Sa+fhmuc+sWQYwY=
|
||||||
gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||||
gopkg.in/errgo.v2 v2.1.0/go.mod h1:hNsd1EY+bozCKY1Ytp96fpM3vjJbqLJn88ws8XvfDNI=
|
gopkg.in/errgo.v2 v2.1.0/go.mod h1:hNsd1EY+bozCKY1Ytp96fpM3vjJbqLJn88ws8XvfDNI=
|
||||||
gopkg.in/ini.v1 v1.51.0 h1:AQvPpx3LzTDM0AjnIRlVFwFFGC+npRopjZxLJj6gdno=
|
gopkg.in/ini.v1 v1.66.4 h1:SsAcf+mM7mRZo2nJNGt8mZCjG8ZRaNGMURJw7BsIST4=
|
||||||
gopkg.in/ini.v1 v1.51.0/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k=
|
gopkg.in/ini.v1 v1.66.4/go.mod h1:pNLf8WUiyNEtQjuu5G5vTm06TEv9tsIgeAvK8hOrP4k=
|
||||||
gopkg.in/resty.v1 v1.12.0/go.mod h1:mDo4pnntr5jdWRML875a/NmxYqAlA73dVijT2AXvQQo=
|
gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||||
gopkg.in/yaml.v2 v2.0.0-20170812160011-eb3733d160e7/go.mod h1:JAlM8MvJe8wmxCU4Bli9HhUf9+ttbYbLASfIpnQbh74=
|
|
||||||
gopkg.in/yaml.v2 v2.2.1/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
|
||||||
gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
|
||||||
gopkg.in/yaml.v2 v2.4.0 h1:D8xgwECY7CYvx+Y2n4sBz93Jn9JRvxdiyyo8CTfuKaY=
|
gopkg.in/yaml.v2 v2.4.0 h1:D8xgwECY7CYvx+Y2n4sBz93Jn9JRvxdiyyo8CTfuKaY=
|
||||||
gopkg.in/yaml.v2 v2.4.0/go.mod h1:RDklbk79AGWmwhnvt/jBztapEOGDOx6ZbXqjP6csGnQ=
|
gopkg.in/yaml.v2 v2.4.0/go.mod h1:RDklbk79AGWmwhnvt/jBztapEOGDOx6ZbXqjP6csGnQ=
|
||||||
|
gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||||
|
gopkg.in/yaml.v3 v3.0.0-20210107192922-496545a6307b h1:h8qDotaEPuJATrMmW04NCwg7v22aHH28wwpauUhK9Oo=
|
||||||
|
gopkg.in/yaml.v3 v3.0.0-20210107192922-496545a6307b/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||||
honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
||||||
honnef.co/go/tools v0.0.0-20190106161140-3f1c8253044a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
honnef.co/go/tools v0.0.0-20190106161140-3f1c8253044a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
||||||
honnef.co/go/tools v0.0.0-20190418001031-e561f6794a2a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
honnef.co/go/tools v0.0.0-20190418001031-e561f6794a2a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
||||||
|
honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
||||||
honnef.co/go/tools v0.0.1-2019.2.3/go.mod h1:a3bituU0lyd329TUQxRnasdCoJDkEUEAqEt0JzvZhAg=
|
honnef.co/go/tools v0.0.1-2019.2.3/go.mod h1:a3bituU0lyd329TUQxRnasdCoJDkEUEAqEt0JzvZhAg=
|
||||||
|
honnef.co/go/tools v0.0.1-2020.1.3/go.mod h1:X/FiERA/W4tHapMX5mGpAtMSVEeEUOyHaw9vFzvIQ3k=
|
||||||
|
honnef.co/go/tools v0.0.1-2020.1.4/go.mod h1:X/FiERA/W4tHapMX5mGpAtMSVEeEUOyHaw9vFzvIQ3k=
|
||||||
rsc.io/binaryregexp v0.2.0/go.mod h1:qTv7/COck+e2FymRvadv62gMdZztPaShugOCi3I+8D8=
|
rsc.io/binaryregexp v0.2.0/go.mod h1:qTv7/COck+e2FymRvadv62gMdZztPaShugOCi3I+8D8=
|
||||||
|
rsc.io/quote/v3 v3.1.0/go.mod h1:yEA65RcK8LyAZtP9Kv3t0HmxON59tX3rD+tICJqUlj0=
|
||||||
|
rsc.io/sampler v1.3.0/go.mod h1:T1hPZKmBbMNahiBKFy5HrXp6adAjACjK9JXDnKaTXpA=
|
||||||
|
|||||||
13
install.sh
13
install.sh
@@ -16,18 +16,27 @@ else
|
|||||||
fi
|
fi
|
||||||
echo $OS
|
echo $OS
|
||||||
|
|
||||||
NATIVE_ARCH=$(uname -m)
|
NATIVE_ARCH=$(uname -m | tr '[:upper:]' '[:lower:]')
|
||||||
if [[ $NATIVE_ARCH == *"x86_64"* ]]; then
|
if [[ $NATIVE_ARCH == *"x86_64"* ]]; then
|
||||||
ARCH=amd64
|
ARCH=amd64
|
||||||
|
elif [[ $NATIVE_ARCH == *"arm64"* || $NATIVE_ARCH == *"aarch64"* ]]; then
|
||||||
|
ARCH=arm64
|
||||||
elif [[ $NATIVE_ARCH == *"x86"* ]]; then
|
elif [[ $NATIVE_ARCH == *"x86"* ]]; then
|
||||||
ARCH=386
|
ARCH=386
|
||||||
|
elif [[ $NATIVE_ARCH == *"armv7"* ]]; then
|
||||||
|
ARCH=arm
|
||||||
else
|
else
|
||||||
echo "Could not determine Architecure automatically, please check the release page manually: https://github.com/cupcakearmy/autorestic/releases"
|
echo "Could not determine Architecure automatically, please check the release page manually: https://github.com/cupcakearmy/autorestic/releases"
|
||||||
exit 1
|
exit 1
|
||||||
fi
|
fi
|
||||||
echo $ARCH
|
echo $ARCH
|
||||||
|
|
||||||
curl -s https://api.github.com/repos/cupcakearmy/autorestic/releases/latest \
|
if ! command -v bzip2 &>/dev/null; then
|
||||||
|
echo "Missing bzip2 command. Please install the bzip2 package for your system."
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
|
||||||
|
wget -qO - https://api.github.com/repos/cupcakearmy/autorestic/releases/latest \
|
||||||
| grep "browser_download_url.*_${OS}_${ARCH}" \
|
| grep "browser_download_url.*_${OS}_${ARCH}" \
|
||||||
| cut -d : -f 2,3 \
|
| cut -d : -f 2,3 \
|
||||||
| tr -d \" \
|
| tr -d \" \
|
||||||
|
|||||||
@@ -9,20 +9,22 @@ import (
|
|||||||
"strings"
|
"strings"
|
||||||
|
|
||||||
"github.com/cupcakearmy/autorestic/internal/colors"
|
"github.com/cupcakearmy/autorestic/internal/colors"
|
||||||
|
"github.com/cupcakearmy/autorestic/internal/flags"
|
||||||
)
|
)
|
||||||
|
|
||||||
type BackendRest struct {
|
type BackendRest struct {
|
||||||
User string `yaml:"user,omitempty"`
|
User string `mapstructure:"user,omitempty"`
|
||||||
Password string `yaml:"password,omitempty"`
|
Password string `mapstructure:"password,omitempty"`
|
||||||
}
|
}
|
||||||
|
|
||||||
type Backend struct {
|
type Backend struct {
|
||||||
name string
|
name string
|
||||||
Type string `yaml:"type,omitempty"`
|
Type string `mapstructure:"type,omitempty"`
|
||||||
Path string `yaml:"path,omitempty"`
|
Path string `mapstructure:"path,omitempty"`
|
||||||
Key string `yaml:"key,omitempty"`
|
Key string `mapstructure:"key,omitempty"`
|
||||||
Env map[string]string `yaml:"env,omitempty"`
|
Env map[string]string `mapstructure:"env,omitempty"`
|
||||||
Rest BackendRest `yaml:"rest,omitempty"`
|
Rest BackendRest `mapstructure:"rest,omitempty"`
|
||||||
|
Options Options `mapstructure:"options,omitempty"`
|
||||||
}
|
}
|
||||||
|
|
||||||
func GetBackend(name string) (Backend, bool) {
|
func GetBackend(name string) (Backend, bool) {
|
||||||
@@ -36,7 +38,7 @@ func (b Backend) generateRepo() (string, error) {
|
|||||||
case "local":
|
case "local":
|
||||||
return GetPathRelativeToConfig(b.Path)
|
return GetPathRelativeToConfig(b.Path)
|
||||||
case "rest":
|
case "rest":
|
||||||
parsed, err := url.Parse(b.Path)
|
parsed, err := url.Parse(os.ExpandEnv(b.Path))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return "", err
|
return "", err
|
||||||
}
|
}
|
||||||
@@ -48,7 +50,7 @@ func (b Backend) generateRepo() (string, error) {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
return fmt.Sprintf("%s:%s", b.Type, parsed.String()), nil
|
return fmt.Sprintf("%s:%s", b.Type, parsed.String()), nil
|
||||||
case "b2", "azure", "gs", "s3", "sftp":
|
case "b2", "azure", "gs", "s3", "sftp", "rclone":
|
||||||
return fmt.Sprintf("%s:%s", b.Type, b.Path), nil
|
return fmt.Sprintf("%s:%s", b.Type, b.Path), nil
|
||||||
default:
|
default:
|
||||||
return "", fmt.Errorf("backend type \"%s\" is invalid", b.Type)
|
return "", fmt.Errorf("backend type \"%s\" is invalid", b.Type)
|
||||||
@@ -57,12 +59,27 @@ func (b Backend) generateRepo() (string, error) {
|
|||||||
|
|
||||||
func (b Backend) getEnv() (map[string]string, error) {
|
func (b Backend) getEnv() (map[string]string, error) {
|
||||||
env := make(map[string]string)
|
env := make(map[string]string)
|
||||||
env["RESTIC_PASSWORD"] = b.Key
|
// Key
|
||||||
|
if b.Key != "" {
|
||||||
|
env["RESTIC_PASSWORD"] = b.Key
|
||||||
|
}
|
||||||
|
|
||||||
|
// From config file
|
||||||
repo, err := b.generateRepo()
|
repo, err := b.generateRepo()
|
||||||
env["RESTIC_REPOSITORY"] = repo
|
env["RESTIC_REPOSITORY"] = repo
|
||||||
for key, value := range b.Env {
|
for key, value := range b.Env {
|
||||||
env[strings.ToUpper(key)] = value
|
env[strings.ToUpper(key)] = value
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// From Envfile and passed as env
|
||||||
|
var prefix = "AUTORESTIC_" + strings.ToUpper(b.name) + "_"
|
||||||
|
for _, variable := range os.Environ() {
|
||||||
|
var splitted = strings.SplitN(variable, "=", 2)
|
||||||
|
if strings.HasPrefix(splitted[0], prefix) {
|
||||||
|
env[strings.TrimPrefix(splitted[0], prefix)] = splitted[1]
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
return env, err
|
return env, err
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -84,32 +101,38 @@ func (b Backend) validate() error {
|
|||||||
return fmt.Errorf(`Backend "%s" has no "path"`, b.name)
|
return fmt.Errorf(`Backend "%s" has no "path"`, b.name)
|
||||||
}
|
}
|
||||||
if b.Key == "" {
|
if b.Key == "" {
|
||||||
key := generateRandomKey()
|
// Check if key is set in environment
|
||||||
b.Key = key
|
env, _ := b.getEnv()
|
||||||
c := GetConfig()
|
if _, found := env["RESTIC_PASSWORD"]; !found {
|
||||||
tmp := c.Backends[b.name]
|
// No key set in config file or env => generate random key and save file
|
||||||
tmp.Key = key
|
key := generateRandomKey()
|
||||||
c.Backends[b.name] = tmp
|
b.Key = key
|
||||||
if err := c.SaveConfig(); err != nil {
|
c := GetConfig()
|
||||||
return err
|
tmp := c.Backends[b.name]
|
||||||
|
tmp.Key = key
|
||||||
|
c.Backends[b.name] = tmp
|
||||||
|
if err := c.SaveConfig(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
env, err := b.getEnv()
|
env, err := b.getEnv()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
options := ExecuteOptions{Envs: env}
|
options := ExecuteOptions{Envs: env, Silent: true}
|
||||||
// Check if already initialized
|
// Check if already initialized
|
||||||
_, err = ExecuteResticCommand(options, "snapshots")
|
cmd := []string{"check"}
|
||||||
|
cmd = append(cmd, combineBackendOptions("check", b)...)
|
||||||
|
_, _, err = ExecuteResticCommand(options, cmd...)
|
||||||
if err == nil {
|
if err == nil {
|
||||||
return nil
|
return nil
|
||||||
} else {
|
} else {
|
||||||
// If not initialize
|
// If not initialize
|
||||||
colors.Body.Printf("Initializing backend \"%s\"...\n", b.name)
|
colors.Body.Printf("Initializing backend \"%s\"...\n", b.name)
|
||||||
out, err := ExecuteResticCommand(options, "init")
|
cmd := []string{"init"}
|
||||||
if VERBOSE {
|
cmd = append(cmd, combineBackendOptions("init", b)...)
|
||||||
colors.Faint.Println(out)
|
_, _, err := ExecuteResticCommand(options, cmd...)
|
||||||
}
|
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -120,45 +143,63 @@ func (b Backend) Exec(args []string) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
options := ExecuteOptions{Envs: env}
|
options := ExecuteOptions{Envs: env}
|
||||||
out, err := ExecuteResticCommand(options, args...)
|
args = append(args, combineBackendOptions("exec", b)...)
|
||||||
if VERBOSE {
|
_, out, err := ExecuteResticCommand(options, args...)
|
||||||
colors.Faint.Println(out)
|
|
||||||
}
|
|
||||||
return err
|
|
||||||
}
|
|
||||||
|
|
||||||
func (b Backend) ExecDocker(l Location, args []string) error {
|
|
||||||
env, err := b.getEnv()
|
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
colors.Error.Println(out)
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
volume := l.getVolumeName()
|
return nil
|
||||||
path, _ := l.getPath()
|
}
|
||||||
|
|
||||||
|
func (b Backend) ExecDocker(l Location, args []string) (int, string, error) {
|
||||||
|
env, err := b.getEnv()
|
||||||
|
if err != nil {
|
||||||
|
return -1, "", err
|
||||||
|
}
|
||||||
|
volume := l.From[0]
|
||||||
options := ExecuteOptions{
|
options := ExecuteOptions{
|
||||||
Command: "docker",
|
Command: "docker",
|
||||||
Envs: env,
|
Envs: env,
|
||||||
}
|
}
|
||||||
|
dir := "/data"
|
||||||
|
args = append([]string{"restic"}, args...)
|
||||||
docker := []string{
|
docker := []string{
|
||||||
"run", "--rm",
|
"run", "--rm",
|
||||||
"--entrypoint", "ash",
|
"--entrypoint", "ash",
|
||||||
"--workdir", path,
|
"--workdir", dir,
|
||||||
"--volume", volume + ":" + path,
|
"--volume", volume + ":" + dir,
|
||||||
}
|
}
|
||||||
|
// Use of docker host, not the container host
|
||||||
if hostname, err := os.Hostname(); err == nil {
|
if hostname, err := os.Hostname(); err == nil {
|
||||||
docker = append(docker, "--hostname", hostname)
|
docker = append(docker, "--hostname", hostname)
|
||||||
}
|
}
|
||||||
if b.Type == "local" {
|
switch b.Type {
|
||||||
|
case "local":
|
||||||
actual := env["RESTIC_REPOSITORY"]
|
actual := env["RESTIC_REPOSITORY"]
|
||||||
docker = append(docker, "--volume", actual+":"+"/repo")
|
docker = append(docker, "--volume", actual+":"+"/repo")
|
||||||
env["RESTIC_REPOSITORY"] = "/repo"
|
env["RESTIC_REPOSITORY"] = "/repo"
|
||||||
|
case "b2":
|
||||||
|
case "s3":
|
||||||
|
case "azure":
|
||||||
|
case "gs":
|
||||||
|
// No additional setup needed
|
||||||
|
case "rclone":
|
||||||
|
// Read host rclone config and mount it into the container
|
||||||
|
code, configFile, err := ExecuteCommand(ExecuteOptions{Command: "rclone"}, "config", "file")
|
||||||
|
if err != nil {
|
||||||
|
return code, "", err
|
||||||
|
}
|
||||||
|
splitted := strings.Split(strings.TrimSpace(configFile), "\n")
|
||||||
|
configFilePath := splitted[len(splitted)-1]
|
||||||
|
docker = append(docker, "--volume", configFilePath+":"+"/root/.config/rclone/rclone.conf:ro")
|
||||||
|
default:
|
||||||
|
return -1, "", fmt.Errorf("Backend type \"%s\" is not supported as volume endpoint", b.Type)
|
||||||
}
|
}
|
||||||
for key, value := range env {
|
for key, value := range env {
|
||||||
docker = append(docker, "--env", key+"="+value)
|
docker = append(docker, "--env", key+"="+value)
|
||||||
}
|
}
|
||||||
docker = append(docker, "restic/restic", "-c", "restic "+strings.Join(args, " "))
|
|
||||||
out, err := ExecuteCommand(options, docker...)
|
docker = append(docker, flags.DOCKER_IMAGE, "-c", strings.Join(args, " "))
|
||||||
if VERBOSE {
|
return ExecuteCommand(options, docker...)
|
||||||
colors.Faint.Println(out)
|
|
||||||
}
|
|
||||||
return err
|
|
||||||
}
|
}
|
||||||
|
|||||||
225
internal/backend_test.go
Normal file
225
internal/backend_test.go
Normal file
@@ -0,0 +1,225 @@
|
|||||||
|
package internal
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"os"
|
||||||
|
"testing"
|
||||||
|
|
||||||
|
"github.com/spf13/viper"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestGenerateRepo(t *testing.T) {
|
||||||
|
|
||||||
|
t.Run("empty backend", func(t *testing.T) {
|
||||||
|
b := Backend{
|
||||||
|
name: "empty backend",
|
||||||
|
Type: "",
|
||||||
|
}
|
||||||
|
_, err := b.generateRepo()
|
||||||
|
if err == nil {
|
||||||
|
t.Errorf("Error expected for empty backend type")
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("local backend", func(t *testing.T) {
|
||||||
|
b := Backend{
|
||||||
|
name: "local backend",
|
||||||
|
Type: "local",
|
||||||
|
Path: "/foo/bar",
|
||||||
|
}
|
||||||
|
result, err := b.generateRepo()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error %v", err)
|
||||||
|
}
|
||||||
|
assertEqual(t, result, "/foo/bar")
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("local backend with homedir prefix", func(t *testing.T) {
|
||||||
|
b := Backend{
|
||||||
|
name: "local backend",
|
||||||
|
Type: "local",
|
||||||
|
Path: "~/foo/bar",
|
||||||
|
}
|
||||||
|
result, err := b.generateRepo()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error %v", err)
|
||||||
|
}
|
||||||
|
assertEqual(t, result, fmt.Sprintf("%s/foo/bar", os.Getenv("HOME")))
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("local backend with config file", func(t *testing.T) {
|
||||||
|
// config file path should always be present from initConfig
|
||||||
|
viper.SetConfigFile("/tmp/.autorestic.yml")
|
||||||
|
defer viper.Reset()
|
||||||
|
|
||||||
|
b := Backend{
|
||||||
|
name: "local backend",
|
||||||
|
Type: "local",
|
||||||
|
}
|
||||||
|
result, err := b.generateRepo()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error %v", err)
|
||||||
|
}
|
||||||
|
assertEqual(t, result, "/tmp")
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("rest backend with valid path", func(t *testing.T) {
|
||||||
|
b := Backend{
|
||||||
|
name: "rest backend",
|
||||||
|
Type: "rest",
|
||||||
|
Path: "http://localhost:8000/foo",
|
||||||
|
}
|
||||||
|
result, err := b.generateRepo()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error %v", err)
|
||||||
|
}
|
||||||
|
assertEqual(t, result, "rest:http://localhost:8000/foo")
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("rest backend with user", func(t *testing.T) {
|
||||||
|
b := Backend{
|
||||||
|
name: "rest backend",
|
||||||
|
Type: "rest",
|
||||||
|
Path: "http://localhost:8000/foo",
|
||||||
|
Rest: BackendRest{
|
||||||
|
User: "user",
|
||||||
|
Password: "",
|
||||||
|
},
|
||||||
|
}
|
||||||
|
result, err := b.generateRepo()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error %v", err)
|
||||||
|
}
|
||||||
|
assertEqual(t, result, "rest:http://user@localhost:8000/foo")
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("rest backend with user and password", func(t *testing.T) {
|
||||||
|
b := Backend{
|
||||||
|
name: "rest backend",
|
||||||
|
Type: "rest",
|
||||||
|
Path: "http://localhost:8000/foo",
|
||||||
|
Rest: BackendRest{
|
||||||
|
User: "user",
|
||||||
|
Password: "pass",
|
||||||
|
},
|
||||||
|
}
|
||||||
|
result, err := b.generateRepo()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error %v", err)
|
||||||
|
}
|
||||||
|
assertEqual(t, result, "rest:http://user:pass@localhost:8000/foo")
|
||||||
|
})
|
||||||
|
|
||||||
|
backendTests := []struct {
|
||||||
|
name string
|
||||||
|
backend Backend
|
||||||
|
want string
|
||||||
|
}{
|
||||||
|
{name: "b2 backend", backend: Backend{name: "b2", Type: "b2", Path: "foo"}, want: "b2:foo"},
|
||||||
|
{name: "azure backend", backend: Backend{name: "azure", Type: "azure", Path: "foo"}, want: "azure:foo"},
|
||||||
|
{name: "gs backend", backend: Backend{name: "gs", Type: "gs", Path: "foo"}, want: "gs:foo"},
|
||||||
|
{name: "s3 backend", backend: Backend{name: "s3", Type: "s3", Path: "foo"}, want: "s3:foo"},
|
||||||
|
{name: "sftp backend", backend: Backend{name: "sftp", Type: "sftp", Path: "foo"}, want: "sftp:foo"},
|
||||||
|
{name: "rclone backend", backend: Backend{name: "rclone", Type: "rclone", Path: "foo"}, want: "rclone:foo"},
|
||||||
|
}
|
||||||
|
|
||||||
|
for _, tt := range backendTests {
|
||||||
|
t.Run(tt.name, func(t *testing.T) {
|
||||||
|
got, err := tt.backend.generateRepo()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error %v", err)
|
||||||
|
}
|
||||||
|
assertEqual(t, got, tt.want)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestGetEnv(t *testing.T) {
|
||||||
|
t.Run("env in key field", func(t *testing.T) {
|
||||||
|
b := Backend{
|
||||||
|
name: "",
|
||||||
|
Type: "local",
|
||||||
|
Path: "/foo/bar",
|
||||||
|
Key: "secret123",
|
||||||
|
}
|
||||||
|
result, err := b.getEnv()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error %v", err)
|
||||||
|
}
|
||||||
|
assertEqual(t, result["RESTIC_REPOSITORY"], "/foo/bar")
|
||||||
|
assertEqual(t, result["RESTIC_PASSWORD"], "secret123")
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("env in config file", func(t *testing.T) {
|
||||||
|
b := Backend{
|
||||||
|
name: "",
|
||||||
|
Type: "local",
|
||||||
|
Path: "/foo/bar",
|
||||||
|
Env: map[string]string{
|
||||||
|
"B2_ACCOUNT_ID": "foo123",
|
||||||
|
"B2_ACCOUNT_KEY": "foo456",
|
||||||
|
},
|
||||||
|
}
|
||||||
|
result, err := b.getEnv()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error %v", err)
|
||||||
|
}
|
||||||
|
assertEqual(t, result["RESTIC_REPOSITORY"], "/foo/bar")
|
||||||
|
assertEqual(t, result["RESTIC_PASSWORD"], "")
|
||||||
|
assertEqual(t, result["B2_ACCOUNT_ID"], "foo123")
|
||||||
|
assertEqual(t, result["B2_ACCOUNT_KEY"], "foo456")
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("env in Envfile or env vars", func(t *testing.T) {
|
||||||
|
// generate env variables
|
||||||
|
// TODO better way to teardown
|
||||||
|
defer os.Unsetenv("AUTORESTIC_FOO_RESTIC_PASSWORD")
|
||||||
|
defer os.Unsetenv("AUTORESTIC_FOO_B2_ACCOUNT_ID")
|
||||||
|
defer os.Unsetenv("AUTORESTIC_FOO_B2_ACCOUNT_KEY")
|
||||||
|
os.Setenv("AUTORESTIC_FOO_RESTIC_PASSWORD", "secret123")
|
||||||
|
os.Setenv("AUTORESTIC_FOO_B2_ACCOUNT_ID", "foo123")
|
||||||
|
os.Setenv("AUTORESTIC_FOO_B2_ACCOUNT_KEY", "foo456")
|
||||||
|
|
||||||
|
b := Backend{
|
||||||
|
name: "foo",
|
||||||
|
Type: "local",
|
||||||
|
Path: "/foo/bar",
|
||||||
|
}
|
||||||
|
result, err := b.getEnv()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error %v", err)
|
||||||
|
}
|
||||||
|
assertEqual(t, result["RESTIC_REPOSITORY"], "/foo/bar")
|
||||||
|
assertEqual(t, result["RESTIC_PASSWORD"], "secret123")
|
||||||
|
assertEqual(t, result["B2_ACCOUNT_ID"], "foo123")
|
||||||
|
assertEqual(t, result["B2_ACCOUNT_KEY"], "foo456")
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestValidate(t *testing.T) {
|
||||||
|
t.Run("no type given", func(t *testing.T) {
|
||||||
|
b := Backend{
|
||||||
|
name: "foo",
|
||||||
|
Type: "",
|
||||||
|
Path: "/foo/bar",
|
||||||
|
}
|
||||||
|
err := b.validate()
|
||||||
|
if err == nil {
|
||||||
|
t.Error("expected to get error")
|
||||||
|
}
|
||||||
|
assertEqual(t, err.Error(), "Backend \"foo\" has no \"type\"")
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("no path given", func(t *testing.T) {
|
||||||
|
b := Backend{
|
||||||
|
name: "foo",
|
||||||
|
Type: "local",
|
||||||
|
Path: "",
|
||||||
|
}
|
||||||
|
err := b.validate()
|
||||||
|
if err == nil {
|
||||||
|
t.Error("expected to get error")
|
||||||
|
}
|
||||||
|
assertEqual(t, err.Error(), "Backend \"foo\" has no \"path\"")
|
||||||
|
})
|
||||||
|
}
|
||||||
@@ -16,6 +16,7 @@ import (
|
|||||||
"github.com/blang/semver/v4"
|
"github.com/blang/semver/v4"
|
||||||
"github.com/cupcakearmy/autorestic/internal"
|
"github.com/cupcakearmy/autorestic/internal"
|
||||||
"github.com/cupcakearmy/autorestic/internal/colors"
|
"github.com/cupcakearmy/autorestic/internal/colors"
|
||||||
|
"github.com/cupcakearmy/autorestic/internal/flags"
|
||||||
)
|
)
|
||||||
|
|
||||||
const INSTALL_PATH = "/usr/local/bin"
|
const INSTALL_PATH = "/usr/local/bin"
|
||||||
@@ -47,11 +48,11 @@ func dlJSON(url string) (GithubRelease, error) {
|
|||||||
|
|
||||||
func Uninstall(restic bool) error {
|
func Uninstall(restic bool) error {
|
||||||
if err := os.Remove(path.Join(INSTALL_PATH, "autorestic")); err != nil {
|
if err := os.Remove(path.Join(INSTALL_PATH, "autorestic")); err != nil {
|
||||||
colors.Error.Println(err)
|
return err
|
||||||
}
|
}
|
||||||
if restic {
|
if restic {
|
||||||
if err := os.Remove(path.Join(INSTALL_PATH, "restic")); err != nil {
|
if err := os.Remove(path.Join(INSTALL_PATH, "restic")); err != nil {
|
||||||
colors.Error.Println(err)
|
return err
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
@@ -79,13 +80,31 @@ func downloadAndInstallAsset(body GithubRelease, name string) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
defer tmp.Close()
|
defer tmp.Close()
|
||||||
tmp.Chmod(0755)
|
if err := tmp.Chmod(0755); err != nil {
|
||||||
io.Copy(tmp, bz)
|
return err
|
||||||
|
}
|
||||||
|
if _, err := io.Copy(tmp, bz); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
to := path.Join(INSTALL_PATH, name)
|
to := path.Join(INSTALL_PATH, name)
|
||||||
os.Remove(to) // Delete if current, ignore error if file does not exits.
|
defer os.Remove(tmp.Name()) // Cleanup temporary file after thread exits
|
||||||
if err := os.Rename(tmp.Name(), to); err != nil {
|
if err := os.Rename(tmp.Name(), to); err != nil {
|
||||||
return nil
|
colors.Error.Printf("os.Rename() failed (%v), retrying with io.Copy()\n", err.Error())
|
||||||
|
var src *os.File
|
||||||
|
var dst *os.File
|
||||||
|
if src, err = os.Open(tmp.Name()); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if dst, err = os.Create(to); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if _, err := io.Copy(dst, src); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if err := os.Chmod(to, 0755); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
colors.Success.Printf("Successfully installed '%s' under %s\n", name, INSTALL_PATH)
|
colors.Success.Printf("Successfully installed '%s' under %s\n", name, INSTALL_PATH)
|
||||||
@@ -110,18 +129,21 @@ func InstallRestic() error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func upgradeRestic() error {
|
func upgradeRestic() error {
|
||||||
out, err := internal.ExecuteCommand(internal.ExecuteOptions{
|
_, _, err := internal.ExecuteCommand(internal.ExecuteOptions{
|
||||||
Command: "restic",
|
Command: flags.RESTIC_BIN,
|
||||||
}, "self-update")
|
}, "self-update")
|
||||||
colors.Faint.Println(out)
|
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
func Upgrade(restic bool) error {
|
func Upgrade(restic bool) error {
|
||||||
// Upgrade restic
|
// Upgrade restic
|
||||||
if restic {
|
if restic {
|
||||||
InstallRestic()
|
if err := InstallRestic(); err != nil {
|
||||||
upgradeRestic()
|
return err
|
||||||
|
}
|
||||||
|
if err := upgradeRestic(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// Upgrade self
|
// Upgrade self
|
||||||
@@ -138,7 +160,9 @@ func Upgrade(restic bool) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
if current.LT(latest) {
|
if current.LT(latest) {
|
||||||
downloadAndInstallAsset(body, "autorestic")
|
if err := downloadAndInstallAsset(body, "autorestic"); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
colors.Success.Println("Updated autorestic")
|
colors.Success.Println("Updated autorestic")
|
||||||
} else {
|
} else {
|
||||||
colors.Body.Println("Already up to date")
|
colors.Body.Println("Already up to date")
|
||||||
|
|||||||
@@ -2,41 +2,95 @@ package internal
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
"fmt"
|
||||||
|
"os"
|
||||||
"path"
|
"path"
|
||||||
|
"path/filepath"
|
||||||
"strings"
|
"strings"
|
||||||
"sync"
|
"sync"
|
||||||
|
|
||||||
"github.com/cupcakearmy/autorestic/internal/colors"
|
"github.com/cupcakearmy/autorestic/internal/colors"
|
||||||
|
"github.com/cupcakearmy/autorestic/internal/flags"
|
||||||
|
"github.com/cupcakearmy/autorestic/internal/lock"
|
||||||
|
"github.com/joho/godotenv"
|
||||||
"github.com/mitchellh/go-homedir"
|
"github.com/mitchellh/go-homedir"
|
||||||
"github.com/spf13/cobra"
|
"github.com/spf13/cobra"
|
||||||
"github.com/spf13/viper"
|
"github.com/spf13/viper"
|
||||||
)
|
)
|
||||||
|
|
||||||
const VERSION = "1.0.4"
|
const VERSION = "1.7.7"
|
||||||
|
|
||||||
var CI bool = false
|
type OptionMap map[string][]interface{}
|
||||||
var VERBOSE bool = false
|
type Options map[string]OptionMap
|
||||||
|
|
||||||
type Config struct {
|
type Config struct {
|
||||||
Locations map[string]Location `yaml:"locations"`
|
Version string `mapstructure:"version"`
|
||||||
Backends map[string]Backend `yaml:"backends"`
|
Extras interface{} `mapstructure:"extras"`
|
||||||
|
Locations map[string]Location `mapstructure:"locations"`
|
||||||
|
Backends map[string]Backend `mapstructure:"backends"`
|
||||||
|
Global Options `mapstructure:"global"`
|
||||||
}
|
}
|
||||||
|
|
||||||
var once sync.Once
|
var once sync.Once
|
||||||
var config *Config
|
var config *Config
|
||||||
|
|
||||||
|
func exitConfig(err error, msg string) {
|
||||||
|
if err != nil {
|
||||||
|
colors.Error.Println(err)
|
||||||
|
}
|
||||||
|
if msg != "" {
|
||||||
|
colors.Error.Println(msg)
|
||||||
|
}
|
||||||
|
lock.Unlock()
|
||||||
|
os.Exit(1)
|
||||||
|
}
|
||||||
|
|
||||||
func GetConfig() *Config {
|
func GetConfig() *Config {
|
||||||
|
|
||||||
if config == nil {
|
if config == nil {
|
||||||
once.Do(func() {
|
once.Do(func() {
|
||||||
if err := viper.ReadInConfig(); err == nil {
|
if err := viper.ReadInConfig(); err == nil {
|
||||||
colors.Faint.Println("Using config file:", viper.ConfigFileUsed())
|
absConfig, _ := filepath.Abs(viper.ConfigFileUsed())
|
||||||
|
if !flags.CRON_LEAN {
|
||||||
|
colors.Faint.Println("Using config: \t", absConfig)
|
||||||
|
}
|
||||||
|
// Load env file
|
||||||
|
envFile := filepath.Join(filepath.Dir(absConfig), ".autorestic.env")
|
||||||
|
err = godotenv.Load(envFile)
|
||||||
|
if err == nil && !flags.CRON_LEAN {
|
||||||
|
colors.Faint.Println("Using env:\t", envFile)
|
||||||
|
}
|
||||||
} else {
|
} else {
|
||||||
return
|
text := err.Error()
|
||||||
|
if strings.Contains(text, "no such file or directory") {
|
||||||
|
cfgFileName := ".autorestic"
|
||||||
|
colors.Error.Println(
|
||||||
|
fmt.Sprintf(
|
||||||
|
"cannot find configuration file '%s.yml' or '%s.yaml'.",
|
||||||
|
cfgFileName, cfgFileName))
|
||||||
|
} else {
|
||||||
|
colors.Error.Println("could not load config file\n" + text)
|
||||||
|
}
|
||||||
|
os.Exit(1)
|
||||||
|
}
|
||||||
|
|
||||||
|
var versionConfig interface{}
|
||||||
|
viper.UnmarshalKey("version", &versionConfig)
|
||||||
|
if versionConfig == nil {
|
||||||
|
exitConfig(nil, "no version specified in config file. please see docs on how to migrate")
|
||||||
|
}
|
||||||
|
version, ok := versionConfig.(int)
|
||||||
|
if !ok {
|
||||||
|
exitConfig(nil, "version specified in config file is not an int")
|
||||||
|
} else {
|
||||||
|
// Check for version
|
||||||
|
if version != 2 {
|
||||||
|
exitConfig(nil, "unsupported config version number. please check the docs for migration\nhttps://autorestic.vercel.app/migration/")
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
config = &Config{}
|
config = &Config{}
|
||||||
if err := viper.UnmarshalExact(config); err != nil {
|
if err := viper.UnmarshalExact(config); err != nil {
|
||||||
panic(err)
|
exitConfig(err, "Could not parse config file!")
|
||||||
}
|
}
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
@@ -60,7 +114,11 @@ func (c *Config) Describe() {
|
|||||||
var tmp string
|
var tmp string
|
||||||
colors.PrimaryPrint(`Location: "%s"`, name)
|
colors.PrimaryPrint(`Location: "%s"`, name)
|
||||||
|
|
||||||
colors.PrintDescription("From", l.From)
|
tmp = ""
|
||||||
|
for _, path := range l.From {
|
||||||
|
tmp += fmt.Sprintf("\t%s %s\n", colors.Success.Sprint("←"), path)
|
||||||
|
}
|
||||||
|
colors.PrintDescription("From", tmp)
|
||||||
|
|
||||||
tmp = ""
|
tmp = ""
|
||||||
for _, to := range l.To {
|
for _, to := range l.To {
|
||||||
@@ -72,21 +130,22 @@ func (c *Config) Describe() {
|
|||||||
colors.PrintDescription("Cron", l.Cron)
|
colors.PrintDescription("Cron", l.Cron)
|
||||||
}
|
}
|
||||||
|
|
||||||
after, before := len(l.Hooks.After), len(l.Hooks.Before)
|
tmp = ""
|
||||||
if after+before > 0 {
|
hooks := map[string][]string{
|
||||||
tmp = ""
|
"Before": l.Hooks.Before,
|
||||||
if before > 0 {
|
"After": l.Hooks.After,
|
||||||
tmp += "\tBefore"
|
"Failure": l.Hooks.Failure,
|
||||||
for _, cmd := range l.Hooks.Before {
|
"Success": l.Hooks.Success,
|
||||||
tmp += colors.Faint.Sprintf("\n\t ▶ %s", cmd)
|
}
|
||||||
}
|
for hook, commands := range hooks {
|
||||||
}
|
if len(commands) > 0 {
|
||||||
if after > 0 {
|
tmp += "\n\t" + hook
|
||||||
tmp += "\n\tAfter"
|
for _, cmd := range commands {
|
||||||
for _, cmd := range l.Hooks.After {
|
|
||||||
tmp += colors.Faint.Sprintf("\n\t ▶ %s", cmd)
|
tmp += colors.Faint.Sprintf("\n\t ▶ %s", cmd)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
if tmp != "" {
|
||||||
colors.PrintDescription("Hooks", tmp)
|
colors.PrintDescription("Hooks", tmp)
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -126,7 +185,7 @@ func CheckConfig() error {
|
|||||||
return fmt.Errorf("config could not be loaded/found")
|
return fmt.Errorf("config could not be loaded/found")
|
||||||
}
|
}
|
||||||
if !CheckIfResticIsCallable() {
|
if !CheckIfResticIsCallable() {
|
||||||
return fmt.Errorf(`restic was not found. Install either with "autorestic install" or manually`)
|
return fmt.Errorf(`%s was not found. Install either with "autorestic install" or manually`, flags.RESTIC_BIN)
|
||||||
}
|
}
|
||||||
for name, backend := range c.Backends {
|
for name, backend := range c.Backends {
|
||||||
backend.name = name
|
backend.name = name
|
||||||
@@ -136,7 +195,7 @@ func CheckConfig() error {
|
|||||||
}
|
}
|
||||||
for name, location := range c.Locations {
|
for name, location := range c.Locations {
|
||||||
location.name = name
|
location.name = name
|
||||||
if err := location.validate(c); err != nil {
|
if err := location.validate(); err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -167,20 +226,18 @@ func GetAllOrSelected(cmd *cobra.Command, backends bool) ([]string, error) {
|
|||||||
selected, _ = cmd.Flags().GetStringSlice("location")
|
selected, _ = cmd.Flags().GetStringSlice("location")
|
||||||
}
|
}
|
||||||
for _, s := range selected {
|
for _, s := range selected {
|
||||||
found := false
|
var splitted = strings.Split(s, "@")
|
||||||
for _, l := range list {
|
for _, l := range list {
|
||||||
if l == s {
|
if l == splitted[0] {
|
||||||
found = true
|
goto found
|
||||||
break
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if !found {
|
if backends {
|
||||||
if backends {
|
return nil, fmt.Errorf("invalid backend \"%s\"", s)
|
||||||
return nil, fmt.Errorf("invalid backend \"%s\"", s)
|
} else {
|
||||||
} else {
|
return nil, fmt.Errorf("invalid location \"%s\"", s)
|
||||||
return nil, fmt.Errorf("invalid location \"%s\"", s)
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
found:
|
||||||
}
|
}
|
||||||
|
|
||||||
if len(selected) == 0 {
|
if len(selected) == 0 {
|
||||||
@@ -190,11 +247,17 @@ func GetAllOrSelected(cmd *cobra.Command, backends bool) ([]string, error) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func AddFlagsToCommand(cmd *cobra.Command, backend bool) {
|
func AddFlagsToCommand(cmd *cobra.Command, backend bool) {
|
||||||
cmd.PersistentFlags().BoolP("all", "a", false, "Backup all locations")
|
var usage string
|
||||||
if backend {
|
if backend {
|
||||||
cmd.PersistentFlags().StringSliceP("backend", "b", []string{}, "backends")
|
usage = "all backends"
|
||||||
} else {
|
} else {
|
||||||
cmd.PersistentFlags().StringSliceP("location", "l", []string{}, "Locations")
|
usage = "all locations"
|
||||||
|
}
|
||||||
|
cmd.PersistentFlags().BoolP("all", "a", false, usage)
|
||||||
|
if backend {
|
||||||
|
cmd.PersistentFlags().StringSliceP("backend", "b", []string{}, "select backends")
|
||||||
|
} else {
|
||||||
|
cmd.PersistentFlags().StringSliceP("location", "l", []string{}, "select locations")
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -203,10 +266,61 @@ func (c *Config) SaveConfig() error {
|
|||||||
if err := CopyFile(file, file+".old"); err != nil {
|
if err := CopyFile(file, file+".old"); err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
colors.Secondary.Println("Saved a backup copy of your file next the the original.")
|
colors.Secondary.Println("Saved a backup copy of your file next to the original.")
|
||||||
|
|
||||||
viper.Set("backends", c.Backends)
|
viper.Set("backends", c.Backends)
|
||||||
viper.Set("locations", c.Locations)
|
viper.Set("locations", c.Locations)
|
||||||
|
|
||||||
return viper.WriteConfig()
|
return viper.WriteConfig()
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func optionToString(option string) string {
|
||||||
|
if !strings.HasPrefix(option, "-") {
|
||||||
|
return "--" + option
|
||||||
|
}
|
||||||
|
return option
|
||||||
|
}
|
||||||
|
|
||||||
|
func appendOptionsToSlice(str *[]string, options OptionMap) {
|
||||||
|
for key, values := range options {
|
||||||
|
for _, value := range values {
|
||||||
|
// Bool
|
||||||
|
asBool, ok := value.(bool)
|
||||||
|
if ok && asBool {
|
||||||
|
*str = append(*str, optionToString(key))
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
*str = append(*str, optionToString(key), fmt.Sprint(value))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func getOptions(options Options, keys []string) []string {
|
||||||
|
var selected []string
|
||||||
|
for _, key := range keys {
|
||||||
|
appendOptionsToSlice(&selected, options[key])
|
||||||
|
}
|
||||||
|
return selected
|
||||||
|
}
|
||||||
|
|
||||||
|
func combineBackendOptions(key string, b Backend) []string {
|
||||||
|
// Priority: backend > global
|
||||||
|
var options []string
|
||||||
|
gFlags := getOptions(GetConfig().Global, []string{key})
|
||||||
|
bFlags := getOptions(b.Options, []string{"all", key})
|
||||||
|
options = append(options, gFlags...)
|
||||||
|
options = append(options, bFlags...)
|
||||||
|
return options
|
||||||
|
}
|
||||||
|
|
||||||
|
func combineAllOptions(key string, l Location, b Backend) []string {
|
||||||
|
// Priority: location > backend > global
|
||||||
|
var options []string
|
||||||
|
gFlags := getOptions(GetConfig().Global, []string{key})
|
||||||
|
bFlags := getOptions(b.Options, []string{"all", key})
|
||||||
|
lFlags := getOptions(l.Options, []string{"all", key})
|
||||||
|
options = append(options, gFlags...)
|
||||||
|
options = append(options, bFlags...)
|
||||||
|
options = append(options, lFlags...)
|
||||||
|
return options
|
||||||
|
}
|
||||||
|
|||||||
164
internal/config_test.go
Normal file
164
internal/config_test.go
Normal file
@@ -0,0 +1,164 @@
|
|||||||
|
package internal
|
||||||
|
|
||||||
|
import (
|
||||||
|
"reflect"
|
||||||
|
"strconv"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestOptionToString(t *testing.T) {
|
||||||
|
t.Run("no prefix", func(t *testing.T) {
|
||||||
|
opt := "test"
|
||||||
|
result := optionToString(opt)
|
||||||
|
assertEqual(t, result, "--test")
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("single prefix", func(t *testing.T) {
|
||||||
|
opt := "-test"
|
||||||
|
result := optionToString(opt)
|
||||||
|
assertEqual(t, result, "-test")
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("double prefix", func(t *testing.T) {
|
||||||
|
opt := "--test"
|
||||||
|
result := optionToString(opt)
|
||||||
|
assertEqual(t, result, "--test")
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestAppendOneOptionToSlice(t *testing.T) {
|
||||||
|
t.Run("string flag", func(t *testing.T) {
|
||||||
|
result := []string{}
|
||||||
|
optionMap := OptionMap{"string-flag": []interface{}{"/root"}}
|
||||||
|
|
||||||
|
appendOptionsToSlice(&result, optionMap)
|
||||||
|
expected := []string{
|
||||||
|
"--string-flag", "/root",
|
||||||
|
}
|
||||||
|
assertSliceEqual(t, result, expected)
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("bool flag", func(t *testing.T) {
|
||||||
|
result := []string{}
|
||||||
|
optionMap := OptionMap{"boolean-flag": []interface{}{true}}
|
||||||
|
|
||||||
|
appendOptionsToSlice(&result, optionMap)
|
||||||
|
expected := []string{
|
||||||
|
"--boolean-flag",
|
||||||
|
}
|
||||||
|
assertSliceEqual(t, result, expected)
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("int flag", func(t *testing.T) {
|
||||||
|
result := []string{}
|
||||||
|
optionMap := OptionMap{"int-flag": []interface{}{123}}
|
||||||
|
|
||||||
|
appendOptionsToSlice(&result, optionMap)
|
||||||
|
expected := []string{
|
||||||
|
"--int-flag", "123",
|
||||||
|
}
|
||||||
|
assertSliceEqual(t, result, expected)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestAppendMultipleOptionsToSlice(t *testing.T) {
|
||||||
|
result := []string{}
|
||||||
|
optionMap := OptionMap{
|
||||||
|
"string-flag": []interface{}{"/root"},
|
||||||
|
"int-flag": []interface{}{123},
|
||||||
|
}
|
||||||
|
|
||||||
|
appendOptionsToSlice(&result, optionMap)
|
||||||
|
expected := []string{
|
||||||
|
"--string-flag", "/root",
|
||||||
|
"--int-flag", "123",
|
||||||
|
}
|
||||||
|
if len(result) != len(expected) {
|
||||||
|
t.Errorf("got length %d, want length %d", len(result), len(expected))
|
||||||
|
}
|
||||||
|
|
||||||
|
// checks that expected option comes after flag, regardless of key order in map
|
||||||
|
for i, v := range expected {
|
||||||
|
v = strings.TrimPrefix(v, "--")
|
||||||
|
|
||||||
|
if value, ok := optionMap[v]; ok {
|
||||||
|
if val, ok := value[0].(int); ok {
|
||||||
|
if expected[i+1] != strconv.Itoa(val) {
|
||||||
|
t.Errorf("Flags and options order are mismatched. got %v, want %v", result, expected)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestAppendOptionWithMultipleValuesToSlice(t *testing.T) {
|
||||||
|
result := []string{}
|
||||||
|
optionMap := OptionMap{
|
||||||
|
"string-flag": []interface{}{"/root", "/bin"},
|
||||||
|
}
|
||||||
|
|
||||||
|
appendOptionsToSlice(&result, optionMap)
|
||||||
|
expected := []string{
|
||||||
|
"--string-flag", "/root",
|
||||||
|
"--string-flag", "/bin",
|
||||||
|
}
|
||||||
|
assertSliceEqual(t, result, expected)
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestGetOptionsOneKey(t *testing.T) {
|
||||||
|
optionMap := OptionMap{
|
||||||
|
"string-flag": []interface{}{"/root"},
|
||||||
|
}
|
||||||
|
options := Options{"backend": optionMap}
|
||||||
|
keys := []string{"backend"}
|
||||||
|
|
||||||
|
result := getOptions(options, keys)
|
||||||
|
expected := []string{
|
||||||
|
"--string-flag", "/root",
|
||||||
|
}
|
||||||
|
assertSliceEqual(t, result, expected)
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestGetOptionsMultipleKeys(t *testing.T) {
|
||||||
|
firstOptionMap := OptionMap{
|
||||||
|
"string-flag": []interface{}{"/root"},
|
||||||
|
}
|
||||||
|
secondOptionMap := OptionMap{
|
||||||
|
"boolean-flag": []interface{}{true},
|
||||||
|
"int-flag": []interface{}{123},
|
||||||
|
}
|
||||||
|
options := Options{
|
||||||
|
"all": firstOptionMap,
|
||||||
|
"forget": secondOptionMap,
|
||||||
|
}
|
||||||
|
keys := []string{"all", "forget"}
|
||||||
|
|
||||||
|
result := getOptions(options, keys)
|
||||||
|
expected := []string{
|
||||||
|
"--string-flag", "/root",
|
||||||
|
"--boolean-flag",
|
||||||
|
"--int-flag", "123",
|
||||||
|
}
|
||||||
|
reflect.DeepEqual(result, expected)
|
||||||
|
}
|
||||||
|
|
||||||
|
func assertEqual[T comparable](t testing.TB, result, expected T) {
|
||||||
|
t.Helper()
|
||||||
|
|
||||||
|
if result != expected {
|
||||||
|
t.Errorf("got %v, want %v", result, expected)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func assertSliceEqual(t testing.TB, result, expected []string) {
|
||||||
|
t.Helper()
|
||||||
|
|
||||||
|
if len(result) != len(expected) {
|
||||||
|
t.Errorf("got length %d, want length %d", len(result), len(expected))
|
||||||
|
}
|
||||||
|
|
||||||
|
for i := range result {
|
||||||
|
assertEqual(t, result[i], expected[i])
|
||||||
|
}
|
||||||
|
}
|
||||||
9
internal/flags/flags.go
Normal file
9
internal/flags/flags.go
Normal file
@@ -0,0 +1,9 @@
|
|||||||
|
package flags
|
||||||
|
|
||||||
|
var (
|
||||||
|
CI bool = false
|
||||||
|
VERBOSE bool = false
|
||||||
|
CRON_LEAN bool = false
|
||||||
|
RESTIC_BIN string
|
||||||
|
DOCKER_IMAGE string
|
||||||
|
)
|
||||||
@@ -9,34 +9,49 @@ import (
|
|||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/cupcakearmy/autorestic/internal/colors"
|
"github.com/cupcakearmy/autorestic/internal/colors"
|
||||||
|
"github.com/cupcakearmy/autorestic/internal/flags"
|
||||||
"github.com/cupcakearmy/autorestic/internal/lock"
|
"github.com/cupcakearmy/autorestic/internal/lock"
|
||||||
|
"github.com/cupcakearmy/autorestic/internal/metadata"
|
||||||
"github.com/robfig/cron"
|
"github.com/robfig/cron"
|
||||||
)
|
)
|
||||||
|
|
||||||
type LocationType string
|
type LocationType string
|
||||||
|
|
||||||
const (
|
const (
|
||||||
TypeLocal LocationType = "local"
|
TypeLocal LocationType = "local"
|
||||||
TypeVolume LocationType = "volume"
|
TypeVolume LocationType = "volume"
|
||||||
VolumePrefix string = "volume:"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
type HookArray = []string
|
type HookArray = []string
|
||||||
|
|
||||||
|
type LocationForgetOption string
|
||||||
|
|
||||||
|
const (
|
||||||
|
LocationForgetYes LocationForgetOption = "yes"
|
||||||
|
LocationForgetNo LocationForgetOption = "no"
|
||||||
|
LocationForgetPrune LocationForgetOption = "prune"
|
||||||
|
)
|
||||||
|
|
||||||
type Hooks struct {
|
type Hooks struct {
|
||||||
Before HookArray `yaml:"before"`
|
Dir string `mapstructure:"dir"`
|
||||||
After HookArray `yaml:"after"`
|
Before HookArray `mapstructure:"before,omitempty"`
|
||||||
|
After HookArray `mapstructure:"after,omitempty"`
|
||||||
|
Success HookArray `mapstructure:"success,omitempty"`
|
||||||
|
Failure HookArray `mapstructure:"failure,omitempty"`
|
||||||
}
|
}
|
||||||
|
|
||||||
type Options map[string]map[string][]string
|
type LocationCopy = map[string][]string
|
||||||
|
|
||||||
type Location struct {
|
type Location struct {
|
||||||
name string `yaml:",omitempty"`
|
name string `mapstructure:",omitempty"`
|
||||||
From string `yaml:"from,omitempty"`
|
From []string `mapstructure:"from,omitempty"`
|
||||||
To []string `yaml:"to,omitempty"`
|
Type string `mapstructure:"type,omitempty"`
|
||||||
Hooks Hooks `yaml:"hooks,omitempty"`
|
To []string `mapstructure:"to,omitempty"`
|
||||||
Cron string `yaml:"cron,omitempty"`
|
Hooks Hooks `mapstructure:"hooks,omitempty"`
|
||||||
Options Options `yaml:"options,omitempty"`
|
Cron string `mapstructure:"cron,omitempty"`
|
||||||
|
Options Options `mapstructure:"options,omitempty"`
|
||||||
|
ForgetOption LocationForgetOption `mapstructure:"forget,omitempty"`
|
||||||
|
CopyOption LocationCopy `mapstructure:"copy,omitempty"`
|
||||||
}
|
}
|
||||||
|
|
||||||
func GetLocation(name string) (Location, bool) {
|
func GetLocation(name string) (Location, bool) {
|
||||||
@@ -45,46 +60,86 @@ func GetLocation(name string) (Location, bool) {
|
|||||||
return l, ok
|
return l, ok
|
||||||
}
|
}
|
||||||
|
|
||||||
func (l Location) validate(c *Config) error {
|
func (l Location) validate() error {
|
||||||
if l.From == "" {
|
if len(l.From) == 0 {
|
||||||
return fmt.Errorf(`Location "%s" is missing "from" key`, l.name)
|
return fmt.Errorf(`Location "%s" is missing "from" key`, l.name)
|
||||||
}
|
}
|
||||||
|
t, err := l.getType()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
switch t {
|
||||||
|
case TypeLocal:
|
||||||
|
for _, path := range l.From {
|
||||||
|
if from, err := GetPathRelativeToConfig(path); err != nil {
|
||||||
|
return err
|
||||||
|
} else {
|
||||||
|
if _, err := os.Stat(from); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
case TypeVolume:
|
||||||
|
if len(l.From) > 1 {
|
||||||
|
return fmt.Errorf(`location "%s" has more than one docker volume`, l.name)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
if len(l.To) == 0 {
|
if len(l.To) == 0 {
|
||||||
return fmt.Errorf(`Location "%s" has no "to" targets`, l.name)
|
return fmt.Errorf(`location "%s" has no "to" targets`, l.name)
|
||||||
}
|
}
|
||||||
// Check if backends are all valid
|
// Check if backends are all valid
|
||||||
for _, to := range l.To {
|
for _, to := range l.To {
|
||||||
_, ok := GetBackend(to)
|
_, ok := GetBackend(to)
|
||||||
if !ok {
|
if !ok {
|
||||||
return fmt.Errorf("invalid backend `%s`", to)
|
return fmt.Errorf(`location "%s" has an invalid backend "%s"`, l.name, to)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check copy option
|
||||||
|
for copyFrom, copyTo := range l.CopyOption {
|
||||||
|
if _, ok := GetBackend(copyFrom); !ok {
|
||||||
|
return fmt.Errorf(`location "%s" has an invalid backend "%s" in copy option`, l.name, copyFrom)
|
||||||
|
}
|
||||||
|
if !ArrayContains(l.To, copyFrom) {
|
||||||
|
return fmt.Errorf(`location "%s" has an invalid copy from "%s"`, l.name, copyFrom)
|
||||||
|
}
|
||||||
|
for _, copyToTarget := range copyTo {
|
||||||
|
if _, ok := GetBackend(copyToTarget); !ok {
|
||||||
|
return fmt.Errorf(`location "%s" has an invalid backend "%s" in copy option`, l.name, copyToTarget)
|
||||||
|
}
|
||||||
|
if ArrayContains(l.To, copyToTarget) {
|
||||||
|
return fmt.Errorf(`location "%s" cannot copy to "%s" as it's already a target`, l.name, copyToTarget)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check if forget type is correct
|
||||||
|
if l.ForgetOption != "" {
|
||||||
|
if l.ForgetOption != LocationForgetYes && l.ForgetOption != LocationForgetNo && l.ForgetOption != LocationForgetPrune {
|
||||||
|
return fmt.Errorf("invalid value for forget option: %s", l.ForgetOption)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
func (l Location) getOptions(key string) []string {
|
func (l Location) ExecuteHooks(commands []string, options ExecuteOptions) error {
|
||||||
var options []string
|
|
||||||
saved := l.Options[key]
|
|
||||||
for k, values := range saved {
|
|
||||||
for _, value := range values {
|
|
||||||
options = append(options, fmt.Sprintf("--%s", k), value)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return options
|
|
||||||
}
|
|
||||||
|
|
||||||
func ExecuteHooks(commands []string, options ExecuteOptions) error {
|
|
||||||
if len(commands) == 0 {
|
if len(commands) == 0 {
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
if l.Hooks.Dir != "" {
|
||||||
|
if dir, err := GetPathRelativeToConfig(l.Hooks.Dir); err != nil {
|
||||||
|
return err
|
||||||
|
} else {
|
||||||
|
options.Dir = dir
|
||||||
|
}
|
||||||
|
}
|
||||||
colors.Secondary.Println("\nRunning hooks")
|
colors.Secondary.Println("\nRunning hooks")
|
||||||
for _, command := range commands {
|
for _, command := range commands {
|
||||||
colors.Body.Println("> " + command)
|
colors.Body.Println("> " + command)
|
||||||
out, err := ExecuteCommand(options, "-c", command)
|
_, out, err := ExecuteCommand(options, "-c", command)
|
||||||
if VERBOSE {
|
|
||||||
colors.Faint.Println(out)
|
|
||||||
}
|
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
colors.Error.Println(out)
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -92,104 +147,188 @@ func ExecuteHooks(commands []string, options ExecuteOptions) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
func (l Location) getType() LocationType {
|
func (l Location) getType() (LocationType, error) {
|
||||||
if strings.HasPrefix(l.From, VolumePrefix) {
|
t := strings.ToLower(l.Type)
|
||||||
return TypeVolume
|
if t == "" || t == "local" {
|
||||||
|
return TypeLocal, nil
|
||||||
|
} else if t == "volume" {
|
||||||
|
return TypeVolume, nil
|
||||||
}
|
}
|
||||||
return TypeLocal
|
return "", fmt.Errorf("invalid location type \"%s\"", l.Type)
|
||||||
}
|
}
|
||||||
|
|
||||||
func (l Location) getVolumeName() string {
|
func buildTag(parts ...string) string {
|
||||||
return strings.TrimPrefix(l.From, VolumePrefix)
|
parts = append([]string{"ar"}, parts...)
|
||||||
|
return strings.Join(parts, ":")
|
||||||
}
|
}
|
||||||
|
|
||||||
func (l Location) getPath() (string, error) {
|
func (l Location) getLocationTags() string {
|
||||||
t := l.getType()
|
return buildTag("location", l.name)
|
||||||
switch t {
|
|
||||||
case TypeLocal:
|
|
||||||
if path, err := GetPathRelativeToConfig(l.From); err != nil {
|
|
||||||
return "", err
|
|
||||||
} else {
|
|
||||||
return path, nil
|
|
||||||
}
|
|
||||||
case TypeVolume:
|
|
||||||
return "/volume/" + l.name + "/" + l.getVolumeName(), nil
|
|
||||||
}
|
|
||||||
return "", fmt.Errorf("could not get path for location \"%s\"", l.name)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
func (l Location) Backup(cron bool) error {
|
func (l Location) Backup(cron bool, specificBackend string) []error {
|
||||||
|
var errors []error
|
||||||
|
var backends []string
|
||||||
colors.PrimaryPrint(" Backing up location \"%s\" ", l.name)
|
colors.PrimaryPrint(" Backing up location \"%s\" ", l.name)
|
||||||
t := l.getType()
|
t, err := l.getType()
|
||||||
|
if err != nil {
|
||||||
|
errors = append(errors, err)
|
||||||
|
return errors
|
||||||
|
}
|
||||||
|
cwd, _ := GetPathRelativeToConfig(".")
|
||||||
options := ExecuteOptions{
|
options := ExecuteOptions{
|
||||||
Command: "bash",
|
Command: "bash",
|
||||||
|
Dir: cwd,
|
||||||
|
Envs: map[string]string{
|
||||||
|
"AUTORESTIC_LOCATION": l.name,
|
||||||
|
},
|
||||||
}
|
}
|
||||||
|
|
||||||
if t == TypeLocal {
|
if err := l.validate(); err != nil {
|
||||||
dir, _ := GetPathRelativeToConfig(l.From)
|
errors = append(errors, err)
|
||||||
options.Dir = dir
|
goto after
|
||||||
}
|
}
|
||||||
|
|
||||||
// Hooks
|
// Hooks
|
||||||
if err := ExecuteHooks(l.Hooks.Before, options); err != nil {
|
if err := l.ExecuteHooks(l.Hooks.Before, options); err != nil {
|
||||||
return err
|
errors = append(errors, err)
|
||||||
|
goto after
|
||||||
}
|
}
|
||||||
|
|
||||||
// Backup
|
// Backup
|
||||||
for _, to := range l.To {
|
if specificBackend == "" {
|
||||||
|
backends = l.To
|
||||||
|
} else {
|
||||||
|
if l.hasBackend(specificBackend) {
|
||||||
|
backends = []string{specificBackend}
|
||||||
|
} else {
|
||||||
|
errors = append(errors, fmt.Errorf("backup location \"%s\" has no backend \"%s\"", l.name, specificBackend))
|
||||||
|
return errors
|
||||||
|
}
|
||||||
|
}
|
||||||
|
for i, to := range backends {
|
||||||
backend, _ := GetBackend(to)
|
backend, _ := GetBackend(to)
|
||||||
colors.Secondary.Printf("Backend: %s\n", backend.name)
|
colors.Secondary.Printf("Backend: %s\n", backend.name)
|
||||||
env, err := backend.getEnv()
|
env, err := backend.getEnv()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return nil
|
errors = append(errors, err)
|
||||||
|
continue
|
||||||
}
|
}
|
||||||
|
|
||||||
flags := l.getOptions("backup")
|
|
||||||
cmd := []string{"backup"}
|
cmd := []string{"backup"}
|
||||||
cmd = append(cmd, flags...)
|
cmd = append(cmd, combineAllOptions("backup", l, backend)...)
|
||||||
if cron {
|
if cron {
|
||||||
cmd = append(cmd, "--tag", "cron")
|
cmd = append(cmd, "--tag", buildTag("cron"))
|
||||||
}
|
}
|
||||||
cmd = append(cmd, ".")
|
cmd = append(cmd, "--tag", l.getLocationTags())
|
||||||
backupOptions := ExecuteOptions{
|
backupOptions := ExecuteOptions{
|
||||||
Dir: options.Dir,
|
|
||||||
Envs: env,
|
Envs: env,
|
||||||
}
|
}
|
||||||
|
|
||||||
|
var code int = 0
|
||||||
var out string
|
var out string
|
||||||
|
|
||||||
switch t {
|
switch t {
|
||||||
case TypeLocal:
|
case TypeLocal:
|
||||||
out, err = ExecuteResticCommand(backupOptions, cmd...)
|
for _, from := range l.From {
|
||||||
if VERBOSE {
|
path, err := GetPathRelativeToConfig(from)
|
||||||
colors.Faint.Println(out)
|
if err != nil {
|
||||||
|
errors = append(errors, err)
|
||||||
|
goto after
|
||||||
|
}
|
||||||
|
cmd = append(cmd, path)
|
||||||
}
|
}
|
||||||
|
code, out, err = ExecuteResticCommand(backupOptions, cmd...)
|
||||||
case TypeVolume:
|
case TypeVolume:
|
||||||
err = backend.ExecDocker(l, cmd)
|
ok := CheckIfVolumeExists(l.From[0])
|
||||||
|
if !ok {
|
||||||
|
errors = append(errors, fmt.Errorf("volume \"%s\" does not exist", l.From[0]))
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
cmd = append(cmd, "/data")
|
||||||
|
code, out, err = backend.ExecDocker(l, cmd)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Extract metadata
|
||||||
|
md := metadata.ExtractMetadataFromBackupLog(out)
|
||||||
|
md.ExitCode = fmt.Sprint(code)
|
||||||
|
mdEnv := metadata.MakeEnvFromMetadata(&md)
|
||||||
|
for k, v := range mdEnv {
|
||||||
|
options.Envs[k+"_"+fmt.Sprint(i)] = v
|
||||||
|
options.Envs[k+"_"+strings.ToUpper(backend.name)] = v
|
||||||
|
}
|
||||||
|
|
||||||
|
// If error save it and continue
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
colors.Error.Println(out)
|
||||||
|
errors = append(errors, fmt.Errorf("%s@%s:\n%s%s", l.name, backend.name, out, err))
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
|
||||||
|
// Copy
|
||||||
|
if md.SnapshotID != "" {
|
||||||
|
for copyFrom, copyTo := range l.CopyOption {
|
||||||
|
b1, _ := GetBackend(copyFrom)
|
||||||
|
for _, copyToTarget := range copyTo {
|
||||||
|
b2, _ := GetBackend(copyToTarget)
|
||||||
|
colors.Secondary.Println("Copying " + copyFrom + " → " + copyToTarget)
|
||||||
|
env, _ := b1.getEnv()
|
||||||
|
env2, _ := b2.getEnv()
|
||||||
|
// Add the second repo to the env with a "2" suffix
|
||||||
|
for k, v := range env2 {
|
||||||
|
env[k+"2"] = v
|
||||||
|
}
|
||||||
|
_, _, err := ExecuteResticCommand(ExecuteOptions{
|
||||||
|
Envs: env,
|
||||||
|
}, "copy", md.SnapshotID)
|
||||||
|
|
||||||
|
if err != nil {
|
||||||
|
errors = append(errors, err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// After hooks
|
// After hooks
|
||||||
if err := ExecuteHooks(l.Hooks.After, options); err != nil {
|
if err := l.ExecuteHooks(l.Hooks.After, options); err != nil {
|
||||||
return err
|
errors = append(errors, err)
|
||||||
}
|
}
|
||||||
colors.Success.Println("Done")
|
|
||||||
return nil
|
after:
|
||||||
|
var commands []string
|
||||||
|
var isSuccess = len(errors) == 0
|
||||||
|
if isSuccess {
|
||||||
|
commands = l.Hooks.Success
|
||||||
|
} else {
|
||||||
|
commands = l.Hooks.Failure
|
||||||
|
}
|
||||||
|
if err := l.ExecuteHooks(commands, options); err != nil {
|
||||||
|
errors = append(errors, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Forget and optionally prune
|
||||||
|
if isSuccess && l.ForgetOption != "" && l.ForgetOption != LocationForgetNo {
|
||||||
|
err := l.Forget(l.ForgetOption == LocationForgetPrune, false)
|
||||||
|
if err != nil {
|
||||||
|
errors = append(errors, err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if len(errors) == 0 {
|
||||||
|
colors.Success.Println("Done")
|
||||||
|
}
|
||||||
|
return errors
|
||||||
}
|
}
|
||||||
|
|
||||||
func (l Location) Forget(prune bool, dry bool) error {
|
func (l Location) Forget(prune bool, dry bool) error {
|
||||||
colors.PrimaryPrint("Forgetting for location \"%s\"", l.name)
|
colors.PrimaryPrint("Forgetting for location \"%s\"", l.name)
|
||||||
|
|
||||||
path, err := l.getPath()
|
backendsToForget := l.To
|
||||||
if err != nil {
|
for _, copyBackends := range l.CopyOption {
|
||||||
return err
|
backendsToForget = append(backendsToForget, copyBackends...)
|
||||||
}
|
}
|
||||||
|
|
||||||
for _, to := range l.To {
|
for _, to := range backendsToForget {
|
||||||
backend, _ := GetBackend(to)
|
backend, _ := GetBackend(to)
|
||||||
colors.Secondary.Printf("For backend \"%s\"\n", backend.name)
|
colors.Secondary.Printf("For backend \"%s\"\n", backend.name)
|
||||||
env, err := backend.getEnv()
|
env, err := backend.getEnv()
|
||||||
@@ -199,19 +338,15 @@ func (l Location) Forget(prune bool, dry bool) error {
|
|||||||
options := ExecuteOptions{
|
options := ExecuteOptions{
|
||||||
Envs: env,
|
Envs: env,
|
||||||
}
|
}
|
||||||
flags := l.getOptions("forget")
|
cmd := []string{"forget", "--tag", l.getLocationTags()}
|
||||||
cmd := []string{"forget", "--path", path}
|
|
||||||
if prune {
|
if prune {
|
||||||
cmd = append(cmd, "--prune")
|
cmd = append(cmd, "--prune")
|
||||||
}
|
}
|
||||||
if dry {
|
if dry {
|
||||||
cmd = append(cmd, "--dry-run")
|
cmd = append(cmd, "--dry-run")
|
||||||
}
|
}
|
||||||
cmd = append(cmd, flags...)
|
cmd = append(cmd, combineAllOptions("forget", l, backend)...)
|
||||||
out, err := ExecuteResticCommand(options, cmd...)
|
_, _, err = ExecuteResticCommand(options, cmd...)
|
||||||
if VERBOSE {
|
|
||||||
colors.Faint.Println(out)
|
|
||||||
}
|
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -229,28 +364,37 @@ func (l Location) hasBackend(backend string) bool {
|
|||||||
return false
|
return false
|
||||||
}
|
}
|
||||||
|
|
||||||
func (l Location) Restore(to, from string, force bool) error {
|
func buildRestoreCommand(l Location, to string, snapshot string, options []string) []string {
|
||||||
|
base := []string{"restore", "--target", to, "--tag", l.getLocationTags(), snapshot}
|
||||||
|
base = append(base, options...)
|
||||||
|
return base
|
||||||
|
}
|
||||||
|
|
||||||
|
func (l Location) Restore(to, from string, force bool, snapshot string, options []string) error {
|
||||||
if from == "" {
|
if from == "" {
|
||||||
from = l.To[0]
|
from = l.To[0]
|
||||||
} else if !l.hasBackend(from) {
|
} else if !l.hasBackend(from) {
|
||||||
return fmt.Errorf("invalid backend: \"%s\"", from)
|
return fmt.Errorf("invalid backend: \"%s\"", from)
|
||||||
}
|
}
|
||||||
|
|
||||||
to, err := filepath.Abs(to)
|
if snapshot == "" {
|
||||||
|
snapshot = "latest"
|
||||||
|
}
|
||||||
|
|
||||||
|
colors.PrimaryPrint("Restoring location \"%s\"", l.name)
|
||||||
|
backend, _ := GetBackend(from)
|
||||||
|
colors.Secondary.Printf("Restoring %s@%s → %s\n", snapshot, backend.name, to)
|
||||||
|
|
||||||
|
t, err := l.getType()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
colors.PrimaryPrint("Restoring location \"%s\"", l.name)
|
switch t {
|
||||||
|
|
||||||
backend, _ := GetBackend(from)
|
|
||||||
path, err := l.getPath()
|
|
||||||
if err != nil {
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
colors.Secondary.Println("Restoring lastest snapshot")
|
|
||||||
colors.Body.Printf("%s → %s.\n", from, path)
|
|
||||||
switch l.getType() {
|
|
||||||
case TypeLocal:
|
case TypeLocal:
|
||||||
|
to, err = filepath.Abs(to)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
// Check if target is empty
|
// Check if target is empty
|
||||||
if !force {
|
if !force {
|
||||||
notEmptyError := fmt.Errorf("target %s is not empty", to)
|
notEmptyError := fmt.Errorf("target %s is not empty", to)
|
||||||
@@ -269,9 +413,9 @@ func (l Location) Restore(to, from string, force bool) error {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
err = backend.Exec([]string{"restore", "--target", to, "--path", path, "latest"})
|
err = backend.Exec(buildRestoreCommand(l, to, snapshot, options))
|
||||||
case TypeVolume:
|
case TypeVolume:
|
||||||
err = backend.ExecDocker(l, []string{"restore", "--target", ".", "--path", path, "latest"})
|
_, _, err = backend.ExecDocker(l, buildRestoreCommand(l, "/", snapshot, options))
|
||||||
}
|
}
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
@@ -294,9 +438,11 @@ func (l Location) RunCron() error {
|
|||||||
now := time.Now()
|
now := time.Now()
|
||||||
if now.After(next) {
|
if now.After(next) {
|
||||||
lock.SetCron(l.name, now.Unix())
|
lock.SetCron(l.name, now.Unix())
|
||||||
l.Backup(true)
|
l.Backup(true, "")
|
||||||
} else {
|
} else {
|
||||||
colors.Body.Printf("Skipping \"%s\", not due yet.\n", l.name)
|
if !flags.CRON_LEAN {
|
||||||
|
colors.Body.Printf("Skipping \"%s\", not due yet.\n", l.name)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
93
internal/location_test.go
Normal file
93
internal/location_test.go
Normal file
@@ -0,0 +1,93 @@
|
|||||||
|
package internal
|
||||||
|
|
||||||
|
import "testing"
|
||||||
|
|
||||||
|
func TestGetType(t *testing.T) {
|
||||||
|
|
||||||
|
t.Run("TypeLocal", func(t *testing.T) {
|
||||||
|
l := Location{
|
||||||
|
Type: "local",
|
||||||
|
}
|
||||||
|
result, err := l.getType()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error: %v", err)
|
||||||
|
}
|
||||||
|
assertEqual(t, result, TypeLocal)
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("TypeVolume", func(t *testing.T) {
|
||||||
|
l := Location{
|
||||||
|
Type: "volume",
|
||||||
|
}
|
||||||
|
result, err := l.getType()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error: %v", err)
|
||||||
|
}
|
||||||
|
assertEqual(t, result, TypeVolume)
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("Empty type", func(t *testing.T) {
|
||||||
|
l := Location{
|
||||||
|
Type: "",
|
||||||
|
}
|
||||||
|
result, err := l.getType()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error: %v", err)
|
||||||
|
}
|
||||||
|
assertEqual(t, result, TypeLocal)
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("Invalid type", func(t *testing.T) {
|
||||||
|
l := Location{
|
||||||
|
Type: "foo",
|
||||||
|
}
|
||||||
|
_, err := l.getType()
|
||||||
|
if err == nil {
|
||||||
|
t.Error("expected error")
|
||||||
|
}
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestBuildTag(t *testing.T) {
|
||||||
|
result := buildTag("foo", "bar")
|
||||||
|
expected := "ar:foo:bar"
|
||||||
|
assertEqual(t, result, expected)
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestGetLocationTags(t *testing.T) {
|
||||||
|
l := Location{
|
||||||
|
name: "foo",
|
||||||
|
}
|
||||||
|
result := l.getLocationTags()
|
||||||
|
expected := "ar:location:foo"
|
||||||
|
assertEqual(t, result, expected)
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestHasBackend(t *testing.T) {
|
||||||
|
t.Run("backend present", func(t *testing.T) {
|
||||||
|
l := Location{
|
||||||
|
name: "foo",
|
||||||
|
To: []string{"foo", "bar"},
|
||||||
|
}
|
||||||
|
result := l.hasBackend("foo")
|
||||||
|
assertEqual(t, result, true)
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("backend absent", func(t *testing.T) {
|
||||||
|
l := Location{
|
||||||
|
name: "foo",
|
||||||
|
To: []string{"bar", "baz"},
|
||||||
|
}
|
||||||
|
result := l.hasBackend("foo")
|
||||||
|
assertEqual(t, result, false)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestBuildRestoreCommand(t *testing.T) {
|
||||||
|
l := Location{
|
||||||
|
name: "foo",
|
||||||
|
}
|
||||||
|
result := buildRestoreCommand(l, "to", "snapshot", []string{"options"})
|
||||||
|
expected := []string{"restore", "--target", "to", "--tag", "ar:location:foo", "snapshot", "options"}
|
||||||
|
assertSliceEqual(t, result, expected)
|
||||||
|
}
|
||||||
@@ -6,6 +6,7 @@ import (
|
|||||||
"sync"
|
"sync"
|
||||||
|
|
||||||
"github.com/cupcakearmy/autorestic/internal/colors"
|
"github.com/cupcakearmy/autorestic/internal/colors"
|
||||||
|
"github.com/cupcakearmy/autorestic/internal/flags"
|
||||||
"github.com/spf13/viper"
|
"github.com/spf13/viper"
|
||||||
)
|
)
|
||||||
|
|
||||||
@@ -13,14 +14,25 @@ var lock *viper.Viper
|
|||||||
var file string
|
var file string
|
||||||
var once sync.Once
|
var once sync.Once
|
||||||
|
|
||||||
|
const (
|
||||||
|
RUNNING = "running"
|
||||||
|
)
|
||||||
|
|
||||||
func getLock() *viper.Viper {
|
func getLock() *viper.Viper {
|
||||||
if lock == nil {
|
if lock == nil {
|
||||||
|
|
||||||
once.Do(func() {
|
once.Do(func() {
|
||||||
lock = viper.New()
|
lock = viper.New()
|
||||||
lock.SetDefault("running", false)
|
lock.SetDefault("running", false)
|
||||||
p := path.Dir(viper.ConfigFileUsed())
|
p := viper.ConfigFileUsed()
|
||||||
file = path.Join(p, ".autorestic.lock.yml")
|
if p == "" {
|
||||||
|
colors.Error.Println("cannot lock before reading config location")
|
||||||
|
os.Exit(1)
|
||||||
|
}
|
||||||
|
file = path.Join(path.Dir(p), ".autorestic.lock.yml")
|
||||||
|
if !flags.CRON_LEAN {
|
||||||
|
colors.Faint.Println("Using lock:\t", file)
|
||||||
|
}
|
||||||
lock.SetConfigFile(file)
|
lock.SetConfigFile(file)
|
||||||
lock.SetConfigType("yml")
|
lock.SetConfigType("yml")
|
||||||
lock.ReadInConfig()
|
lock.ReadInConfig()
|
||||||
@@ -29,36 +41,38 @@ func getLock() *viper.Viper {
|
|||||||
return lock
|
return lock
|
||||||
}
|
}
|
||||||
|
|
||||||
func setLock(locked bool) error {
|
func setLockValue(key string, value interface{}) (*viper.Viper, error) {
|
||||||
lock := getLock()
|
lock := getLock()
|
||||||
if locked {
|
|
||||||
running := lock.GetBool("running")
|
if key == RUNNING {
|
||||||
if running {
|
value := value.(bool)
|
||||||
|
if value && lock.GetBool(key) {
|
||||||
colors.Error.Println("an instance is already running. exiting")
|
colors.Error.Println("an instance is already running. exiting")
|
||||||
os.Exit(1)
|
os.Exit(1)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
lock.Set("running", locked)
|
|
||||||
|
lock.Set(key, value)
|
||||||
if err := lock.WriteConfigAs(file); err != nil {
|
if err := lock.WriteConfigAs(file); err != nil {
|
||||||
return err
|
return nil, err
|
||||||
}
|
}
|
||||||
return nil
|
return lock, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
func GetCron(location string) int64 {
|
func GetCron(location string) int64 {
|
||||||
lock := getLock()
|
return getLock().GetInt64("cron." + location)
|
||||||
return lock.GetInt64("cron." + location)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
func SetCron(location string, value int64) {
|
func SetCron(location string, value int64) {
|
||||||
lock.Set("cron."+location, value)
|
setLockValue("cron."+location, value)
|
||||||
lock.WriteConfigAs(file)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
func Lock() error {
|
func Lock() error {
|
||||||
return setLock(true)
|
_, err := setLockValue(RUNNING, true)
|
||||||
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
func Unlock() error {
|
func Unlock() error {
|
||||||
return setLock(false)
|
_, err := setLockValue(RUNNING, false)
|
||||||
|
return err
|
||||||
}
|
}
|
||||||
|
|||||||
114
internal/lock/lock_test.go
Normal file
114
internal/lock/lock_test.go
Normal file
@@ -0,0 +1,114 @@
|
|||||||
|
package lock
|
||||||
|
|
||||||
|
import (
|
||||||
|
"log"
|
||||||
|
"os"
|
||||||
|
"os/exec"
|
||||||
|
"strconv"
|
||||||
|
"testing"
|
||||||
|
|
||||||
|
"github.com/spf13/viper"
|
||||||
|
)
|
||||||
|
|
||||||
|
var testDirectory = "autorestic_test_tmp"
|
||||||
|
|
||||||
|
// All tests must share the same lock file as it is only initialized once
|
||||||
|
func setup(t *testing.T) {
|
||||||
|
d, err := os.MkdirTemp("", testDirectory)
|
||||||
|
if err != nil {
|
||||||
|
log.Fatalf("error creating temp dir: %v", err)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
// set config file location
|
||||||
|
viper.SetConfigFile(d + "/.autorestic.yml")
|
||||||
|
|
||||||
|
t.Cleanup(func() {
|
||||||
|
os.RemoveAll(d)
|
||||||
|
viper.Reset()
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestLock(t *testing.T) {
|
||||||
|
setup(t)
|
||||||
|
|
||||||
|
t.Run("getLock", func(t *testing.T) {
|
||||||
|
result := getLock().GetBool(RUNNING)
|
||||||
|
|
||||||
|
if result {
|
||||||
|
t.Errorf("got %v, want %v", result, false)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("lock", func(t *testing.T) {
|
||||||
|
lock, err := setLockValue(RUNNING, true)
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
result := lock.GetBool(RUNNING)
|
||||||
|
if !result {
|
||||||
|
t.Errorf("got %v, want %v", result, true)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("unlock", func(t *testing.T) {
|
||||||
|
lock, err := setLockValue(RUNNING, false)
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
result := lock.GetBool(RUNNING)
|
||||||
|
if result {
|
||||||
|
t.Errorf("got %v, want %v", result, false)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
// locking a locked instance exits the instance
|
||||||
|
// this trick to capture os.Exit(1) is discussed here:
|
||||||
|
// https://talks.golang.org/2014/testing.slide#23
|
||||||
|
t.Run("lock twice", func(t *testing.T) {
|
||||||
|
if os.Getenv("CRASH") == "1" {
|
||||||
|
err := Lock()
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error: %v", err)
|
||||||
|
}
|
||||||
|
// should fail
|
||||||
|
Lock()
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := exec.Command(os.Args[0], "-test.run=TestLock/lock_twice")
|
||||||
|
cmd.Env = append(os.Environ(), "CRASH=1")
|
||||||
|
err := cmd.Run()
|
||||||
|
|
||||||
|
err, ok := err.(*exec.ExitError)
|
||||||
|
if !ok {
|
||||||
|
t.Error("unexpected error")
|
||||||
|
}
|
||||||
|
expected := "exit status 1"
|
||||||
|
if err.Error() != expected {
|
||||||
|
t.Errorf("got %q, want %q", err.Error(), expected)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("set cron", func(t *testing.T) {
|
||||||
|
expected := int64(5)
|
||||||
|
SetCron("foo", expected)
|
||||||
|
|
||||||
|
result, err := strconv.ParseInt(getLock().GetString("cron.foo"), 10, 64)
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("unexpected error: %v", err)
|
||||||
|
}
|
||||||
|
if result != expected {
|
||||||
|
t.Errorf("got %d, want %d", result, expected)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
t.Run("get cron", func(t *testing.T) {
|
||||||
|
expected := int64(5)
|
||||||
|
result := GetCron("foo")
|
||||||
|
|
||||||
|
if result != expected {
|
||||||
|
t.Errorf("got %d, want %d", result, expected)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
}
|
||||||
22
internal/metadata/extractor_added.go
Normal file
22
internal/metadata/extractor_added.go
Normal file
@@ -0,0 +1,22 @@
|
|||||||
|
package metadata
|
||||||
|
|
||||||
|
import (
|
||||||
|
"regexp"
|
||||||
|
"strings"
|
||||||
|
)
|
||||||
|
|
||||||
|
type addedExtractor struct {
|
||||||
|
re *regexp.Regexp
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e addedExtractor) Matches(line string) bool {
|
||||||
|
return e.re.MatchString(line)
|
||||||
|
}
|
||||||
|
func (e addedExtractor) Extract(metadata *BackupLogMetadata, line string) {
|
||||||
|
// Sample line: "Added to the repo: 0 B"
|
||||||
|
metadata.AddedSize = strings.TrimSpace(e.re.ReplaceAllString(line, "$2"))
|
||||||
|
}
|
||||||
|
|
||||||
|
func NewAddedExtractor() MetadatExtractor {
|
||||||
|
return addedExtractor{regexp.MustCompile(`(?i)^Added to the repo(sitory)?: ([\d\.]+ \w+)( \([\d\.]+[\w\s]+\))?`)}
|
||||||
|
}
|
||||||
57
internal/metadata/extractor_changeset.go
Normal file
57
internal/metadata/extractor_changeset.go
Normal file
@@ -0,0 +1,57 @@
|
|||||||
|
package metadata
|
||||||
|
|
||||||
|
import (
|
||||||
|
"regexp"
|
||||||
|
"strings"
|
||||||
|
)
|
||||||
|
|
||||||
|
type ChangeSetExtractor struct {
|
||||||
|
re *regexp.Regexp
|
||||||
|
cleaner *regexp.Regexp
|
||||||
|
saver changeSetSaver
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e ChangeSetExtractor) Matches(line string) bool {
|
||||||
|
return e.re.MatchString(line)
|
||||||
|
}
|
||||||
|
func (e ChangeSetExtractor) Extract(metadata *BackupLogMetadata, line string) {
|
||||||
|
// Sample line: "Files: 0 new, 0 changed, 2 unmodified"
|
||||||
|
trimmed := strings.TrimSpace(e.re.ReplaceAllString(line, ""))
|
||||||
|
splitted := strings.Split(trimmed, ",")
|
||||||
|
var changeset BackupLogMetadataChangeset = BackupLogMetadataChangeset{}
|
||||||
|
changeset.Added = e.cleaner.ReplaceAllString(splitted[0], "")
|
||||||
|
changeset.Changed = e.cleaner.ReplaceAllString(splitted[1], "")
|
||||||
|
changeset.Unmodified = e.cleaner.ReplaceAllString(splitted[2], "")
|
||||||
|
e.saver.Save(metadata, changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
type changeSetSaver interface {
|
||||||
|
Save(metadata *BackupLogMetadata, changeset BackupLogMetadataChangeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
type fileSaver struct{}
|
||||||
|
|
||||||
|
func (f fileSaver) Save(metadata *BackupLogMetadata, changeset BackupLogMetadataChangeset) {
|
||||||
|
metadata.Files = changeset
|
||||||
|
}
|
||||||
|
|
||||||
|
type dirsSaver struct{}
|
||||||
|
|
||||||
|
func (d dirsSaver) Save(metadata *BackupLogMetadata, changeset BackupLogMetadataChangeset) {
|
||||||
|
metadata.Dirs = changeset
|
||||||
|
}
|
||||||
|
|
||||||
|
func NewFilesExtractor() MetadatExtractor {
|
||||||
|
return ChangeSetExtractor{
|
||||||
|
re: regexp.MustCompile(`(?i)^Files:`),
|
||||||
|
cleaner: regexp.MustCompile(`[^\d]`),
|
||||||
|
saver: fileSaver{},
|
||||||
|
}
|
||||||
|
}
|
||||||
|
func NewDirsExtractor() MetadatExtractor {
|
||||||
|
return ChangeSetExtractor{
|
||||||
|
re: regexp.MustCompile(`(?i)^Dirs:`),
|
||||||
|
cleaner: regexp.MustCompile(`[^\d]`),
|
||||||
|
saver: dirsSaver{},
|
||||||
|
}
|
||||||
|
}
|
||||||
22
internal/metadata/extractor_parent.go
Normal file
22
internal/metadata/extractor_parent.go
Normal file
@@ -0,0 +1,22 @@
|
|||||||
|
package metadata
|
||||||
|
|
||||||
|
import (
|
||||||
|
"regexp"
|
||||||
|
"strings"
|
||||||
|
)
|
||||||
|
|
||||||
|
type parentSnapshotIDExtractor struct {
|
||||||
|
re *regexp.Regexp
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e parentSnapshotIDExtractor) Matches(line string) bool {
|
||||||
|
return e.re.MatchString(line)
|
||||||
|
}
|
||||||
|
func (e parentSnapshotIDExtractor) Extract(metadata *BackupLogMetadata, line string) {
|
||||||
|
// Sample line: "using parent snapshot c65d9310"
|
||||||
|
metadata.ParentSnapshotID = strings.TrimSpace(e.re.ReplaceAllString(line, ""))
|
||||||
|
}
|
||||||
|
|
||||||
|
func NewParentSnapshotIDExtractor() MetadatExtractor {
|
||||||
|
return parentSnapshotIDExtractor{regexp.MustCompile(`(?i)^using parent snapshot`)}
|
||||||
|
}
|
||||||
32
internal/metadata/extractor_processed.go
Normal file
32
internal/metadata/extractor_processed.go
Normal file
@@ -0,0 +1,32 @@
|
|||||||
|
package metadata
|
||||||
|
|
||||||
|
import (
|
||||||
|
"regexp"
|
||||||
|
"strings"
|
||||||
|
)
|
||||||
|
|
||||||
|
type processedExtractor struct {
|
||||||
|
re *regexp.Regexp
|
||||||
|
cleaner *regexp.Regexp
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e processedExtractor) Matches(line string) bool {
|
||||||
|
return e.re.MatchString(line)
|
||||||
|
}
|
||||||
|
func (e processedExtractor) Extract(metadata *BackupLogMetadata, line string) {
|
||||||
|
// Sample line: "processed 2 files, 24 B in 0:00"
|
||||||
|
var processed = BackupLogMetadataProcessed{}
|
||||||
|
split := strings.Split(line, "in")
|
||||||
|
processed.Duration = strings.TrimSpace(split[1])
|
||||||
|
split = strings.Split(split[0], ",")
|
||||||
|
processed.Files = e.cleaner.ReplaceAllString(split[0], "")
|
||||||
|
processed.Size = strings.TrimSpace(split[1])
|
||||||
|
metadata.Processed = processed
|
||||||
|
}
|
||||||
|
|
||||||
|
func NewProcessedExtractor() MetadatExtractor {
|
||||||
|
return processedExtractor{
|
||||||
|
regexp.MustCompile(`(?i)^processed \d* files`),
|
||||||
|
regexp.MustCompile(`(?i)[^\d]`),
|
||||||
|
}
|
||||||
|
}
|
||||||
22
internal/metadata/extractor_snapshot.go
Normal file
22
internal/metadata/extractor_snapshot.go
Normal file
@@ -0,0 +1,22 @@
|
|||||||
|
package metadata
|
||||||
|
|
||||||
|
import (
|
||||||
|
"regexp"
|
||||||
|
"strings"
|
||||||
|
)
|
||||||
|
|
||||||
|
type snapshotExtractor struct {
|
||||||
|
re *regexp.Regexp
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e snapshotExtractor) Matches(line string) bool {
|
||||||
|
return e.re.MatchString(line)
|
||||||
|
}
|
||||||
|
func (e snapshotExtractor) Extract(metadata *BackupLogMetadata, line string) {
|
||||||
|
// Sample line: "snapshot 917c7691 saved"
|
||||||
|
metadata.SnapshotID = strings.Split(line, " ")[1]
|
||||||
|
}
|
||||||
|
|
||||||
|
func NewSnapshotExtractor() MetadatExtractor {
|
||||||
|
return snapshotExtractor{regexp.MustCompile(`(?i)^snapshot \w+ saved`)}
|
||||||
|
}
|
||||||
74
internal/metadata/metadata.go
Normal file
74
internal/metadata/metadata.go
Normal file
@@ -0,0 +1,74 @@
|
|||||||
|
package metadata
|
||||||
|
|
||||||
|
import (
|
||||||
|
"strings"
|
||||||
|
)
|
||||||
|
|
||||||
|
type BackupLogMetadataChangeset struct {
|
||||||
|
Added string
|
||||||
|
Changed string
|
||||||
|
Unmodified string
|
||||||
|
}
|
||||||
|
type BackupLogMetadataProcessed struct {
|
||||||
|
Files string
|
||||||
|
Size string
|
||||||
|
Duration string
|
||||||
|
}
|
||||||
|
type BackupLogMetadata struct {
|
||||||
|
ParentSnapshotID string
|
||||||
|
Files BackupLogMetadataChangeset
|
||||||
|
Dirs BackupLogMetadataChangeset
|
||||||
|
AddedSize string
|
||||||
|
Processed BackupLogMetadataProcessed
|
||||||
|
SnapshotID string
|
||||||
|
ExitCode string
|
||||||
|
}
|
||||||
|
|
||||||
|
type MetadatExtractor interface {
|
||||||
|
Matches(line string) bool
|
||||||
|
Extract(metadata *BackupLogMetadata, line string)
|
||||||
|
}
|
||||||
|
|
||||||
|
var extractors = []MetadatExtractor{
|
||||||
|
NewParentSnapshotIDExtractor(),
|
||||||
|
NewFilesExtractor(),
|
||||||
|
NewDirsExtractor(),
|
||||||
|
NewAddedExtractor(),
|
||||||
|
NewProcessedExtractor(),
|
||||||
|
NewSnapshotExtractor(),
|
||||||
|
}
|
||||||
|
|
||||||
|
func ExtractMetadataFromBackupLog(log string) BackupLogMetadata {
|
||||||
|
var md BackupLogMetadata
|
||||||
|
for _, line := range strings.Split(log, "\n") {
|
||||||
|
line = strings.TrimSpace(line)
|
||||||
|
for _, extractor := range extractors {
|
||||||
|
if extractor.Matches(line) {
|
||||||
|
extractor.Extract(&md, line)
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return md
|
||||||
|
}
|
||||||
|
|
||||||
|
func MakeEnvFromMetadata(metadata *BackupLogMetadata) map[string]string {
|
||||||
|
env := make(map[string]string)
|
||||||
|
var prefix = "AUTORESTIC_"
|
||||||
|
|
||||||
|
env[prefix+"SNAPSHOT_ID"] = metadata.SnapshotID
|
||||||
|
env[prefix+"PARENT_SNAPSHOT_ID"] = metadata.ParentSnapshotID
|
||||||
|
env[prefix+"FILES_ADDED"] = metadata.Files.Added
|
||||||
|
env[prefix+"FILES_CHANGED"] = metadata.Files.Changed
|
||||||
|
env[prefix+"FILES_UNMODIFIED"] = metadata.Files.Unmodified
|
||||||
|
env[prefix+"DIRS_ADDED"] = metadata.Dirs.Added
|
||||||
|
env[prefix+"DIRS_CHANGED"] = metadata.Dirs.Changed
|
||||||
|
env[prefix+"DIRS_UNMODIFIED"] = metadata.Dirs.Unmodified
|
||||||
|
env[prefix+"ADDED_SIZE"] = metadata.AddedSize
|
||||||
|
env[prefix+"PROCESSED_FILES"] = metadata.Processed.Files
|
||||||
|
env[prefix+"PROCESSED_SIZE"] = metadata.Processed.Size
|
||||||
|
env[prefix+"PROCESSED_DURATION"] = metadata.Processed.Duration
|
||||||
|
env[prefix+"EXIT_CODE"] = metadata.ExitCode
|
||||||
|
|
||||||
|
return env
|
||||||
|
}
|
||||||
@@ -8,6 +8,8 @@ import (
|
|||||||
"os/exec"
|
"os/exec"
|
||||||
|
|
||||||
"github.com/cupcakearmy/autorestic/internal/colors"
|
"github.com/cupcakearmy/autorestic/internal/colors"
|
||||||
|
"github.com/cupcakearmy/autorestic/internal/flags"
|
||||||
|
"github.com/fatih/color"
|
||||||
)
|
)
|
||||||
|
|
||||||
func CheckIfCommandIsCallable(cmd string) bool {
|
func CheckIfCommandIsCallable(cmd string) bool {
|
||||||
@@ -16,16 +18,28 @@ func CheckIfCommandIsCallable(cmd string) bool {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func CheckIfResticIsCallable() bool {
|
func CheckIfResticIsCallable() bool {
|
||||||
return CheckIfCommandIsCallable("restic")
|
return CheckIfCommandIsCallable(flags.RESTIC_BIN)
|
||||||
}
|
}
|
||||||
|
|
||||||
type ExecuteOptions struct {
|
type ExecuteOptions struct {
|
||||||
Command string
|
Command string
|
||||||
Envs map[string]string
|
Envs map[string]string
|
||||||
Dir string
|
Dir string
|
||||||
|
Silent bool
|
||||||
}
|
}
|
||||||
|
|
||||||
func ExecuteCommand(options ExecuteOptions, args ...string) (string, error) {
|
type ColoredWriter struct {
|
||||||
|
target io.Writer
|
||||||
|
color *color.Color
|
||||||
|
}
|
||||||
|
|
||||||
|
func (w ColoredWriter) Write(p []byte) (n int, err error) {
|
||||||
|
colored := []byte(w.color.Sprint(string(p)))
|
||||||
|
w.target.Write(colored)
|
||||||
|
return len(p), nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func ExecuteCommand(options ExecuteOptions, args ...string) (int, string, error) {
|
||||||
cmd := exec.Command(options.Command, args...)
|
cmd := exec.Command(options.Command, args...)
|
||||||
env := os.Environ()
|
env := os.Environ()
|
||||||
for k, v := range options.Envs {
|
for k, v := range options.Envs {
|
||||||
@@ -34,34 +48,50 @@ func ExecuteCommand(options ExecuteOptions, args ...string) (string, error) {
|
|||||||
cmd.Env = env
|
cmd.Env = env
|
||||||
cmd.Dir = options.Dir
|
cmd.Dir = options.Dir
|
||||||
|
|
||||||
if VERBOSE {
|
if flags.VERBOSE {
|
||||||
colors.Faint.Printf("> Executing: %s\n", cmd)
|
colors.Faint.Printf("> Executing: %s\n", cmd)
|
||||||
}
|
}
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
var error bytes.Buffer
|
var error bytes.Buffer
|
||||||
cmd.Stdout = &out
|
if flags.VERBOSE && !options.Silent {
|
||||||
|
var colored ColoredWriter = ColoredWriter{
|
||||||
|
target: os.Stdout,
|
||||||
|
color: colors.Faint,
|
||||||
|
}
|
||||||
|
mw := io.MultiWriter(colored, &out)
|
||||||
|
cmd.Stdout = mw
|
||||||
|
} else {
|
||||||
|
cmd.Stdout = &out
|
||||||
|
}
|
||||||
cmd.Stderr = &error
|
cmd.Stderr = &error
|
||||||
err := cmd.Run()
|
err := cmd.Run()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return error.String(), err
|
code := -1
|
||||||
|
if exitError, ok := err.(*exec.ExitError); ok {
|
||||||
|
code = exitError.ExitCode()
|
||||||
|
}
|
||||||
|
return code, error.String(), err
|
||||||
}
|
}
|
||||||
return out.String(), nil
|
return 0, out.String(), nil
|
||||||
}
|
}
|
||||||
|
|
||||||
func ExecuteResticCommand(options ExecuteOptions, args ...string) (string, error) {
|
func ExecuteResticCommand(options ExecuteOptions, args ...string) (int, string, error) {
|
||||||
options.Command = "restic"
|
options.Command = flags.RESTIC_BIN
|
||||||
|
var c = GetConfig()
|
||||||
|
var optionsAsString = getOptions(c.Global, []string{"all"})
|
||||||
|
args = append(optionsAsString, args...)
|
||||||
return ExecuteCommand(options, args...)
|
return ExecuteCommand(options, args...)
|
||||||
}
|
}
|
||||||
|
|
||||||
func CopyFile(from, to string) error {
|
func CopyFile(from, to string) error {
|
||||||
original, err := os.Open("original.txt")
|
original, err := os.Open(from)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
defer original.Close()
|
defer original.Close()
|
||||||
|
|
||||||
new, err := os.Create("new.txt")
|
new, err := os.Create(to)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@@ -72,3 +102,17 @@ func CopyFile(from, to string) error {
|
|||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func CheckIfVolumeExists(volume string) bool {
|
||||||
|
_, _, err := ExecuteCommand(ExecuteOptions{Command: "docker"}, "volume", "inspect", volume)
|
||||||
|
return err == nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func ArrayContains[T comparable](arr []T, needle T) bool {
|
||||||
|
for _, item := range arr {
|
||||||
|
if item == needle {
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return false
|
||||||
|
}
|
||||||
|
|||||||
Reference in New Issue
Block a user